Merge branch 'main' into run-command-on-selection-change

python: Replace pyright with basedpyright (#35362 )
Follow-up to #35250. Let's experiment with having this by default on nightly. Release Notes: - Added built-in support for the basedpyright language server for Python code. basedpyright is now enabled by default, and pyright (previously the primary Python language server) remains available but is disabled by default. This supersedes the basedpyright extension, which can be uninstalled. Advantages of basedpyright over pyright include support for inlay hints, semantic highlighting, auto-import code actions, and stricter type checking. To switch back to pyright, add the following configuration to settings.json: ```json { "languages": { "Python": { "language_servers": ["pyright", "pylsp", "!basedpyright"] } } } ``` --------- Co-authored-by: Piotr Osiewicz <24362066+osiewicz@users.noreply.github.com> Co-authored-by: Lukas Wirth <lukas@zed.dev>
2025-09-08 13:48:34 -06:00 · 2025-09-08 19:15:17 +00:00 · 2025-09-08 14:19:41 -04:00 · 2025-09-08 12:57:22 -04:00 · 2025-09-08 12:21:47 -04:00 · 2025-09-08 12:17:48 -04:00
366 changed files with 14462 additions and 9977 deletions
--- a/.cargo/config.toml
+++ b/.cargo/config.toml
@@ -19,8 +19,6 @@ rustflags = [
    "windows_slim_errors",        # This cfg will reduce the size of `windows::core::Error` from 16 bytes to 4 bytes
    "-C",
    "target-feature=+crt-static", # This fixes the linking issue when compiling livekit on Windows
-    "-C",
-    "link-arg=-fuse-ld=lld",
 ]

 [env]
--- a/.config/hakari.toml
+++ b/.config/hakari.toml
@@ -41,5 +41,4 @@ workspace-members = [
    "slash_commands_example",
    "zed_snippets",
    "zed_test_extension",
-    "zed_toml",
 ]
--- a/.gitattributes
+++ b/.gitattributes
@@ -2,4 +2,4 @@
 *.json linguist-language=JSON-with-Comments

 # Ensure the WSL script always has LF line endings, even on Windows
-crates/zed/resources/windows/zed-wsl text eol=lf
+crates/zed/resources/windows/zed.sh text eol=lf
--- a/.rules
+++ b/.rules
@@ -12,6 +12,19 @@
  - Example: avoid `let _ = client.request(...).await?;` - use `client.request(...).await?;` instead
 * When implementing async operations that may fail, ensure errors propagate to the UI layer so users get meaningful feedback.
 * Never create files with `mod.rs` paths - prefer `src/some_module.rs` instead of `src/some_module/mod.rs`.
+* When creating new crates, prefer specifying the library root path in `Cargo.toml` using `[lib] path = "...rs"` instead of the default `lib.rs`, to maintain consistent and descriptive naming (e.g., `gpui.rs` or `main.rs`).
+* Avoid creative additions unless explicitly requested
+* Use full words for variable names (no abbreviations like "q" for "queue")
+* Use variable shadowing to scope clones in async contexts for clarity, minimizing the lifetime of borrowed references.
+  Example:
+  ```rust
+  executor.spawn({
+      let task_ran = task_ran.clone();
+      async move {
+          *task_ran.borrow_mut() = true;
+      }
+  });
+  ```

 # GPUI

--- a/CONTRIBUTING.md
+++ b/CONTRIBUTING.md
@@ -65,7 +65,7 @@ If you would like to add a new icon to the Zed icon theme, [open a Discussion](h

 ## Bird's-eye view of Zed

-We suggest you keep the [zed glossary](docs/src/development/GLOSSARY.md) at your side when starting out. It lists and explains some of the structures and terms you will see throughout the codebase.
+We suggest you keep the [zed glossary](docs/src/development/glossary.md) at your side when starting out. It lists and explains some of the structures and terms you will see throughout the codebase.

 Zed is made up of several smaller crates - let's go over those you're most likely to interact with:

--- a/Cargo.lock
+++ b/Cargo.lock
@@ -26,7 +26,7 @@ dependencies = [
 "portable-pty",
 "project",
 "prompt_store",
- "rand 0.8.5",
+ "rand 0.9.1",
 "serde",
 "serde_json",
 "settings",
@@ -79,7 +79,7 @@ dependencies = [
 "log",
 "pretty_assertions",
 "project",
- "rand 0.8.5",
+ "rand 0.9.1",
 "serde_json",
 "settings",
 "text",
@@ -172,7 +172,7 @@ dependencies = [
 "pretty_assertions",
 "project",
 "prompt_store",
- "rand 0.8.5",
+ "rand 0.9.1",
 "ref-cast",
 "rope",
 "schemars",
@@ -308,22 +308,18 @@ dependencies = [
 "libc",
 "log",
 "nix 0.29.0",
- "node_runtime",
- "paths",
 "project",
 "reqwest_client",
- "schemars",
- "semver",
 "serde",
 "serde_json",
 "settings",
 "smol",
+ "task",
 "tempfile",
 "thiserror 2.0.12",
 "ui",
 "util",
 "watch",
- "which 6.0.3",
 "workspace-hack",
 ]

@@ -408,7 +404,7 @@ dependencies = [
 "project",
 "prompt_store",
 "proto",
- "rand 0.8.5",
+ "rand 0.9.1",
 "release_channel",
 "rope",
 "rules_library",
@@ -834,7 +830,7 @@ dependencies = [
 "project",
 "prompt_store",
 "proto",
- "rand 0.8.5",
+ "rand 0.9.1",
 "regex",
 "rpc",
 "serde",
@@ -933,7 +929,7 @@ dependencies = [
 "parking_lot",
 "pretty_assertions",
 "project",
- "rand 0.8.5",
+ "rand 0.9.1",
 "regex",
 "serde",
 "serde_json",
@@ -985,7 +981,7 @@ dependencies = [
 "pretty_assertions",
 "project",
 "prompt_store",
- "rand 0.8.5",
+ "rand 0.9.1",
 "regex",
 "reqwest_client",
 "rust-embed",
@@ -2291,7 +2287,7 @@ dependencies = [
 [[package]]
 name = "blade-graphics"
 version = "0.6.0"
-source = "git+https://github.com/kvark/blade?rev=e0ec4e720957edd51b945b64dd85605ea54bcfe5#e0ec4e720957edd51b945b64dd85605ea54bcfe5"
+source = "git+https://github.com/kvark/blade?rev=bfa594ea697d4b6326ea29f747525c85ecf933b9#bfa594ea697d4b6326ea29f747525c85ecf933b9"
 dependencies = [
 "ash",
 "ash-window",
@@ -2324,7 +2320,7 @@ dependencies = [
 [[package]]
 name = "blade-macros"
 version = "0.3.0"
-source = "git+https://github.com/kvark/blade?rev=e0ec4e720957edd51b945b64dd85605ea54bcfe5#e0ec4e720957edd51b945b64dd85605ea54bcfe5"
+source = "git+https://github.com/kvark/blade?rev=bfa594ea697d4b6326ea29f747525c85ecf933b9#bfa594ea697d4b6326ea29f747525c85ecf933b9"
 dependencies = [
 "proc-macro2",
 "quote",
@@ -2334,7 +2330,7 @@ dependencies = [
 [[package]]
 name = "blade-util"
 version = "0.2.0"
-source = "git+https://github.com/kvark/blade?rev=e0ec4e720957edd51b945b64dd85605ea54bcfe5#e0ec4e720957edd51b945b64dd85605ea54bcfe5"
+source = "git+https://github.com/kvark/blade?rev=bfa594ea697d4b6326ea29f747525c85ecf933b9#bfa594ea697d4b6326ea29f747525c85ecf933b9"
 dependencies = [
 "blade-graphics",
 "bytemuck",
@@ -2351,19 +2347,6 @@ dependencies = [
 "digest",
 ]

-[[package]]
-name = "blake3"
-version = "1.8.2"
-source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "3888aaa89e4b2a40fca9848e400f6a658a5a3978de7be858e209cafa8be9a4a0"
-dependencies = [
- "arrayref",
- "arrayvec",
- "cc",
- "cfg-if",
- "constant_time_eq 0.3.1",
-]
-
 [[package]]
 name = "block"
 version = "0.1.6"
@@ -2478,7 +2461,7 @@ dependencies = [
 "language",
 "log",
 "pretty_assertions",
- "rand 0.8.5",
+ "rand 0.9.1",
 "rope",
 "serde_json",
 "sum_tree",
@@ -2899,7 +2882,7 @@ dependencies = [
 "language",
 "log",
 "postage",
- "rand 0.8.5",
+ "rand 0.9.1",
 "release_channel",
 "rpc",
 "settings",
@@ -3070,7 +3053,6 @@ dependencies = [
 "clock",
 "cloud_api_client",
 "cloud_llm_client",
- "cocoa 0.26.0",
 "collections",
 "credentials_provider",
 "derive_more",
@@ -3083,10 +3065,11 @@ dependencies = [
 "http_client_tls",
 "httparse",
 "log",
+ "objc2-foundation",
 "parking_lot",
 "paths",
 "postage",
- "rand 0.8.5",
+ "rand 0.9.1",
 "regex",
 "release_channel",
 "rpc",
@@ -3335,7 +3318,7 @@ dependencies = [
 "prometheus",
 "prompt_store",
 "prost 0.9.0",
- "rand 0.8.5",
+ "rand 0.9.1",
 "recent_projects",
 "release_channel",
 "remote",
@@ -3515,6 +3498,7 @@ name = "component"
 version = "0.1.0"
 dependencies = [
 "collections",
+ "documented",
 "gpui",
 "inventory",
 "parking_lot",
@@ -3577,12 +3561,6 @@ version = "0.1.5"
 source = "registry+https://github.com/rust-lang/crates.io-index"
 checksum = "245097e9a4535ee1e3e3931fcfcd55a796a44c643e8596ff6566d68f09b87bbc"

-[[package]]
-name = "constant_time_eq"
-version = "0.3.1"
-source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "7c74b8349d32d297c9134b8c88677813a227df8f779daa29bfc29c183fe3dca6"
-
 [[package]]
 name = "context_server"
 version = "0.1.0"
@@ -4697,7 +4675,7 @@ dependencies = [
 "markdown",
 "pretty_assertions",
 "project",
- "rand 0.8.5",
+ "rand 0.9.1",
 "serde",
 "serde_json",
 "settings",
@@ -5066,9 +5044,10 @@ dependencies = [
 "multi_buffer",
 "ordered-float 2.10.1",
 "parking_lot",
+ "postage",
 "pretty_assertions",
 "project",
- "rand 0.8.5",
+ "rand 0.9.1",
 "regex",
 "release_channel",
 "rpc",
@@ -5563,7 +5542,7 @@ dependencies = [
 "parking_lot",
 "paths",
 "project",
- "rand 0.8.5",
+ "rand 0.9.1",
 "release_channel",
 "remote",
 "reqwest_client",
@@ -6163,17 +6142,6 @@ dependencies = [
 "futures-util",
 ]

-[[package]]
-name = "futures-batch"
-version = "0.6.1"
-source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "6f444c45a1cb86f2a7e301469fd50a82084a60dadc25d94529a8312276ecb71a"
-dependencies = [
- "futures 0.3.31",
- "futures-timer",
- "pin-utils",
-]
-
 [[package]]
 name = "futures-channel"
 version = "0.3.31"
@@ -6269,12 +6237,6 @@ version = "0.3.31"
 source = "registry+https://github.com/rust-lang/crates.io-index"
 checksum = "f90f7dce0722e95104fcb095585910c0977252f286e354b5e3bd38902cd99988"

-[[package]]
-name = "futures-timer"
-version = "3.0.3"
-source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "f288b0a4f20f9a56b5d1da57e2227c661b7b16168e2f72365f57b63326e29b24"
-
 [[package]]
 name = "futures-util"
 version = "0.3.31"
@@ -6412,7 +6374,7 @@ dependencies = [
 "log",
 "parking_lot",
 "pretty_assertions",
- "rand 0.8.5",
+ "rand 0.9.1",
 "regex",
 "rope",
 "schemars",
@@ -7465,7 +7427,7 @@ dependencies = [
 "pathfinder_geometry",
 "postage",
 "profiling",
- "rand 0.8.5",
+ "rand 0.9.1",
 "raw-window-handle",
 "refineable",
 "reqwest_client",
@@ -9078,7 +9040,7 @@ dependencies = [
 "parking_lot",
 "postage",
 "pretty_assertions",
- "rand 0.8.5",
+ "rand 0.9.1",
 "regex",
 "rpc",
 "schemars",
@@ -9220,6 +9182,19 @@ dependencies = [
 "x_ai",
 ]

+[[package]]
+name = "language_onboarding"
+version = "0.1.0"
+dependencies = [
+ "db",
+ "editor",
+ "gpui",
+ "project",
+ "ui",
+ "workspace",
+ "workspace-hack",
+]
+
 [[package]]
 name = "language_selector"
 version = "0.1.0"
@@ -9247,6 +9222,7 @@ dependencies = [
 "anyhow",
 "client",
 "collections",
+ "command_palette_hooks",
 "copilot",
 "editor",
 "futures 0.3.31",
@@ -9281,7 +9257,6 @@ dependencies = [
 "chrono",
 "collections",
 "dap",
- "feature_flags",
 "futures 0.3.31",
 "gpui",
 "http_client",
@@ -9517,6 +9492,21 @@ dependencies = [
 "vcpkg",
 ]

+[[package]]
+name = "line_ending_selector"
+version = "0.1.0"
+dependencies = [
+ "editor",
+ "gpui",
+ "language",
+ "picker",
+ "project",
+ "ui",
+ "util",
+ "workspace",
+ "workspace-hack",
+]
+
 [[package]]
 name = "link-cplusplus"
 version = "1.0.10"
@@ -10392,7 +10382,7 @@ dependencies = [
 "parking_lot",
 "pretty_assertions",
 "project",
- "rand 0.8.5",
+ "rand 0.9.1",
 "rope",
 "serde",
 "settings",
@@ -12618,12 +12608,13 @@ dependencies = [
 "postage",
 "prettier",
 "pretty_assertions",
- "rand 0.8.5",
+ "rand 0.9.1",
 "regex",
 "release_channel",
 "remote",
 "rpc",
 "schemars",
+ "semver",
 "serde",
 "serde_json",
 "settings",
@@ -12643,6 +12634,7 @@ dependencies = [
 "unindent",
 "url",
 "util",
+ "watch",
 "which 6.0.3",
 "workspace-hack",
 "worktree",
@@ -13892,7 +13884,7 @@ dependencies = [
 "ctor",
 "gpui",
 "log",
- "rand 0.8.5",
+ "rand 0.9.1",
 "rayon",
 "smallvec",
 "sum_tree",
@@ -13921,7 +13913,7 @@ dependencies = [
 "gpui",
 "parking_lot",
 "proto",
- "rand 0.8.5",
+ "rand 0.9.1",
 "rsa",
 "serde",
 "serde_json",
@@ -14356,6 +14348,19 @@ dependencies = [
 "windows-sys 0.59.0",
 ]

+[[package]]
+name = "scheduler"
+version = "0.1.0"
+dependencies = [
+ "async-task",
+ "chrono",
+ "futures 0.3.31",
+ "parking",
+ "parking_lot",
+ "rand 0.9.1",
+ "workspace-hack",
+]
+
 [[package]]
 name = "schema_generator"
 version = "0.1.0"
@@ -14658,49 +14663,6 @@ version = "1.2.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
 checksum = "0f7d95a54511e0c7be3f51e8867aa8cf35148d7b9445d44de2f943e2b206e749"

-[[package]]
-name = "semantic_index"
-version = "0.1.0"
-dependencies = [
- "anyhow",
- "arrayvec",
- "blake3",
- "client",
- "clock",
- "collections",
- "feature_flags",
- "fs",
- "futures 0.3.31",
- "futures-batch",
- "gpui",
- "heed",
- "http_client",
- "language",
- "language_model",
- "languages",
- "log",
- "open_ai",
- "parking_lot",
- "project",
- "reqwest_client",
- "serde",
- "serde_json",
- "settings",
- "sha2",
- "smol",
- "streaming-iterator",
- "tempfile",
- "theme",
- "tree-sitter",
- "ui",
- "unindent",
- "util",
- "workspace",
- "workspace-hack",
- "worktree",
- "zlog",
-]
-
 [[package]]
 name = "semantic_version"
 version = "0.1.0"
@@ -15318,6 +15280,7 @@ dependencies = [
 "futures 0.3.31",
 "indoc",
 "libsqlite3-sys",
+ "log",
 "parking_lot",
 "smol",
 "sqlformat",
@@ -15655,7 +15618,7 @@ name = "streaming_diff"
 version = "0.1.0"
 dependencies = [
 "ordered-float 2.10.1",
- "rand 0.8.5",
+ "rand 0.9.1",
 "rope",
 "util",
 "workspace-hack",
@@ -15769,7 +15732,7 @@ dependencies = [
 "arrayvec",
 "ctor",
 "log",
- "rand 0.8.5",
+ "rand 0.9.1",
 "rayon",
 "workspace-hack",
 "zlog",
@@ -16360,7 +16323,7 @@ dependencies = [
 "futures 0.3.31",
 "gpui",
 "libc",
- "rand 0.8.5",
+ "rand 0.9.1",
 "regex",
 "release_channel",
 "schemars",
@@ -16408,7 +16371,7 @@ dependencies = [
 "language",
 "log",
 "project",
- "rand 0.8.5",
+ "rand 0.9.1",
 "regex",
 "schemars",
 "search",
@@ -16440,7 +16403,7 @@ dependencies = [
 "log",
 "parking_lot",
 "postage",
- "rand 0.8.5",
+ "rand 0.9.1",
 "regex",
 "rope",
 "smallvec",
@@ -16971,10 +16934,15 @@ checksum = "bfb942dfe1d8e29a7ee7fcbde5bd2b9a25fb89aa70caea2eba3bee836ff41076"
 name = "toolchain_selector"
 version = "0.1.0"
 dependencies = [
+ "anyhow",
+ "convert_case 0.8.0",
 "editor",
+ "file_finder",
+ "futures 0.3.31",
 "fuzzy",
 "gpui",
 "language",
+ "menu",
 "picker",
 "project",
 "ui",
@@ -17797,7 +17765,7 @@ dependencies = [
 "libc",
 "log",
 "nix 0.29.0",
- "rand 0.8.5",
+ "rand 0.9.1",
 "regex",
 "rust-embed",
 "schemars",
@@ -17982,6 +17950,8 @@ version = "0.1.0"
 dependencies = [
 "anyhow",
 "gpui",
+ "schemars",
+ "serde",
 "settings",
 "workspace-hack",
 ]
@@ -18588,7 +18558,7 @@ dependencies = [
 "futures 0.3.31",
 "gpui",
 "parking_lot",
- "rand 0.8.5",
+ "rand 0.9.1",
 "workspace-hack",
 "zlog",
 ]
@@ -20047,7 +20017,7 @@ dependencies = [
 "paths",
 "postage",
 "pretty_assertions",
- "rand 0.8.5",
+ "rand 0.9.1",
 "rpc",
 "schemars",
 "serde",
@@ -20408,7 +20378,6 @@ dependencies = [
 "acp_tools",
 "activity_indicator",
 "agent",
- "agent_servers",
 "agent_settings",
 "agent_ui",
 "anyhow",
@@ -20472,10 +20441,12 @@ dependencies = [
 "language_extension",
 "language_model",
 "language_models",
+ "language_onboarding",
 "language_selector",
 "language_tools",
 "languages",
 "libc",
+ "line_ending_selector",
 "livekit_client",
 "log",
 "markdown",
@@ -20493,6 +20464,7 @@ dependencies = [
 "parking_lot",
 "paths",
 "picker",
+ "postage",
 "pretty_assertions",
 "profiling",
 "project",
@@ -20627,7 +20599,7 @@ dependencies = [

 [[package]]
 name = "zed_snippets"
-version = "0.0.5"
+version = "0.0.6"
 dependencies = [
 "serde_json",
 "zed_extension_api 0.1.0",
@@ -20640,13 +20612,6 @@ dependencies = [
 "zed_extension_api 0.6.0",
 ]

-[[package]]
-name = "zed_toml"
-version = "0.1.4"
-dependencies = [
- "zed_extension_api 0.1.0",
-]
-
 [[package]]
 name = "zeno"
 version = "0.3.2"
@@ -20810,9 +20775,10 @@ dependencies = [
 "language_model",
 "log",
 "menu",
+ "parking_lot",
 "postage",
 "project",
- "rand 0.8.5",
+ "rand 0.9.1",
 "regex",
 "release_channel",
 "reqwest_client",
@@ -20882,7 +20848,7 @@ dependencies = [
 "aes",
 "byteorder",
 "bzip2",
- "constant_time_eq 0.1.5",
+ "constant_time_eq",
 "crc32fast",
 "crossbeam-utils",
 "flate2",
--- a/Cargo.toml
+++ b/Cargo.toml
@@ -94,9 +94,11 @@ members = [
    "crates/language_extension",
    "crates/language_model",
    "crates/language_models",
+    "crates/language_onboarding",
    "crates/language_selector",
    "crates/language_tools",
    "crates/languages",
+    "crates/line_ending_selector",
    "crates/livekit_api",
    "crates/livekit_client",
    "crates/lmstudio",
@@ -131,6 +133,7 @@ members = [
    "crates/refineable",
    "crates/refineable/derive_refineable",
    "crates/release_channel",
+    "crates/scheduler",
    "crates/remote",
    "crates/remote_server",
    "crates/repl",
@@ -141,7 +144,6 @@ members = [
    "crates/rules_library",
    "crates/schema_generator",
    "crates/search",
-    "crates/semantic_index",
    "crates/semantic_version",
    "crates/session",
    "crates/settings",
@@ -210,7 +212,6 @@ members = [
    "extensions/slash-commands-example",
    "extensions/snippets",
    "extensions/test-extension",
-    "extensions/toml",

    #
    # Tooling
@@ -320,9 +321,11 @@ language = { path = "crates/language" }
 language_extension = { path = "crates/language_extension" }
 language_model = { path = "crates/language_model" }
 language_models = { path = "crates/language_models" }
+language_onboarding = { path = "crates/language_onboarding" }
 language_selector = { path = "crates/language_selector" }
 language_tools = { path = "crates/language_tools" }
 languages = { path = "crates/languages" }
+line_ending_selector = { path = "crates/line_ending_selector" }
 livekit_api = { path = "crates/livekit_api" }
 livekit_client = { path = "crates/livekit_client" }
 lmstudio = { path = "crates/lmstudio" }
@@ -360,6 +363,7 @@ proto = { path = "crates/proto" }
 recent_projects = { path = "crates/recent_projects" }
 refineable = { path = "crates/refineable" }
 release_channel = { path = "crates/release_channel" }
+scheduler = { path = "crates/scheduler" }
 remote = { path = "crates/remote" }
 remote_server = { path = "crates/remote_server" }
 repl = { path = "crates/repl" }
@@ -370,7 +374,6 @@ rope = { path = "crates/rope" }
 rpc = { path = "crates/rpc" }
 rules_library = { path = "crates/rules_library" }
 search = { path = "crates/search" }
-semantic_index = { path = "crates/semantic_index" }
 semantic_version = { path = "crates/semantic_version" }
 session = { path = "crates/session" }
 settings = { path = "crates/settings" }
@@ -444,6 +447,7 @@ async-fs = "2.1"
 async-pipe = { git = "https://github.com/zed-industries/async-pipe-rs", rev = "82d00a04211cf4e1236029aa03e6b6ce2a74c553" }
 async-recursion = "1.0.0"
 async-tar = "0.5.0"
+async-task = "4.7"
 async-trait = "0.1"
 async-tungstenite = "0.29.1"
 async_zip = { version = "0.0.17", features = ["deflate", "deflate64"] }
@@ -459,9 +463,9 @@ aws-smithy-types = { version = "1.3.0", features = ["http-body-1-x"] }
 base64 = "0.22"
 bincode = "1.2.1"
 bitflags = "2.6.0"
-blade-graphics = { git = "https://github.com/kvark/blade", rev = "e0ec4e720957edd51b945b64dd85605ea54bcfe5" }
-blade-macros = { git = "https://github.com/kvark/blade", rev = "e0ec4e720957edd51b945b64dd85605ea54bcfe5" }
-blade-util = { git = "https://github.com/kvark/blade", rev = "e0ec4e720957edd51b945b64dd85605ea54bcfe5" }
+blade-graphics = { git = "https://github.com/kvark/blade", rev = "bfa594ea697d4b6326ea29f747525c85ecf933b9" }
+blade-macros = { git = "https://github.com/kvark/blade", rev = "bfa594ea697d4b6326ea29f747525c85ecf933b9" }
+blade-util = { git = "https://github.com/kvark/blade", rev = "bfa594ea697d4b6326ea29f747525c85ecf933b9" }
 blake3 = "1.5.3"
 bytes = "1.0"
 cargo_metadata = "0.19"
@@ -535,9 +539,35 @@ nbformat = {  git = "https://github.com/ConradIrwin/runtimed", rev = "7130c80421
 nix = "0.29"
 num-format = "0.4.4"
 objc = "0.2"
+objc2-foundation = { version = "0.3", default-features = false, features = [
+    "NSArray",
+    "NSAttributedString",
+    "NSBundle",
+    "NSCoder",
+    "NSData",
+    "NSDate",
+    "NSDictionary",
+    "NSEnumerator",
+    "NSError",
+    "NSGeometry",
+    "NSNotification",
+    "NSNull",
+    "NSObjCRuntime",
+    "NSObject",
+    "NSProcessInfo",
+    "NSRange",
+    "NSRunLoop",
+    "NSString",
+    "NSURL",
+    "NSUndoManager",
+    "NSValue",
+    "objc2-core-foundation",
+    "std"
+] }
 open = "5.0.0"
 ordered-float = "2.1.1"
 palette = { version = "0.7.5", default-features = false, features = ["std"] }
+parking = "2.0"
 parking_lot = "0.12.1"
 partial-json-fixer = "0.5.3"
 parse_int = "0.9"
@@ -560,7 +590,7 @@ prost-build = "0.9"
 prost-types = "0.9"
 pulldown-cmark = { version = "0.12.0", default-features = false }
 quote = "1.0.9"
-rand = "0.8.5"
+rand = "0.9"
 rayon = "1.8"
 ref-cast = "1.0.24"
 regex = "1.5"
--- a/assets/keymaps/default-linux.json
+++ b/assets/keymaps/default-linux.json
@@ -16,6 +16,7 @@
      "up": "menu::SelectPrevious",
      "enter": "menu::Confirm",
      "ctrl-enter": "menu::SecondaryConfirm",
+      "ctrl-escape": "menu::Cancel",
      "ctrl-c": "menu::Cancel",
      "escape": "menu::Cancel",
      "alt-shift-enter": "menu::Restart",
@@ -582,7 +583,7 @@
      "ctrl-n": "workspace::NewFile",
      "shift-new": "workspace::NewWindow",
      "ctrl-shift-n": "workspace::NewWindow",
-      "ctrl-`": "terminal_panel::ToggleFocus",
+      "ctrl-`": "terminal_panel::Toggle",
      "f10": ["app_menu::OpenApplicationMenu", "Zed"],
      "alt-1": ["workspace::ActivatePane", 0],
      "alt-2": ["workspace::ActivatePane", 1],
@@ -627,6 +628,7 @@
      "alt-save": "workspace::SaveAll",
      "ctrl-alt-s": "workspace::SaveAll",
      "ctrl-k m": "language_selector::Toggle",
+      "ctrl-k ctrl-m": "toolchain::AddToolchain",
      "escape": "workspace::Unfollow",
      "ctrl-k ctrl-left": "workspace::ActivatePaneLeft",
      "ctrl-k ctrl-right": "workspace::ActivatePaneRight",
@@ -1027,6 +1029,13 @@
      "tab": "channel_modal::ToggleMode"
    }
  },
+  {
+    "context": "ToolchainSelector",
+    "use_key_equivalents": true,
+    "bindings": {
+      "ctrl-shift-a": "toolchain::AddToolchain"
+    }
+  },
  {
    "context": "FileFinder || (FileFinder > Picker > Editor)",
    "bindings": {
--- a/assets/keymaps/default-macos.json
+++ b/assets/keymaps/default-macos.json
@@ -649,7 +649,7 @@
      "alt-shift-enter": "toast::RunAction",
      "cmd-shift-s": "workspace::SaveAs",
      "cmd-shift-n": "workspace::NewWindow",
-      "ctrl-`": "terminal_panel::ToggleFocus",
+      "ctrl-`": "terminal_panel::Toggle",
      "cmd-1": ["workspace::ActivatePane", 0],
      "cmd-2": ["workspace::ActivatePane", 1],
      "cmd-3": ["workspace::ActivatePane", 2],
@@ -690,6 +690,7 @@
      "cmd-?": "agent::ToggleFocus",
      "cmd-alt-s": "workspace::SaveAll",
      "cmd-k m": "language_selector::Toggle",
+      "cmd-k cmd-m": "toolchain::AddToolchain",
      "escape": "workspace::Unfollow",
      "cmd-k cmd-left": "workspace::ActivatePaneLeft",
      "cmd-k cmd-right": "workspace::ActivatePaneRight",
@@ -1094,6 +1095,13 @@
      "tab": "channel_modal::ToggleMode"
    }
  },
+  {
+    "context": "ToolchainSelector",
+    "use_key_equivalents": true,
+    "bindings": {
+      "cmd-shift-a": "toolchain::AddToolchain"
+    }
+  },
  {
    "context": "FileFinder || (FileFinder > Picker > Editor)",
    "use_key_equivalents": true,
--- a/assets/keymaps/default-windows.json
+++ b/assets/keymaps/default-windows.json
@@ -25,7 +25,6 @@
      "ctrl-alt-enter": ["picker::ConfirmInput", { "secondary": true }],
      "ctrl-shift-w": "workspace::CloseWindow",
      "shift-escape": "workspace::ToggleZoom",
-      "open": "workspace::Open",
      "ctrl-o": "workspace::Open",
      "ctrl-=": ["zed::IncreaseBufferFontSize", { "persist": false }],
      "ctrl-shift-=": ["zed::IncreaseBufferFontSize", { "persist": false }],
@@ -68,18 +67,13 @@
      "ctrl-k q": "editor::Rewrap",
      "ctrl-backspace": ["editor::DeleteToPreviousWordStart", { "ignore_newlines": false, "ignore_brackets": false }],
      "ctrl-delete": ["editor::DeleteToNextWordEnd", { "ignore_newlines": false, "ignore_brackets": false }],
-      "cut": "editor::Cut",
      "shift-delete": "editor::Cut",
      "ctrl-x": "editor::Cut",
-      "copy": "editor::Copy",
      "ctrl-insert": "editor::Copy",
      "ctrl-c": "editor::Copy",
-      "paste": "editor::Paste",
      "shift-insert": "editor::Paste",
      "ctrl-v": "editor::Paste",
-      "undo": "editor::Undo",
      "ctrl-z": "editor::Undo",
-      "redo": "editor::Redo",
      "ctrl-y": "editor::Redo",
      "ctrl-shift-z": "editor::Redo",
      "up": "editor::MoveUp",
@@ -138,7 +132,6 @@
      "ctrl-shift-enter": "editor::NewlineAbove",
      "ctrl-k ctrl-z": "editor::ToggleSoftWrap",
      "ctrl-k z": "editor::ToggleSoftWrap",
-      "find": "buffer_search::Deploy",
      "ctrl-f": "buffer_search::Deploy",
      "ctrl-h": "buffer_search::DeployReplace",
      "ctrl-shift-.": "assistant::QuoteSelection",
@@ -177,7 +170,6 @@
    "context": "Markdown",
    "use_key_equivalents": true,
    "bindings": {
-      "copy": "markdown::Copy",
      "ctrl-c": "markdown::Copy"
    }
  },
@@ -225,7 +217,6 @@
    "bindings": {
      "ctrl-enter": "assistant::Assist",
      "ctrl-s": "workspace::Save",
-      "save": "workspace::Save",
      "ctrl-shift-,": "assistant::InsertIntoEditor",
      "shift-enter": "assistant::Split",
      "ctrl-r": "assistant::CycleMessageRole",
@@ -272,7 +263,6 @@
    "context": "AgentPanel > Markdown",
    "use_key_equivalents": true,
    "bindings": {
-      "copy": "markdown::CopyAsMarkdown",
      "ctrl-c": "markdown::CopyAsMarkdown"
    }
  },
@@ -367,7 +357,6 @@
    "context": "PromptLibrary",
    "use_key_equivalents": true,
    "bindings": {
-      "new": "rules_library::NewRule",
      "ctrl-n": "rules_library::NewRule",
      "ctrl-shift-s": "rules_library::ToggleDefaultRule"
    }
@@ -381,7 +370,6 @@
      "enter": "search::SelectNextMatch",
      "shift-enter": "search::SelectPreviousMatch",
      "alt-enter": "search::SelectAllMatches",
-      "find": "search::FocusSearch",
      "ctrl-f": "search::FocusSearch",
      "ctrl-h": "search::ToggleReplace",
      "ctrl-l": "search::ToggleSelection"
@@ -408,7 +396,6 @@
    "use_key_equivalents": true,
    "bindings": {
      "escape": "project_search::ToggleFocus",
-      "shift-find": "search::FocusSearch",
      "ctrl-shift-f": "search::FocusSearch",
      "ctrl-shift-h": "search::ToggleReplace",
      "alt-r": "search::ToggleRegex" // vscode
@@ -472,14 +459,12 @@
      "forward": "pane::GoForward",
      "f3": "search::SelectNextMatch",
      "shift-f3": "search::SelectPreviousMatch",
-      "shift-find": "project_search::ToggleFocus",
      "ctrl-shift-f": "project_search::ToggleFocus",
      "shift-alt-h": "search::ToggleReplace",
      "alt-l": "search::ToggleSelection",
      "alt-enter": "search::SelectAllMatches",
      "alt-c": "search::ToggleCaseSensitive",
      "alt-w": "search::ToggleWholeWord",
-      "alt-find": "project_search::ToggleFilters",
      "alt-f": "project_search::ToggleFilters",
      "alt-r": "search::ToggleRegex",
      // "ctrl-shift-alt-x": "search::ToggleRegex",
@@ -579,27 +564,21 @@
    "context": "Workspace",
    "use_key_equivalents": true,
    "bindings": {
-      "alt-open": ["projects::OpenRecent", { "create_new_window": false }],
      // Change the default action on `menu::Confirm` by setting the parameter
      // "ctrl-alt-o": ["projects::OpenRecent", { "create_new_window": true }],
      "ctrl-r": ["projects::OpenRecent", { "create_new_window": false }],
-      "shift-alt-open": ["projects::OpenRemote", { "from_existing_connection": false, "create_new_window": false }],
      // Change to open path modal for existing remote connection by setting the parameter
      // "ctrl-shift-alt-o": "["projects::OpenRemote", { "from_existing_connection": true }]",
      "ctrl-shift-alt-o": ["projects::OpenRemote", { "from_existing_connection": false, "create_new_window": false }],
      "shift-alt-b": "branches::OpenRecent",
      "shift-alt-enter": "toast::RunAction",
      "ctrl-shift-`": "workspace::NewTerminal",
-      "save": "workspace::Save",
      "ctrl-s": "workspace::Save",
      "ctrl-k ctrl-shift-s": "workspace::SaveWithoutFormat",
-      "shift-save": "workspace::SaveAs",
      "ctrl-shift-s": "workspace::SaveAs",
-      "new": "workspace::NewFile",
      "ctrl-n": "workspace::NewFile",
-      "shift-new": "workspace::NewWindow",
      "ctrl-shift-n": "workspace::NewWindow",
-      "ctrl-`": "terminal_panel::ToggleFocus",
+      "ctrl-`": "terminal_panel::Toggle",
      "f10": ["app_menu::OpenApplicationMenu", "Zed"],
      "alt-1": ["workspace::ActivatePane", 0],
      "alt-2": ["workspace::ActivatePane", 1],
@@ -621,7 +600,6 @@
      "shift-alt-0": "workspace::ResetOpenDocksSize",
      "ctrl-shift-alt--": ["workspace::DecreaseOpenDocksSize", { "px": 0 }],
      "ctrl-shift-alt-=": ["workspace::IncreaseOpenDocksSize", { "px": 0 }],
-      "shift-find": "pane::DeploySearch",
      "ctrl-shift-f": "pane::DeploySearch",
      "ctrl-shift-h": ["pane::DeploySearch", { "replace_enabled": true }],
      "ctrl-shift-t": "pane::ReopenClosedItem",
@@ -641,9 +619,9 @@
      "ctrl-shift-g": "git_panel::ToggleFocus",
      "ctrl-shift-d": "debug_panel::ToggleFocus",
      "ctrl-shift-/": "agent::ToggleFocus",
-      "alt-save": "workspace::SaveAll",
      "ctrl-k s": "workspace::SaveAll",
      "ctrl-k m": "language_selector::Toggle",
+      "ctrl-m ctrl-m": "toolchain::AddToolchain",
      "escape": "workspace::Unfollow",
      "ctrl-k ctrl-left": "workspace::ActivatePaneLeft",
      "ctrl-k ctrl-right": "workspace::ActivatePaneRight",
@@ -848,9 +826,7 @@
    "bindings": {
      "left": "outline_panel::CollapseSelectedEntry",
      "right": "outline_panel::ExpandSelectedEntry",
-      "alt-copy": "outline_panel::CopyPath",
      "shift-alt-c": "outline_panel::CopyPath",
-      "shift-alt-copy": "workspace::CopyRelativePath",
      "ctrl-shift-alt-c": "workspace::CopyRelativePath",
      "ctrl-alt-r": "outline_panel::RevealInFileManager",
      "space": "outline_panel::OpenSelectedEntry",
@@ -866,21 +842,14 @@
    "bindings": {
      "left": "project_panel::CollapseSelectedEntry",
      "right": "project_panel::ExpandSelectedEntry",
-      "new": "project_panel::NewFile",
      "ctrl-n": "project_panel::NewFile",
-      "alt-new": "project_panel::NewDirectory",
      "alt-n": "project_panel::NewDirectory",
-      "cut": "project_panel::Cut",
      "ctrl-x": "project_panel::Cut",
-      "copy": "project_panel::Copy",
      "ctrl-insert": "project_panel::Copy",
      "ctrl-c": "project_panel::Copy",
-      "paste": "project_panel::Paste",
      "shift-insert": "project_panel::Paste",
      "ctrl-v": "project_panel::Paste",
-      "alt-copy": "project_panel::CopyPath",
      "shift-alt-c": "project_panel::CopyPath",
-      "shift-alt-copy": "workspace::CopyRelativePath",
      "ctrl-k ctrl-shift-c": "workspace::CopyRelativePath",
      "enter": "project_panel::Rename",
      "f2": "project_panel::Rename",
@@ -892,7 +861,6 @@
      "ctrl-alt-r": "project_panel::RevealInFileManager",
      "ctrl-shift-enter": "project_panel::OpenWithSystem",
      "alt-d": "project_panel::CompareMarkedFiles",
-      "shift-find": "project_panel::NewSearchInDirectory",
      "ctrl-k ctrl-shift-f": "project_panel::NewSearchInDirectory",
      "shift-down": "menu::SelectNext",
      "shift-up": "menu::SelectPrevious",
@@ -1075,6 +1043,13 @@
      "tab": "channel_modal::ToggleMode"
    }
  },
+  {
+    "context": "ToolchainSelector",
+    "use_key_equivalents": true,
+    "bindings": {
+      "ctrl-shift-a": "toolchain::AddToolchain"
+    }
+  },
  {
    "context": "FileFinder || (FileFinder > Picker > Editor)",
    "use_key_equivalents": true,
@@ -1110,10 +1085,8 @@
    "use_key_equivalents": true,
    "bindings": {
      "ctrl-alt-space": "terminal::ShowCharacterPalette",
-      "copy": "terminal::Copy",
      "ctrl-insert": "terminal::Copy",
      "ctrl-shift-c": "terminal::Copy",
-      "paste": "terminal::Paste",
      "shift-insert": "terminal::Paste",
      "ctrl-shift-v": "terminal::Paste",
      "ctrl-enter": "assistant::InlineAssist",
@@ -1129,7 +1102,6 @@
      "ctrl-w": ["terminal::SendKeystroke", "ctrl-w"],
      "ctrl-backspace": ["terminal::SendKeystroke", "ctrl-w"],
      "ctrl-shift-a": "editor::SelectAll",
-      "find": "buffer_search::Deploy",
      "ctrl-shift-f": "buffer_search::Deploy",
      "ctrl-shift-l": "terminal::Clear",
      "ctrl-shift-w": "pane::CloseActiveItem",
@@ -1210,7 +1182,6 @@
    "use_key_equivalents": true,
    "bindings": {
      "ctrl-f": "search::FocusSearch",
-      "alt-find": "keymap_editor::ToggleKeystrokeSearch",
      "alt-f": "keymap_editor::ToggleKeystrokeSearch",
      "alt-c": "keymap_editor::ToggleConflictFilter",
      "enter": "keymap_editor::EditBinding",
--- a/assets/keymaps/linux/jetbrains.json
+++ b/assets/keymaps/linux/jetbrains.json
@@ -125,7 +125,7 @@
  {
    "context": "Workspace || Editor",
    "bindings": {
-      "alt-f12": "terminal_panel::ToggleFocus",
+      "alt-f12": "terminal_panel::Toggle",
      "ctrl-shift-k": "git::Push"
    }
  },
--- a/assets/keymaps/macos/jetbrains.json
+++ b/assets/keymaps/macos/jetbrains.json
@@ -127,7 +127,7 @@
  {
    "context": "Workspace || Editor",
    "bindings": {
-      "alt-f12": "terminal_panel::ToggleFocus",
+      "alt-f12": "terminal_panel::Toggle",
      "cmd-shift-k": "git::Push"
    }
  },
--- a/assets/keymaps/vim.json
+++ b/assets/keymaps/vim.json
@@ -32,34 +32,6 @@
      "(": "vim::SentenceBackward",
      ")": "vim::SentenceForward",
      "|": "vim::GoToColumn",
-      "] ]": "vim::NextSectionStart",
-      "] [": "vim::NextSectionEnd",
-      "[ [": "vim::PreviousSectionStart",
-      "[ ]": "vim::PreviousSectionEnd",
-      "] m": "vim::NextMethodStart",
-      "] shift-m": "vim::NextMethodEnd",
-      "[ m": "vim::PreviousMethodStart",
-      "[ shift-m": "vim::PreviousMethodEnd",
-      "[ *": "vim::PreviousComment",
-      "[ /": "vim::PreviousComment",
-      "] *": "vim::NextComment",
-      "] /": "vim::NextComment",
-      "[ -": "vim::PreviousLesserIndent",
-      "[ +": "vim::PreviousGreaterIndent",
-      "[ =": "vim::PreviousSameIndent",
-      "] -": "vim::NextLesserIndent",
-      "] +": "vim::NextGreaterIndent",
-      "] =": "vim::NextSameIndent",
-      "] b": "pane::ActivateNextItem",
-      "[ b": "pane::ActivatePreviousItem",
-      "] shift-b": "pane::ActivateLastItem",
-      "[ shift-b": ["pane::ActivateItem", 0],
-      "] space": "vim::InsertEmptyLineBelow",
-      "[ space": "vim::InsertEmptyLineAbove",
-      "[ e": "editor::MoveLineUp",
-      "] e": "editor::MoveLineDown",
-      "[ f": "workspace::FollowNextCollaborator",
-      "] f": "workspace::FollowNextCollaborator",

      // Word motions
      "w": "vim::NextWordStart",
@@ -83,10 +55,6 @@
      "n": "vim::MoveToNextMatch",
      "shift-n": "vim::MoveToPreviousMatch",
      "%": "vim::Matching",
-      "] }": ["vim::UnmatchedForward", { "char": "}" }],
-      "[ {": ["vim::UnmatchedBackward", { "char": "{" }],
-      "] )": ["vim::UnmatchedForward", { "char": ")" }],
-      "[ (": ["vim::UnmatchedBackward", { "char": "(" }],
      "f": ["vim::PushFindForward", { "before": false, "multiline": false }],
      "t": ["vim::PushFindForward", { "before": true, "multiline": false }],
      "shift-f": ["vim::PushFindBackward", { "after": false, "multiline": false }],
@@ -219,6 +187,46 @@
      ".": "vim::Repeat"
    }
  },
+  {
+    "context": "vim_mode == normal || vim_mode == visual || vim_mode == operator",
+    "bindings": {
+      "] ]": "vim::NextSectionStart",
+      "] [": "vim::NextSectionEnd",
+      "[ [": "vim::PreviousSectionStart",
+      "[ ]": "vim::PreviousSectionEnd",
+      "] m": "vim::NextMethodStart",
+      "] shift-m": "vim::NextMethodEnd",
+      "[ m": "vim::PreviousMethodStart",
+      "[ shift-m": "vim::PreviousMethodEnd",
+      "[ *": "vim::PreviousComment",
+      "[ /": "vim::PreviousComment",
+      "] *": "vim::NextComment",
+      "] /": "vim::NextComment",
+      "[ -": "vim::PreviousLesserIndent",
+      "[ +": "vim::PreviousGreaterIndent",
+      "[ =": "vim::PreviousSameIndent",
+      "] -": "vim::NextLesserIndent",
+      "] +": "vim::NextGreaterIndent",
+      "] =": "vim::NextSameIndent",
+      "] b": "pane::ActivateNextItem",
+      "[ b": "pane::ActivatePreviousItem",
+      "] shift-b": "pane::ActivateLastItem",
+      "[ shift-b": ["pane::ActivateItem", 0],
+      "] space": "vim::InsertEmptyLineBelow",
+      "[ space": "vim::InsertEmptyLineAbove",
+      "[ e": "editor::MoveLineUp",
+      "] e": "editor::MoveLineDown",
+      "[ f": "workspace::FollowNextCollaborator",
+      "] f": "workspace::FollowNextCollaborator",
+      "] }": ["vim::UnmatchedForward", { "char": "}" }],
+      "[ {": ["vim::UnmatchedBackward", { "char": "{" }],
+      "] )": ["vim::UnmatchedForward", { "char": ")" }],
+      "[ (": ["vim::UnmatchedBackward", { "char": "(" }],
+      // tree-sitter related commands
+      "[ x": "vim::SelectLargerSyntaxNode",
+      "] x": "vim::SelectSmallerSyntaxNode"
+    }
+  },
  {
    "context": "vim_mode == normal",
    "bindings": {
@@ -249,9 +257,6 @@
      "g w": "vim::PushRewrap",
      "g q": "vim::PushRewrap",
      "insert": "vim::InsertBefore",
-      // tree-sitter related commands
-      "[ x": "vim::SelectLargerSyntaxNode",
-      "] x": "vim::SelectSmallerSyntaxNode",
      "] d": "editor::GoToDiagnostic",
      "[ d": "editor::GoToPreviousDiagnostic",
      "] c": "editor::GoToHunk",
@@ -317,10 +322,7 @@
      "g w": "vim::Rewrap",
      "g ?": "vim::ConvertToRot13",
      // "g ?": "vim::ConvertToRot47",
-      "\"": "vim::PushRegister",
-      // tree-sitter related commands
-      "[ x": "editor::SelectLargerSyntaxNode",
-      "] x": "editor::SelectSmallerSyntaxNode"
+      "\"": "vim::PushRegister"
    }
  },
  {
@@ -397,6 +399,9 @@
      "ctrl-[": "editor::Cancel",
      ";": "vim::HelixCollapseSelection",
      ":": "command_palette::Toggle",
+      "m": "vim::PushHelixMatch",
+      "]": ["vim::PushHelixNext", { "around": true }],
+      "[": ["vim::PushHelixPrevious", { "around": true }],
      "left": "vim::WrappingLeft",
      "right": "vim::WrappingRight",
      "h": "vim::WrappingLeft",
@@ -419,13 +424,6 @@
      "insert": "vim::InsertBefore",
      "alt-.": "vim::RepeatFind",
      "alt-s": ["editor::SplitSelectionIntoLines", { "keep_selections": true }],
-      // tree-sitter related commands
-      "[ x": "editor::SelectLargerSyntaxNode",
-      "] x": "editor::SelectSmallerSyntaxNode",
-      "] d": "editor::GoToDiagnostic",
-      "[ d": "editor::GoToPreviousDiagnostic",
-      "] c": "editor::GoToHunk",
-      "[ c": "editor::GoToPreviousHunk",
      // Goto mode
      "g n": "pane::ActivateNextItem",
      "g p": "pane::ActivatePreviousItem",
@@ -469,9 +467,6 @@
      "space c": "editor::ToggleComments",
      "space y": "editor::Copy",
      "space p": "editor::Paste",
-      // Match mode
-      "m m": "vim::Matching",
-      "m i w": ["workspace::SendKeystrokes", "v i w"],
      "shift-u": "editor::Redo",
      "ctrl-c": "editor::ToggleComments",
      "d": "vim::HelixDelete",
@@ -540,7 +535,7 @@
    }
  },
  {
-    "context": "vim_operator == a || vim_operator == i || vim_operator == cs",
+    "context": "vim_operator == a || vim_operator == i || vim_operator == cs || vim_operator == helix_next || vim_operator == helix_previous",
    "bindings": {
      "w": "vim::Word",
      "shift-w": ["vim::Word", { "ignore_punctuation": true }],
@@ -577,6 +572,48 @@
      "e": "vim::EntireFile"
    }
  },
+  {
+    "context": "vim_operator == helix_m",
+    "bindings": {
+      "m": "vim::Matching"
+    }
+  },
+  {
+    "context": "vim_operator == helix_next",
+    "bindings": {
+      "z": "vim::NextSectionStart",
+      "shift-z": "vim::NextSectionEnd",
+      "*": "vim::NextComment",
+      "/": "vim::NextComment",
+      "-": "vim::NextLesserIndent",
+      "+": "vim::NextGreaterIndent",
+      "=": "vim::NextSameIndent",
+      "b": "pane::ActivateNextItem",
+      "shift-b": "pane::ActivateLastItem",
+      "x": "editor::SelectSmallerSyntaxNode",
+      "d": "editor::GoToDiagnostic",
+      "c": "editor::GoToHunk",
+      "space": "vim::InsertEmptyLineBelow"
+    }
+  },
+  {
+    "context": "vim_operator == helix_previous",
+    "bindings": {
+      "z": "vim::PreviousSectionStart",
+      "shift-z": "vim::PreviousSectionEnd",
+      "*": "vim::PreviousComment",
+      "/": "vim::PreviousComment",
+      "-": "vim::PreviousLesserIndent",
+      "+": "vim::PreviousGreaterIndent",
+      "=": "vim::PreviousSameIndent",
+      "b": "pane::ActivatePreviousItem",
+      "shift-b": ["pane::ActivateItem", 0],
+      "x": "editor::SelectLargerSyntaxNode",
+      "d": "editor::GoToPreviousDiagnostic",
+      "c": "editor::GoToPreviousHunk",
+      "space": "vim::InsertEmptyLineAbove"
+    }
+  },
  {
    "context": "vim_operator == c",
    "bindings": {
--- a/assets/settings/default.json
+++ b/assets/settings/default.json
@@ -962,7 +962,7 @@
    // Show git status colors in the editor tabs.
    "git_status": false,
    // Position of the close button on the editor tabs.
-    // One of: ["right", "left", "hidden"]
+    // One of: ["right", "left"]
    "close_position": "right",
    // Whether to show the file icon for a tab.
    "file_icons": false,
--- a/crates/acp_thread/src/acp_thread.rs
+++ b/crates/acp_thread/src/acp_thread.rs
@@ -2114,7 +2114,7 @@ mod tests {
    use gpui::{App, AsyncApp, TestAppContext, WeakEntity};
    use indoc::indoc;
    use project::{FakeFs, Fs};
-    use rand::Rng as _;
+    use rand::{distr, prelude::*};
    use serde_json::json;
    use settings::SettingsStore;
    use smol::stream::StreamExt as _;
@@ -2758,7 +2758,7 @@ mod tests {
        }));

        let thread = cx
-            .update(|cx| connection.new_thread(project, Path::new("/test"), cx))
+            .update(|cx| connection.new_thread(project, Path::new(path!("/test")), cx))
            .await
            .unwrap();

@@ -3057,8 +3057,8 @@ mod tests {
            cx: &mut App,
        ) -> Task<gpui::Result<Entity<AcpThread>>> {
            let session_id = acp::SessionId(
-                rand::thread_rng()
-                    .sample_iter(&rand::distributions::Alphanumeric)
+                rand::rng()
+                    .sample_iter(&distr::Alphanumeric)
                    .take(7)
                    .map(char::from)
                    .collect::<String>()
--- a/crates/action_log/src/action_log.rs
+++ b/crates/action_log/src/action_log.rs
@@ -2218,7 +2218,7 @@ mod tests {
        action_log.update(cx, |log, cx| log.buffer_read(buffer.clone(), cx));

        for _ in 0..operations {
-            match rng.gen_range(0..100) {
+            match rng.random_range(0..100) {
                0..25 => {
                    action_log.update(cx, |log, cx| {
                        let range = buffer.read(cx).random_byte_range(0, &mut rng);
@@ -2237,7 +2237,7 @@ mod tests {
                        .unwrap();
                }
                _ => {
-                    let is_agent_edit = rng.gen_bool(0.5);
+                    let is_agent_edit = rng.random_bool(0.5);
                    if is_agent_edit {
                        log::info!("agent edit");
                    } else {
@@ -2252,7 +2252,7 @@ mod tests {
                }
            }

-            if rng.gen_bool(0.2) {
+            if rng.random_bool(0.2) {
                quiesce(&action_log, &buffer, cx);
            }
        }
--- a/crates/activity_indicator/src/activity_indicator.rs
+++ b/crates/activity_indicator/src/activity_indicator.rs
@@ -84,7 +84,6 @@ impl ActivityIndicator {
    ) -> Entity<ActivityIndicator> {
        let project = workspace.project().clone();
        let auto_updater = AutoUpdater::get(cx);
-        let workspace_handle = cx.entity();
        let this = cx.new(|cx| {
            let mut status_events = languages.language_server_binary_statuses();
            cx.spawn(async move |this, cx| {
@@ -102,20 +101,6 @@ impl ActivityIndicator {
            })
            .detach();

-            cx.subscribe_in(
-                &workspace_handle,
-                window,
-                |activity_indicator, _, event, window, cx| {
-                    if let workspace::Event::ClearActivityIndicator = event
-                        && activity_indicator.statuses.pop().is_some()
-                    {
-                        activity_indicator.dismiss_error_message(&DismissErrorMessage, window, cx);
-                        cx.notify();
-                    }
-                },
-            )
-            .detach();
-
            cx.subscribe(
                &project.read(cx).lsp_store(),
                |activity_indicator, _, event, cx| {
@@ -227,7 +212,8 @@ impl ActivityIndicator {
                server_name,
                status,
            } => {
-                let create_buffer = project.update(cx, |project, cx| project.create_buffer(cx));
+                let create_buffer =
+                    project.update(cx, |project, cx| project.create_buffer(false, cx));
                let status = status.clone();
                let server_name = server_name.clone();
                cx.spawn_in(window, async move |workspace, cx| {
--- a/crates/agent2/src/native_agent_server.rs
+++ b/crates/agent2/src/native_agent_server.rs
@@ -35,10 +35,15 @@ impl AgentServer for NativeAgentServer {

    fn connect(
        &self,
-        _root_dir: &Path,
+        _root_dir: Option<&Path>,
        delegate: AgentServerDelegate,
        cx: &mut App,
-    ) -> Task<Result<Rc<dyn acp_thread::AgentConnection>>> {
+    ) -> Task<
+        Result<(
+            Rc<dyn acp_thread::AgentConnection>,
+            Option<task::SpawnInTerminal>,
+        )>,
+    > {
        log::debug!(
            "NativeAgentServer::connect called for path: {:?}",
            _root_dir
@@ -60,7 +65,10 @@ impl AgentServer for NativeAgentServer {
            let connection = NativeAgentConnection(agent);
            log::debug!("NativeAgentServer connection established successfully");

-            Ok(Rc::new(connection) as Rc<dyn acp_thread::AgentConnection>)
+            Ok((
+                Rc::new(connection) as Rc<dyn acp_thread::AgentConnection>,
+                None,
+            ))
        })
    }

--- a/crates/agent2/src/tests/test_tools.rs
+++ b/crates/agent2/src/tests/test_tools.rs
@@ -24,7 +24,11 @@ impl AgentTool for EchoTool {
        acp::ToolKind::Other
    }

-    fn initial_title(&self, _input: Result<Self::Input, serde_json::Value>) -> SharedString {
+    fn initial_title(
+        &self,
+        _input: Result<Self::Input, serde_json::Value>,
+        _cx: &mut App,
+    ) -> SharedString {
        "Echo".into()
    }

@@ -55,7 +59,11 @@ impl AgentTool for DelayTool {
        "delay"
    }

-    fn initial_title(&self, input: Result<Self::Input, serde_json::Value>) -> SharedString {
+    fn initial_title(
+        &self,
+        input: Result<Self::Input, serde_json::Value>,
+        _cx: &mut App,
+    ) -> SharedString {
        if let Ok(input) = input {
            format!("Delay {}ms", input.ms).into()
        } else {
@@ -100,7 +108,11 @@ impl AgentTool for ToolRequiringPermission {
        acp::ToolKind::Other
    }

-    fn initial_title(&self, _input: Result<Self::Input, serde_json::Value>) -> SharedString {
+    fn initial_title(
+        &self,
+        _input: Result<Self::Input, serde_json::Value>,
+        _cx: &mut App,
+    ) -> SharedString {
        "This tool requires permission".into()
    }

@@ -135,7 +147,11 @@ impl AgentTool for InfiniteTool {
        acp::ToolKind::Other
    }

-    fn initial_title(&self, _input: Result<Self::Input, serde_json::Value>) -> SharedString {
+    fn initial_title(
+        &self,
+        _input: Result<Self::Input, serde_json::Value>,
+        _cx: &mut App,
+    ) -> SharedString {
        "Infinite Tool".into()
    }

@@ -186,7 +202,11 @@ impl AgentTool for WordListTool {
        acp::ToolKind::Other
    }

-    fn initial_title(&self, _input: Result<Self::Input, serde_json::Value>) -> SharedString {
+    fn initial_title(
+        &self,
+        _input: Result<Self::Input, serde_json::Value>,
+        _cx: &mut App,
+    ) -> SharedString {
        "List of random words".into()
    }

--- a/crates/agent2/src/thread.rs
+++ b/crates/agent2/src/thread.rs
@@ -741,7 +741,7 @@ impl Thread {
            return;
        };

-        let title = tool.initial_title(tool_use.input.clone());
+        let title = tool.initial_title(tool_use.input.clone(), cx);
        let kind = tool.kind();
        stream.send_tool_call(&tool_use.id, title, kind, tool_use.input.clone());

@@ -1062,7 +1062,11 @@ impl Thread {
            self.action_log.clone(),
        ));
        self.add_tool(DiagnosticsTool::new(self.project.clone()));
-        self.add_tool(EditFileTool::new(cx.weak_entity(), language_registry));
+        self.add_tool(EditFileTool::new(
+            self.project.clone(),
+            cx.weak_entity(),
+            language_registry,
+        ));
        self.add_tool(FetchTool::new(self.project.read(cx).client().http_client()));
        self.add_tool(FindPathTool::new(self.project.clone()));
        self.add_tool(GrepTool::new(self.project.clone()));
@@ -1514,7 +1518,7 @@ impl Thread {
        let mut title = SharedString::from(&tool_use.name);
        let mut kind = acp::ToolKind::Other;
        if let Some(tool) = tool.as_ref() {
-            title = tool.initial_title(tool_use.input.clone());
+            title = tool.initial_title(tool_use.input.clone(), cx);
            kind = tool.kind();
        }

@@ -2148,7 +2152,11 @@ where
    fn kind() -> acp::ToolKind;

    /// The initial tool title to display. Can be updated during the tool run.
-    fn initial_title(&self, input: Result<Self::Input, serde_json::Value>) -> SharedString;
+    fn initial_title(
+        &self,
+        input: Result<Self::Input, serde_json::Value>,
+        cx: &mut App,
+    ) -> SharedString;

    /// Returns the JSON schema that describes the tool's input.
    fn input_schema(&self, format: LanguageModelToolSchemaFormat) -> Schema {
@@ -2196,7 +2204,7 @@ pub trait AnyAgentTool {
    fn name(&self) -> SharedString;
    fn description(&self) -> SharedString;
    fn kind(&self) -> acp::ToolKind;
-    fn initial_title(&self, input: serde_json::Value) -> SharedString;
+    fn initial_title(&self, input: serde_json::Value, _cx: &mut App) -> SharedString;
    fn input_schema(&self, format: LanguageModelToolSchemaFormat) -> Result<serde_json::Value>;
    fn supported_provider(&self, _provider: &LanguageModelProviderId) -> bool {
        true
@@ -2232,9 +2240,9 @@ where
        T::kind()
    }

-    fn initial_title(&self, input: serde_json::Value) -> SharedString {
+    fn initial_title(&self, input: serde_json::Value, _cx: &mut App) -> SharedString {
        let parsed_input = serde_json::from_value(input.clone()).map_err(|_| input);
-        self.0.initial_title(parsed_input)
+        self.0.initial_title(parsed_input, _cx)
    }

    fn input_schema(&self, format: LanguageModelToolSchemaFormat) -> Result<serde_json::Value> {
--- a/crates/agent2/src/tools/context_server_registry.rs
+++ b/crates/agent2/src/tools/context_server_registry.rs
@@ -145,7 +145,7 @@ impl AnyAgentTool for ContextServerTool {
        ToolKind::Other
    }

-    fn initial_title(&self, _input: serde_json::Value) -> SharedString {
+    fn initial_title(&self, _input: serde_json::Value, _cx: &mut App) -> SharedString {
        format!("Run MCP tool `{}`", self.tool.name).into()
    }

@@ -176,7 +176,7 @@ impl AnyAgentTool for ContextServerTool {
            return Task::ready(Err(anyhow!("Context server not found")));
        };
        let tool_name = self.tool.name.clone();
-        let authorize = event_stream.authorize(self.initial_title(input.clone()), cx);
+        let authorize = event_stream.authorize(self.initial_title(input.clone(), cx), cx);

        cx.spawn(async move |_cx| {
            authorize.await?;
--- a/crates/agent2/src/tools/copy_path_tool.rs
+++ b/crates/agent2/src/tools/copy_path_tool.rs
@@ -58,7 +58,11 @@ impl AgentTool for CopyPathTool {
        ToolKind::Move
    }

-    fn initial_title(&self, input: Result<Self::Input, serde_json::Value>) -> ui::SharedString {
+    fn initial_title(
+        &self,
+        input: Result<Self::Input, serde_json::Value>,
+        _cx: &mut App,
+    ) -> ui::SharedString {
        if let Ok(input) = input {
            let src = MarkdownInlineCode(&input.source_path);
            let dest = MarkdownInlineCode(&input.destination_path);
--- a/crates/agent2/src/tools/create_directory_tool.rs
+++ b/crates/agent2/src/tools/create_directory_tool.rs
@@ -49,7 +49,11 @@ impl AgentTool for CreateDirectoryTool {
        ToolKind::Read
    }

-    fn initial_title(&self, input: Result<Self::Input, serde_json::Value>) -> SharedString {
+    fn initial_title(
+        &self,
+        input: Result<Self::Input, serde_json::Value>,
+        _cx: &mut App,
+    ) -> SharedString {
        if let Ok(input) = input {
            format!("Create directory {}", MarkdownInlineCode(&input.path)).into()
        } else {
--- a/crates/agent2/src/tools/delete_path_tool.rs
+++ b/crates/agent2/src/tools/delete_path_tool.rs
@@ -52,7 +52,11 @@ impl AgentTool for DeletePathTool {
        ToolKind::Delete
    }

-    fn initial_title(&self, input: Result<Self::Input, serde_json::Value>) -> SharedString {
+    fn initial_title(
+        &self,
+        input: Result<Self::Input, serde_json::Value>,
+        _cx: &mut App,
+    ) -> SharedString {
        if let Ok(input) = input {
            format!("Delete “`{}`”", input.path).into()
        } else {
--- a/crates/agent2/src/tools/diagnostics_tool.rs
+++ b/crates/agent2/src/tools/diagnostics_tool.rs
@@ -71,7 +71,11 @@ impl AgentTool for DiagnosticsTool {
        acp::ToolKind::Read
    }

-    fn initial_title(&self, input: Result<Self::Input, serde_json::Value>) -> SharedString {
+    fn initial_title(
+        &self,
+        input: Result<Self::Input, serde_json::Value>,
+        _cx: &mut App,
+    ) -> SharedString {
        if let Some(path) = input.ok().and_then(|input| match input.path {
            Some(path) if !path.is_empty() => Some(path),
            _ => None,
--- a/crates/agent2/src/tools/edit_file_tool.rs
+++ b/crates/agent2/src/tools/edit_file_tool.rs
@@ -83,6 +83,7 @@ struct EditFileToolPartialInput {

 #[derive(Clone, Debug, Serialize, Deserialize, JsonSchema)]
 #[serde(rename_all = "lowercase")]
+#[schemars(inline)]
 pub enum EditFileMode {
    Edit,
    Create,
@@ -119,11 +120,17 @@ impl From<EditFileToolOutput> for LanguageModelToolResultContent {
 pub struct EditFileTool {
    thread: WeakEntity<Thread>,
    language_registry: Arc<LanguageRegistry>,
+    project: Entity<Project>,
 }

 impl EditFileTool {
-    pub fn new(thread: WeakEntity<Thread>, language_registry: Arc<LanguageRegistry>) -> Self {
+    pub fn new(
+        project: Entity<Project>,
+        thread: WeakEntity<Thread>,
+        language_registry: Arc<LanguageRegistry>,
+    ) -> Self {
        Self {
+            project,
            thread,
            language_registry,
        }
@@ -194,22 +201,50 @@ impl AgentTool for EditFileTool {
        acp::ToolKind::Edit
    }

-    fn initial_title(&self, input: Result<Self::Input, serde_json::Value>) -> SharedString {
+    fn initial_title(
+        &self,
+        input: Result<Self::Input, serde_json::Value>,
+        cx: &mut App,
+    ) -> SharedString {
        match input {
-            Ok(input) => input.display_description.into(),
+            Ok(input) => self
+                .project
+                .read(cx)
+                .find_project_path(&input.path, cx)
+                .and_then(|project_path| {
+                    self.project
+                        .read(cx)
+                        .short_full_path_for_project_path(&project_path, cx)
+                })
+                .unwrap_or(Path::new(&input.path).into())
+                .to_string_lossy()
+                .to_string()
+                .into(),
            Err(raw_input) => {
                if let Some(input) =
                    serde_json::from_value::<EditFileToolPartialInput>(raw_input).ok()
                {
+                    let path = input.path.trim();
+                    if !path.is_empty() {
+                        return self
+                            .project
+                            .read(cx)
+                            .find_project_path(&input.path, cx)
+                            .and_then(|project_path| {
+                                self.project
+                                    .read(cx)
+                                    .short_full_path_for_project_path(&project_path, cx)
+                            })
+                            .unwrap_or(Path::new(&input.path).into())
+                            .to_string_lossy()
+                            .to_string()
+                            .into();
+                    }
+
                    let description = input.display_description.trim();
                    if !description.is_empty() {
                        return description.to_string().into();
                    }
-
-                    let path = input.path.trim().to_string();
-                    if !path.is_empty() {
-                        return path.into();
-                    }
                }

                DEFAULT_UI_TEXT.into()
@@ -544,7 +579,7 @@ mod tests {
        let model = Arc::new(FakeLanguageModel::default());
        let thread = cx.new(|cx| {
            Thread::new(
-                project,
+                project.clone(),
                cx.new(|_cx| ProjectContext::default()),
                context_server_registry,
                Templates::new(),
@@ -559,11 +594,12 @@ mod tests {
                    path: "root/nonexistent_file.txt".into(),
                    mode: EditFileMode::Edit,
                };
-                Arc::new(EditFileTool::new(thread.downgrade(), language_registry)).run(
-                    input,
-                    ToolCallEventStream::test().0,
-                    cx,
-                )
+                Arc::new(EditFileTool::new(
+                    project,
+                    thread.downgrade(),
+                    language_registry,
+                ))
+                .run(input, ToolCallEventStream::test().0, cx)
            })
            .await;
        assert_eq!(
@@ -742,7 +778,7 @@ mod tests {
        let model = Arc::new(FakeLanguageModel::default());
        let thread = cx.new(|cx| {
            Thread::new(
-                project,
+                project.clone(),
                cx.new(|_cx| ProjectContext::default()),
                context_server_registry,
                Templates::new(),
@@ -774,6 +810,7 @@ mod tests {
                    mode: EditFileMode::Overwrite,
                };
                Arc::new(EditFileTool::new(
+                    project.clone(),
                    thread.downgrade(),
                    language_registry.clone(),
                ))
@@ -832,11 +869,12 @@ mod tests {
                    path: "root/src/main.rs".into(),
                    mode: EditFileMode::Overwrite,
                };
-                Arc::new(EditFileTool::new(thread.downgrade(), language_registry)).run(
-                    input,
-                    ToolCallEventStream::test().0,
-                    cx,
-                )
+                Arc::new(EditFileTool::new(
+                    project.clone(),
+                    thread.downgrade(),
+                    language_registry,
+                ))
+                .run(input, ToolCallEventStream::test().0, cx)
            });

            // Stream the unformatted content
@@ -884,7 +922,7 @@ mod tests {
        let model = Arc::new(FakeLanguageModel::default());
        let thread = cx.new(|cx| {
            Thread::new(
-                project,
+                project.clone(),
                cx.new(|_cx| ProjectContext::default()),
                context_server_registry,
                Templates::new(),
@@ -917,6 +955,7 @@ mod tests {
                    mode: EditFileMode::Overwrite,
                };
                Arc::new(EditFileTool::new(
+                    project.clone(),
                    thread.downgrade(),
                    language_registry.clone(),
                ))
@@ -968,11 +1007,12 @@ mod tests {
                    path: "root/src/main.rs".into(),
                    mode: EditFileMode::Overwrite,
                };
-                Arc::new(EditFileTool::new(thread.downgrade(), language_registry)).run(
-                    input,
-                    ToolCallEventStream::test().0,
-                    cx,
-                )
+                Arc::new(EditFileTool::new(
+                    project.clone(),
+                    thread.downgrade(),
+                    language_registry,
+                ))
+                .run(input, ToolCallEventStream::test().0, cx)
            });

            // Stream the content with trailing whitespace
@@ -1011,7 +1051,7 @@ mod tests {
        let model = Arc::new(FakeLanguageModel::default());
        let thread = cx.new(|cx| {
            Thread::new(
-                project,
+                project.clone(),
                cx.new(|_cx| ProjectContext::default()),
                context_server_registry,
                Templates::new(),
@@ -1019,7 +1059,11 @@ mod tests {
                cx,
            )
        });
-        let tool = Arc::new(EditFileTool::new(thread.downgrade(), language_registry));
+        let tool = Arc::new(EditFileTool::new(
+            project.clone(),
+            thread.downgrade(),
+            language_registry,
+        ));
        fs.insert_tree("/root", json!({})).await;

        // Test 1: Path with .zed component should require confirmation
@@ -1147,7 +1191,7 @@ mod tests {
        let model = Arc::new(FakeLanguageModel::default());
        let thread = cx.new(|cx| {
            Thread::new(
-                project,
+                project.clone(),
                cx.new(|_cx| ProjectContext::default()),
                context_server_registry,
                Templates::new(),
@@ -1155,7 +1199,11 @@ mod tests {
                cx,
            )
        });
-        let tool = Arc::new(EditFileTool::new(thread.downgrade(), language_registry));
+        let tool = Arc::new(EditFileTool::new(
+            project.clone(),
+            thread.downgrade(),
+            language_registry,
+        ));

        // Test global config paths - these should require confirmation if they exist and are outside the project
        let test_cases = vec![
@@ -1263,7 +1311,11 @@ mod tests {
                cx,
            )
        });
-        let tool = Arc::new(EditFileTool::new(thread.downgrade(), language_registry));
+        let tool = Arc::new(EditFileTool::new(
+            project.clone(),
+            thread.downgrade(),
+            language_registry,
+        ));

        // Test files in different worktrees
        let test_cases = vec![
@@ -1343,7 +1395,11 @@ mod tests {
                cx,
            )
        });
-        let tool = Arc::new(EditFileTool::new(thread.downgrade(), language_registry));
+        let tool = Arc::new(EditFileTool::new(
+            project.clone(),
+            thread.downgrade(),
+            language_registry,
+        ));

        // Test edge cases
        let test_cases = vec![
@@ -1426,7 +1482,11 @@ mod tests {
                cx,
            )
        });
-        let tool = Arc::new(EditFileTool::new(thread.downgrade(), language_registry));
+        let tool = Arc::new(EditFileTool::new(
+            project.clone(),
+            thread.downgrade(),
+            language_registry,
+        ));

        // Test different EditFileMode values
        let modes = vec![
@@ -1506,48 +1566,67 @@ mod tests {
                cx,
            )
        });
-        let tool = Arc::new(EditFileTool::new(thread.downgrade(), language_registry));
+        let tool = Arc::new(EditFileTool::new(
+            project,
+            thread.downgrade(),
+            language_registry,
+        ));

-        assert_eq!(
-            tool.initial_title(Err(json!({
-                "path": "src/main.rs",
-                "display_description": "",
-                "old_string": "old code",
-                "new_string": "new code"
-            }))),
-            "src/main.rs"
-        );
-        assert_eq!(
-            tool.initial_title(Err(json!({
-                "path": "",
-                "display_description": "Fix error handling",
-                "old_string": "old code",
-                "new_string": "new code"
-            }))),
-            "Fix error handling"
-        );
-        assert_eq!(
-            tool.initial_title(Err(json!({
-                "path": "src/main.rs",
-                "display_description": "Fix error handling",
-                "old_string": "old code",
-                "new_string": "new code"
-            }))),
-            "Fix error handling"
-        );
-        assert_eq!(
-            tool.initial_title(Err(json!({
-                "path": "",
-                "display_description": "",
-                "old_string": "old code",
-                "new_string": "new code"
-            }))),
-            DEFAULT_UI_TEXT
-        );
-        assert_eq!(
-            tool.initial_title(Err(serde_json::Value::Null)),
-            DEFAULT_UI_TEXT
-        );
+        cx.update(|cx| {
+            // ...
+            assert_eq!(
+                tool.initial_title(
+                    Err(json!({
+                        "path": "src/main.rs",
+                        "display_description": "",
+                        "old_string": "old code",
+                        "new_string": "new code"
+                    })),
+                    cx
+                ),
+                "src/main.rs"
+            );
+            assert_eq!(
+                tool.initial_title(
+                    Err(json!({
+                        "path": "",
+                        "display_description": "Fix error handling",
+                        "old_string": "old code",
+                        "new_string": "new code"
+                    })),
+                    cx
+                ),
+                "Fix error handling"
+            );
+            assert_eq!(
+                tool.initial_title(
+                    Err(json!({
+                        "path": "src/main.rs",
+                        "display_description": "Fix error handling",
+                        "old_string": "old code",
+                        "new_string": "new code"
+                    })),
+                    cx
+                ),
+                "src/main.rs"
+            );
+            assert_eq!(
+                tool.initial_title(
+                    Err(json!({
+                        "path": "",
+                        "display_description": "",
+                        "old_string": "old code",
+                        "new_string": "new code"
+                    })),
+                    cx
+                ),
+                DEFAULT_UI_TEXT
+            );
+            assert_eq!(
+                tool.initial_title(Err(serde_json::Value::Null), cx),
+                DEFAULT_UI_TEXT
+            );
+        });
    }

    #[gpui::test]
@@ -1574,7 +1653,11 @@ mod tests {

        // Ensure the diff is finalized after the edit completes.
        {
-            let tool = Arc::new(EditFileTool::new(thread.downgrade(), languages.clone()));
+            let tool = Arc::new(EditFileTool::new(
+                project.clone(),
+                thread.downgrade(),
+                languages.clone(),
+            ));
            let (stream_tx, mut stream_rx) = ToolCallEventStream::test();
            let edit = cx.update(|cx| {
                tool.run(
@@ -1599,7 +1682,11 @@ mod tests {
        // Ensure the diff is finalized if an error occurs while editing.
        {
            model.forbid_requests();
-            let tool = Arc::new(EditFileTool::new(thread.downgrade(), languages.clone()));
+            let tool = Arc::new(EditFileTool::new(
+                project.clone(),
+                thread.downgrade(),
+                languages.clone(),
+            ));
            let (stream_tx, mut stream_rx) = ToolCallEventStream::test();
            let edit = cx.update(|cx| {
                tool.run(
@@ -1622,7 +1709,11 @@ mod tests {

        // Ensure the diff is finalized if the tool call gets dropped.
        {
-            let tool = Arc::new(EditFileTool::new(thread.downgrade(), languages.clone()));
+            let tool = Arc::new(EditFileTool::new(
+                project.clone(),
+                thread.downgrade(),
+                languages.clone(),
+            ));
            let (stream_tx, mut stream_rx) = ToolCallEventStream::test();
            let edit = cx.update(|cx| {
                tool.run(
--- a/crates/agent2/src/tools/fetch_tool.rs
+++ b/crates/agent2/src/tools/fetch_tool.rs
@@ -126,7 +126,11 @@ impl AgentTool for FetchTool {
        acp::ToolKind::Fetch
    }

-    fn initial_title(&self, input: Result<Self::Input, serde_json::Value>) -> SharedString {
+    fn initial_title(
+        &self,
+        input: Result<Self::Input, serde_json::Value>,
+        _cx: &mut App,
+    ) -> SharedString {
        match input {
            Ok(input) => format!("Fetch {}", MarkdownEscaped(&input.url)).into(),
            Err(_) => "Fetch URL".into(),
--- a/crates/agent2/src/tools/find_path_tool.rs
+++ b/crates/agent2/src/tools/find_path_tool.rs
@@ -93,7 +93,11 @@ impl AgentTool for FindPathTool {
        acp::ToolKind::Search
    }

-    fn initial_title(&self, input: Result<Self::Input, serde_json::Value>) -> SharedString {
+    fn initial_title(
+        &self,
+        input: Result<Self::Input, serde_json::Value>,
+        _cx: &mut App,
+    ) -> SharedString {
        let mut title = "Find paths".to_string();
        if let Ok(input) = input {
            title.push_str(&format!(" matching “`{}`”", input.glob));
--- a/crates/agent2/src/tools/grep_tool.rs
+++ b/crates/agent2/src/tools/grep_tool.rs
@@ -75,7 +75,11 @@ impl AgentTool for GrepTool {
        acp::ToolKind::Search
    }

-    fn initial_title(&self, input: Result<Self::Input, serde_json::Value>) -> SharedString {
+    fn initial_title(
+        &self,
+        input: Result<Self::Input, serde_json::Value>,
+        _cx: &mut App,
+    ) -> SharedString {
        match input {
            Ok(input) => {
                let page = input.page();
--- a/crates/agent2/src/tools/list_directory_tool.rs
+++ b/crates/agent2/src/tools/list_directory_tool.rs
@@ -59,7 +59,11 @@ impl AgentTool for ListDirectoryTool {
        ToolKind::Read
    }

-    fn initial_title(&self, input: Result<Self::Input, serde_json::Value>) -> SharedString {
+    fn initial_title(
+        &self,
+        input: Result<Self::Input, serde_json::Value>,
+        _cx: &mut App,
+    ) -> SharedString {
        if let Ok(input) = input {
            let path = MarkdownInlineCode(&input.path);
            format!("List the {path} directory's contents").into()
--- a/crates/agent2/src/tools/move_path_tool.rs
+++ b/crates/agent2/src/tools/move_path_tool.rs
@@ -60,7 +60,11 @@ impl AgentTool for MovePathTool {
        ToolKind::Move
    }

-    fn initial_title(&self, input: Result<Self::Input, serde_json::Value>) -> SharedString {
+    fn initial_title(
+        &self,
+        input: Result<Self::Input, serde_json::Value>,
+        _cx: &mut App,
+    ) -> SharedString {
        if let Ok(input) = input {
            let src = MarkdownInlineCode(&input.source_path);
            let dest = MarkdownInlineCode(&input.destination_path);
--- a/crates/agent2/src/tools/now_tool.rs
+++ b/crates/agent2/src/tools/now_tool.rs
@@ -11,6 +11,7 @@ use crate::{AgentTool, ToolCallEventStream};

 #[derive(Debug, Serialize, Deserialize, JsonSchema)]
 #[serde(rename_all = "snake_case")]
+#[schemars(inline)]
 pub enum Timezone {
    /// Use UTC for the datetime.
    Utc,
@@ -40,7 +41,11 @@ impl AgentTool for NowTool {
        acp::ToolKind::Other
    }

-    fn initial_title(&self, _input: Result<Self::Input, serde_json::Value>) -> SharedString {
+    fn initial_title(
+        &self,
+        _input: Result<Self::Input, serde_json::Value>,
+        _cx: &mut App,
+    ) -> SharedString {
        "Get current time".into()
    }

--- a/crates/agent2/src/tools/open_tool.rs
+++ b/crates/agent2/src/tools/open_tool.rs
@@ -45,7 +45,11 @@ impl AgentTool for OpenTool {
        ToolKind::Execute
    }

-    fn initial_title(&self, input: Result<Self::Input, serde_json::Value>) -> SharedString {
+    fn initial_title(
+        &self,
+        input: Result<Self::Input, serde_json::Value>,
+        _cx: &mut App,
+    ) -> SharedString {
        if let Ok(input) = input {
            format!("Open `{}`", MarkdownEscaped(&input.path_or_url)).into()
        } else {
@@ -61,7 +65,7 @@ impl AgentTool for OpenTool {
    ) -> Task<Result<Self::Output>> {
        // If path_or_url turns out to be a path in the project, make it absolute.
        let abs_path = to_absolute_path(&input.path_or_url, self.project.clone(), cx);
-        let authorize = event_stream.authorize(self.initial_title(Ok(input.clone())), cx);
+        let authorize = event_stream.authorize(self.initial_title(Ok(input.clone()), cx), cx);
        cx.background_spawn(async move {
            authorize.await?;

--- a/crates/agent2/src/tools/read_file_tool.rs
+++ b/crates/agent2/src/tools/read_file_tool.rs
@@ -10,7 +10,7 @@ use project::{AgentLocation, ImageItem, Project, WorktreeSettings, image_store};
 use schemars::JsonSchema;
 use serde::{Deserialize, Serialize};
 use settings::Settings;
-use std::{path::Path, sync::Arc};
+use std::sync::Arc;
 use util::markdown::MarkdownCodeBlock;

 use crate::{AgentTool, ToolCallEventStream};
@@ -68,13 +68,31 @@ impl AgentTool for ReadFileTool {
        acp::ToolKind::Read
    }

-    fn initial_title(&self, input: Result<Self::Input, serde_json::Value>) -> SharedString {
-        input
-            .ok()
-            .as_ref()
-            .and_then(|input| Path::new(&input.path).file_name())
-            .map(|file_name| file_name.to_string_lossy().to_string().into())
-            .unwrap_or_default()
+    fn initial_title(
+        &self,
+        input: Result<Self::Input, serde_json::Value>,
+        cx: &mut App,
+    ) -> SharedString {
+        if let Ok(input) = input
+            && let Some(project_path) = self.project.read(cx).find_project_path(&input.path, cx)
+            && let Some(path) = self
+                .project
+                .read(cx)
+                .short_full_path_for_project_path(&project_path, cx)
+        {
+            match (input.start_line, input.end_line) {
+                (Some(start), Some(end)) => {
+                    format!("Read file `{}` (lines {}-{})", path.display(), start, end,)
+                }
+                (Some(start), None) => {
+                    format!("Read file `{}` (from line {})", path.display(), start)
+                }
+                _ => format!("Read file `{}`", path.display()),
+            }
+            .into()
+        } else {
+            "Read file".into()
+        }
    }

    fn run(
@@ -86,6 +104,12 @@ impl AgentTool for ReadFileTool {
        let Some(project_path) = self.project.read(cx).find_project_path(&input.path, cx) else {
            return Task::ready(Err(anyhow!("Path {} not found in project", &input.path)));
        };
+        let Some(abs_path) = self.project.read(cx).absolute_path(&project_path, cx) else {
+            return Task::ready(Err(anyhow!(
+                "Failed to convert {} to absolute path",
+                &input.path
+            )));
+        };

        // Error out if this path is either excluded or private in global settings
        let global_settings = WorktreeSettings::get_global(cx);
@@ -121,6 +145,14 @@ impl AgentTool for ReadFileTool {

        let file_path = input.path.clone();

+        event_stream.update_fields(ToolCallUpdateFields {
+            locations: Some(vec![acp::ToolCallLocation {
+                path: abs_path,
+                line: input.start_line.map(|line| line.saturating_sub(1)),
+            }]),
+            ..Default::default()
+        });
+
        if image_store::is_image_file(&self.project, &project_path, cx) {
            return cx.spawn(async move |cx| {
                let image_entity: Entity<ImageItem> = cx
@@ -229,34 +261,25 @@ impl AgentTool for ReadFileTool {
            };

            project.update(cx, |project, cx| {
-                if let Some(abs_path) = project.absolute_path(&project_path, cx) {
-                    project.set_agent_location(
-                        Some(AgentLocation {
-                            buffer: buffer.downgrade(),
-                            position: anchor.unwrap_or(text::Anchor::MIN),
-                        }),
-                        cx,
-                    );
+                project.set_agent_location(
+                    Some(AgentLocation {
+                        buffer: buffer.downgrade(),
+                        position: anchor.unwrap_or(text::Anchor::MIN),
+                    }),
+                    cx,
+                );
+                if let Ok(LanguageModelToolResultContent::Text(text)) = &result {
+                    let markdown = MarkdownCodeBlock {
+                        tag: &input.path,
+                        text,
+                    }
+                    .to_string();
                    event_stream.update_fields(ToolCallUpdateFields {
-                        locations: Some(vec![acp::ToolCallLocation {
-                            path: abs_path,
-                            line: input.start_line.map(|line| line.saturating_sub(1)),
+                        content: Some(vec![acp::ToolCallContent::Content {
+                            content: markdown.into(),
                        }]),
                        ..Default::default()
-                    });
-                    if let Ok(LanguageModelToolResultContent::Text(text)) = &result {
-                        let markdown = MarkdownCodeBlock {
-                            tag: &input.path,
-                            text,
-                        }
-                        .to_string();
-                        event_stream.update_fields(ToolCallUpdateFields {
-                            content: Some(vec![acp::ToolCallContent::Content {
-                                content: markdown.into(),
-                            }]),
-                            ..Default::default()
-                        })
-                    }
+                    })
                }
            })?;

--- a/crates/agent2/src/tools/terminal_tool.rs
+++ b/crates/agent2/src/tools/terminal_tool.rs
@@ -60,7 +60,11 @@ impl AgentTool for TerminalTool {
        acp::ToolKind::Execute
    }

-    fn initial_title(&self, input: Result<Self::Input, serde_json::Value>) -> SharedString {
+    fn initial_title(
+        &self,
+        input: Result<Self::Input, serde_json::Value>,
+        _cx: &mut App,
+    ) -> SharedString {
        if let Ok(input) = input {
            let mut lines = input.command.lines();
            let first_line = lines.next().unwrap_or_default();
@@ -93,7 +97,7 @@ impl AgentTool for TerminalTool {
            Err(err) => return Task::ready(Err(err)),
        };

-        let authorize = event_stream.authorize(self.initial_title(Ok(input.clone())), cx);
+        let authorize = event_stream.authorize(self.initial_title(Ok(input.clone()), cx), cx);
        cx.spawn(async move |cx| {
            authorize.await?;

--- a/crates/agent2/src/tools/thinking_tool.rs
+++ b/crates/agent2/src/tools/thinking_tool.rs
@@ -29,7 +29,11 @@ impl AgentTool for ThinkingTool {
        acp::ToolKind::Think
    }

-    fn initial_title(&self, _input: Result<Self::Input, serde_json::Value>) -> SharedString {
+    fn initial_title(
+        &self,
+        _input: Result<Self::Input, serde_json::Value>,
+        _cx: &mut App,
+    ) -> SharedString {
        "Thinking".into()
    }

--- a/crates/agent2/src/tools/web_search_tool.rs
+++ b/crates/agent2/src/tools/web_search_tool.rs
@@ -48,7 +48,11 @@ impl AgentTool for WebSearchTool {
        acp::ToolKind::Fetch
    }

-    fn initial_title(&self, _input: Result<Self::Input, serde_json::Value>) -> SharedString {
+    fn initial_title(
+        &self,
+        _input: Result<Self::Input, serde_json::Value>,
+        _cx: &mut App,
+    ) -> SharedString {
        "Searching the Web".into()
    }

--- a/crates/agent_servers/Cargo.toml
+++ b/crates/agent_servers/Cargo.toml
@@ -35,22 +35,18 @@ language.workspace = true
 language_model.workspace = true
 language_models.workspace = true
 log.workspace = true
-node_runtime.workspace = true
-paths.workspace = true
 project.workspace = true
 reqwest_client = { workspace = true, optional = true }
-schemars.workspace = true
-semver.workspace = true
 serde.workspace = true
 serde_json.workspace = true
 settings.workspace = true
 smol.workspace = true
+task.workspace = true
 tempfile.workspace = true
 thiserror.workspace = true
 ui.workspace = true
 util.workspace = true
 watch.workspace = true
-which.workspace = true
 workspace-hack.workspace = true

 [target.'cfg(unix)'.dependencies]
--- a/crates/agent_servers/src/acp.rs
+++ b/crates/agent_servers/src/acp.rs
@@ -1,4 +1,3 @@
-use crate::AgentServerCommand;
 use acp_thread::AgentConnection;
 use acp_tools::AcpConnectionRegistry;
 use action_log::ActionLog;
@@ -8,8 +7,10 @@ use collections::HashMap;
 use futures::AsyncBufReadExt as _;
 use futures::io::BufReader;
 use project::Project;
+use project::agent_server_store::AgentServerCommand;
 use serde::Deserialize;

+use std::path::PathBuf;
 use std::{any::Any, cell::RefCell};
 use std::{path::Path, rc::Rc};
 use thiserror::Error;
@@ -29,6 +30,7 @@ pub struct AcpConnection {
    sessions: Rc<RefCell<HashMap<acp::SessionId, AcpSession>>>,
    auth_methods: Vec<acp::AuthMethod>,
    agent_capabilities: acp::AgentCapabilities,
+    root_dir: PathBuf,
    _io_task: Task<Result<()>>,
    _wait_task: Task<Result<()>>,
    _stderr_task: Task<Result<()>>,
@@ -43,9 +45,10 @@ pub async fn connect(
    server_name: SharedString,
    command: AgentServerCommand,
    root_dir: &Path,
+    is_remote: bool,
    cx: &mut AsyncApp,
 ) -> Result<Rc<dyn AgentConnection>> {
-    let conn = AcpConnection::stdio(server_name, command.clone(), root_dir, cx).await?;
+    let conn = AcpConnection::stdio(server_name, command.clone(), root_dir, is_remote, cx).await?;
    Ok(Rc::new(conn) as _)
 }

@@ -56,17 +59,21 @@ impl AcpConnection {
        server_name: SharedString,
        command: AgentServerCommand,
        root_dir: &Path,
+        is_remote: bool,
        cx: &mut AsyncApp,
    ) -> Result<Self> {
-        let mut child = util::command::new_smol_command(command.path)
+        let mut child = util::command::new_smol_command(command.path);
+        child
            .args(command.args.iter().map(|arg| arg.as_str()))
            .envs(command.env.iter().flatten())
-            .current_dir(root_dir)
            .stdin(std::process::Stdio::piped())
            .stdout(std::process::Stdio::piped())
            .stderr(std::process::Stdio::piped())
-            .kill_on_drop(true)
-            .spawn()?;
+            .kill_on_drop(true);
+        if !is_remote {
+            child.current_dir(root_dir);
+        }
+        let mut child = child.spawn()?;

        let stdout = child.stdout.take().context("Failed to take stdout")?;
        let stdin = child.stdin.take().context("Failed to take stdin")?;
@@ -145,6 +152,7 @@ impl AcpConnection {

        Ok(Self {
            auth_methods: response.auth_methods,
+            root_dir: root_dir.to_owned(),
            connection,
            server_name,
            sessions,
@@ -158,6 +166,10 @@ impl AcpConnection {
    pub fn prompt_capabilities(&self) -> &acp::PromptCapabilities {
        &self.agent_capabilities.prompt_capabilities
    }
+
+    pub fn root_dir(&self) -> &Path {
+        &self.root_dir
+    }
 }

 impl AgentConnection for AcpConnection {
@@ -171,29 +183,36 @@ impl AgentConnection for AcpConnection {
        let sessions = self.sessions.clone();
        let cwd = cwd.to_path_buf();
        let context_server_store = project.read(cx).context_server_store().read(cx);
-        let mcp_servers = context_server_store
-            .configured_server_ids()
-            .iter()
-            .filter_map(|id| {
-                let configuration = context_server_store.configuration_for_server(id)?;
-                let command = configuration.command();
-                Some(acp::McpServer {
-                    name: id.0.to_string(),
-                    command: command.path.clone(),
-                    args: command.args.clone(),
-                    env: if let Some(env) = command.env.as_ref() {
-                        env.iter()
-                            .map(|(name, value)| acp::EnvVariable {
-                                name: name.clone(),
-                                value: value.clone(),
-                            })
-                            .collect()
-                    } else {
-                        vec![]
-                    },
+        let mcp_servers = if project.read(cx).is_local() {
+            context_server_store
+                .configured_server_ids()
+                .iter()
+                .filter_map(|id| {
+                    let configuration = context_server_store.configuration_for_server(id)?;
+                    let command = configuration.command();
+                    Some(acp::McpServer {
+                        name: id.0.to_string(),
+                        command: command.path.clone(),
+                        args: command.args.clone(),
+                        env: if let Some(env) = command.env.as_ref() {
+                            env.iter()
+                                .map(|(name, value)| acp::EnvVariable {
+                                    name: name.clone(),
+                                    value: value.clone(),
+                                })
+                                .collect()
+                        } else {
+                            vec![]
+                        },
+                    })
                })
-            })
-            .collect();
+                .collect()
+        } else {
+            // In SSH projects, the external agent is running on the remote
+            // machine, and currently we only run MCP servers on the local
+            // machine. So don't pass any MCP servers to the agent in that case.
+            Vec::new()
+        };

        cx.spawn(async move |cx| {
            let response = conn
--- a/crates/agent_servers/src/agent_servers.rs
+++ b/crates/agent_servers/src/agent_servers.rs
@@ -2,47 +2,25 @@ mod acp;
 mod claude;
 mod custom;
 mod gemini;
-mod settings;

 #[cfg(any(test, feature = "test-support"))]
 pub mod e2e_tests;

-use anyhow::Context as _;
 pub use claude::*;
 pub use custom::*;
-use fs::Fs;
-use fs::RemoveOptions;
-use fs::RenameOptions;
-use futures::StreamExt as _;
 pub use gemini::*;
-use gpui::AppContext;
-use node_runtime::NodeRuntime;
-pub use settings::*;
+use project::agent_server_store::AgentServerStore;

 use acp_thread::AgentConnection;
-use acp_thread::LoadError;
 use anyhow::Result;
-use anyhow::anyhow;
-use collections::HashMap;
-use gpui::{App, AsyncApp, Entity, SharedString, Task};
+use gpui::{App, Entity, SharedString, Task};
 use project::Project;
-use schemars::JsonSchema;
-use semver::Version;
-use serde::{Deserialize, Serialize};
-use std::str::FromStr as _;
-use std::{
-    any::Any,
-    path::{Path, PathBuf},
-    rc::Rc,
-    sync::Arc,
-};
-use util::ResultExt as _;
+use std::{any::Any, path::Path, rc::Rc};

-pub fn init(cx: &mut App) {
-    settings::init(cx);
-}
+pub use acp::AcpConnection;

 pub struct AgentServerDelegate {
+    store: Entity<AgentServerStore>,
    project: Entity<Project>,
    status_tx: Option<watch::Sender<SharedString>>,
    new_version_available: Option<watch::Sender<Option<String>>>,
@@ -50,11 +28,13 @@ pub struct AgentServerDelegate {

 impl AgentServerDelegate {
    pub fn new(
+        store: Entity<AgentServerStore>,
        project: Entity<Project>,
        status_tx: Option<watch::Sender<SharedString>>,
        new_version_tx: Option<watch::Sender<Option<String>>>,
    ) -> Self {
        Self {
+            store,
            project,
            status_tx,
            new_version_available: new_version_tx,
@@ -64,188 +44,6 @@ impl AgentServerDelegate {
    pub fn project(&self) -> &Entity<Project> {
        &self.project
    }
-
-    fn get_or_npm_install_builtin_agent(
-        self,
-        binary_name: SharedString,
-        package_name: SharedString,
-        entrypoint_path: PathBuf,
-        ignore_system_version: bool,
-        minimum_version: Option<Version>,
-        cx: &mut App,
-    ) -> Task<Result<AgentServerCommand>> {
-        let project = self.project;
-        let fs = project.read(cx).fs().clone();
-        let Some(node_runtime) = project.read(cx).node_runtime().cloned() else {
-            return Task::ready(Err(anyhow!(
-                "External agents are not yet available in remote projects."
-            )));
-        };
-        let status_tx = self.status_tx;
-        let new_version_available = self.new_version_available;
-
-        cx.spawn(async move |cx| {
-            if !ignore_system_version {
-                if let Some(bin) = find_bin_in_path(binary_name.clone(), &project, cx).await {
-                    return Ok(AgentServerCommand {
-                        path: bin,
-                        args: Vec::new(),
-                        env: Default::default(),
-                    });
-                }
-            }
-
-            cx.spawn(async move |cx| {
-                let node_path = node_runtime.binary_path().await?;
-                let dir = paths::data_dir()
-                    .join("external_agents")
-                    .join(binary_name.as_str());
-                fs.create_dir(&dir).await?;
-
-                let mut stream = fs.read_dir(&dir).await?;
-                let mut versions = Vec::new();
-                let mut to_delete = Vec::new();
-                while let Some(entry) = stream.next().await {
-                    let Ok(entry) = entry else { continue };
-                    let Some(file_name) = entry.file_name() else {
-                        continue;
-                    };
-
-                    if let Some(name) = file_name.to_str()
-                        && let Some(version) = semver::Version::from_str(name).ok()
-                        && fs
-                            .is_file(&dir.join(file_name).join(&entrypoint_path))
-                            .await
-                    {
-                        versions.push((version, file_name.to_owned()));
-                    } else {
-                        to_delete.push(file_name.to_owned())
-                    }
-                }
-
-                versions.sort();
-                let newest_version = if let Some((version, file_name)) = versions.last().cloned()
-                    && minimum_version.is_none_or(|minimum_version| version >= minimum_version)
-                {
-                    versions.pop();
-                    Some(file_name)
-                } else {
-                    None
-                };
-                log::debug!("existing version of {package_name}: {newest_version:?}");
-                to_delete.extend(versions.into_iter().map(|(_, file_name)| file_name));
-
-                cx.background_spawn({
-                    let fs = fs.clone();
-                    let dir = dir.clone();
-                    async move {
-                        for file_name in to_delete {
-                            fs.remove_dir(
-                                &dir.join(file_name),
-                                RemoveOptions {
-                                    recursive: true,
-                                    ignore_if_not_exists: false,
-                                },
-                            )
-                            .await
-                            .ok();
-                        }
-                    }
-                })
-                .detach();
-
-                let version = if let Some(file_name) = newest_version {
-                    cx.background_spawn({
-                        let file_name = file_name.clone();
-                        let dir = dir.clone();
-                        let fs = fs.clone();
-                        async move {
-                            let latest_version =
-                                node_runtime.npm_package_latest_version(&package_name).await;
-                            if let Ok(latest_version) = latest_version
-                                && &latest_version != &file_name.to_string_lossy()
-                            {
-                                Self::download_latest_version(
-                                    fs,
-                                    dir.clone(),
-                                    node_runtime,
-                                    package_name,
-                                )
-                                .await
-                                .log_err();
-                                if let Some(mut new_version_available) = new_version_available {
-                                    new_version_available.send(Some(latest_version)).ok();
-                                }
-                            }
-                        }
-                    })
-                    .detach();
-                    file_name
-                } else {
-                    if let Some(mut status_tx) = status_tx {
-                        status_tx.send("Installing…".into()).ok();
-                    }
-                    let dir = dir.clone();
-                    cx.background_spawn(Self::download_latest_version(
-                        fs.clone(),
-                        dir.clone(),
-                        node_runtime,
-                        package_name,
-                    ))
-                    .await?
-                    .into()
-                };
-
-                let agent_server_path = dir.join(version).join(entrypoint_path);
-                let agent_server_path_exists = fs.is_file(&agent_server_path).await;
-                anyhow::ensure!(
-                    agent_server_path_exists,
-                    "Missing entrypoint path {} after installation",
-                    agent_server_path.to_string_lossy()
-                );
-
-                anyhow::Ok(AgentServerCommand {
-                    path: node_path,
-                    args: vec![agent_server_path.to_string_lossy().to_string()],
-                    env: Default::default(),
-                })
-            })
-            .await
-            .map_err(|e| LoadError::FailedToInstall(e.to_string().into()).into())
-        })
-    }
-
-    async fn download_latest_version(
-        fs: Arc<dyn Fs>,
-        dir: PathBuf,
-        node_runtime: NodeRuntime,
-        package_name: SharedString,
-    ) -> Result<String> {
-        log::debug!("downloading latest version of {package_name}");
-
-        let tmp_dir = tempfile::tempdir_in(&dir)?;
-
-        node_runtime
-            .npm_install_packages(tmp_dir.path(), &[(&package_name, "latest")])
-            .await?;
-
-        let version = node_runtime
-            .npm_package_installed_version(tmp_dir.path(), &package_name)
-            .await?
-            .context("expected package to be installed")?;
-
-        fs.rename(
-            &tmp_dir.keep(),
-            &dir.join(&version),
-            RenameOptions {
-                ignore_if_exists: true,
-                overwrite: false,
-            },
-        )
-        .await?;
-
-        anyhow::Ok(version)
-    }
 }

 pub trait AgentServer: Send {
@@ -255,10 +53,10 @@ pub trait AgentServer: Send {

    fn connect(
        &self,
-        root_dir: &Path,
+        root_dir: Option<&Path>,
        delegate: AgentServerDelegate,
        cx: &mut App,
-    ) -> Task<Result<Rc<dyn AgentConnection>>>;
+    ) -> Task<Result<(Rc<dyn AgentConnection>, Option<task::SpawnInTerminal>)>>;

    fn into_any(self: Rc<Self>) -> Rc<dyn Any>;
 }
@@ -268,120 +66,3 @@ impl dyn AgentServer {
        self.into_any().downcast().ok()
    }
 }
-
-impl std::fmt::Debug for AgentServerCommand {
-    fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
-        let filtered_env = self.env.as_ref().map(|env| {
-            env.iter()
-                .map(|(k, v)| {
-                    (
-                        k,
-                        if util::redact::should_redact(k) {
-                            "[REDACTED]"
-                        } else {
-                            v
-                        },
-                    )
-                })
-                .collect::<Vec<_>>()
-        });
-
-        f.debug_struct("AgentServerCommand")
-            .field("path", &self.path)
-            .field("args", &self.args)
-            .field("env", &filtered_env)
-            .finish()
-    }
-}
-
-#[derive(Deserialize, Serialize, Clone, PartialEq, Eq, JsonSchema)]
-pub struct AgentServerCommand {
-    #[serde(rename = "command")]
-    pub path: PathBuf,
-    #[serde(default)]
-    pub args: Vec<String>,
-    pub env: Option<HashMap<String, String>>,
-}
-
-impl AgentServerCommand {
-    pub async fn resolve(
-        path_bin_name: &'static str,
-        extra_args: &[&'static str],
-        fallback_path: Option<&Path>,
-        settings: Option<BuiltinAgentServerSettings>,
-        project: &Entity<Project>,
-        cx: &mut AsyncApp,
-    ) -> Option<Self> {
-        if let Some(settings) = settings
-            && let Some(command) = settings.custom_command()
-        {
-            Some(command)
-        } else {
-            match find_bin_in_path(path_bin_name.into(), project, cx).await {
-                Some(path) => Some(Self {
-                    path,
-                    args: extra_args.iter().map(|arg| arg.to_string()).collect(),
-                    env: None,
-                }),
-                None => fallback_path.and_then(|path| {
-                    if path.exists() {
-                        Some(Self {
-                            path: path.to_path_buf(),
-                            args: extra_args.iter().map(|arg| arg.to_string()).collect(),
-                            env: None,
-                        })
-                    } else {
-                        None
-                    }
-                }),
-            }
-        }
-    }
-}
-
-async fn find_bin_in_path(
-    bin_name: SharedString,
-    project: &Entity<Project>,
-    cx: &mut AsyncApp,
-) -> Option<PathBuf> {
-    let (env_task, root_dir) = project
-        .update(cx, |project, cx| {
-            let worktree = project.visible_worktrees(cx).next();
-            match worktree {
-                Some(worktree) => {
-                    let env_task = project.environment().update(cx, |env, cx| {
-                        env.get_worktree_environment(worktree.clone(), cx)
-                    });
-
-                    let path = worktree.read(cx).abs_path();
-                    (env_task, path)
-                }
-                None => {
-                    let path: Arc<Path> = paths::home_dir().as_path().into();
-                    let env_task = project.environment().update(cx, |env, cx| {
-                        env.get_directory_environment(path.clone(), cx)
-                    });
-                    (env_task, path)
-                }
-            }
-        })
-        .log_err()?;
-
-    cx.background_executor()
-        .spawn(async move {
-            let which_result = if cfg!(windows) {
-                which::which(bin_name.as_str())
-            } else {
-                let env = env_task.await.unwrap_or_default();
-                let shell_path = env.get("PATH").cloned();
-                which::which_in(bin_name.as_str(), shell_path.as_ref(), root_dir.as_ref())
-            };
-
-            if let Err(which::Error::CannotFindBinaryPath) = which_result {
-                return None;
-            }
-
-            which_result.log_err()
-        })
-        .await
-}
--- a/crates/agent_servers/src/claude.rs
+++ b/crates/agent_servers/src/claude.rs
@@ -1,61 +1,22 @@
-use language_models::provider::anthropic::AnthropicLanguageModelProvider;
-use settings::SettingsStore;
 use std::path::Path;
 use std::rc::Rc;
 use std::{any::Any, path::PathBuf};

-use anyhow::Result;
-use gpui::{App, AppContext as _, SharedString, Task};
+use anyhow::{Context as _, Result};
+use gpui::{App, SharedString, Task};
+use project::agent_server_store::CLAUDE_CODE_NAME;

-use crate::{AgentServer, AgentServerDelegate, AllAgentServersSettings};
+use crate::{AgentServer, AgentServerDelegate};
 use acp_thread::AgentConnection;

 #[derive(Clone)]
 pub struct ClaudeCode;

-pub struct ClaudeCodeLoginCommand {
+pub struct AgentServerLoginCommand {
    pub path: PathBuf,
    pub arguments: Vec<String>,
 }

-impl ClaudeCode {
-    const BINARY_NAME: &'static str = "claude-code-acp";
-    const PACKAGE_NAME: &'static str = "@zed-industries/claude-code-acp";
-
-    pub fn login_command(
-        delegate: AgentServerDelegate,
-        cx: &mut App,
-    ) -> Task<Result<ClaudeCodeLoginCommand>> {
-        let settings = cx.read_global(|settings: &SettingsStore, _| {
-            settings.get::<AllAgentServersSettings>(None).claude.clone()
-        });
-
-        cx.spawn(async move |cx| {
-            let mut command = if let Some(settings) = settings {
-                settings.command
-            } else {
-                cx.update(|cx| {
-                    delegate.get_or_npm_install_builtin_agent(
-                        Self::BINARY_NAME.into(),
-                        Self::PACKAGE_NAME.into(),
-                        "node_modules/@anthropic-ai/claude-code/cli.js".into(),
-                        true,
-                        Some("0.2.5".parse().unwrap()),
-                        cx,
-                    )
-                })?
-                .await?
-            };
-            command.args.push("/login".into());
-
-            Ok(ClaudeCodeLoginCommand {
-                path: command.path,
-                arguments: command.args,
-            })
-        })
-    }
-}
-
 impl AgentServer for ClaudeCode {
    fn telemetry_id(&self) -> &'static str {
        "claude-code"
@@ -71,53 +32,33 @@ impl AgentServer for ClaudeCode {

    fn connect(
        &self,
-        root_dir: &Path,
+        root_dir: Option<&Path>,
        delegate: AgentServerDelegate,
        cx: &mut App,
-    ) -> Task<Result<Rc<dyn AgentConnection>>> {
-        let root_dir = root_dir.to_path_buf();
-        let fs = delegate.project().read(cx).fs().clone();
-        let server_name = self.name();
-        let settings = cx.read_global(|settings: &SettingsStore, _| {
-            settings.get::<AllAgentServersSettings>(None).claude.clone()
-        });
+    ) -> Task<Result<(Rc<dyn AgentConnection>, Option<task::SpawnInTerminal>)>> {
+        let name = self.name();
+        let root_dir = root_dir.map(|root_dir| root_dir.to_string_lossy().to_string());
+        let is_remote = delegate.project.read(cx).is_via_remote_server();
+        let store = delegate.store.downgrade();

        cx.spawn(async move |cx| {
-            let mut command = if let Some(settings) = settings {
-                settings.command
-            } else {
-                cx.update(|cx| {
-                    delegate.get_or_npm_install_builtin_agent(
-                        Self::BINARY_NAME.into(),
-                        Self::PACKAGE_NAME.into(),
-                        format!("node_modules/{}/dist/index.js", Self::PACKAGE_NAME).into(),
-                        true,
-                        None,
-                        cx,
-                    )
-                })?
-                .await?
-            };
-
-            if let Some(api_key) = cx
-                .update(AnthropicLanguageModelProvider::api_key)?
-                .await
-                .ok()
-            {
-                command
-                    .env
-                    .get_or_insert_default()
-                    .insert("ANTHROPIC_API_KEY".to_owned(), api_key.key);
-            }
-
-            let root_dir_exists = fs.is_dir(&root_dir).await;
-            anyhow::ensure!(
-                root_dir_exists,
-                "Session root {} does not exist or is not a directory",
-                root_dir.to_string_lossy()
-            );
-
-            crate::acp::connect(server_name, command.clone(), &root_dir, cx).await
+            let (command, root_dir, login) = store
+                .update(cx, |store, cx| {
+                    let agent = store
+                        .get_external_agent(&CLAUDE_CODE_NAME.into())
+                        .context("Claude Code is not registered")?;
+                    anyhow::Ok(agent.get_command(
+                        root_dir.as_deref(),
+                        Default::default(),
+                        delegate.status_tx,
+                        delegate.new_version_available,
+                        &mut cx.to_async(),
+                    ))
+                })??
+                .await?;
+            let connection =
+                crate::acp::connect(name, command, root_dir.as_ref(), is_remote, cx).await?;
+            Ok((connection, login))
        })
    }

--- a/crates/agent_servers/src/custom.rs
+++ b/crates/agent_servers/src/custom.rs
@@ -1,19 +1,19 @@
-use crate::{AgentServerCommand, AgentServerDelegate};
+use crate::AgentServerDelegate;
 use acp_thread::AgentConnection;
-use anyhow::Result;
+use anyhow::{Context as _, Result};
 use gpui::{App, SharedString, Task};
+use project::agent_server_store::ExternalAgentServerName;
 use std::{path::Path, rc::Rc};
 use ui::IconName;

 /// A generic agent server implementation for custom user-defined agents
 pub struct CustomAgentServer {
    name: SharedString,
-    command: AgentServerCommand,
 }

 impl CustomAgentServer {
-    pub fn new(name: SharedString, command: AgentServerCommand) -> Self {
-        Self { name, command }
+    pub fn new(name: SharedString) -> Self {
+        Self { name }
    }
 }

@@ -32,14 +32,36 @@ impl crate::AgentServer for CustomAgentServer {

    fn connect(
        &self,
-        root_dir: &Path,
-        _delegate: AgentServerDelegate,
+        root_dir: Option<&Path>,
+        delegate: AgentServerDelegate,
        cx: &mut App,
-    ) -> Task<Result<Rc<dyn AgentConnection>>> {
-        let server_name = self.name();
-        let command = self.command.clone();
-        let root_dir = root_dir.to_path_buf();
-        cx.spawn(async move |cx| crate::acp::connect(server_name, command, &root_dir, cx).await)
+    ) -> Task<Result<(Rc<dyn AgentConnection>, Option<task::SpawnInTerminal>)>> {
+        let name = self.name();
+        let root_dir = root_dir.map(|root_dir| root_dir.to_string_lossy().to_string());
+        let is_remote = delegate.project.read(cx).is_via_remote_server();
+        let store = delegate.store.downgrade();
+
+        cx.spawn(async move |cx| {
+            let (command, root_dir, login) = store
+                .update(cx, |store, cx| {
+                    let agent = store
+                        .get_external_agent(&ExternalAgentServerName(name.clone()))
+                        .with_context(|| {
+                            format!("Custom agent server `{}` is not registered", name)
+                        })?;
+                    anyhow::Ok(agent.get_command(
+                        root_dir.as_deref(),
+                        Default::default(),
+                        delegate.status_tx,
+                        delegate.new_version_available,
+                        &mut cx.to_async(),
+                    ))
+                })??
+                .await?;
+            let connection =
+                crate::acp::connect(name, command, root_dir.as_ref(), is_remote, cx).await?;
+            Ok((connection, login))
+        })
    }

    fn into_any(self: Rc<Self>) -> Rc<dyn std::any::Any> {
--- a/crates/agent_servers/src/e2e_tests.rs
+++ b/crates/agent_servers/src/e2e_tests.rs
@@ -1,12 +1,12 @@
 use crate::{AgentServer, AgentServerDelegate};
-#[cfg(test)]
-use crate::{AgentServerCommand, CustomAgentServerSettings};
 use acp_thread::{AcpThread, AgentThreadEntry, ToolCall, ToolCallStatus};
 use agent_client_protocol as acp;
 use futures::{FutureExt, StreamExt, channel::mpsc, select};
 use gpui::{AppContext, Entity, TestAppContext};
 use indoc::indoc;
-use project::{FakeFs, Project};
+#[cfg(test)]
+use project::agent_server_store::{AgentServerCommand, CustomAgentServerSettings};
+use project::{FakeFs, Project, agent_server_store::AllAgentServersSettings};
 use std::{
    path::{Path, PathBuf},
    sync::Arc,
@@ -449,7 +449,6 @@ pub use common_e2e_tests;
 // Helpers

 pub async fn init_test(cx: &mut TestAppContext) -> Arc<FakeFs> {
-    #[cfg(test)]
    use settings::Settings;

    env_logger::try_init().ok();
@@ -468,11 +467,11 @@ pub async fn init_test(cx: &mut TestAppContext) -> Arc<FakeFs> {
        language_model::init(client.clone(), cx);
        language_models::init(user_store, client, cx);
        agent_settings::init(cx);
-        crate::settings::init(cx);
+        AllAgentServersSettings::register(cx);

        #[cfg(test)]
-        crate::AllAgentServersSettings::override_global(
-            crate::AllAgentServersSettings {
+        AllAgentServersSettings::override_global(
+            AllAgentServersSettings {
                claude: Some(CustomAgentServerSettings {
                    command: AgentServerCommand {
                        path: "claude-code-acp".into(),
@@ -498,10 +497,11 @@ pub async fn new_test_thread(
    current_dir: impl AsRef<Path>,
    cx: &mut TestAppContext,
 ) -> Entity<AcpThread> {
-    let delegate = AgentServerDelegate::new(project.clone(), None, None);
+    let store = project.read_with(cx, |project, _| project.agent_server_store().clone());
+    let delegate = AgentServerDelegate::new(store, project.clone(), None, None);

-    let connection = cx
-        .update(|cx| server.connect(current_dir.as_ref(), delegate, cx))
+    let (connection, _) = cx
+        .update(|cx| server.connect(Some(current_dir.as_ref()), delegate, cx))
        .await
        .unwrap();

--- a/crates/agent_servers/src/gemini.rs
+++ b/crates/agent_servers/src/gemini.rs
@@ -1,21 +1,17 @@
 use std::rc::Rc;
 use std::{any::Any, path::Path};

-use crate::acp::AcpConnection;
 use crate::{AgentServer, AgentServerDelegate};
-use acp_thread::{AgentConnection, LoadError};
-use anyhow::Result;
-use gpui::{App, AppContext as _, SharedString, Task};
+use acp_thread::AgentConnection;
+use anyhow::{Context as _, Result};
+use collections::HashMap;
+use gpui::{App, SharedString, Task};
 use language_models::provider::google::GoogleLanguageModelProvider;
-use settings::SettingsStore;
-
-use crate::AllAgentServersSettings;
+use project::agent_server_store::GEMINI_NAME;

 #[derive(Clone)]
 pub struct Gemini;

-const ACP_ARG: &str = "--experimental-acp";
-
 impl AgentServer for Gemini {
    fn telemetry_id(&self) -> &'static str {
        "gemini-cli"
@@ -31,120 +27,37 @@ impl AgentServer for Gemini {

    fn connect(
        &self,
-        root_dir: &Path,
+        root_dir: Option<&Path>,
        delegate: AgentServerDelegate,
        cx: &mut App,
-    ) -> Task<Result<Rc<dyn AgentConnection>>> {
-        let root_dir = root_dir.to_path_buf();
-        let fs = delegate.project().read(cx).fs().clone();
-        let server_name = self.name();
-        let settings = cx.read_global(|settings: &SettingsStore, _| {
-            settings.get::<AllAgentServersSettings>(None).gemini.clone()
-        });
+    ) -> Task<Result<(Rc<dyn AgentConnection>, Option<task::SpawnInTerminal>)>> {
+        let name = self.name();
+        let root_dir = root_dir.map(|root_dir| root_dir.to_string_lossy().to_string());
+        let is_remote = delegate.project.read(cx).is_via_remote_server();
+        let store = delegate.store.downgrade();

        cx.spawn(async move |cx| {
-            let ignore_system_version = settings
-                .as_ref()
-                .and_then(|settings| settings.ignore_system_version)
-                .unwrap_or(true);
-            let mut command = if let Some(settings) = settings
-                && let Some(command) = settings.custom_command()
-            {
-                command
-            } else {
-                cx.update(|cx| {
-                    delegate.get_or_npm_install_builtin_agent(
-                        Self::BINARY_NAME.into(),
-                        Self::PACKAGE_NAME.into(),
-                        format!("node_modules/{}/dist/index.js", Self::PACKAGE_NAME).into(),
-                        ignore_system_version,
-                        Some(Self::MINIMUM_VERSION.parse().unwrap()),
-                        cx,
-                    )
-                })?
-                .await?
-            };
-            if !command.args.contains(&ACP_ARG.into()) {
-                command.args.push(ACP_ARG.into());
-            }
-
+            let mut extra_env = HashMap::default();
            if let Some(api_key) = cx.update(GoogleLanguageModelProvider::api_key)?.await.ok() {
-                command
-                    .env
-                    .get_or_insert_default()
-                    .insert("GEMINI_API_KEY".to_owned(), api_key.key);
+                extra_env.insert("GEMINI_API_KEY".into(), api_key.key);
            }
-
-            let root_dir_exists = fs.is_dir(&root_dir).await;
-            anyhow::ensure!(
-                root_dir_exists,
-                "Session root {} does not exist or is not a directory",
-                root_dir.to_string_lossy()
-            );
-
-            let result = crate::acp::connect(server_name, command.clone(), &root_dir, cx).await;
-            match &result {
-                Ok(connection) => {
-                    if let Some(connection) = connection.clone().downcast::<AcpConnection>()
-                        && !connection.prompt_capabilities().image
-                    {
-                        let version_output = util::command::new_smol_command(&command.path)
-                            .args(command.args.iter())
-                            .arg("--version")
-                            .kill_on_drop(true)
-                            .output()
-                            .await;
-                        let current_version =
-                            String::from_utf8(version_output?.stdout)?.trim().to_owned();
-
-                        log::error!("connected to gemini, but missing prompt_capabilities.image (version is {current_version})");
-                        return Err(LoadError::Unsupported {
-                            current_version: current_version.into(),
-                            command: (command.path.to_string_lossy().to_string() + " " + &command.args.join(" ")).into(),
-                            minimum_version: Self::MINIMUM_VERSION.into(),
-                        }
-                        .into());
-                    }
-                }
-                Err(e) => {
-                    let version_fut = util::command::new_smol_command(&command.path)
-                        .args(command.args.iter())
-                        .arg("--version")
-                        .kill_on_drop(true)
-                        .output();
-
-                    let help_fut = util::command::new_smol_command(&command.path)
-                        .args(command.args.iter())
-                        .arg("--help")
-                        .kill_on_drop(true)
-                        .output();
-
-                    let (version_output, help_output) =
-                        futures::future::join(version_fut, help_fut).await;
-                    let Some(version_output) = version_output.ok().and_then(|output| String::from_utf8(output.stdout).ok()) else {
-                        return result;
-                    };
-                    let Some((help_stdout, help_stderr)) = help_output.ok().and_then(|output| String::from_utf8(output.stdout).ok().zip(String::from_utf8(output.stderr).ok())) else  {
-                        return result;
-                    };
-
-                    let current_version = version_output.trim().to_string();
-                    let supported = help_stdout.contains(ACP_ARG) || current_version.parse::<semver::Version>().is_ok_and(|version| version >= Self::MINIMUM_VERSION.parse::<semver::Version>().unwrap());
-
-                    log::error!("failed to create ACP connection to gemini (version is {current_version}, supported: {supported}): {e}");
-                    log::debug!("gemini --help stdout: {help_stdout:?}");
-                    log::debug!("gemini --help stderr: {help_stderr:?}");
-                    if !supported {
-                        return Err(LoadError::Unsupported {
-                            current_version: current_version.into(),
-                            command: (command.path.to_string_lossy().to_string() + " " + &command.args.join(" ")).into(),
-                            minimum_version: Self::MINIMUM_VERSION.into(),
-                        }
-                        .into());
-                    }
-                }
-            }
-            result
+            let (command, root_dir, login) = store
+                .update(cx, |store, cx| {
+                    let agent = store
+                        .get_external_agent(&GEMINI_NAME.into())
+                        .context("Gemini CLI is not registered")?;
+                    anyhow::Ok(agent.get_command(
+                        root_dir.as_deref(),
+                        extra_env,
+                        delegate.status_tx,
+                        delegate.new_version_available,
+                        &mut cx.to_async(),
+                    ))
+                })??
+                .await?;
+            let connection =
+                crate::acp::connect(name, command, root_dir.as_ref(), is_remote, cx).await?;
+            Ok((connection, login))
        })
    }

@@ -153,18 +66,11 @@ impl AgentServer for Gemini {
    }
 }

-impl Gemini {
-    const PACKAGE_NAME: &str = "@google/gemini-cli";
-
-    const MINIMUM_VERSION: &str = "0.2.1";
-
-    const BINARY_NAME: &str = "gemini";
-}
-
 #[cfg(test)]
 pub(crate) mod tests {
+    use project::agent_server_store::AgentServerCommand;
+
    use super::*;
-    use crate::AgentServerCommand;
    use std::path::Path;

    crate::common_e2e_tests!(async |_, _, _| Gemini, allow_option_id = "proceed_once");
--- a/crates/agent_servers/src/settings.rs
+++ b/crates/agent_servers/src/settings.rs
@@ -1,111 +0,0 @@
-use std::path::PathBuf;
-
-use crate::AgentServerCommand;
-use anyhow::Result;
-use collections::HashMap;
-use gpui::{App, SharedString};
-use schemars::JsonSchema;
-use serde::{Deserialize, Serialize};
-use settings::{Settings, SettingsSources, SettingsUi};
-
-pub fn init(cx: &mut App) {
-    AllAgentServersSettings::register(cx);
-}
-
-#[derive(Default, Deserialize, Serialize, Clone, JsonSchema, Debug, SettingsUi)]
-pub struct AllAgentServersSettings {
-    pub gemini: Option<BuiltinAgentServerSettings>,
-    pub claude: Option<CustomAgentServerSettings>,
-
-    /// Custom agent servers configured by the user
-    #[serde(flatten)]
-    pub custom: HashMap<SharedString, CustomAgentServerSettings>,
-}
-
-#[derive(Default, Deserialize, Serialize, Clone, JsonSchema, Debug, PartialEq)]
-pub struct BuiltinAgentServerSettings {
-    /// Absolute path to a binary to be used when launching this agent.
-    ///
-    /// This can be used to run a specific binary without automatic downloads or searching `$PATH`.
-    #[serde(rename = "command")]
-    pub path: Option<PathBuf>,
-    /// If a binary is specified in `command`, it will be passed these arguments.
-    pub args: Option<Vec<String>>,
-    /// If a binary is specified in `command`, it will be passed these environment variables.
-    pub env: Option<HashMap<String, String>>,
-    /// Whether to skip searching `$PATH` for an agent server binary when
-    /// launching this agent.
-    ///
-    /// This has no effect if a `command` is specified. Otherwise, when this is
-    /// `false`, Zed will search `$PATH` for an agent server binary and, if one
-    /// is found, use it for threads with this agent. If no agent binary is
-    /// found on `$PATH`, Zed will automatically install and use its own binary.
-    /// When this is `true`, Zed will not search `$PATH`, and will always use
-    /// its own binary.
-    ///
-    /// Default: true
-    pub ignore_system_version: Option<bool>,
-}
-
-impl BuiltinAgentServerSettings {
-    pub(crate) fn custom_command(self) -> Option<AgentServerCommand> {
-        self.path.map(|path| AgentServerCommand {
-            path,
-            args: self.args.unwrap_or_default(),
-            env: self.env,
-        })
-    }
-}
-
-impl From<AgentServerCommand> for BuiltinAgentServerSettings {
-    fn from(value: AgentServerCommand) -> Self {
-        BuiltinAgentServerSettings {
-            path: Some(value.path),
-            args: Some(value.args),
-            env: value.env,
-            ..Default::default()
-        }
-    }
-}
-
-#[derive(Deserialize, Serialize, Clone, JsonSchema, Debug, PartialEq)]
-pub struct CustomAgentServerSettings {
-    #[serde(flatten)]
-    pub command: AgentServerCommand,
-}
-
-impl settings::Settings for AllAgentServersSettings {
-    const KEY: Option<&'static str> = Some("agent_servers");
-
-    type FileContent = Self;
-
-    fn load(sources: SettingsSources<Self::FileContent>, _: &mut App) -> Result<Self> {
-        let mut settings = AllAgentServersSettings::default();
-
-        for AllAgentServersSettings {
-            gemini,
-            claude,
-            custom,
-        } in sources.defaults_and_customizations()
-        {
-            if gemini.is_some() {
-                settings.gemini = gemini.clone();
-            }
-            if claude.is_some() {
-                settings.claude = claude.clone();
-            }
-
-            // Merge custom agents
-            for (name, config) in custom {
-                // Skip built-in agent names to avoid conflicts
-                if name != "gemini" && name != "claude" {
-                    settings.custom.insert(name.clone(), config.clone());
-                }
-            }
-        }
-
-        Ok(settings)
-    }
-
-    fn import_from_vscode(_vscode: &settings::VsCodeSettings, _current: &mut Self::FileContent) {}
-}
--- a/crates/agent_settings/src/agent_settings.rs
+++ b/crates/agent_settings/src/agent_settings.rs
@@ -8,7 +8,7 @@ use gpui::{App, Pixels, SharedString};
 use language_model::LanguageModel;
 use schemars::{JsonSchema, json_schema};
 use serde::{Deserialize, Serialize};
-use settings::{Settings, SettingsSources, SettingsUi};
+use settings::{Settings, SettingsKey, SettingsSources, SettingsUi};
 use std::borrow::Cow;

 pub use crate::agent_profile::*;
@@ -223,7 +223,8 @@ impl AgentSettingsContent {
    }
 }

-#[derive(Clone, Serialize, Deserialize, JsonSchema, Debug, Default, SettingsUi)]
+#[derive(Clone, Serialize, Deserialize, JsonSchema, Debug, Default, SettingsUi, SettingsKey)]
+#[settings_key(key = "agent", fallback_key = "assistant")]
 pub struct AgentSettingsContent {
    /// Whether the Agent is enabled.
    ///
@@ -399,10 +400,6 @@ pub struct ContextServerPresetContent {
 }

 impl Settings for AgentSettings {
-    const KEY: Option<&'static str> = Some("agent");
-
-    const FALLBACK_KEY: Option<&'static str> = Some("assistant");
-
    const PRESERVED_KEYS: Option<&'static [&'static str]> = Some(&["version"]);

    type FileContent = AgentSettingsContent;
--- a/crates/agent_ui/src/acp/completion_provider.rs
+++ b/crates/agent_ui/src/acp/completion_provider.rs
@@ -1025,43 +1025,31 @@ impl SlashCommandCompletion {
            return None;
        }

-        let last_command_start = line.rfind('/')?;
-        if last_command_start >= line.len() {
-            return Some(Self::default());
-        }
-        if last_command_start > 0
-            && line
-                .chars()
-                .nth(last_command_start - 1)
-                .is_some_and(|c| !c.is_whitespace())
+        let (prefix, last_command) = line.rsplit_once('/')?;
+        if prefix.chars().last().is_some_and(|c| !c.is_whitespace())
+            || last_command.starts_with(char::is_whitespace)
        {
            return None;
        }

-        let rest_of_line = &line[last_command_start + 1..];
-
-        let mut command = None;
        let mut argument = None;
-        let mut end = last_command_start + 1;
-
-        if let Some(command_text) = rest_of_line.split_whitespace().next() {
-            command = Some(command_text.to_string());
-            end += command_text.len();
-
-            // Find the start of arguments after the command
-            if let Some(args_start) =
-                rest_of_line[command_text.len()..].find(|c: char| !c.is_whitespace())
-            {
-                let args = &rest_of_line[command_text.len() + args_start..].trim_end();
-                if !args.is_empty() {
-                    argument = Some(args.to_string());
-                    end += args.len() + 1;
-                }
+        let mut command = None;
+        if let Some((command_text, args)) = last_command.split_once(char::is_whitespace) {
+            if !args.is_empty() {
+                argument = Some(args.trim_end().to_string());
            }
-        }
+            command = Some(command_text.to_string());
+        } else if !last_command.is_empty() {
+            command = Some(last_command.to_string());
+        };

        Some(Self {
-            source_range: last_command_start + offset_to_line..end + offset_to_line,
+            source_range: prefix.len() + offset_to_line
+                ..line
+                    .rfind(|c: char| !c.is_whitespace())
+                    .unwrap_or_else(|| line.len())
+                    + 1
+                    + offset_to_line,
            command,
            argument,
        })
@@ -1180,6 +1168,15 @@ mod tests {
            })
        );

+        assert_eq!(
+            SlashCommandCompletion::try_parse("/拿不到命令 拿不到命令 ", 0),
+            Some(SlashCommandCompletion {
+                source_range: 0..30,
+                command: Some("拿不到命令".to_string()),
+                argument: Some("拿不到命令".to_string()),
+            })
+        );
+
        assert_eq!(SlashCommandCompletion::try_parse("Lorem Ipsum", 0), None);

        assert_eq!(SlashCommandCompletion::try_parse("Lorem /", 0), None);
@@ -1187,6 +1184,8 @@ mod tests {
        assert_eq!(SlashCommandCompletion::try_parse("Lorem /help", 0), None);

        assert_eq!(SlashCommandCompletion::try_parse("Lorem/", 0), None);
+
+        assert_eq!(SlashCommandCompletion::try_parse("/ ", 0), None);
    }

    #[test]
--- a/crates/agent_ui/src/acp/entry_view_state.rs
+++ b/crates/agent_ui/src/acp/entry_view_state.rs
@@ -207,7 +207,7 @@ impl EntryViewState {
        self.entries.drain(range);
    }

-    pub fn settings_changed(&mut self, cx: &mut App) {
+    pub fn agent_font_size_changed(&mut self, cx: &mut App) {
        for entry in self.entries.iter() {
            match entry {
                Entry::UserMessage { .. } | Entry::AssistantMessage { .. } => {}
--- a/crates/agent_ui/src/acp/message_editor.rs
+++ b/crates/agent_ui/src/acp/message_editor.rs
@@ -493,14 +493,13 @@ impl MessageEditor {
        let Some(entry) = self.project.read(cx).entry_for_path(&project_path, cx) else {
            return Task::ready(Err(anyhow!("project entry not found")));
        };
-        let Some(worktree) = self.project.read(cx).worktree_for_entry(entry.id, cx) else {
+        let directory_path = entry.path.clone();
+        let worktree_id = project_path.worktree_id;
+        let Some(worktree) = self.project.read(cx).worktree_for_id(worktree_id, cx) else {
            return Task::ready(Err(anyhow!("worktree not found")));
        };
        let project = self.project.clone();
        cx.spawn(async move |_, cx| {
-            let directory_path = entry.path.clone();
-
-            let worktree_id = worktree.read_with(cx, |worktree, _| worktree.id())?;
            let file_paths = worktree.read_with(cx, |worktree, _cx| {
                collect_files_in_path(worktree, &directory_path)
            })?;
@@ -700,10 +699,15 @@ impl MessageEditor {
            self.project.read(cx).fs().clone(),
            self.history_store.clone(),
        ));
-        let delegate = AgentServerDelegate::new(self.project.clone(), None, None);
-        let connection = server.connect(Path::new(""), delegate, cx);
+        let delegate = AgentServerDelegate::new(
+            self.project.read(cx).agent_server_store().clone(),
+            self.project.clone(),
+            None,
+            None,
+        );
+        let connection = server.connect(None, delegate, cx);
        cx.spawn(async move |_, cx| {
-            let agent = connection.await?;
+            let (agent, _) = connection.await?;
            let agent = agent.downcast::<agent2::NativeAgentConnection>().unwrap();
            let summary = agent
                .0
--- a/crates/agent_ui/src/acp/model_selector.rs
+++ b/crates/agent_ui/src/acp/model_selector.rs
@@ -192,8 +192,10 @@ impl PickerDelegate for AcpModelPickerDelegate {
        }
    }

-    fn dismissed(&mut self, _: &mut Window, cx: &mut Context<Picker<Self>>) {
-        cx.emit(DismissEvent);
+    fn dismissed(&mut self, window: &mut Window, cx: &mut Context<Picker<Self>>) {
+        cx.defer_in(window, |picker, window, cx| {
+            picker.set_query("", window, cx);
+        });
    }

    fn render_match(
--- a/crates/agent_ui/src/acp/thread_view.rs
+++ b/crates/agent_ui/src/acp/thread_view.rs
@@ -6,7 +6,7 @@ use acp_thread::{
 use acp_thread::{AgentConnection, Plan};
 use action_log::ActionLog;
 use agent_client_protocol::{self as acp, PromptCapabilities};
-use agent_servers::{AgentServer, AgentServerDelegate, ClaudeCode};
+use agent_servers::{AgentServer, AgentServerDelegate};
 use agent_settings::{AgentProfileId, AgentSettings, CompletionMode, NotifyWhenAgentWaiting};
 use agent2::{DbThreadMetadata, HistoryEntry, HistoryEntryId, HistoryStore, NativeAgentServer};
 use anyhow::{Context as _, Result, anyhow, bail};
@@ -40,10 +40,9 @@ use std::path::Path;
 use std::sync::Arc;
 use std::time::Instant;
 use std::{collections::BTreeMap, rc::Rc, time::Duration};
-use task::SpawnInTerminal;
 use terminal_view::terminal_panel::TerminalPanel;
 use text::Anchor;
-use theme::ThemeSettings;
+use theme::{AgentFontSize, ThemeSettings};
 use ui::{
    Callout, CommonAnimationExt, Disclosure, Divider, DividerColor, ElevationIndex, KeyBinding,
    PopoverMenuHandle, Scrollbar, ScrollbarState, SpinnerLabel, TintColor, Tooltip, prelude::*,
@@ -263,6 +262,7 @@ pub struct AcpThreadView {
    workspace: WeakEntity<Workspace>,
    project: Entity<Project>,
    thread_state: ThreadState,
+    login: Option<task::SpawnInTerminal>,
    history_store: Entity<HistoryStore>,
    hovered_recent_history_item: Option<usize>,
    entry_view_state: Entity<EntryViewState>,
@@ -290,7 +290,7 @@ pub struct AcpThreadView {
    is_loading_contents: bool,
    new_server_version_available: Option<SharedString>,
    _cancel_task: Option<Task<()>>,
-    _subscriptions: [Subscription; 3],
+    _subscriptions: [Subscription; 4],
 }

 enum ThreadState {
@@ -380,7 +380,8 @@ impl AcpThreadView {
        });

        let subscriptions = [
-            cx.observe_global_in::<SettingsStore>(window, Self::settings_changed),
+            cx.observe_global_in::<SettingsStore>(window, Self::agent_font_size_changed),
+            cx.observe_global_in::<AgentFontSize>(window, Self::agent_font_size_changed),
            cx.subscribe_in(&message_editor, window, Self::handle_message_editor_event),
            cx.subscribe_in(&entry_view_state, window, Self::handle_entry_view_event),
        ];
@@ -391,6 +392,7 @@ impl AcpThreadView {
            project: project.clone(),
            entry_view_state,
            thread_state: Self::initial_state(agent, resume_thread, workspace, project, window, cx),
+            login: None,
            message_editor,
            model_selector: None,
            profile_selector: None,
@@ -443,9 +445,11 @@ impl AcpThreadView {
        window: &mut Window,
        cx: &mut Context<Self>,
    ) -> ThreadState {
-        if !project.read(cx).is_local() && agent.clone().downcast::<NativeAgentServer>().is_none() {
+        if project.read(cx).is_via_collab()
+            && agent.clone().downcast::<NativeAgentServer>().is_none()
+        {
            return ThreadState::LoadError(LoadError::Other(
-                "External agents are not yet supported for remote projects.".into(),
+                "External agents are not yet supported in shared projects.".into(),
            ));
        }
        let mut worktrees = project.read(cx).visible_worktrees(cx).collect::<Vec<_>>();
@@ -465,20 +469,23 @@ impl AcpThreadView {
                    Some(worktree.read(cx).abs_path())
                }
            })
-            .next()
-            .unwrap_or_else(|| paths::home_dir().as_path().into());
+            .next();
        let (status_tx, mut status_rx) = watch::channel("Loading…".into());
        let (new_version_available_tx, mut new_version_available_rx) = watch::channel(None);
        let delegate = AgentServerDelegate::new(
+            project.read(cx).agent_server_store().clone(),
            project.clone(),
            Some(status_tx),
            Some(new_version_available_tx),
        );

-        let connect_task = agent.connect(&root_dir, delegate, cx);
+        let connect_task = agent.connect(root_dir.as_deref(), delegate, cx);
        let load_task = cx.spawn_in(window, async move |this, cx| {
            let connection = match connect_task.await {
-                Ok(connection) => connection,
+                Ok((connection, login)) => {
+                    this.update(cx, |this, _| this.login = login).ok();
+                    connection
+                }
                Err(err) => {
                    this.update_in(cx, |this, window, cx| {
                        if err.downcast_ref::<LoadError>().is_some() {
@@ -505,6 +512,14 @@ impl AcpThreadView {
                })
                .log_err()
            } else {
+                let root_dir = if let Some(acp_agent) = connection
+                    .clone()
+                    .downcast::<agent_servers::AcpConnection>()
+                {
+                    acp_agent.root_dir().into()
+                } else {
+                    root_dir.unwrap_or(paths::home_dir().as_path().into())
+                };
                cx.update(|_, cx| {
                    connection
                        .clone()
@@ -983,7 +998,7 @@ impl AcpThreadView {
                    this,
                    AuthRequired {
                        description: None,
-                        provider_id: Some(language_model::ANTHROPIC_PROVIDER_ID),
+                        provider_id: None,
                    },
                    agent,
                    connection,
@@ -1461,9 +1476,12 @@ impl AcpThreadView {
        self.thread_error.take();
        configuration_view.take();
        pending_auth_method.replace(method.clone());
-        let authenticate = if method.0.as_ref() == "claude-login" {
+        let authenticate = if (method.0.as_ref() == "claude-login"
+            || method.0.as_ref() == "spawn-gemini-cli")
+            && let Some(login) = self.login.clone()
+        {
            if let Some(workspace) = self.workspace.upgrade() {
-                Self::spawn_claude_login(&workspace, window, cx)
+                Self::spawn_external_agent_login(login, workspace, false, window, cx)
            } else {
                Task::ready(Ok(()))
            }
@@ -1510,31 +1528,28 @@ impl AcpThreadView {
            }));
    }

-    fn spawn_claude_login(
-        workspace: &Entity<Workspace>,
+    fn spawn_external_agent_login(
+        login: task::SpawnInTerminal,
+        workspace: Entity<Workspace>,
+        previous_attempt: bool,
        window: &mut Window,
        cx: &mut App,
    ) -> Task<Result<()>> {
        let Some(terminal_panel) = workspace.read(cx).panel::<TerminalPanel>(cx) else {
            return Task::ready(Ok(()));
        };
-        let project_entity = workspace.read(cx).project();
-        let project = project_entity.read(cx);
-        let cwd = project.first_project_directory(cx);
-        let shell = project.terminal_settings(&cwd, cx).shell.clone();
-
-        let delegate = AgentServerDelegate::new(project_entity.clone(), None, None);
-        let command = ClaudeCode::login_command(delegate, cx);
+        let project = workspace.read(cx).project().clone();
+        let cwd = project.read(cx).first_project_directory(cx);
+        let shell = project.read(cx).terminal_settings(&cwd, cx).shell.clone();

        window.spawn(cx, async move |cx| {
-            let login_command = command.await?;
-            let command = login_command
-                .path
-                .to_str()
-                .with_context(|| format!("invalid login command: {:?}", login_command.path))?;
-            let command = shlex::try_quote(command)?;
-            let args = login_command
-                .arguments
+            let mut task = login.clone();
+            task.command = task
+                .command
+                .map(|command| anyhow::Ok(shlex::try_quote(&command)?.to_string()))
+                .transpose()?;
+            task.args = task
+                .args
                .iter()
                .map(|arg| {
                    Ok(shlex::try_quote(arg)
@@ -1542,26 +1557,16 @@ impl AcpThreadView {
                        .to_string())
                })
                .collect::<Result<Vec<_>>>()?;
+            task.full_label = task.label.clone();
+            task.id = task::TaskId(format!("external-agent-{}-login", task.label));
+            task.command_label = task.label.clone();
+            task.use_new_terminal = true;
+            task.allow_concurrent_runs = true;
+            task.hide = task::HideStrategy::Always;
+            task.shell = shell;

            let terminal = terminal_panel.update_in(cx, |terminal_panel, window, cx| {
-                terminal_panel.spawn_task(
-                    &SpawnInTerminal {
-                        id: task::TaskId("claude-login".into()),
-                        full_label: "claude /login".to_owned(),
-                        label: "claude /login".to_owned(),
-                        command: Some(command.into()),
-                        args,
-                        command_label: "claude /login".to_owned(),
-                        cwd,
-                        use_new_terminal: true,
-                        allow_concurrent_runs: true,
-                        hide: task::HideStrategy::Always,
-                        shell,
-                        ..Default::default()
-                    },
-                    window,
-                    cx,
-                )
+                terminal_panel.spawn_task(&login, window, cx)
            })?;

            let terminal = terminal.await?;
@@ -1577,7 +1582,9 @@ impl AcpThreadView {
                            cx.background_executor().timer(Duration::from_secs(1)).await;
                            let content =
                                terminal.update(cx, |terminal, _cx| terminal.get_content())?;
-                            if content.contains("Login successful") {
+                            if content.contains("Login successful")
+                                || content.contains("Type your message")
+                            {
                                return anyhow::Ok(());
                            }
                        }
@@ -1593,6 +1600,9 @@ impl AcpThreadView {
                    }
                }
                _ = exit_status => {
+                    if !previous_attempt && project.read_with(cx, |project, _| project.is_via_remote_server())? && login.label.contains("gemini") {
+                        return cx.update(|window, cx| Self::spawn_external_agent_login(login, workspace, true, window, cx))?.await
+                    }
                    return Err(anyhow!("exited before logging in"));
                }
            }
@@ -2023,35 +2033,34 @@ impl AcpThreadView {
        window: &Window,
        cx: &Context<Self>,
    ) -> Div {
+        let has_location = tool_call.locations.len() == 1;
        let card_header_id = SharedString::from("inner-tool-call-header");

-        let tool_icon =
-            if tool_call.kind == acp::ToolKind::Edit && tool_call.locations.len() == 1 {
-                FileIcons::get_icon(&tool_call.locations[0].path, cx)
-                    .map(Icon::from_path)
-                    .unwrap_or(Icon::new(IconName::ToolPencil))
-            } else {
-                Icon::new(match tool_call.kind {
-                    acp::ToolKind::Read => IconName::ToolSearch,
-                    acp::ToolKind::Edit => IconName::ToolPencil,
-                    acp::ToolKind::Delete => IconName::ToolDeleteFile,
-                    acp::ToolKind::Move => IconName::ArrowRightLeft,
-                    acp::ToolKind::Search => IconName::ToolSearch,
-                    acp::ToolKind::Execute => IconName::ToolTerminal,
-                    acp::ToolKind::Think => IconName::ToolThink,
-                    acp::ToolKind::Fetch => IconName::ToolWeb,
-                    acp::ToolKind::Other => IconName::ToolHammer,
-                })
-            }
-            .size(IconSize::Small)
-            .color(Color::Muted);
+        let tool_icon = if tool_call.kind == acp::ToolKind::Edit && has_location {
+            FileIcons::get_icon(&tool_call.locations[0].path, cx)
+                .map(Icon::from_path)
+                .unwrap_or(Icon::new(IconName::ToolPencil))
+        } else {
+            Icon::new(match tool_call.kind {
+                acp::ToolKind::Read => IconName::ToolSearch,
+                acp::ToolKind::Edit => IconName::ToolPencil,
+                acp::ToolKind::Delete => IconName::ToolDeleteFile,
+                acp::ToolKind::Move => IconName::ArrowRightLeft,
+                acp::ToolKind::Search => IconName::ToolSearch,
+                acp::ToolKind::Execute => IconName::ToolTerminal,
+                acp::ToolKind::Think => IconName::ToolThink,
+                acp::ToolKind::Fetch => IconName::ToolWeb,
+                acp::ToolKind::Other => IconName::ToolHammer,
+            })
+        }
+        .size(IconSize::Small)
+        .color(Color::Muted);

        let failed_or_canceled = match &tool_call.status {
            ToolCallStatus::Rejected | ToolCallStatus::Canceled | ToolCallStatus::Failed => true,
            _ => false,
        };

-        let has_location = tool_call.locations.len() == 1;
        let needs_confirmation = matches!(
            tool_call.status,
            ToolCallStatus::WaitingForConfirmation { .. }
@@ -2194,13 +2203,6 @@ impl AcpThreadView {
                            .overflow_hidden()
                            .child(tool_icon)
                            .child(if has_location {
-                                let name = tool_call.locations[0]
-                                    .path
-                                    .file_name()
-                                    .unwrap_or_default()
-                                    .display()
-                                    .to_string();
-
                                h_flex()
                                    .id(("open-tool-call-location", entry_ix))
                                    .w_full()
@@ -2211,7 +2213,13 @@ impl AcpThreadView {
                                            this.text_color(cx.theme().colors().text_muted)
                                        }
                                    })
-                                    .child(name)
+                                    .child(self.render_markdown(
+                                        tool_call.label.clone(),
+                                        MarkdownStyle {
+                                            prevent_mouse_interaction: true,
+                                            ..default_markdown_style(false, true, window, cx)
+                                        },
+                                    ))
                                    .tooltip(Tooltip::text("Jump to File"))
                                    .on_click(cx.listener(move |this, _, window, cx| {
                                        this.open_tool_call_location(entry_ix, 0, window, cx);
@@ -3010,6 +3018,8 @@ impl AcpThreadView {
        let show_description =
            configuration_view.is_none() && description.is_none() && pending_auth_method.is_none();

+        let auth_methods = connection.auth_methods();
+
        v_flex().flex_1().size_full().justify_end().child(
            v_flex()
                .p_2()
@@ -3040,21 +3050,23 @@ impl AcpThreadView {
                        .cloned()
                        .map(|view| div().w_full().child(view)),
                )
-                .when(
-                    show_description,
-                    |el| {
-                        el.child(
-                            Label::new(format!(
-                                "You are not currently authenticated with {}. Please choose one of the following options:",
-                                self.agent.name()
-                            ))
-                            .size(LabelSize::Small)
-                            .color(Color::Muted)
-                            .mb_1()
-                            .ml_5(),
-                        )
-                    },
-                )
+                .when(show_description, |el| {
+                    el.child(
+                        Label::new(format!(
+                            "You are not currently authenticated with {}.{}",
+                            self.agent.name(),
+                            if auth_methods.len() > 1 {
+                                " Please choose one of the following options:"
+                            } else {
+                                ""
+                            }
+                        ))
+                        .size(LabelSize::Small)
+                        .color(Color::Muted)
+                        .mb_1()
+                        .ml_5(),
+                    )
+                })
                .when_some(pending_auth_method, |el, _| {
                    el.child(
                        h_flex()
@@ -3066,12 +3078,12 @@ impl AcpThreadView {
                                Icon::new(IconName::ArrowCircle)
                                    .size(IconSize::Small)
                                    .color(Color::Muted)
-                                    .with_rotate_animation(2)
+                                    .with_rotate_animation(2),
                            )
                            .child(Label::new("Authenticating…").size(LabelSize::Small)),
                    )
                })
-                .when(!connection.auth_methods().is_empty(), |this| {
+                .when(!auth_methods.is_empty(), |this| {
                    this.child(
                        h_flex()
                            .justify_end()
@@ -3083,23 +3095,26 @@ impl AcpThreadView {
                                    .pt_2()
                                    .border_color(cx.theme().colors().border.opacity(0.8))
                            })
-                            .children(
-                                connection
-                                    .auth_methods()
-                                    .iter()
-                                    .enumerate()
-                                    .rev()
-                                    .map(|(ix, method)| {
-                                        Button::new(
-                                            SharedString::from(method.id.0.clone()),
-                                            method.name.clone(),
-                                        )
+                            .children(connection.auth_methods().iter().enumerate().rev().map(
+                                |(ix, method)| {
+                                    let (method_id, name) = if self
+                                        .project
+                                        .read(cx)
+                                        .is_via_remote_server()
+                                        && method.id.0.as_ref() == "oauth-personal"
+                                        && method.name == "Log in with Google"
+                                    {
+                                        ("spawn-gemini-cli".into(), "Log in with Gemini CLI".into())
+                                    } else {
+                                        (method.id.0.clone(), method.name.clone())
+                                    };
+
+                                    Button::new(SharedString::from(method_id.clone()), name)
                                        .when(ix == 0, |el| {
                                            el.style(ButtonStyle::Tinted(ui::TintColor::Warning))
                                        })
                                        .label_size(LabelSize::Small)
                                        .on_click({
-                                            let method_id = method.id.clone();
                                            cx.listener(move |this, _, window, cx| {
                                                telemetry::event!(
                                                    "Authenticate Agent Started",
@@ -3107,14 +3122,17 @@ impl AcpThreadView {
                                                    method = method_id
                                                );

-                                                this.authenticate(method_id.clone(), window, cx)
+                                                this.authenticate(
+                                                    acp::AuthMethodId(method_id.clone()),
+                                                    window,
+                                                    cx,
+                                                )
                                            })
                                        })
-                                    }),
-                            ),
+                                },
+                            )),
                    )
-                })
-
+                }),
        )
    }

@@ -4071,15 +4089,15 @@ impl AcpThreadView {
                MentionUri::PastedImage => {}
                MentionUri::Directory { abs_path } => {
                    let project = workspace.project();
-                    let Some(entry) = project.update(cx, |project, cx| {
+                    let Some(entry_id) = project.update(cx, |project, cx| {
                        let path = project.find_project_path(abs_path, cx)?;
-                        project.entry_for_path(&path, cx)
+                        project.entry_for_path(&path, cx).map(|entry| entry.id)
                    }) else {
                        return;
                    };

                    project.update(cx, |_, cx| {
-                        cx.emit(project::Event::RevealInProjectPanel(entry.id));
+                        cx.emit(project::Event::RevealInProjectPanel(entry_id));
                    });
                }
                MentionUri::Symbol {
@@ -4092,11 +4110,9 @@ impl AcpThreadView {
                    line_range,
                } => {
                    let project = workspace.project();
-                    let Some((path, _)) = project.update(cx, |project, cx| {
-                        let path = project.find_project_path(path, cx)?;
-                        let entry = project.entry_for_path(&path, cx)?;
-                        Some((path, entry))
-                    }) else {
+                    let Some(path) =
+                        project.update(cx, |project, cx| project.find_project_path(path, cx))
+                    else {
                        return;
                    };

@@ -4258,7 +4274,7 @@ impl AcpThreadView {
                }

                let buffer = project.update(cx, |project, cx| {
-                    project.create_local_buffer(&markdown, Some(markdown_language), cx)
+                    project.create_local_buffer(&markdown, Some(markdown_language), true, cx)
                });
                let buffer = cx.new(|cx| {
                    MultiBuffer::singleton(buffer, cx).with_title(thread_summary.clone())
@@ -4737,9 +4753,9 @@ impl AcpThreadView {
        )
    }

-    fn settings_changed(&mut self, _window: &mut Window, cx: &mut Context<Self>) {
+    fn agent_font_size_changed(&mut self, _window: &mut Window, cx: &mut Context<Self>) {
        self.entry_view_state.update(cx, |entry_view_state, cx| {
-            entry_view_state.settings_changed(cx);
+            entry_view_state.agent_font_size_changed(cx);
        });
    }

@@ -5715,11 +5731,11 @@ pub(crate) mod tests {

        fn connect(
            &self,
-            _root_dir: &Path,
+            _root_dir: Option<&Path>,
            _delegate: AgentServerDelegate,
            _cx: &mut App,
-        ) -> Task<gpui::Result<Rc<dyn AgentConnection>>> {
-            Task::ready(Ok(Rc::new(self.connection.clone())))
+        ) -> Task<gpui::Result<(Rc<dyn AgentConnection>, Option<task::SpawnInTerminal>)>> {
+            Task::ready(Ok((Rc::new(self.connection.clone()), None)))
        }

        fn into_any(self: Rc<Self>) -> Rc<dyn Any> {
--- a/crates/agent_ui/src/active_thread.rs
+++ b/crates/agent_ui/src/active_thread.rs
@@ -3585,7 +3585,7 @@ pub(crate) fn open_active_thread_as_markdown(
            }

            let buffer = project.update(cx, |project, cx| {
-                project.create_local_buffer(&markdown, Some(markdown_language), cx)
+                project.create_local_buffer(&markdown, Some(markdown_language), true, cx)
            });
            let buffer =
                cx.new(|cx| MultiBuffer::singleton(buffer, cx).with_title(thread_summary.clone()));
--- a/crates/agent_ui/src/agent_configuration.rs
+++ b/crates/agent_ui/src/agent_configuration.rs
@@ -5,7 +5,6 @@ mod tool_picker;

 use std::{ops::Range, sync::Arc};

-use agent_servers::{AgentServerCommand, AllAgentServersSettings, CustomAgentServerSettings};
 use agent_settings::AgentSettings;
 use anyhow::Result;
 use assistant_tool::{ToolSource, ToolWorkingSet};
@@ -26,6 +25,10 @@ use language_model::{
 };
 use notifications::status_toast::{StatusToast, ToastIcon};
 use project::{
+    agent_server_store::{
+        AgentServerCommand, AgentServerStore, AllAgentServersSettings, CLAUDE_CODE_NAME,
+        CustomAgentServerSettings, GEMINI_NAME,
+    },
    context_server_store::{ContextServerConfiguration, ContextServerStatus, ContextServerStore},
    project_settings::{ContextServerSettings, ProjectSettings},
 };
@@ -45,11 +48,13 @@ pub(crate) use manage_profiles_modal::ManageProfilesModal;
 use crate::{
    AddContextServer, ExternalAgent, NewExternalAgentThread,
    agent_configuration::add_llm_provider_modal::{AddLlmProviderModal, LlmCompatibleProvider},
+    placeholder_command,
 };

 pub struct AgentConfiguration {
    fs: Arc<dyn Fs>,
    language_registry: Arc<LanguageRegistry>,
+    agent_server_store: Entity<AgentServerStore>,
    workspace: WeakEntity<Workspace>,
    focus_handle: FocusHandle,
    configuration_views_by_provider: HashMap<LanguageModelProviderId, AnyView>,
@@ -66,6 +71,7 @@ pub struct AgentConfiguration {
 impl AgentConfiguration {
    pub fn new(
        fs: Arc<dyn Fs>,
+        agent_server_store: Entity<AgentServerStore>,
        context_server_store: Entity<ContextServerStore>,
        tools: Entity<ToolWorkingSet>,
        language_registry: Arc<LanguageRegistry>,
@@ -104,6 +110,7 @@ impl AgentConfiguration {
            workspace,
            focus_handle,
            configuration_views_by_provider: HashMap::default(),
+            agent_server_store,
            context_server_store,
            expanded_context_server_tools: HashMap::default(),
            expanded_provider_configurations: HashMap::default(),
@@ -991,17 +998,30 @@ impl AgentConfiguration {
    }

    fn render_agent_servers_section(&mut self, cx: &mut Context<Self>) -> impl IntoElement {
-        let settings = AllAgentServersSettings::get_global(cx).clone();
-        let user_defined_agents = settings
+        let custom_settings = cx
+            .global::<SettingsStore>()
+            .get::<AllAgentServersSettings>(None)
            .custom
-            .iter()
-            .map(|(name, settings)| {
+            .clone();
+        let user_defined_agents = self
+            .agent_server_store
+            .read(cx)
+            .external_agents()
+            .filter(|name| name.0 != GEMINI_NAME && name.0 != CLAUDE_CODE_NAME)
+            .cloned()
+            .collect::<Vec<_>>();
+        let user_defined_agents = user_defined_agents
+            .into_iter()
+            .map(|name| {
                self.render_agent_server(
                    IconName::Ai,
                    name.clone(),
                    ExternalAgent::Custom {
-                        name: name.clone(),
-                        command: settings.command.clone(),
+                        name: name.clone().into(),
+                        command: custom_settings
+                            .get(&name.0)
+                            .map(|settings| settings.command.clone())
+                            .unwrap_or(placeholder_command()),
                    },
                    cx,
                )
--- a/crates/agent_ui/src/agent_configuration/configure_context_server_modal.rs
+++ b/crates/agent_ui/src/agent_configuration/configure_context_server_modal.rs
@@ -251,6 +251,7 @@ pub struct ConfigureContextServerModal {
    workspace: WeakEntity<Workspace>,
    source: ConfigurationSource,
    state: State,
+    original_server_id: Option<ContextServerId>,
 }

 impl ConfigureContextServerModal {
@@ -348,6 +349,11 @@ impl ConfigureContextServerModal {
                    context_server_store,
                    workspace: workspace_handle,
                    state: State::Idle,
+                    original_server_id: match &target {
+                        ConfigurationTarget::Existing { id, .. } => Some(id.clone()),
+                        ConfigurationTarget::Extension { id, .. } => Some(id.clone()),
+                        ConfigurationTarget::New => None,
+                    },
                    source: ConfigurationSource::from_target(
                        target,
                        language_registry,
@@ -415,9 +421,19 @@ impl ConfigureContextServerModal {
            // When we write the settings to the file, the context server will be restarted.
            workspace.update(cx, |workspace, cx| {
                let fs = workspace.app_state().fs.clone();
-                update_settings_file::<ProjectSettings>(fs.clone(), cx, |project_settings, _| {
-                    project_settings.context_servers.insert(id.0, settings);
-                });
+                let original_server_id = self.original_server_id.clone();
+                update_settings_file::<ProjectSettings>(
+                    fs.clone(),
+                    cx,
+                    move |project_settings, _| {
+                        if let Some(original_id) = original_server_id {
+                            if original_id != id {
+                                project_settings.context_servers.remove(&original_id.0);
+                            }
+                        }
+                        project_settings.context_servers.insert(id.0, settings);
+                    },
+                );
            });
        } else if let Some(existing_server) = existing_server {
            self.context_server_store
--- a/crates/agent_ui/src/agent_panel.rs
+++ b/crates/agent_ui/src/agent_panel.rs
@@ -5,9 +5,11 @@ use std::sync::Arc;
 use std::time::Duration;

 use acp_thread::AcpThread;
-use agent_servers::AgentServerCommand;
 use agent2::{DbThreadMetadata, HistoryEntry};
 use db::kvp::{Dismissable, KEY_VALUE_STORE};
+use project::agent_server_store::{
+    AgentServerCommand, AllAgentServersSettings, CLAUDE_CODE_NAME, GEMINI_NAME,
+};
 use serde::{Deserialize, Serialize};
 use zed_actions::OpenBrowser;
 use zed_actions::agent::{OpenClaudeCodeOnboardingModal, ReauthenticateAgent};
@@ -33,7 +35,9 @@ use crate::{
    thread_history::{HistoryEntryElement, ThreadHistory},
    ui::{AgentOnboardingModal, EndTrialUpsell},
 };
-use crate::{ExternalAgent, NewExternalAgentThread, NewNativeAgentThreadFromSummary};
+use crate::{
+    ExternalAgent, NewExternalAgentThread, NewNativeAgentThreadFromSummary, placeholder_command,
+};
 use agent::{
    Thread, ThreadError, ThreadEvent, ThreadId, ThreadSummary, TokenUsageRatio,
    context_store::ContextStore,
@@ -62,7 +66,7 @@ use project::{DisableAiSettings, Project, ProjectPath, Worktree};
 use prompt_store::{PromptBuilder, PromptStore, UserPromptId};
 use rules_library::{RulesLibrary, open_rules_library};
 use search::{BufferSearchBar, buffer_search};
-use settings::{Settings, update_settings_file};
+use settings::{Settings, SettingsStore, update_settings_file};
 use theme::ThemeSettings;
 use time::UtcOffset;
 use ui::utils::WithRemSize;
@@ -1094,7 +1098,7 @@ impl AgentPanel {
        let workspace = self.workspace.clone();
        let project = self.project.clone();
        let fs = self.fs.clone();
-        let is_not_local = !self.project.read(cx).is_local();
+        let is_via_collab = self.project.read(cx).is_via_collab();

        const LAST_USED_EXTERNAL_AGENT_KEY: &str = "agent_panel__last_used_external_agent";

@@ -1126,7 +1130,7 @@ impl AgentPanel {
                    agent
                }
                None => {
-                    if is_not_local {
+                    if is_via_collab {
                        ExternalAgent::NativeAgent
                    } else {
                        cx.background_spawn(async move {
@@ -1503,6 +1507,7 @@ impl AgentPanel {
    }

    pub(crate) fn open_configuration(&mut self, window: &mut Window, cx: &mut Context<Self>) {
+        let agent_server_store = self.project.read(cx).agent_server_store().clone();
        let context_server_store = self.project.read(cx).context_server_store();
        let tools = self.thread_store.read(cx).tools();
        let fs = self.fs.clone();
@@ -1511,6 +1516,7 @@ impl AgentPanel {
        self.configuration = Some(cx.new(|cx| {
            AgentConfiguration::new(
                fs,
+                agent_server_store,
                context_server_store,
                tools,
                self.language_registry.clone(),
@@ -2503,6 +2509,7 @@ impl AgentPanel {
    }

    fn render_toolbar_new(&self, window: &mut Window, cx: &mut Context<Self>) -> impl IntoElement {
+        let agent_server_store = self.project.read(cx).agent_server_store().clone();
        let focus_handle = self.focus_handle(cx);

        let active_thread = match &self.active_view {
@@ -2535,8 +2542,10 @@ impl AgentPanel {
            .with_handle(self.new_thread_menu_handle.clone())
            .menu({
                let workspace = self.workspace.clone();
-                let is_not_local = workspace
-                    .update(cx, |workspace, cx| !workspace.project().read(cx).is_local())
+                let is_via_collab = workspace
+                    .update(cx, |workspace, cx| {
+                        workspace.project().read(cx).is_via_collab()
+                    })
                    .unwrap_or_default();

                move |window, cx| {
@@ -2628,7 +2637,7 @@ impl AgentPanel {
                                    ContextMenuEntry::new("New Gemini CLI Thread")
                                        .icon(IconName::AiGemini)
                                        .icon_color(Color::Muted)
-                                        .disabled(is_not_local)
+                                        .disabled(is_via_collab)
                                        .handler({
                                            let workspace = workspace.clone();
                                            move |window, cx| {
@@ -2655,7 +2664,7 @@ impl AgentPanel {
                                menu.item(
                                    ContextMenuEntry::new("New Claude Code Thread")
                                        .icon(IconName::AiClaude)
-                                        .disabled(is_not_local)
+                                        .disabled(is_via_collab)
                                        .icon_color(Color::Muted)
                                        .handler({
                                            let workspace = workspace.clone();
@@ -2680,19 +2689,25 @@ impl AgentPanel {
                                )
                            })
                            .when(cx.has_flag::<GeminiAndNativeFeatureFlag>(), |mut menu| {
-                                // Add custom agents from settings
-                                let settings =
-                                    agent_servers::AllAgentServersSettings::get_global(cx);
-                                for (agent_name, agent_settings) in &settings.custom {
+                                let agent_names = agent_server_store
+                                    .read(cx)
+                                    .external_agents()
+                                    .filter(|name| {
+                                        name.0 != GEMINI_NAME && name.0 != CLAUDE_CODE_NAME
+                                    })
+                                    .cloned()
+                                    .collect::<Vec<_>>();
+                                let custom_settings = cx.global::<SettingsStore>().get::<AllAgentServersSettings>(None).custom.clone();
+                                for agent_name in agent_names {
                                    menu = menu.item(
                                        ContextMenuEntry::new(format!("New {} Thread", agent_name))
                                            .icon(IconName::Terminal)
                                            .icon_color(Color::Muted)
-                                            .disabled(is_not_local)
+                                            .disabled(is_via_collab)
                                            .handler({
                                                let workspace = workspace.clone();
                                                let agent_name = agent_name.clone();
-                                                let agent_settings = agent_settings.clone();
+                                                let custom_settings = custom_settings.clone();
                                                move |window, cx| {
                                                    if let Some(workspace) = workspace.upgrade() {
                                                        workspace.update(cx, |workspace, cx| {
@@ -2703,10 +2718,9 @@ impl AgentPanel {
                                                                    panel.new_agent_thread(
                                                                        AgentType::Custom {
                                                                            name: agent_name
-                                                                                .clone(),
-                                                                            command: agent_settings
-                                                                                .command
-                                                                                .clone(),
+                                                                                .clone()
+                                                                                .into(),
+                                                                            command: custom_settings.get(&agent_name.0).map(|settings| settings.command.clone()).unwrap_or(placeholder_command())
                                                                        },
                                                                        window,
                                                                        cx,
--- a/crates/agent_ui/src/agent_ui.rs
+++ b/crates/agent_ui/src/agent_ui.rs
@@ -28,7 +28,6 @@ use std::rc::Rc;
 use std::sync::Arc;

 use agent::{Thread, ThreadId};
-use agent_servers::AgentServerCommand;
 use agent_settings::{AgentProfileId, AgentSettings, LanguageModelSelection};
 use assistant_slash_command::SlashCommandRegistry;
 use client::Client;
@@ -41,6 +40,7 @@ use language_model::{
    ConfiguredModel, LanguageModel, LanguageModelId, LanguageModelProviderId, LanguageModelRegistry,
 };
 use project::DisableAiSettings;
+use project::agent_server_store::AgentServerCommand;
 use prompt_store::PromptBuilder;
 use schemars::JsonSchema;
 use serde::{Deserialize, Serialize};
@@ -174,6 +174,14 @@ enum ExternalAgent {
    },
 }

+fn placeholder_command() -> AgentServerCommand {
+    AgentServerCommand {
+        path: "/placeholder".into(),
+        args: vec![],
+        env: None,
+    }
+}
+
 impl ExternalAgent {
    fn name(&self) -> &'static str {
        match self {
@@ -193,10 +201,9 @@ impl ExternalAgent {
            Self::Gemini => Rc::new(agent_servers::Gemini),
            Self::ClaudeCode => Rc::new(agent_servers::ClaudeCode),
            Self::NativeAgent => Rc::new(agent2::NativeAgentServer::new(fs, history)),
-            Self::Custom { name, command } => Rc::new(agent_servers::CustomAgentServer::new(
-                name.clone(),
-                command.clone(),
-            )),
+            Self::Custom { name, command: _ } => {
+                Rc::new(agent_servers::CustomAgentServer::new(name.clone()))
+            }
        }
    }
 }
@@ -337,8 +344,7 @@ fn update_command_palette_filter(cx: &mut App) {
            ];
            filter.show_action_types(edit_prediction_actions.iter());

-            filter
-                .show_action_types([TypeId::of::<zed_actions::OpenZedPredictOnboarding>()].iter());
+            filter.show_action_types(&[TypeId::of::<zed_actions::OpenZedPredictOnboarding>()]);
        }
    });
 }
--- a/crates/agent_ui/src/buffer_codegen.rs
+++ b/crates/agent_ui/src/buffer_codegen.rs
@@ -1139,7 +1139,7 @@ mod tests {
        );
        while !new_text.is_empty() {
            let max_len = cmp::min(new_text.len(), 10);
-            let len = rng.gen_range(1..=max_len);
+            let len = rng.random_range(1..=max_len);
            let (chunk, suffix) = new_text.split_at(len);
            chunks_tx.unbounded_send(chunk.to_string()).unwrap();
            new_text = suffix;
@@ -1208,7 +1208,7 @@ mod tests {
        );
        while !new_text.is_empty() {
            let max_len = cmp::min(new_text.len(), 10);
-            let len = rng.gen_range(1..=max_len);
+            let len = rng.random_range(1..=max_len);
            let (chunk, suffix) = new_text.split_at(len);
            chunks_tx.unbounded_send(chunk.to_string()).unwrap();
            new_text = suffix;
@@ -1277,7 +1277,7 @@ mod tests {
        );
        while !new_text.is_empty() {
            let max_len = cmp::min(new_text.len(), 10);
-            let len = rng.gen_range(1..=max_len);
+            let len = rng.random_range(1..=max_len);
            let (chunk, suffix) = new_text.split_at(len);
            chunks_tx.unbounded_send(chunk.to_string()).unwrap();
            new_text = suffix;
--- a/crates/agent_ui/src/context_picker.rs
+++ b/crates/agent_ui/src/context_picker.rs
@@ -987,7 +987,8 @@ impl MentionLink {
                    .read(cx)
                    .project()
                    .read(cx)
-                    .entry_for_path(&project_path, cx)?;
+                    .entry_for_path(&project_path, cx)?
+                    .clone();
                Some(MentionLink::File(project_path, entry))
            }
            Self::SYMBOL => {
--- a/crates/agent_ui/src/message_editor.rs
+++ b/crates/agent_ui/src/message_editor.rs
@@ -125,6 +125,7 @@ pub(crate) fn create_editor(
            cx,
        );
        editor.set_placeholder_text("Message the agent – @ to include context", cx);
+        editor.disable_word_completions();
        editor.set_show_indent_guides(false, cx);
        editor.set_soft_wrap();
        editor.set_use_modal_editing(true);
--- a/crates/agent_ui/src/slash_command_settings.rs
+++ b/crates/agent_ui/src/slash_command_settings.rs
@@ -2,10 +2,11 @@ use anyhow::Result;
 use gpui::App;
 use schemars::JsonSchema;
 use serde::{Deserialize, Serialize};
-use settings::{Settings, SettingsSources, SettingsUi};
+use settings::{Settings, SettingsKey, SettingsSources, SettingsUi};

 /// Settings for slash commands.
-#[derive(Deserialize, Serialize, Debug, Default, Clone, JsonSchema, SettingsUi)]
+#[derive(Deserialize, Serialize, Debug, Default, Clone, JsonSchema, SettingsUi, SettingsKey)]
+#[settings_key(key = "slash_commands")]
 pub struct SlashCommandSettings {
    /// Settings for the `/cargo-workspace` slash command.
    #[serde(default)]
@@ -21,8 +22,6 @@ pub struct CargoWorkspaceCommandSettings {
 }

 impl Settings for SlashCommandSettings {
-    const KEY: Option<&'static str> = Some("slash_commands");
-
    type FileContent = Self;

    fn load(sources: SettingsSources<Self::FileContent>, _cx: &mut App) -> Result<Self> {
--- a/crates/assistant_context/src/assistant_context_tests.rs
+++ b/crates/assistant_context/src/assistant_context_tests.rs
@@ -764,7 +764,7 @@ async fn test_random_context_collaboration(cx: &mut TestAppContext, mut rng: Std
    let network = Arc::new(Mutex::new(Network::new(rng.clone())));
    let mut contexts = Vec::new();

-    let num_peers = rng.gen_range(min_peers..=max_peers);
+    let num_peers = rng.random_range(min_peers..=max_peers);
    let context_id = ContextId::new();
    let prompt_builder = Arc::new(PromptBuilder::new(None).unwrap());
    for i in 0..num_peers {
@@ -806,10 +806,10 @@ async fn test_random_context_collaboration(cx: &mut TestAppContext, mut rng: Std
        || !network.lock().is_idle()
        || network.lock().contains_disconnected_peers()
    {
-        let context_index = rng.gen_range(0..contexts.len());
+        let context_index = rng.random_range(0..contexts.len());
        let context = &contexts[context_index];

-        match rng.gen_range(0..100) {
+        match rng.random_range(0..100) {
            0..=29 if mutation_count > 0 => {
                log::info!("Context {}: edit buffer", context_index);
                context.update(cx, |context, cx| {
@@ -874,10 +874,10 @@ async fn test_random_context_collaboration(cx: &mut TestAppContext, mut rng: Std
                        merge_same_roles: true,
                    })];

-                    let num_sections = rng.gen_range(0..=3);
+                    let num_sections = rng.random_range(0..=3);
                    let mut section_start = 0;
                    for _ in 0..num_sections {
-                        let mut section_end = rng.gen_range(section_start..=output_text.len());
+                        let mut section_end = rng.random_range(section_start..=output_text.len());
                        while !output_text.is_char_boundary(section_end) {
                            section_end += 1;
                        }
@@ -924,7 +924,7 @@ async fn test_random_context_collaboration(cx: &mut TestAppContext, mut rng: Std
            75..=84 if mutation_count > 0 => {
                context.update(cx, |context, cx| {
                    if let Some(message) = context.messages(cx).choose(&mut rng) {
-                        let new_status = match rng.gen_range(0..3) {
+                        let new_status = match rng.random_range(0..3) {
                            0 => MessageStatus::Done,
                            1 => MessageStatus::Pending,
                            _ => MessageStatus::Error(SharedString::from("Random error")),
@@ -971,7 +971,7 @@ async fn test_random_context_collaboration(cx: &mut TestAppContext, mut rng: Std

                    network.lock().broadcast(replica_id, ops_to_send);
                    context.update(cx, |context, cx| context.apply_ops(ops_to_receive, cx));
-                } else if rng.gen_bool(0.1) && replica_id != 0 {
+                } else if rng.random_bool(0.1) && replica_id != 0 {
                    log::info!("Context {}: disconnecting", context_index);
                    network.lock().disconnect_peer(replica_id);
                } else if network.lock().has_unreceived(replica_id) {
--- a/crates/assistant_tools/src/edit_agent.rs
+++ b/crates/assistant_tools/src/edit_agent.rs
@@ -1315,17 +1315,17 @@ mod tests {

    #[gpui::test(iterations = 100)]
    async fn test_random_indents(mut rng: StdRng) {
-        let len = rng.gen_range(1..=100);
+        let len = rng.random_range(1..=100);
        let new_text = util::RandomCharIter::new(&mut rng)
            .with_simple_text()
            .take(len)
            .collect::<String>();
        let new_text = new_text
            .split('\n')
-            .map(|line| format!("{}{}", " ".repeat(rng.gen_range(0..=8)), line))
+            .map(|line| format!("{}{}", " ".repeat(rng.random_range(0..=8)), line))
            .collect::<Vec<_>>()
            .join("\n");
-        let delta = IndentDelta::Spaces(rng.gen_range(-4..=4));
+        let delta = IndentDelta::Spaces(rng.random_range(-4i8..=4i8) as isize);

        let chunks = to_random_chunks(&mut rng, &new_text);
        let new_text_chunks = stream::iter(chunks.iter().enumerate().map(|(index, chunk)| {
@@ -1357,7 +1357,7 @@ mod tests {
    }

    fn to_random_chunks(rng: &mut StdRng, input: &str) -> Vec<String> {
-        let chunk_count = rng.gen_range(1..=cmp::min(input.len(), 50));
+        let chunk_count = rng.random_range(1..=cmp::min(input.len(), 50));
        let mut chunk_indices = (0..input.len()).choose_multiple(rng, chunk_count);
        chunk_indices.sort();
        chunk_indices.push(input.len());
--- a/crates/assistant_tools/src/edit_agent/create_file_parser.rs
+++ b/crates/assistant_tools/src/edit_agent/create_file_parser.rs
@@ -204,7 +204,7 @@ mod tests {
    }

    fn parse_random_chunks(input: &str, parser: &mut CreateFileParser, rng: &mut StdRng) -> String {
-        let chunk_count = rng.gen_range(1..=cmp::min(input.len(), 50));
+        let chunk_count = rng.random_range(1..=cmp::min(input.len(), 50));
        let mut chunk_indices = (0..input.len()).choose_multiple(rng, chunk_count);
        chunk_indices.sort();
        chunk_indices.push(input.len());
--- a/crates/assistant_tools/src/edit_agent/edit_parser.rs
+++ b/crates/assistant_tools/src/edit_agent/edit_parser.rs
@@ -996,7 +996,7 @@ mod tests {
    }

    fn parse_random_chunks(input: &str, parser: &mut EditParser, rng: &mut StdRng) -> Vec<Edit> {
-        let chunk_count = rng.gen_range(1..=cmp::min(input.len(), 50));
+        let chunk_count = rng.random_range(1..=cmp::min(input.len(), 50));
        let mut chunk_indices = (0..input.len()).choose_multiple(rng, chunk_count);
        chunk_indices.sort();
        chunk_indices.push(input.len());
--- a/crates/assistant_tools/src/edit_agent/evals.rs
+++ b/crates/assistant_tools/src/edit_agent/evals.rs
@@ -1399,7 +1399,7 @@ fn eval(
 }

 fn run_eval(eval: EvalInput, tx: mpsc::Sender<Result<EvalOutput>>) {
-    let dispatcher = gpui::TestDispatcher::new(StdRng::from_entropy());
+    let dispatcher = gpui::TestDispatcher::new(StdRng::from_os_rng());
    let mut cx = TestAppContext::build(dispatcher, None);
    let output = cx.executor().block_test(async {
        let test = EditAgentTest::new(&mut cx).await;
@@ -1707,7 +1707,7 @@ async fn retry_on_rate_limit<R>(mut request: impl AsyncFnMut() -> Result<R>) ->
        };

        if let Some(retry_after) = retry_delay {
-            let jitter = retry_after.mul_f64(rand::thread_rng().gen_range(0.0..1.0));
+            let jitter = retry_after.mul_f64(rand::rng().random_range(0.0..1.0));
            eprintln!("Attempt #{attempt}: Retry after {retry_after:?} + jitter of {jitter:?}");
            Timer::after(retry_after + jitter).await;
        } else {
--- a/crates/assistant_tools/src/edit_agent/streaming_fuzzy_matcher.rs
+++ b/crates/assistant_tools/src/edit_agent/streaming_fuzzy_matcher.rs
@@ -771,7 +771,7 @@ mod tests {
    }

    fn to_random_chunks(rng: &mut StdRng, input: &str) -> Vec<String> {
-        let chunk_count = rng.gen_range(1..=cmp::min(input.len(), 50));
+        let chunk_count = rng.random_range(1..=cmp::min(input.len(), 50));
        let mut chunk_indices = (0..input.len()).choose_multiple(rng, chunk_count);
        chunk_indices.sort();
        chunk_indices.push(input.len());
--- a/crates/audio/src/audio_settings.rs
+++ b/crates/audio/src/audio_settings.rs
@@ -2,9 +2,9 @@ use anyhow::Result;
 use gpui::App;
 use schemars::JsonSchema;
 use serde::{Deserialize, Serialize};
-use settings::{Settings, SettingsSources, SettingsUi};
+use settings::{Settings, SettingsKey, SettingsSources, SettingsUi};

-#[derive(Clone, Default, Serialize, Deserialize, JsonSchema, Debug)]
+#[derive(Clone, Default, Serialize, Deserialize, JsonSchema, Debug, SettingsUi)]
 pub struct AudioSettings {
    /// Opt into the new audio system.
    #[serde(rename = "experimental.rodio_audio", default)]
@@ -12,8 +12,9 @@ pub struct AudioSettings {
 }

 /// Configuration of audio in Zed.
-#[derive(Clone, Default, Serialize, Deserialize, JsonSchema, Debug, SettingsUi)]
+#[derive(Clone, Default, Serialize, Deserialize, JsonSchema, Debug, SettingsUi, SettingsKey)]
 #[serde(default)]
+#[settings_key(key = "audio")]
 pub struct AudioSettingsContent {
    /// Whether to use the experimental audio system
    #[serde(rename = "experimental.rodio_audio", default)]
@@ -21,8 +22,6 @@ pub struct AudioSettingsContent {
 }

 impl Settings for AudioSettings {
-    const KEY: Option<&'static str> = Some("audio");
-
    type FileContent = AudioSettingsContent;

    fn load(sources: SettingsSources<Self::FileContent>, _cx: &mut App) -> Result<Self> {
--- a/crates/auto_update/src/auto_update.rs
+++ b/crates/auto_update/src/auto_update.rs
@@ -10,7 +10,7 @@ use paths::remote_servers_dir;
 use release_channel::{AppCommitSha, ReleaseChannel};
 use schemars::JsonSchema;
 use serde::{Deserialize, Serialize};
-use settings::{Settings, SettingsSources, SettingsStore, SettingsUi};
+use settings::{Settings, SettingsKey, SettingsSources, SettingsStore, SettingsUi};
 use smol::{fs, io::AsyncReadExt};
 use smol::{fs::File, process::Command};
 use std::{
@@ -118,13 +118,12 @@ struct AutoUpdateSetting(bool);
 /// Whether or not to automatically check for updates.
 ///
 /// Default: true
-#[derive(Clone, Copy, Default, JsonSchema, Deserialize, Serialize, SettingsUi)]
+#[derive(Clone, Copy, Default, JsonSchema, Deserialize, Serialize, SettingsUi, SettingsKey)]
 #[serde(transparent)]
+#[settings_key(key = "auto_update")]
 struct AutoUpdateSettingContent(bool);

 impl Settings for AutoUpdateSetting {
-    const KEY: Option<&'static str> = Some("auto_update");
-
    type FileContent = AutoUpdateSettingContent;

    fn load(sources: SettingsSources<Self::FileContent>, _: &mut App) -> Result<Self> {
--- a/crates/auto_update_ui/src/auto_update_ui.rs
+++ b/crates/auto_update_ui/src/auto_update_ui.rs
@@ -88,10 +88,7 @@ fn view_release_notes_locally(
                        .update_in(cx, |workspace, window, cx| {
                            let project = workspace.project().clone();
                            let buffer = project.update(cx, |project, cx| {
-                                let buffer = project.create_local_buffer("", markdown, cx);
-                                project
-                                    .mark_buffer_as_non_searchable(buffer.read(cx).remote_id(), cx);
-                                buffer
+                                project.create_local_buffer("", markdown, false, cx)
                            });
                            buffer.update(cx, |buffer, cx| {
                                buffer.edit([(0..0, body.release_notes)], None, cx)
--- a/crates/buffer_diff/src/buffer_diff.rs
+++ b/crates/buffer_diff/src/buffer_diff.rs
@@ -2044,10 +2044,10 @@ mod tests {
    #[gpui::test(iterations = 100)]
    async fn test_staging_and_unstaging_hunks(cx: &mut TestAppContext, mut rng: StdRng) {
        fn gen_line(rng: &mut StdRng) -> String {
-            if rng.gen_bool(0.2) {
+            if rng.random_bool(0.2) {
                "\n".to_owned()
            } else {
-                let c = rng.gen_range('A'..='Z');
+                let c = rng.random_range('A'..='Z');
                format!("{c}{c}{c}\n")
            }
        }
@@ -2066,7 +2066,7 @@ mod tests {
                old_lines.into_iter()
            };
            let mut result = String::new();
-            let unchanged_count = rng.gen_range(0..=old_lines.len());
+            let unchanged_count = rng.random_range(0..=old_lines.len());
            result +=
                &old_lines
                    .by_ref()
@@ -2076,14 +2076,14 @@ mod tests {
                        s
                    });
            while old_lines.len() > 0 {
-                let deleted_count = rng.gen_range(0..=old_lines.len());
+                let deleted_count = rng.random_range(0..=old_lines.len());
                let _advance = old_lines
                    .by_ref()
                    .take(deleted_count)
                    .map(|line| line.len() + 1)
                    .sum::<usize>();
                let minimum_added = if deleted_count == 0 { 1 } else { 0 };
-                let added_count = rng.gen_range(minimum_added..=5);
+                let added_count = rng.random_range(minimum_added..=5);
                let addition = (0..added_count).map(|_| gen_line(rng)).collect::<String>();
                result += &addition;

@@ -2092,7 +2092,8 @@ mod tests {
                    if blank_lines == old_lines.len() {
                        break;
                    };
-                    let unchanged_count = rng.gen_range((blank_lines + 1).max(1)..=old_lines.len());
+                    let unchanged_count =
+                        rng.random_range((blank_lines + 1).max(1)..=old_lines.len());
                    result += &old_lines.by_ref().take(unchanged_count).fold(
                        String::new(),
                        |mut s, line| {
@@ -2149,7 +2150,7 @@ mod tests {
            )
        });
        let working_copy = working_copy.read_with(cx, |working_copy, _| working_copy.snapshot());
-        let mut index_text = if rng.r#gen() {
+        let mut index_text = if rng.random() {
            Rope::from(head_text.as_str())
        } else {
            working_copy.as_rope().clone()
@@ -2165,7 +2166,7 @@ mod tests {
        }

        for _ in 0..operations {
-            let i = rng.gen_range(0..hunks.len());
+            let i = rng.random_range(0..hunks.len());
            let hunk = &mut hunks[i];
            let hunk_to_change = hunk.clone();
            let stage = match hunk.secondary_status {
--- a/crates/call/src/call_settings.rs
+++ b/crates/call/src/call_settings.rs
@@ -2,7 +2,7 @@ use anyhow::Result;
 use gpui::App;
 use schemars::JsonSchema;
 use serde_derive::{Deserialize, Serialize};
-use settings::{Settings, SettingsSources, SettingsUi};
+use settings::{Settings, SettingsKey, SettingsSources, SettingsUi};

 #[derive(Deserialize, Debug)]
 pub struct CallSettings {
@@ -11,7 +11,8 @@ pub struct CallSettings {
 }

 /// Configuration of voice calls in Zed.
-#[derive(Clone, Default, Serialize, Deserialize, JsonSchema, Debug, SettingsUi)]
+#[derive(Clone, Default, Serialize, Deserialize, JsonSchema, Debug, SettingsUi, SettingsKey)]
+#[settings_key(key = "calls")]
 pub struct CallSettingsContent {
    /// Whether the microphone should be muted when joining a channel or a call.
    ///
@@ -25,8 +26,6 @@ pub struct CallSettingsContent {
 }

 impl Settings for CallSettings {
-    const KEY: Option<&'static str> = Some("calls");
-
    type FileContent = CallSettingsContent;

    fn load(sources: SettingsSources<Self::FileContent>, _: &mut App) -> Result<Self> {
--- a/crates/channel/src/channel_chat.rs
+++ b/crates/channel/src/channel_chat.rs
@@ -129,7 +129,7 @@ impl ChannelChat {
                loaded_all_messages: false,
                next_pending_message_id: 0,
                last_acknowledged_id: None,
-                rng: StdRng::from_entropy(),
+                rng: StdRng::from_os_rng(),
                first_loaded_message_id: None,
                _subscription: subscription.set_entity(&cx.entity(), &cx.to_async()),
            }
@@ -183,7 +183,7 @@ impl ChannelChat {

        let channel_id = self.channel_id;
        let pending_id = ChannelMessageId::Pending(post_inc(&mut self.next_pending_message_id));
-        let nonce = self.rng.r#gen();
+        let nonce = self.rng.random();
        self.insert_messages(
            SumTree::from_item(
                ChannelMessage {
@@ -257,7 +257,7 @@ impl ChannelChat {
            cx,
        );

-        let nonce: u128 = self.rng.r#gen();
+        let nonce: u128 = self.rng.random();

        let request = self.rpc.request(proto::UpdateChannelMessage {
            channel_id: self.channel_id.0,
--- a/crates/client/Cargo.toml
+++ b/crates/client/Cargo.toml
@@ -75,7 +75,7 @@ util = { workspace = true, features = ["test-support"] }
 windows.workspace = true

 [target.'cfg(target_os = "macos")'.dependencies]
-cocoa.workspace = true
+objc2-foundation.workspace = true

 [target.'cfg(any(target_os = "windows", target_os = "macos"))'.dependencies]
 tokio-native-tls = "0.3"
--- a/crates/client/src/client.rs
+++ b/crates/client/src/client.rs
@@ -31,7 +31,7 @@ use release_channel::{AppVersion, ReleaseChannel};
 use rpc::proto::{AnyTypedEnvelope, EnvelopedMessage, PeerId, RequestMessage};
 use schemars::JsonSchema;
 use serde::{Deserialize, Serialize};
-use settings::{Settings, SettingsSources, SettingsUi};
+use settings::{Settings, SettingsKey, SettingsSources, SettingsUi};
 use std::{
    any::TypeId,
    convert::TryFrom,
@@ -96,7 +96,8 @@ actions!(
    ]
 );

-#[derive(Clone, Default, Serialize, Deserialize, JsonSchema, SettingsUi)]
+#[derive(Clone, Default, Serialize, Deserialize, JsonSchema, SettingsUi, SettingsKey)]
+#[settings_key(None)]
 pub struct ClientSettingsContent {
    server_url: Option<String>,
 }
@@ -107,8 +108,6 @@ pub struct ClientSettings {
 }

 impl Settings for ClientSettings {
-    const KEY: Option<&'static str> = None;
-
    type FileContent = ClientSettingsContent;

    fn load(sources: SettingsSources<Self::FileContent>, _: &mut App) -> Result<Self> {
@@ -122,7 +121,8 @@ impl Settings for ClientSettings {
    fn import_from_vscode(_vscode: &settings::VsCodeSettings, _current: &mut Self::FileContent) {}
 }

-#[derive(Default, Clone, Serialize, Deserialize, JsonSchema, SettingsUi)]
+#[derive(Default, Clone, Serialize, Deserialize, JsonSchema, SettingsUi, SettingsKey)]
+#[settings_key(None)]
 pub struct ProxySettingsContent {
    proxy: Option<String>,
 }
@@ -133,8 +133,6 @@ pub struct ProxySettings {
 }

 impl Settings for ProxySettings {
-    const KEY: Option<&'static str> = None;
-
    type FileContent = ProxySettingsContent;

    fn load(sources: SettingsSources<Self::FileContent>, _: &mut App) -> Result<Self> {
@@ -527,7 +525,8 @@ pub struct TelemetrySettings {
 }

 /// Control what info is collected by Zed.
-#[derive(Default, Clone, Serialize, Deserialize, JsonSchema, Debug, SettingsUi)]
+#[derive(Default, Clone, Serialize, Deserialize, JsonSchema, Debug, SettingsUi, SettingsKey)]
+#[settings_key(key = "telemetry")]
 pub struct TelemetrySettingsContent {
    /// Send debug info like crash reports.
    ///
@@ -540,8 +539,6 @@ pub struct TelemetrySettingsContent {
 }

 impl settings::Settings for TelemetrySettings {
-    const KEY: Option<&'static str> = Some("telemetry");
-
    type FileContent = TelemetrySettingsContent;

    fn load(sources: SettingsSources<Self::FileContent>, _: &mut App) -> Result<Self> {
@@ -691,7 +688,7 @@ impl Client {
                    #[cfg(any(test, feature = "test-support"))]
                    let mut rng = StdRng::seed_from_u64(0);
                    #[cfg(not(any(test, feature = "test-support")))]
-                    let mut rng = StdRng::from_entropy();
+                    let mut rng = StdRng::from_os_rng();

                    let mut delay = INITIAL_RECONNECTION_DELAY;
                    loop {
@@ -721,8 +718,9 @@ impl Client {
                                },
                                cx,
                            );
-                            let jitter =
-                                Duration::from_millis(rng.gen_range(0..delay.as_millis() as u64));
+                            let jitter = Duration::from_millis(
+                                rng.random_range(0..delay.as_millis() as u64),
+                            );
                            cx.background_executor().timer(delay + jitter).await;
                            delay = cmp::min(delay * 2, MAX_RECONNECTION_DELAY);
                        } else {
--- a/crates/client/src/telemetry.rs
+++ b/crates/client/src/telemetry.rs
@@ -84,6 +84,10 @@ static DOTNET_PROJECT_FILES_REGEX: LazyLock<Regex> = LazyLock::new(|| {
    Regex::new(r"^(global\.json|Directory\.Build\.props|.*\.(csproj|fsproj|vbproj|sln))$").unwrap()
 });

+#[cfg(target_os = "macos")]
+static MACOS_VERSION_REGEX: LazyLock<Regex> =
+    LazyLock::new(|| Regex::new(r"(\s*\(Build [^)]*[0-9]\))").unwrap());
+
 pub fn os_name() -> String {
    #[cfg(target_os = "macos")]
    {
@@ -108,19 +112,16 @@ pub fn os_name() -> String {
 pub fn os_version() -> String {
    #[cfg(target_os = "macos")]
    {
-        use cocoa::base::nil;
-        use cocoa::foundation::NSProcessInfo;
-
-        unsafe {
-            let process_info = cocoa::foundation::NSProcessInfo::processInfo(nil);
-            let version = process_info.operatingSystemVersion();
-            gpui::SemanticVersion::new(
-                version.majorVersion as usize,
-                version.minorVersion as usize,
-                version.patchVersion as usize,
-            )
+        use objc2_foundation::NSProcessInfo;
+        let process_info = NSProcessInfo::processInfo();
+        let version_nsstring = unsafe { process_info.operatingSystemVersionString() };
+        // "Version 15.6.1 (Build 24G90)" -> "15.6.1 (Build 24G90)"
+        let version_string = version_nsstring.to_string().replace("Version ", "");
+        // "15.6.1 (Build 24G90)" -> "15.6.1"
+        // "26.0.0 (Build 25A5349a)" -> unchanged (Beta or Rapid Security Response; ends with letter)
+        MACOS_VERSION_REGEX
+            .replace_all(&version_string, "")
            .to_string()
-        }
    }
    #[cfg(any(target_os = "linux", target_os = "freebsd"))]
    {
--- a/crates/collab/src/auth.rs
+++ b/crates/collab/src/auth.rs
@@ -227,7 +227,7 @@ pub async fn verify_access_token(

 #[cfg(test)]
 mod test {
-    use rand::thread_rng;
+    use rand::prelude::*;
    use scrypt::password_hash::{PasswordHasher, SaltString};
    use sea_orm::EntityTrait;

@@ -358,9 +358,42 @@ mod test {
                None,
                None,
                params,
-                &SaltString::generate(thread_rng()),
+                &SaltString::generate(PasswordHashRngCompat::new()),
            )
            .map_err(anyhow::Error::new)?
            .to_string())
    }
+
+    // TODO: remove once we password_hash v0.6 is released.
+    struct PasswordHashRngCompat(rand::rngs::ThreadRng);
+
+    impl PasswordHashRngCompat {
+        fn new() -> Self {
+            Self(rand::rng())
+        }
+    }
+
+    impl scrypt::password_hash::rand_core::RngCore for PasswordHashRngCompat {
+        fn next_u32(&mut self) -> u32 {
+            self.0.next_u32()
+        }
+
+        fn next_u64(&mut self) -> u64 {
+            self.0.next_u64()
+        }
+
+        fn fill_bytes(&mut self, dest: &mut [u8]) {
+            self.0.fill_bytes(dest);
+        }
+
+        fn try_fill_bytes(
+            &mut self,
+            dest: &mut [u8],
+        ) -> Result<(), scrypt::password_hash::rand_core::Error> {
+            self.fill_bytes(dest);
+            Ok(())
+        }
+    }
+
+    impl scrypt::password_hash::rand_core::CryptoRng for PasswordHashRngCompat {}
 }
--- a/crates/collab/src/db.rs
+++ b/crates/collab/src/db.rs
@@ -256,7 +256,7 @@ impl Database {
            let test_options = self.test_options.as_ref().unwrap();
            test_options.executor.simulate_random_delay().await;
            let fail_probability = *test_options.query_failure_probability.lock();
-            if test_options.executor.rng().gen_bool(fail_probability) {
+            if test_options.executor.rng().random_bool(fail_probability) {
                return Err(anyhow!("simulated query failure"))?;
            }

--- a/crates/collab/src/db/tests.rs
+++ b/crates/collab/src/db/tests.rs
@@ -75,10 +75,10 @@ impl TestDb {
        static LOCK: Mutex<()> = Mutex::new(());

        let _guard = LOCK.lock();
-        let mut rng = StdRng::from_entropy();
+        let mut rng = StdRng::from_os_rng();
        let url = format!(
            "postgres://postgres@localhost/zed-test-{}",
-            rng.r#gen::<u128>()
+            rng.random::<u128>()
        );
        let runtime = tokio::runtime::Builder::new_current_thread()
            .enable_io()
--- a/crates/collab/src/tests/following_tests.rs
+++ b/crates/collab/src/tests/following_tests.rs
@@ -2098,7 +2098,7 @@ async fn test_following_after_replacement(cx_a: &mut TestAppContext, cx_b: &mut
    share_workspace(&workspace, cx_a).await.unwrap();
    let buffer = workspace.update(cx_a, |workspace, cx| {
        workspace.project().update(cx, |project, cx| {
-            project.create_local_buffer(&sample_text(26, 5, 'a'), None, cx)
+            project.create_local_buffer(&sample_text(26, 5, 'a'), None, false, cx)
        })
    });
    let multibuffer = cx_a.new(|cx| {
--- a/crates/collab/src/tests/integration_tests.rs
+++ b/crates/collab/src/tests/integration_tests.rs
@@ -2506,7 +2506,7 @@ async fn test_propagate_saves_and_fs_changes(
    });

    let new_buffer_a = project_a
-        .update(cx_a, |p, cx| p.create_buffer(cx))
+        .update(cx_a, |p, cx| p.create_buffer(false, cx))
        .await
        .unwrap();

@@ -5746,7 +5746,7 @@ async fn test_open_buffer_while_getting_definition_pointing_to_it(

    let definitions;
    let buffer_b2;
-    if rng.r#gen() {
+    if rng.random() {
        cx_a.run_until_parked();
        cx_b.run_until_parked();
        definitions = project_b.update(cx_b, |p, cx| p.definitions(&buffer_b1, 23, cx));
--- a/crates/collab/src/tests/random_channel_buffer_tests.rs
+++ b/crates/collab/src/tests/random_channel_buffer_tests.rs
@@ -84,7 +84,7 @@ impl RandomizedTest for RandomChannelBufferTest {
        }

        loop {
-            match rng.gen_range(0..100_u32) {
+            match rng.random_range(0..100_u32) {
                0..=29 => {
                    let channel_name = client.channel_store().read_with(cx, |store, cx| {
                        store.ordered_channels().find_map(|(_, channel)| {
--- a/crates/collab/src/tests/random_project_collaboration_tests.rs
+++ b/crates/collab/src/tests/random_project_collaboration_tests.rs
@@ -17,7 +17,7 @@ use project::{
    DEFAULT_COMPLETION_CONTEXT, Project, ProjectPath, search::SearchQuery, search::SearchResult,
 };
 use rand::{
-    distributions::{Alphanumeric, DistString},
+    distr::{self, SampleString},
    prelude::*,
 };
 use serde::{Deserialize, Serialize};
@@ -168,19 +168,19 @@ impl RandomizedTest for ProjectCollaborationTest {
    ) -> ClientOperation {
        let call = cx.read(ActiveCall::global);
        loop {
-            match rng.gen_range(0..100_u32) {
+            match rng.random_range(0..100_u32) {
                // Mutate the call
                0..=29 => {
                    // Respond to an incoming call
                    if call.read_with(cx, |call, _| call.incoming().borrow().is_some()) {
-                        break if rng.gen_bool(0.7) {
+                        break if rng.random_bool(0.7) {
                            ClientOperation::AcceptIncomingCall
                        } else {
                            ClientOperation::RejectIncomingCall
                        };
                    }

-                    match rng.gen_range(0..100_u32) {
+                    match rng.random_range(0..100_u32) {
                        // Invite a contact to the current call
                        0..=70 => {
                            let available_contacts =
@@ -212,7 +212,7 @@ impl RandomizedTest for ProjectCollaborationTest {
                }

                // Mutate projects
-                30..=59 => match rng.gen_range(0..100_u32) {
+                30..=59 => match rng.random_range(0..100_u32) {
                    // Open a new project
                    0..=70 => {
                        // Open a remote project
@@ -270,7 +270,7 @@ impl RandomizedTest for ProjectCollaborationTest {
                    }

                    // Mutate project worktrees
-                    81.. => match rng.gen_range(0..100_u32) {
+                    81.. => match rng.random_range(0..100_u32) {
                        // Add a worktree to a local project
                        0..=50 => {
                            let Some(project) = client.local_projects().choose(rng).cloned() else {
@@ -279,7 +279,7 @@ impl RandomizedTest for ProjectCollaborationTest {
                            let project_root_name = root_name_for_project(&project, cx);
                            let mut paths = client.fs().paths(false);
                            paths.remove(0);
-                            let new_root_path = if paths.is_empty() || rng.r#gen() {
+                            let new_root_path = if paths.is_empty() || rng.random() {
                                Path::new(path!("/")).join(plan.next_root_dir_name())
                            } else {
                                paths.choose(rng).unwrap().clone()
@@ -309,7 +309,7 @@ impl RandomizedTest for ProjectCollaborationTest {
                                    .choose(rng)
                            });
                            let Some(worktree) = worktree else { continue };
-                            let is_dir = rng.r#gen::<bool>();
+                            let is_dir = rng.random::<bool>();
                            let mut full_path =
                                worktree.read_with(cx, |w, _| PathBuf::from(w.root_name()));
                            full_path.push(gen_file_name(rng));
@@ -334,7 +334,7 @@ impl RandomizedTest for ProjectCollaborationTest {
                    let project_root_name = root_name_for_project(&project, cx);
                    let is_local = project.read_with(cx, |project, _| project.is_local());

-                    match rng.gen_range(0..100_u32) {
+                    match rng.random_range(0..100_u32) {
                        // Manipulate an existing buffer
                        0..=70 => {
                            let Some(buffer) = client
@@ -349,7 +349,7 @@ impl RandomizedTest for ProjectCollaborationTest {
                            let full_path = buffer
                                .read_with(cx, |buffer, cx| buffer.file().unwrap().full_path(cx));

-                            match rng.gen_range(0..100_u32) {
+                            match rng.random_range(0..100_u32) {
                                // Close the buffer
                                0..=15 => {
                                    break ClientOperation::CloseBuffer {
@@ -360,7 +360,7 @@ impl RandomizedTest for ProjectCollaborationTest {
                                }
                                // Save the buffer
                                16..=29 if buffer.read_with(cx, |b, _| b.is_dirty()) => {
-                                    let detach = rng.gen_bool(0.3);
+                                    let detach = rng.random_bool(0.3);
                                    break ClientOperation::SaveBuffer {
                                        project_root_name,
                                        is_local,
@@ -383,17 +383,17 @@ impl RandomizedTest for ProjectCollaborationTest {
                                _ => {
                                    let offset = buffer.read_with(cx, |buffer, _| {
                                        buffer.clip_offset(
-                                            rng.gen_range(0..=buffer.len()),
+                                            rng.random_range(0..=buffer.len()),
                                            language::Bias::Left,
                                        )
                                    });
-                                    let detach = rng.r#gen();
+                                    let detach = rng.random();
                                    break ClientOperation::RequestLspDataInBuffer {
                                        project_root_name,
                                        full_path,
                                        offset,
                                        is_local,
-                                        kind: match rng.gen_range(0..5_u32) {
+                                        kind: match rng.random_range(0..5_u32) {
                                            0 => LspRequestKind::Rename,
                                            1 => LspRequestKind::Highlights,
                                            2 => LspRequestKind::Definition,
@@ -407,8 +407,8 @@ impl RandomizedTest for ProjectCollaborationTest {
                        }

                        71..=80 => {
-                            let query = rng.gen_range('a'..='z').to_string();
-                            let detach = rng.gen_bool(0.3);
+                            let query = rng.random_range('a'..='z').to_string();
+                            let detach = rng.random_bool(0.3);
                            break ClientOperation::SearchProject {
                                project_root_name,
                                is_local,
@@ -460,7 +460,7 @@ impl RandomizedTest for ProjectCollaborationTest {

                // Create or update a file or directory
                96.. => {
-                    let is_dir = rng.r#gen::<bool>();
+                    let is_dir = rng.random::<bool>();
                    let content;
                    let mut path;
                    let dir_paths = client.fs().directories(false);
@@ -470,11 +470,11 @@ impl RandomizedTest for ProjectCollaborationTest {
                        path = dir_paths.choose(rng).unwrap().clone();
                        path.push(gen_file_name(rng));
                    } else {
-                        content = Alphanumeric.sample_string(rng, 16);
+                        content = distr::Alphanumeric.sample_string(rng, 16);

                        // Create a new file or overwrite an existing file
                        let file_paths = client.fs().files();
-                        if file_paths.is_empty() || rng.gen_bool(0.5) {
+                        if file_paths.is_empty() || rng.random_bool(0.5) {
                            path = dir_paths.choose(rng).unwrap().clone();
                            path.push(gen_file_name(rng));
                            path.set_extension("rs");
@@ -1090,7 +1090,7 @@ impl RandomizedTest for ProjectCollaborationTest {
                            move |_, cx| {
                                let background = cx.background_executor();
                                let mut rng = background.rng();
-                                let count = rng.gen_range::<usize, _>(1..3);
+                                let count = rng.random_range::<usize, _>(1..3);
                                let files = fs.as_fake().files();
                                let files = (0..count)
                                    .map(|_| files.choose(&mut rng).unwrap().clone())
@@ -1117,12 +1117,12 @@ impl RandomizedTest for ProjectCollaborationTest {
                                    let background = cx.background_executor();
                                    let mut rng = background.rng();

-                                    let highlight_count = rng.gen_range(1..=5);
+                                    let highlight_count = rng.random_range(1..=5);
                                    for _ in 0..highlight_count {
-                                        let start_row = rng.gen_range(0..100);
-                                        let start_column = rng.gen_range(0..100);
-                                        let end_row = rng.gen_range(0..100);
-                                        let end_column = rng.gen_range(0..100);
+                                        let start_row = rng.random_range(0..100);
+                                        let start_column = rng.random_range(0..100);
+                                        let end_row = rng.random_range(0..100);
+                                        let end_column = rng.random_range(0..100);
                                        let start = PointUtf16::new(start_row, start_column);
                                        let end = PointUtf16::new(end_row, end_column);
                                        let range =
@@ -1219,8 +1219,8 @@ impl RandomizedTest for ProjectCollaborationTest {
                                        guest_project.remote_id(),
                                    );
                                    assert_eq!(
-                                        guest_snapshot.entries(false, 0).collect::<Vec<_>>(),
-                                        host_snapshot.entries(false, 0).collect::<Vec<_>>(),
+                                        guest_snapshot.entries(false, 0).map(null_out_entry_size).collect::<Vec<_>>(),
+                                        host_snapshot.entries(false, 0).map(null_out_entry_size).collect::<Vec<_>>(),
                                        "{} has different snapshot than the host for worktree {:?} ({:?}) and project {:?}",
                                        client.username,
                                        host_snapshot.abs_path(),
@@ -1248,6 +1248,18 @@ impl RandomizedTest for ProjectCollaborationTest {
                            );
                        }
                    });
+
+                // A hack to work around a hack in
+                // https://github.com/zed-industries/zed/pull/16696 that wasn't
+                // detected until we upgraded the rng crate. This whole crate is
+                // going away with DeltaDB soon, so we hold our nose and
+                // continue.
+                fn null_out_entry_size(entry: &project::Entry) -> project::Entry {
+                    project::Entry {
+                        size: 0,
+                        ..entry.clone()
+                    }
+                }
            }

            let buffers = client.buffers().clone();
@@ -1422,7 +1434,7 @@ fn generate_git_operation(rng: &mut StdRng, client: &TestClient) -> GitOperation
            .filter(|path| path.starts_with(repo_path))
            .collect::<Vec<_>>();

-        let count = rng.gen_range(0..=paths.len());
+        let count = rng.random_range(0..=paths.len());
        paths.shuffle(rng);
        paths.truncate(count);

@@ -1434,13 +1446,13 @@ fn generate_git_operation(rng: &mut StdRng, client: &TestClient) -> GitOperation

    let repo_path = client.fs().directories(false).choose(rng).unwrap().clone();

-    match rng.gen_range(0..100_u32) {
+    match rng.random_range(0..100_u32) {
        0..=25 => {
            let file_paths = generate_file_paths(&repo_path, rng, client);

            let contents = file_paths
                .into_iter()
-                .map(|path| (path, Alphanumeric.sample_string(rng, 16)))
+                .map(|path| (path, distr::Alphanumeric.sample_string(rng, 16)))
                .collect();

            GitOperation::WriteGitIndex {
@@ -1449,7 +1461,8 @@ fn generate_git_operation(rng: &mut StdRng, client: &TestClient) -> GitOperation
            }
        }
        26..=63 => {
-            let new_branch = (rng.gen_range(0..10) > 3).then(|| Alphanumeric.sample_string(rng, 8));
+            let new_branch =
+                (rng.random_range(0..10) > 3).then(|| distr::Alphanumeric.sample_string(rng, 8));

            GitOperation::WriteGitBranch {
                repo_path,
@@ -1596,7 +1609,7 @@ fn choose_random_project(client: &TestClient, rng: &mut StdRng) -> Option<Entity
 fn gen_file_name(rng: &mut StdRng) -> String {
    let mut name = String::new();
    for _ in 0..10 {
-        let letter = rng.gen_range('a'..='z');
+        let letter = rng.random_range('a'..='z');
        name.push(letter);
    }
    name
@@ -1604,7 +1617,7 @@ fn gen_file_name(rng: &mut StdRng) -> String {

 fn gen_status(rng: &mut StdRng) -> FileStatus {
    fn gen_tracked_status(rng: &mut StdRng) -> TrackedStatus {
-        match rng.gen_range(0..3) {
+        match rng.random_range(0..3) {
            0 => TrackedStatus {
                index_status: StatusCode::Unmodified,
                worktree_status: StatusCode::Unmodified,
@@ -1626,7 +1639,7 @@ fn gen_status(rng: &mut StdRng) -> FileStatus {
    }

    fn gen_unmerged_status_code(rng: &mut StdRng) -> UnmergedStatusCode {
-        match rng.gen_range(0..3) {
+        match rng.random_range(0..3) {
            0 => UnmergedStatusCode::Updated,
            1 => UnmergedStatusCode::Added,
            2 => UnmergedStatusCode::Deleted,
@@ -1634,7 +1647,7 @@ fn gen_status(rng: &mut StdRng) -> FileStatus {
        }
    }

-    match rng.gen_range(0..2) {
+    match rng.random_range(0..2) {
        0 => FileStatus::Unmerged(UnmergedStatus {
            first_head: gen_unmerged_status_code(rng),
            second_head: gen_unmerged_status_code(rng),
--- a/crates/collab/src/tests/randomized_test_helpers.rs
+++ b/crates/collab/src/tests/randomized_test_helpers.rs
@@ -208,9 +208,9 @@ pub fn save_randomized_test_plan() {

 impl<T: RandomizedTest> TestPlan<T> {
    pub async fn new(server: &mut TestServer, mut rng: StdRng) -> Arc<Mutex<Self>> {
-        let allow_server_restarts = rng.gen_bool(0.7);
-        let allow_client_reconnection = rng.gen_bool(0.7);
-        let allow_client_disconnection = rng.gen_bool(0.1);
+        let allow_server_restarts = rng.random_bool(0.7);
+        let allow_client_reconnection = rng.random_bool(0.7);
+        let allow_client_disconnection = rng.random_bool(0.1);

        let mut users = Vec::new();
        for ix in 0..max_peers() {
@@ -407,7 +407,7 @@ impl<T: RandomizedTest> TestPlan<T> {
        }

        Some(loop {
-            break match self.rng.gen_range(0..100) {
+            break match self.rng.random_range(0..100) {
                0..=29 if clients.len() < self.users.len() => {
                    let user = self
                        .users
@@ -421,13 +421,13 @@ impl<T: RandomizedTest> TestPlan<T> {
                    }
                }
                30..=34 if clients.len() > 1 && self.allow_client_disconnection => {
-                    let (client, cx) = &clients[self.rng.gen_range(0..clients.len())];
+                    let (client, cx) = &clients[self.rng.random_range(0..clients.len())];
                    let user_id = client.current_user_id(cx);
                    self.operation_ix += 1;
                    ServerOperation::RemoveConnection { user_id }
                }
                35..=39 if clients.len() > 1 && self.allow_client_reconnection => {
-                    let (client, cx) = &clients[self.rng.gen_range(0..clients.len())];
+                    let (client, cx) = &clients[self.rng.random_range(0..clients.len())];
                    let user_id = client.current_user_id(cx);
                    self.operation_ix += 1;
                    ServerOperation::BounceConnection { user_id }
@@ -439,12 +439,12 @@ impl<T: RandomizedTest> TestPlan<T> {
                _ if !clients.is_empty() => {
                    let count = self
                        .rng
-                        .gen_range(1..10)
+                        .random_range(1..10)
                        .min(self.max_operations - self.operation_ix);
                    let batch_id = util::post_inc(&mut self.next_batch_id);
                    let mut user_ids = (0..count)
                        .map(|_| {
-                            let ix = self.rng.gen_range(0..clients.len());
+                            let ix = self.rng.random_range(0..clients.len());
                            let (client, cx) = &clients[ix];
                            client.current_user_id(cx)
                        })
@@ -453,7 +453,7 @@ impl<T: RandomizedTest> TestPlan<T> {
                    ServerOperation::MutateClients {
                        user_ids,
                        batch_id,
-                        quiesce: self.rng.gen_bool(0.7),
+                        quiesce: self.rng.random_bool(0.7),
                    }
                }
                _ => continue,
--- a/crates/collab_ui/src/panel_settings.rs
+++ b/crates/collab_ui/src/panel_settings.rs
@@ -1,7 +1,7 @@
 use gpui::Pixels;
 use schemars::JsonSchema;
 use serde::{Deserialize, Serialize};
-use settings::{Settings, SettingsSources, SettingsUi};
+use settings::{Settings, SettingsKey, SettingsSources, SettingsUi};
 use workspace::dock::DockPosition;

 #[derive(Deserialize, Debug)]
@@ -27,7 +27,8 @@ pub struct ChatPanelSettings {
    pub default_width: Pixels,
 }

-#[derive(Clone, Default, Serialize, Deserialize, JsonSchema, Debug, SettingsUi)]
+#[derive(Clone, Default, Serialize, Deserialize, JsonSchema, Debug, SettingsUi, SettingsKey)]
+#[settings_key(key = "chat_panel")]
 pub struct ChatPanelSettingsContent {
    /// When to show the panel button in the status bar.
    ///
@@ -43,14 +44,8 @@ pub struct ChatPanelSettingsContent {
    pub default_width: Option<f32>,
 }

-#[derive(Deserialize, Debug)]
-pub struct NotificationPanelSettings {
-    pub button: bool,
-    pub dock: DockPosition,
-    pub default_width: Pixels,
-}
-
-#[derive(Clone, Default, Serialize, Deserialize, JsonSchema, Debug, SettingsUi)]
+#[derive(Clone, Default, Serialize, Deserialize, JsonSchema, Debug, SettingsUi, SettingsKey)]
+#[settings_key(key = "collaboration_panel")]
 pub struct PanelSettingsContent {
    /// Whether to show the panel button in the status bar.
    ///
@@ -66,7 +61,32 @@ pub struct PanelSettingsContent {
    pub default_width: Option<f32>,
 }

-#[derive(Clone, Default, Serialize, Deserialize, JsonSchema, Debug, SettingsUi)]
+#[derive(Deserialize, Debug)]
+pub struct NotificationPanelSettings {
+    pub button: bool,
+    pub dock: DockPosition,
+    pub default_width: Pixels,
+}
+
+#[derive(Clone, Default, Serialize, Deserialize, JsonSchema, Debug, SettingsUi, SettingsKey)]
+#[settings_key(key = "notification_panel")]
+pub struct NotificationPanelSettingsContent {
+    /// Whether to show the panel button in the status bar.
+    ///
+    /// Default: true
+    pub button: Option<bool>,
+    /// Where to dock the panel.
+    ///
+    /// Default: right
+    pub dock: Option<DockPosition>,
+    /// Default width of the panel in pixels.
+    ///
+    /// Default: 300
+    pub default_width: Option<f32>,
+}
+
+#[derive(Clone, Default, Serialize, Deserialize, JsonSchema, Debug, SettingsUi, SettingsKey)]
+#[settings_key(key = "message_editor")]
 pub struct MessageEditorSettings {
    /// Whether to automatically replace emoji shortcodes with emoji characters.
    /// For example: typing `:wave:` gets replaced with `👋`.
@@ -76,8 +96,6 @@ pub struct MessageEditorSettings {
 }

 impl Settings for CollaborationPanelSettings {
-    const KEY: Option<&'static str> = Some("collaboration_panel");
-
    type FileContent = PanelSettingsContent;

    fn load(
@@ -91,8 +109,6 @@ impl Settings for CollaborationPanelSettings {
 }

 impl Settings for ChatPanelSettings {
-    const KEY: Option<&'static str> = Some("chat_panel");
-
    type FileContent = ChatPanelSettingsContent;

    fn load(
@@ -106,9 +122,7 @@ impl Settings for ChatPanelSettings {
 }

 impl Settings for NotificationPanelSettings {
-    const KEY: Option<&'static str> = Some("notification_panel");
-
-    type FileContent = PanelSettingsContent;
+    type FileContent = NotificationPanelSettingsContent;

    fn load(
        sources: SettingsSources<Self::FileContent>,
@@ -121,8 +135,6 @@ impl Settings for NotificationPanelSettings {
 }

 impl Settings for MessageEditorSettings {
-    const KEY: Option<&'static str> = Some("message_editor");
-
    type FileContent = MessageEditorSettings;

    fn load(
--- a/crates/command_palette_hooks/src/command_palette_hooks.rs
+++ b/crates/command_palette_hooks/src/command_palette_hooks.rs
@@ -76,7 +76,7 @@ impl CommandPaletteFilter {
    }

    /// Hides all actions with the given types.
-    pub fn hide_action_types(&mut self, action_types: &[TypeId]) {
+    pub fn hide_action_types<'a>(&mut self, action_types: impl IntoIterator<Item = &'a TypeId>) {
        for action_type in action_types {
            self.hidden_action_types.insert(*action_type);
            self.shown_action_types.remove(action_type);
@@ -84,7 +84,7 @@ impl CommandPaletteFilter {
    }

    /// Shows all actions with the given types.
-    pub fn show_action_types<'a>(&mut self, action_types: impl Iterator<Item = &'a TypeId>) {
+    pub fn show_action_types<'a>(&mut self, action_types: impl IntoIterator<Item = &'a TypeId>) {
        for action_type in action_types {
            self.shown_action_types.insert(*action_type);
            self.hidden_action_types.remove(action_type);
--- a/crates/component/Cargo.toml
+++ b/crates/component/Cargo.toml
@@ -20,5 +20,8 @@ strum.workspace = true
 theme.workspace = true
 workspace-hack.workspace = true

+[dev-dependencies]
+documented.workspace = true
+
 [features]
 default = []
--- a/crates/component/src/component.rs
+++ b/crates/component/src/component.rs
@@ -227,6 +227,8 @@ pub trait Component {
    /// Example:
    ///
    /// ```
+    /// use documented::Documented;
+    ///
    /// /// This is a doc comment.
    /// #[derive(Documented)]
    /// struct MyComponent;
--- a/crates/copilot/src/copilot.rs
+++ b/crates/copilot/src/copilot.rs
@@ -1095,7 +1095,7 @@ impl Copilot {
                _ => {
                    filter.hide_action_types(&signed_in_actions);
                    filter.hide_action_types(&auth_actions);
-                    filter.show_action_types(no_auth_actions.iter());
+                    filter.show_action_types(&no_auth_actions);
                }
            }
        }
--- a/crates/dap/src/debugger_settings.rs
+++ b/crates/dap/src/debugger_settings.rs
@@ -2,7 +2,7 @@ use dap_types::SteppingGranularity;
 use gpui::{App, Global};
 use schemars::JsonSchema;
 use serde::{Deserialize, Serialize};
-use settings::{Settings, SettingsSources, SettingsUi};
+use settings::{Settings, SettingsKey, SettingsSources, SettingsUi};

 #[derive(Copy, Clone, Debug, Serialize, Deserialize, JsonSchema, PartialEq, Eq, SettingsUi)]
 #[serde(rename_all = "snake_case")]
@@ -12,11 +12,12 @@ pub enum DebugPanelDockPosition {
    Right,
 }

-#[derive(Serialize, Deserialize, JsonSchema, Clone, Copy, SettingsUi)]
+#[derive(Serialize, Deserialize, JsonSchema, Clone, Copy, SettingsUi, SettingsKey)]
 #[serde(default)]
 // todo(settings_ui) @ben: I'm pretty sure not having the fields be optional here is a bug,
 // it means the defaults will override previously set values if a single key is missing
-#[settings_ui(group = "Debugger", path = "debugger")]
+#[settings_ui(group = "Debugger")]
+#[settings_key(key = "debugger")]
 pub struct DebuggerSettings {
    /// Determines the stepping granularity.
    ///
@@ -64,8 +65,6 @@ impl Default for DebuggerSettings {
 }

 impl Settings for DebuggerSettings {
-    const KEY: Option<&'static str> = Some("debugger");
-
    type FileContent = Self;

    fn load(sources: SettingsSources<Self::FileContent>, _: &mut App) -> anyhow::Result<Self> {
--- a/crates/debugger_ui/src/attach_modal.rs
+++ b/crates/debugger_ui/src/attach_modal.rs
@@ -1,8 +1,10 @@
 use dap::{DapRegistry, DebugRequest};
 use fuzzy::{StringMatch, StringMatchCandidate};
-use gpui::{AppContext, DismissEvent, Entity, EventEmitter, Focusable, Render};
+use gpui::{AppContext, DismissEvent, Entity, EventEmitter, Focusable, Render, Task};
 use gpui::{Subscription, WeakEntity};
 use picker::{Picker, PickerDelegate};
+use project::Project;
+use rpc::proto;
 use task::ZedDebugConfig;
 use util::debug_panic;

@@ -56,29 +58,28 @@ impl AttachModal {
    pub fn new(
        definition: ZedDebugConfig,
        workspace: WeakEntity<Workspace>,
+        project: Entity<Project>,
        modal: bool,
        window: &mut Window,
        cx: &mut Context<Self>,
    ) -> Self {
-        let mut processes: Box<[_]> = System::new_all()
-            .processes()
-            .values()
-            .map(|process| {
-                let name = process.name().to_string_lossy().into_owned();
-                Candidate {
-                    name: name.into(),
-                    pid: process.pid().as_u32(),
-                    command: process
-                        .cmd()
-                        .iter()
-                        .map(|s| s.to_string_lossy().to_string())
-                        .collect::<Vec<_>>(),
-                }
-            })
-            .collect();
-        processes.sort_by_key(|k| k.name.clone());
-        let processes = processes.into_iter().collect();
-        Self::with_processes(workspace, definition, processes, modal, window, cx)
+        let processes_task = get_processes_for_project(&project, cx);
+
+        let modal = Self::with_processes(workspace, definition, Arc::new([]), modal, window, cx);
+
+        cx.spawn_in(window, async move |this, cx| {
+            let processes = processes_task.await;
+            this.update_in(cx, |modal, window, cx| {
+                modal.picker.update(cx, |picker, cx| {
+                    picker.delegate.candidates = processes;
+                    picker.refresh(window, cx);
+                });
+            })?;
+            anyhow::Ok(())
+        })
+        .detach_and_log_err(cx);
+
+        modal
    }

    pub(super) fn with_processes(
@@ -332,6 +333,57 @@ impl PickerDelegate for AttachModalDelegate {
    }
 }

+fn get_processes_for_project(project: &Entity<Project>, cx: &mut App) -> Task<Arc<[Candidate]>> {
+    let project = project.read(cx);
+
+    if let Some(remote_client) = project.remote_client() {
+        let proto_client = remote_client.read(cx).proto_client();
+        cx.spawn(async move |_cx| {
+            let response = proto_client
+                .request(proto::GetProcesses {
+                    project_id: proto::REMOTE_SERVER_PROJECT_ID,
+                })
+                .await
+                .unwrap_or_else(|_| proto::GetProcessesResponse {
+                    processes: Vec::new(),
+                });
+
+            let mut processes: Vec<Candidate> = response
+                .processes
+                .into_iter()
+                .map(|p| Candidate {
+                    pid: p.pid,
+                    name: p.name.into(),
+                    command: p.command,
+                })
+                .collect();
+
+            processes.sort_by_key(|k| k.name.clone());
+            Arc::from(processes.into_boxed_slice())
+        })
+    } else {
+        let mut processes: Box<[_]> = System::new_all()
+            .processes()
+            .values()
+            .map(|process| {
+                let name = process.name().to_string_lossy().into_owned();
+                Candidate {
+                    name: name.into(),
+                    pid: process.pid().as_u32(),
+                    command: process
+                        .cmd()
+                        .iter()
+                        .map(|s| s.to_string_lossy().to_string())
+                        .collect::<Vec<_>>(),
+                }
+            })
+            .collect();
+        processes.sort_by_key(|k| k.name.clone());
+        let processes = processes.into_iter().collect();
+        Task::ready(processes)
+    }
+}
+
 #[cfg(any(test, feature = "test-support"))]
 pub(crate) fn _process_names(modal: &AttachModal, cx: &mut Context<AttachModal>) -> Vec<String> {
    modal.picker.read_with(cx, |picker, _| {
--- a/crates/debugger_ui/src/debugger_panel.rs
+++ b/crates/debugger_ui/src/debugger_panel.rs
@@ -13,11 +13,8 @@ use anyhow::{Context as _, Result, anyhow};
 use collections::IndexMap;
 use dap::adapters::DebugAdapterName;
 use dap::debugger_settings::DebugPanelDockPosition;
-use dap::{
-    ContinuedEvent, LoadedSourceEvent, ModuleEvent, OutputEvent, StoppedEvent, ThreadEvent,
-    client::SessionId, debugger_settings::DebuggerSettings,
-};
 use dap::{DapRegistry, StartDebuggingRequestArguments};
+use dap::{client::SessionId, debugger_settings::DebuggerSettings};
 use editor::Editor;
 use gpui::{
    Action, App, AsyncWindowContext, ClipboardItem, Context, DismissEvent, Entity, EntityId,
@@ -46,23 +43,6 @@ use workspace::{
 };
 use zed_actions::ToggleFocus;

-pub enum DebugPanelEvent {
-    Exited(SessionId),
-    Terminated(SessionId),
-    Stopped {
-        client_id: SessionId,
-        event: StoppedEvent,
-        go_to_stack_frame: bool,
-    },
-    Thread((SessionId, ThreadEvent)),
-    Continued((SessionId, ContinuedEvent)),
-    Output((SessionId, OutputEvent)),
-    Module((SessionId, ModuleEvent)),
-    LoadedSource((SessionId, LoadedSourceEvent)),
-    ClientShutdown(SessionId),
-    CapabilitiesChanged(SessionId),
-}
-
 pub struct DebugPanel {
    size: Pixels,
    active_session: Option<Entity<DebugSession>>,
@@ -1407,7 +1387,6 @@ async fn register_session_inner(
 }

 impl EventEmitter<PanelEvent> for DebugPanel {}
-impl EventEmitter<DebugPanelEvent> for DebugPanel {}

 impl Focusable for DebugPanel {
    fn focus_handle(&self, _: &App) -> FocusHandle {
--- a/crates/debugger_ui/src/dropdown_menus.rs
+++ b/crates/debugger_ui/src/dropdown_menus.rs
@@ -113,23 +113,6 @@ impl DebugPanel {
                }
            };
            session_entries.push(root_entry);
-
-            session_entries.extend(
-                sessions_with_children
-                    .by_ref()
-                    .take_while(|(session, _)| {
-                        session
-                            .read(cx)
-                            .session(cx)
-                            .read(cx)
-                            .parent_id(cx)
-                            .is_some()
-                    })
-                    .map(|(session, _)| SessionListEntry {
-                        leaf: session.clone(),
-                        ancestors: vec![],
-                    }),
-            );
        }

        let weak = cx.weak_entity();
--- a/crates/debugger_ui/src/new_process_modal.rs
+++ b/crates/debugger_ui/src/new_process_modal.rs
@@ -20,7 +20,7 @@ use gpui::{
 };
 use itertools::Itertools as _;
 use picker::{Picker, PickerDelegate, highlighted_match_with_paths::HighlightedMatch};
-use project::{DebugScenarioContext, TaskContexts, TaskSourceKind, task_store::TaskStore};
+use project::{DebugScenarioContext, Project, TaskContexts, TaskSourceKind, task_store::TaskStore};
 use settings::Settings;
 use task::{DebugScenario, RevealTarget, ZedDebugConfig};
 use theme::ThemeSettings;
@@ -88,8 +88,10 @@ impl NewProcessModal {
            })?;
            workspace.update_in(cx, |workspace, window, cx| {
                let workspace_handle = workspace.weak_handle();
+                let project = workspace.project().clone();
                workspace.toggle_modal(window, cx, |window, cx| {
-                    let attach_mode = AttachMode::new(None, workspace_handle.clone(), window, cx);
+                    let attach_mode =
+                        AttachMode::new(None, workspace_handle.clone(), project, window, cx);

                    let debug_picker = cx.new(|cx| {
                        let delegate =
@@ -940,6 +942,7 @@ impl AttachMode {
    pub(super) fn new(
        debugger: Option<DebugAdapterName>,
        workspace: WeakEntity<Workspace>,
+        project: Entity<Project>,
        window: &mut Window,
        cx: &mut Context<NewProcessModal>,
    ) -> Entity<Self> {
@@ -950,7 +953,7 @@ impl AttachMode {
            stop_on_entry: Some(false),
        };
        let attach_picker = cx.new(|cx| {
-            let modal = AttachModal::new(definition.clone(), workspace, false, window, cx);
+            let modal = AttachModal::new(definition.clone(), workspace, project, false, window, cx);
            window.focus(&modal.focus_handle(cx));

            modal
--- a/crates/debugger_ui/src/session.rs
+++ b/crates/debugger_ui/src/session.rs
@@ -2,9 +2,7 @@ pub mod running;

 use crate::{StackTraceView, persistence::SerializedLayout, session::running::DebugTerminal};
 use dap::client::SessionId;
-use gpui::{
-    App, Axis, Entity, EventEmitter, FocusHandle, Focusable, Subscription, Task, WeakEntity,
-};
+use gpui::{App, Axis, Entity, EventEmitter, FocusHandle, Focusable, Task, WeakEntity};
 use project::debugger::session::Session;
 use project::worktree_store::WorktreeStore;
 use project::{Project, debugger::session::SessionQuirks};
@@ -24,13 +22,6 @@ pub struct DebugSession {
    stack_trace_view: OnceCell<Entity<StackTraceView>>,
    _worktree_store: WeakEntity<WorktreeStore>,
    workspace: WeakEntity<Workspace>,
-    _subscriptions: [Subscription; 1],
-}
-
-#[derive(Debug)]
-pub enum DebugPanelItemEvent {
-    Close,
-    Stopped { go_to_stack_frame: bool },
 }

 impl DebugSession {
@@ -59,9 +50,6 @@ impl DebugSession {
        let quirks = session.read(cx).quirks();

        cx.new(|cx| Self {
-            _subscriptions: [cx.subscribe(&running_state, |_, _, _, cx| {
-                cx.notify();
-            })],
            remote_id: None,
            running_state,
            quirks,
@@ -133,7 +121,7 @@ impl DebugSession {
    }
 }

-impl EventEmitter<DebugPanelItemEvent> for DebugSession {}
+impl EventEmitter<()> for DebugSession {}

 impl Focusable for DebugSession {
    fn focus_handle(&self, cx: &App) -> FocusHandle {
@@ -142,7 +130,7 @@ impl Focusable for DebugSession {
 }

 impl Item for DebugSession {
-    type Event = DebugPanelItemEvent;
+    type Event = ();
    fn tab_content_text(&self, _detail: usize, _cx: &App) -> SharedString {
        "Debugger".into()
    }
--- a/crates/debugger_ui/src/session/running.rs
+++ b/crates/debugger_ui/src/session/running.rs
@@ -14,7 +14,6 @@ use crate::{
    session::running::memory_view::MemoryView,
 };

-use super::DebugPanelItemEvent;
 use anyhow::{Context as _, Result, anyhow};
 use breakpoint_list::BreakpointList;
 use collections::{HashMap, IndexMap};
@@ -1826,8 +1825,6 @@ impl RunningState {
    }
 }

-impl EventEmitter<DebugPanelItemEvent> for RunningState {}
-
 impl Focusable for RunningState {
    fn focus_handle(&self, _: &App) -> FocusHandle {
        self.focus_handle.clone()
--- a/crates/debugger_ui/src/session/running/stack_frame_list.rs
+++ b/crates/debugger_ui/src/session/running/stack_frame_list.rs
@@ -28,8 +28,8 @@ pub enum StackFrameListEvent {
 }

 /// Represents the filter applied to the stack frame list
-#[derive(PartialEq, Eq, Copy, Clone)]
-enum StackFrameFilter {
+#[derive(PartialEq, Eq, Copy, Clone, Debug)]
+pub(crate) enum StackFrameFilter {
    /// Show all frames
    All,
    /// Show only frames from the user's code
@@ -174,19 +174,29 @@ impl StackFrameList {

    #[cfg(test)]
    pub(crate) fn dap_stack_frames(&self, cx: &mut App) -> Vec<dap::StackFrame> {
-        self.stack_frames(cx)
-            .unwrap_or_default()
-            .into_iter()
-            .enumerate()
-            .filter(|(ix, _)| {
-                self.list_filter == StackFrameFilter::All
-                    || self
-                        .filter_entries_indices
-                        .binary_search_by_key(&ix, |ix| ix)
-                        .is_ok()
-            })
-            .map(|(_, stack_frame)| stack_frame.dap)
-            .collect()
+        match self.list_filter {
+            StackFrameFilter::All => self
+                .stack_frames(cx)
+                .unwrap_or_default()
+                .into_iter()
+                .map(|stack_frame| stack_frame.dap)
+                .collect(),
+            StackFrameFilter::OnlyUserFrames => self
+                .filter_entries_indices
+                .iter()
+                .map(|ix| match &self.entries[*ix] {
+                    StackFrameEntry::Label(label) => label,
+                    StackFrameEntry::Collapsed(_) => panic!("Collapsed tabs should not be visible"),
+                    StackFrameEntry::Normal(frame) => frame,
+                })
+                .cloned()
+                .collect(),
+        }
+    }
+
+    #[cfg(test)]
+    pub(crate) fn list_filter(&self) -> StackFrameFilter {
+        self.list_filter
    }

    pub fn opened_stack_frame_id(&self) -> Option<StackFrameId> {
@@ -246,6 +256,7 @@ impl StackFrameList {
                self.entries.clear();
                self.selected_ix = None;
                self.list_state.reset(0);
+                self.filter_entries_indices.clear();
                cx.emit(StackFrameListEvent::BuiltEntries);
                cx.notify();
                return;
@@ -263,7 +274,7 @@ impl StackFrameList {
            .unwrap_or_default();

        let mut filter_entries_indices = Vec::default();
-        for (ix, stack_frame) in stack_frames.iter().enumerate() {
+        for stack_frame in stack_frames.iter() {
            let frame_in_visible_worktree = stack_frame.dap.source.as_ref().is_some_and(|source| {
                source.path.as_ref().is_some_and(|path| {
                    worktree_prefixes
@@ -273,10 +284,6 @@ impl StackFrameList {
                })
            });

-            if frame_in_visible_worktree {
-                filter_entries_indices.push(ix);
-            }
-
            match stack_frame.dap.presentation_hint {
                Some(dap::StackFramePresentationHint::Deemphasize)
                | Some(dap::StackFramePresentationHint::Subtle) => {
@@ -302,6 +309,9 @@ impl StackFrameList {
                        first_stack_frame_with_path.get_or_insert(entries.len());
                    }
                    entries.push(StackFrameEntry::Normal(stack_frame.dap.clone()));
+                    if frame_in_visible_worktree {
+                        filter_entries_indices.push(entries.len() - 1);
+                    }
                }
            }
        }
@@ -309,7 +319,6 @@ impl StackFrameList {
        let collapsed_entries = std::mem::take(&mut collapsed_entries);
        if !collapsed_entries.is_empty() {
            entries.push(StackFrameEntry::Collapsed(collapsed_entries));
-            self.filter_entries_indices.push(entries.len() - 1);
        }
        self.entries = entries;
        self.filter_entries_indices = filter_entries_indices;
@@ -612,7 +621,16 @@ impl StackFrameList {
        let entries = std::mem::take(stack_frames)
            .into_iter()
            .map(StackFrameEntry::Normal);
+        // HERE
+        let entries_len = entries.len();
        self.entries.splice(ix..ix + 1, entries);
+        let (Ok(filtered_indices_start) | Err(filtered_indices_start)) =
+            self.filter_entries_indices.binary_search(&ix);
+
+        for idx in &mut self.filter_entries_indices[filtered_indices_start..] {
+            *idx += entries_len - 1;
+        }
+
        self.selected_ix = Some(ix);
        self.list_state.reset(self.entries.len());
        cx.emit(StackFrameListEvent::BuiltEntries);
--- a/crates/debugger_ui/src/tests/stack_frame_list.rs
+++ b/crates/debugger_ui/src/tests/stack_frame_list.rs
@@ -1,6 +1,6 @@
 use crate::{
    debugger_panel::DebugPanel,
-    session::running::stack_frame_list::StackFrameEntry,
+    session::running::stack_frame_list::{StackFrameEntry, StackFrameFilter},
    tests::{active_debug_session_panel, init_test, init_test_workspace, start_debug_session},
 };
 use dap::{
@@ -867,6 +867,28 @@ async fn test_stack_frame_filter(executor: BackgroundExecutor, cx: &mut TestAppC
        },
        StackFrame {
            id: 4,
+            name: "node:internal/modules/run_main2".into(),
+            source: Some(dap::Source {
+                name: Some("run_main.js".into()),
+                path: Some(path!("/usr/lib/node/internal/modules/run_main2.js").into()),
+                source_reference: None,
+                presentation_hint: None,
+                origin: None,
+                sources: None,
+                adapter_data: None,
+                checksums: None,
+            }),
+            line: 50,
+            column: 1,
+            end_line: None,
+            end_column: None,
+            can_restart: None,
+            instruction_pointer_reference: None,
+            module_id: None,
+            presentation_hint: Some(dap::StackFramePresentationHint::Deemphasize),
+        },
+        StackFrame {
+            id: 5,
            name: "doSomething".into(),
            source: Some(dap::Source {
                name: Some("test.js".into()),
@@ -957,83 +979,119 @@ async fn test_stack_frame_filter(executor: BackgroundExecutor, cx: &mut TestAppC

    cx.run_until_parked();

-    active_debug_session_panel(workspace, cx).update_in(cx, |debug_panel_item, window, cx| {
-        let stack_frame_list = debug_panel_item
-            .running_state()
-            .update(cx, |state, _| state.stack_frame_list().clone());
+    let stack_frame_list =
+        active_debug_session_panel(workspace, cx).update_in(cx, |debug_panel_item, window, cx| {
+            let stack_frame_list = debug_panel_item
+                .running_state()
+                .update(cx, |state, _| state.stack_frame_list().clone());

-        stack_frame_list.update(cx, |stack_frame_list, cx| {
-            stack_frame_list.build_entries(true, window, cx);
+            stack_frame_list.update(cx, |stack_frame_list, cx| {
+                stack_frame_list.build_entries(true, window, cx);

-            // Verify we have the expected collapsed structure
-            assert_eq!(
-                stack_frame_list.entries(),
-                &vec![
-                    StackFrameEntry::Normal(stack_frames_for_assertions[0].clone()),
-                    StackFrameEntry::Collapsed(vec![
-                        stack_frames_for_assertions[1].clone(),
-                        stack_frames_for_assertions[2].clone()
-                    ]),
-                    StackFrameEntry::Normal(stack_frames_for_assertions[3].clone()),
-                ]
-            );
+                // Verify we have the expected collapsed structure
+                assert_eq!(
+                    stack_frame_list.entries(),
+                    &vec![
+                        StackFrameEntry::Normal(stack_frames_for_assertions[0].clone()),
+                        StackFrameEntry::Collapsed(vec![
+                            stack_frames_for_assertions[1].clone(),
+                            stack_frames_for_assertions[2].clone(),
+                            stack_frames_for_assertions[3].clone()
+                        ]),
+                        StackFrameEntry::Normal(stack_frames_for_assertions[4].clone()),
+                    ]
+                );
+            });

-            // Test 1: Verify filtering works
-            let all_frames = stack_frame_list.flatten_entries(true, false);
-            assert_eq!(all_frames.len(), 4, "Should see all 4 frames initially");
-
-            // Toggle to user frames only
            stack_frame_list
-                .toggle_frame_filter(Some(project::debugger::session::ThreadStatus::Stopped), cx);
-
-            let user_frames = stack_frame_list.dap_stack_frames(cx);
-            assert_eq!(user_frames.len(), 2, "Should only see 2 user frames");
-            assert_eq!(user_frames[0].name, "main");
-            assert_eq!(user_frames[1].name, "doSomething");
-
-            // Test 2: Verify filtering toggles correctly
-            // Check we can toggle back and see all frames again
-
-            // Toggle back to all frames
-            stack_frame_list
-                .toggle_frame_filter(Some(project::debugger::session::ThreadStatus::Stopped), cx);
-
-            let all_frames_again = stack_frame_list.flatten_entries(true, false);
-            assert_eq!(
-                all_frames_again.len(),
-                4,
-                "Should see all 4 frames after toggling back"
-            );
-
-            // Test 3: Verify collapsed entries stay expanded
-            stack_frame_list.expand_collapsed_entry(1, cx);
-            assert_eq!(
-                stack_frame_list.entries(),
-                &vec![
-                    StackFrameEntry::Normal(stack_frames_for_assertions[0].clone()),
-                    StackFrameEntry::Normal(stack_frames_for_assertions[1].clone()),
-                    StackFrameEntry::Normal(stack_frames_for_assertions[2].clone()),
-                    StackFrameEntry::Normal(stack_frames_for_assertions[3].clone()),
-                ]
-            );
-
-            // Toggle filter twice
-            stack_frame_list
-                .toggle_frame_filter(Some(project::debugger::session::ThreadStatus::Stopped), cx);
-            stack_frame_list
-                .toggle_frame_filter(Some(project::debugger::session::ThreadStatus::Stopped), cx);
-
-            // Verify entries remain expanded
-            assert_eq!(
-                stack_frame_list.entries(),
-                &vec![
-                    StackFrameEntry::Normal(stack_frames_for_assertions[0].clone()),
-                    StackFrameEntry::Normal(stack_frames_for_assertions[1].clone()),
-                    StackFrameEntry::Normal(stack_frames_for_assertions[2].clone()),
-                    StackFrameEntry::Normal(stack_frames_for_assertions[3].clone()),
-                ],
-                "Expanded entries should remain expanded after toggling filter"
-            );
        });
+
+    stack_frame_list.update(cx, |stack_frame_list, cx| {
+        let all_frames = stack_frame_list.flatten_entries(true, false);
+        assert_eq!(all_frames.len(), 5, "Should see all 5 frames initially");
+
+        stack_frame_list
+            .toggle_frame_filter(Some(project::debugger::session::ThreadStatus::Stopped), cx);
+        assert_eq!(
+            stack_frame_list.list_filter(),
+            StackFrameFilter::OnlyUserFrames
+        );
+    });
+
+    stack_frame_list.update(cx, |stack_frame_list, cx| {
+        let user_frames = stack_frame_list.dap_stack_frames(cx);
+        assert_eq!(user_frames.len(), 2, "Should only see 2 user frames");
+        assert_eq!(user_frames[0].name, "main");
+        assert_eq!(user_frames[1].name, "doSomething");
+
+        // Toggle back to all frames
+        stack_frame_list
+            .toggle_frame_filter(Some(project::debugger::session::ThreadStatus::Stopped), cx);
+        assert_eq!(stack_frame_list.list_filter(), StackFrameFilter::All);
+    });
+
+    stack_frame_list.update(cx, |stack_frame_list, cx| {
+        let all_frames_again = stack_frame_list.flatten_entries(true, false);
+        assert_eq!(
+            all_frames_again.len(),
+            5,
+            "Should see all 5 frames after toggling back"
+        );
+
+        // Test 3: Verify collapsed entries stay expanded
+        stack_frame_list.expand_collapsed_entry(1, cx);
+        assert_eq!(
+            stack_frame_list.entries(),
+            &vec![
+                StackFrameEntry::Normal(stack_frames_for_assertions[0].clone()),
+                StackFrameEntry::Normal(stack_frames_for_assertions[1].clone()),
+                StackFrameEntry::Normal(stack_frames_for_assertions[2].clone()),
+                StackFrameEntry::Normal(stack_frames_for_assertions[3].clone()),
+                StackFrameEntry::Normal(stack_frames_for_assertions[4].clone()),
+            ]
+        );
+
+        stack_frame_list
+            .toggle_frame_filter(Some(project::debugger::session::ThreadStatus::Stopped), cx);
+        assert_eq!(
+            stack_frame_list.list_filter(),
+            StackFrameFilter::OnlyUserFrames
+        );
+    });
+
+    stack_frame_list.update(cx, |stack_frame_list, cx| {
+        stack_frame_list
+            .toggle_frame_filter(Some(project::debugger::session::ThreadStatus::Stopped), cx);
+        assert_eq!(stack_frame_list.list_filter(), StackFrameFilter::All);
+    });
+
+    stack_frame_list.update(cx, |stack_frame_list, cx| {
+        stack_frame_list
+            .toggle_frame_filter(Some(project::debugger::session::ThreadStatus::Stopped), cx);
+        assert_eq!(
+            stack_frame_list.list_filter(),
+            StackFrameFilter::OnlyUserFrames
+        );
+
+        assert_eq!(
+            stack_frame_list.dap_stack_frames(cx).as_slice(),
+            &[
+                stack_frames_for_assertions[0].clone(),
+                stack_frames_for_assertions[4].clone()
+            ]
+        );
+
+        // Verify entries remain expanded
+        assert_eq!(
+            stack_frame_list.entries(),
+            &vec![
+                StackFrameEntry::Normal(stack_frames_for_assertions[0].clone()),
+                StackFrameEntry::Normal(stack_frames_for_assertions[1].clone()),
+                StackFrameEntry::Normal(stack_frames_for_assertions[2].clone()),
+                StackFrameEntry::Normal(stack_frames_for_assertions[3].clone()),
+                StackFrameEntry::Normal(stack_frames_for_assertions[4].clone()),
+            ],
+            "Expanded entries should remain expanded after toggling filter"
+        );
    });
 }
--- a/crates/deepseek/src/deepseek.rs
+++ b/crates/deepseek/src/deepseek.rs
@@ -96,7 +96,7 @@ impl Model {

    pub fn max_token_count(&self) -> u64 {
        match self {
-            Self::Chat | Self::Reasoner => 64_000,
+            Self::Chat | Self::Reasoner => 128_000,
            Self::Custom { max_tokens, .. } => *max_tokens,
        }
    }
@@ -104,7 +104,7 @@ impl Model {
    pub fn max_output_tokens(&self) -> Option<u64> {
        match self {
            Self::Chat => Some(8_192),
-            Self::Reasoner => Some(8_192),
+            Self::Reasoner => Some(64_000),
            Self::Custom {
                max_output_tokens, ..
            } => *max_output_tokens,
--- a/crates/diagnostics/src/buffer_diagnostics.rs
+++ b/crates/diagnostics/src/buffer_diagnostics.rs
@@ -0,0 +1,982 @@
+use crate::{
+    DIAGNOSTICS_UPDATE_DELAY, IncludeWarnings, ToggleWarnings, context_range_for_entry,
+    diagnostic_renderer::{DiagnosticBlock, DiagnosticRenderer},
+    toolbar_controls::DiagnosticsToolbarEditor,
+};
+use anyhow::Result;
+use collections::HashMap;
+use editor::{
+    Editor, EditorEvent, ExcerptRange, MultiBuffer, PathKey,
+    display_map::{BlockPlacement, BlockProperties, BlockStyle, CustomBlockId},
+    multibuffer_context_lines,
+};
+use gpui::{
+    AnyElement, App, AppContext, Context, Entity, EntityId, EventEmitter, FocusHandle, Focusable,
+    InteractiveElement, IntoElement, ParentElement, Render, SharedString, Styled, Subscription,
+    Task, WeakEntity, Window, actions, div,
+};
+use language::{Buffer, DiagnosticEntry, Point};
+use project::{
+    DiagnosticSummary, Event, Project, ProjectItem, ProjectPath,
+    project_settings::{DiagnosticSeverity, ProjectSettings},
+};
+use settings::Settings;
+use std::{
+    any::{Any, TypeId},
+    cmp::Ordering,
+    sync::Arc,
+};
+use text::{Anchor, BufferSnapshot, OffsetRangeExt};
+use ui::{Button, ButtonStyle, Icon, IconName, Label, Tooltip, h_flex, prelude::*};
+use util::paths::PathExt;
+use workspace::{
+    ItemHandle, ItemNavHistory, ToolbarItemLocation, Workspace,
+    item::{BreadcrumbText, Item, ItemEvent, TabContentParams},
+};
+
+actions!(
+    diagnostics,
+    [
+        /// Opens the project diagnostics view for the currently focused file.
+        DeployCurrentFile,
+    ]
+);
+
+/// The `BufferDiagnosticsEditor` is meant to be used when dealing specifically
+/// with diagnostics for a single buffer, as only the excerpts of the buffer
+/// where diagnostics are available are displayed.
+pub(crate) struct BufferDiagnosticsEditor {
+    pub project: Entity<Project>,
+    focus_handle: FocusHandle,
+    editor: Entity<Editor>,
+    /// The current diagnostic entries in the `BufferDiagnosticsEditor`. Used to
+    /// allow quick comparison of updated diagnostics, to confirm if anything
+    /// has changed.
+    pub(crate) diagnostics: Vec<DiagnosticEntry<Anchor>>,
+    /// The blocks used to display the diagnostics' content in the editor, next
+    /// to the excerpts where the diagnostic originated.
+    blocks: Vec<CustomBlockId>,
+    /// Multibuffer to contain all excerpts that contain diagnostics, which are
+    /// to be rendered in the editor.
+    multibuffer: Entity<MultiBuffer>,
+    /// The buffer for which the editor is displaying diagnostics and excerpts
+    /// for.
+    buffer: Option<Entity<Buffer>>,
+    /// The path for which the editor is displaying diagnostics for.
+    project_path: ProjectPath,
+    /// Summary of the number of warnings and errors for the path. Used to
+    /// display the number of warnings and errors in the tab's content.
+    summary: DiagnosticSummary,
+    /// Whether to include warnings in the list of diagnostics shown in the
+    /// editor.
+    pub(crate) include_warnings: bool,
+    /// Keeps track of whether there's a background task already running to
+    /// update the excerpts, in order to avoid firing multiple tasks for this purpose.
+    pub(crate) update_excerpts_task: Option<Task<Result<()>>>,
+    /// The project's subscription, responsible for processing events related to
+    /// diagnostics.
+    _subscription: Subscription,
+}
+
+impl BufferDiagnosticsEditor {
+    /// Creates new instance of the `BufferDiagnosticsEditor` which can then be
+    /// displayed by adding it to a pane.
+    pub fn new(
+        project_path: ProjectPath,
+        project_handle: Entity<Project>,
+        buffer: Option<Entity<Buffer>>,
+        include_warnings: bool,
+        window: &mut Window,
+        cx: &mut Context<Self>,
+    ) -> Self {
+        // Subscribe to project events related to diagnostics so the
+        // `BufferDiagnosticsEditor` can update its state accordingly.
+        let project_event_subscription = cx.subscribe_in(
+            &project_handle,
+            window,
+            |buffer_diagnostics_editor, _project, event, window, cx| match event {
+                Event::DiskBasedDiagnosticsStarted { .. } => {
+                    cx.notify();
+                }
+                Event::DiskBasedDiagnosticsFinished { .. } => {
+                    buffer_diagnostics_editor.update_all_excerpts(window, cx);
+                }
+                Event::DiagnosticsUpdated {
+                    paths,
+                    language_server_id,
+                } => {
+                    // When diagnostics have been updated, the
+                    // `BufferDiagnosticsEditor` should update its state only if
+                    // one of the paths matches its `project_path`, otherwise
+                    // the event should be ignored.
+                    if paths.contains(&buffer_diagnostics_editor.project_path) {
+                        buffer_diagnostics_editor.update_diagnostic_summary(cx);
+
+                        if buffer_diagnostics_editor.editor.focus_handle(cx).contains_focused(window, cx) || buffer_diagnostics_editor.focus_handle.contains_focused(window, cx) {
+                            log::debug!("diagnostics updated for server {language_server_id}. recording change");
+                        } else {
+                            log::debug!("diagnostics updated for server {language_server_id}. updating excerpts");
+                            buffer_diagnostics_editor.update_all_excerpts(window, cx);
+                        }
+                    }
+                }
+                _ => {}
+            },
+        );
+
+        let focus_handle = cx.focus_handle();
+
+        cx.on_focus_in(
+            &focus_handle,
+            window,
+            |buffer_diagnostics_editor, window, cx| buffer_diagnostics_editor.focus_in(window, cx),
+        )
+        .detach();
+
+        cx.on_focus_out(
+            &focus_handle,
+            window,
+            |buffer_diagnostics_editor, _event, window, cx| {
+                buffer_diagnostics_editor.focus_out(window, cx)
+            },
+        )
+        .detach();
+
+        let summary = project_handle
+            .read(cx)
+            .diagnostic_summary_for_path(&project_path, cx);
+
+        let multibuffer = cx.new(|cx| MultiBuffer::new(project_handle.read(cx).capability()));
+        let max_severity = Self::max_diagnostics_severity(include_warnings);
+        let editor = cx.new(|cx| {
+            let mut editor = Editor::for_multibuffer(
+                multibuffer.clone(),
+                Some(project_handle.clone()),
+                window,
+                cx,
+            );
+            editor.set_vertical_scroll_margin(5, cx);
+            editor.disable_inline_diagnostics();
+            editor.set_max_diagnostics_severity(max_severity, cx);
+            editor.set_all_diagnostics_active(cx);
+            editor
+        });
+
+        // Subscribe to events triggered by the editor in order to correctly
+        // update the buffer's excerpts.
+        cx.subscribe_in(
+            &editor,
+            window,
+            |buffer_diagnostics_editor, _editor, event: &EditorEvent, window, cx| {
+                cx.emit(event.clone());
+
+                match event {
+                    // If the user tries to focus on the editor but there's actually
+                    // no excerpts for the buffer, focus back on the
+                    // `BufferDiagnosticsEditor` instance.
+                    EditorEvent::Focused => {
+                        if buffer_diagnostics_editor.multibuffer.read(cx).is_empty() {
+                            window.focus(&buffer_diagnostics_editor.focus_handle);
+                        }
+                    }
+                    EditorEvent::Blurred => {
+                        buffer_diagnostics_editor.update_all_excerpts(window, cx)
+                    }
+                    _ => {}
+                }
+            },
+        )
+        .detach();
+
+        let diagnostics = vec![];
+        let update_excerpts_task = None;
+        let mut buffer_diagnostics_editor = Self {
+            project: project_handle,
+            focus_handle,
+            editor,
+            diagnostics,
+            blocks: Default::default(),
+            multibuffer,
+            buffer,
+            project_path,
+            summary,
+            include_warnings,
+            update_excerpts_task,
+            _subscription: project_event_subscription,
+        };
+
+        buffer_diagnostics_editor.update_all_diagnostics(window, cx);
+        buffer_diagnostics_editor
+    }
+
+    fn deploy(
+        workspace: &mut Workspace,
+        _: &DeployCurrentFile,
+        window: &mut Window,
+        cx: &mut Context<Workspace>,
+    ) {
+        // Determine the currently opened path by finding the active editor and
+        // finding the project path for the buffer.
+        // If there's no active editor with a project path, avoiding deploying
+        // the buffer diagnostics view.
+        if let Some(editor) = workspace.active_item_as::<Editor>(cx)
+            && let Some(project_path) = editor.project_path(cx)
+        {
+            // Check if there's already a `BufferDiagnosticsEditor` tab for this
+            // same path, and if so, focus on that one instead of creating a new
+            // one.
+            let existing_editor = workspace
+                .items_of_type::<BufferDiagnosticsEditor>(cx)
+                .find(|editor| editor.read(cx).project_path == project_path);
+
+            if let Some(editor) = existing_editor {
+                workspace.activate_item(&editor, true, true, window, cx);
+            } else {
+                let include_warnings = match cx.try_global::<IncludeWarnings>() {
+                    Some(include_warnings) => include_warnings.0,
+                    None => ProjectSettings::get_global(cx).diagnostics.include_warnings,
+                };
+
+                let item = cx.new(|cx| {
+                    Self::new(
+                        project_path,
+                        workspace.project().clone(),
+                        editor.read(cx).buffer().read(cx).as_singleton(),
+                        include_warnings,
+                        window,
+                        cx,
+                    )
+                });
+
+                workspace.add_item_to_active_pane(Box::new(item), None, true, window, cx);
+            }
+        }
+    }
+
+    pub fn register(
+        workspace: &mut Workspace,
+        _window: Option<&mut Window>,
+        _: &mut Context<Workspace>,
+    ) {
+        workspace.register_action(Self::deploy);
+    }
+
+    fn update_all_diagnostics(&mut self, window: &mut Window, cx: &mut Context<Self>) {
+        self.update_all_excerpts(window, cx);
+    }
+
+    fn update_diagnostic_summary(&mut self, cx: &mut Context<Self>) {
+        let project = self.project.read(cx);
+
+        self.summary = project.diagnostic_summary_for_path(&self.project_path, cx);
+    }
+
+    /// Enqueue an update to the excerpts and diagnostic blocks being shown in
+    /// the editor.
+    pub(crate) fn update_all_excerpts(&mut self, window: &mut Window, cx: &mut Context<Self>) {
+        // If there's already a task updating the excerpts, early return and let
+        // the other task finish.
+        if self.update_excerpts_task.is_some() {
+            return;
+        }
+
+        let buffer = self.buffer.clone();
+
+        self.update_excerpts_task = Some(cx.spawn_in(window, async move |editor, cx| {
+            cx.background_executor()
+                .timer(DIAGNOSTICS_UPDATE_DELAY)
+                .await;
+
+            if let Some(buffer) = buffer {
+                editor
+                    .update_in(cx, |editor, window, cx| {
+                        editor.update_excerpts(buffer, window, cx)
+                    })?
+                    .await?;
+            };
+
+            let _ = editor.update(cx, |editor, cx| {
+                editor.update_excerpts_task = None;
+                cx.notify();
+            });
+
+            Ok(())
+        }));
+    }
+
+    /// Updates the excerpts in the `BufferDiagnosticsEditor` for a single
+    /// buffer.
+    fn update_excerpts(
+        &mut self,
+        buffer: Entity<Buffer>,
+        window: &mut Window,
+        cx: &mut Context<Self>,
+    ) -> Task<Result<()>> {
+        let was_empty = self.multibuffer.read(cx).is_empty();
+        let multibuffer_context = multibuffer_context_lines(cx);
+        let buffer_snapshot = buffer.read(cx).snapshot();
+        let buffer_snapshot_max = buffer_snapshot.max_point();
+        let max_severity = Self::max_diagnostics_severity(self.include_warnings)
+            .into_lsp()
+            .unwrap_or(lsp::DiagnosticSeverity::WARNING);
+
+        cx.spawn_in(window, async move |buffer_diagnostics_editor, mut cx| {
+            // Fetch the diagnostics for the whole of the buffer
+            // (`Point::zero()..buffer_snapshot.max_point()`) so we can confirm
+            // if the diagnostics changed, if it didn't, early return as there's
+            // nothing to update.
+            let diagnostics = buffer_snapshot
+                .diagnostics_in_range::<_, Anchor>(Point::zero()..buffer_snapshot_max, false)
+                .collect::<Vec<_>>();
+
+            let unchanged =
+                buffer_diagnostics_editor.update(cx, |buffer_diagnostics_editor, _cx| {
+                    if buffer_diagnostics_editor
+                        .diagnostics_are_unchanged(&diagnostics, &buffer_snapshot)
+                    {
+                        return true;
+                    }
+
+                    buffer_diagnostics_editor.set_diagnostics(&diagnostics);
+                    return false;
+                })?;
+
+            if unchanged {
+                return Ok(());
+            }
+
+            // Mapping between the Group ID and a vector of DiagnosticEntry.
+            let mut grouped: HashMap<usize, Vec<_>> = HashMap::default();
+            for entry in diagnostics {
+                grouped
+                    .entry(entry.diagnostic.group_id)
+                    .or_default()
+                    .push(DiagnosticEntry {
+                        range: entry.range.to_point(&buffer_snapshot),
+                        diagnostic: entry.diagnostic,
+                    })
+            }
+
+            let mut blocks: Vec<DiagnosticBlock> = Vec::new();
+            for (_, group) in grouped {
+                // If the minimum severity of the group is higher than the
+                // maximum severity, or it doesn't even have severity, skip this
+                // group.
+                if group
+                    .iter()
+                    .map(|d| d.diagnostic.severity)
+                    .min()
+                    .is_none_or(|severity| severity > max_severity)
+                {
+                    continue;
+                }
+
+                let diagnostic_blocks = cx.update(|_window, cx| {
+                    DiagnosticRenderer::diagnostic_blocks_for_group(
+                        group,
+                        buffer_snapshot.remote_id(),
+                        Some(Arc::new(buffer_diagnostics_editor.clone())),
+                        cx,
+                    )
+                })?;
+
+                // For each of the diagnostic blocks to be displayed in the
+                // editor, figure out its index in the list of blocks.
+                //
+                // The following rules are used to determine the order:
+                // 1. Blocks with a lower start position should come first.
+                // 2. If two blocks have the same start position, the one with
+                // the higher end position should come first.
+                for diagnostic_block in diagnostic_blocks {
+                    let index = blocks.partition_point(|probe| {
+                        match probe
+                            .initial_range
+                            .start
+                            .cmp(&diagnostic_block.initial_range.start)
+                        {
+                            Ordering::Less => true,
+                            Ordering::Greater => false,
+                            Ordering::Equal => {
+                                probe.initial_range.end > diagnostic_block.initial_range.end
+                            }
+                        }
+                    });
+
+                    blocks.insert(index, diagnostic_block);
+                }
+            }
+
+            // Build the excerpt ranges for this specific buffer's diagnostics,
+            // so those excerpts can later be used to update the excerpts shown
+            // in the editor.
+            // This is done by iterating over the list of diagnostic blocks and
+            // determine what range does the diagnostic block span.
+            let mut excerpt_ranges: Vec<ExcerptRange<Point>> = Vec::new();
+
+            for diagnostic_block in blocks.iter() {
+                let excerpt_range = context_range_for_entry(
+                    diagnostic_block.initial_range.clone(),
+                    multibuffer_context,
+                    buffer_snapshot.clone(),
+                    &mut cx,
+                )
+                .await;
+
+                let index = excerpt_ranges
+                    .binary_search_by(|probe| {
+                        probe
+                            .context
+                            .start
+                            .cmp(&excerpt_range.start)
+                            .then(probe.context.end.cmp(&excerpt_range.end))
+                            .then(
+                                probe
+                                    .primary
+                                    .start
+                                    .cmp(&diagnostic_block.initial_range.start),
+                            )
+                            .then(probe.primary.end.cmp(&diagnostic_block.initial_range.end))
+                            .then(Ordering::Greater)
+                    })
+                    .unwrap_or_else(|index| index);
+
+                excerpt_ranges.insert(
+                    index,
+                    ExcerptRange {
+                        context: excerpt_range,
+                        primary: diagnostic_block.initial_range.clone(),
+                    },
+                )
+            }
+
+            // Finally, update the editor's content with the new excerpt ranges
+            // for this editor, as well as the diagnostic blocks.
+            buffer_diagnostics_editor.update_in(cx, |buffer_diagnostics_editor, window, cx| {
+                // Remove the list of `CustomBlockId` from the editor's display
+                // map, ensuring that if any diagnostics have been solved, the
+                // associated block stops being shown.
+                let block_ids = buffer_diagnostics_editor.blocks.clone();
+
+                buffer_diagnostics_editor.editor.update(cx, |editor, cx| {
+                    editor.display_map.update(cx, |display_map, cx| {
+                        display_map.remove_blocks(block_ids.into_iter().collect(), cx);
+                    })
+                });
+
+                let (anchor_ranges, _) =
+                    buffer_diagnostics_editor
+                        .multibuffer
+                        .update(cx, |multibuffer, cx| {
+                            multibuffer.set_excerpt_ranges_for_path(
+                                PathKey::for_buffer(&buffer, cx),
+                                buffer.clone(),
+                                &buffer_snapshot,
+                                excerpt_ranges,
+                                cx,
+                            )
+                        });
+
+                if was_empty {
+                    if let Some(anchor_range) = anchor_ranges.first() {
+                        let range_to_select = anchor_range.start..anchor_range.start;
+
+                        buffer_diagnostics_editor.editor.update(cx, |editor, cx| {
+                            editor.change_selections(Default::default(), window, cx, |selection| {
+                                selection.select_anchor_ranges([range_to_select])
+                            })
+                        });
+
+                        // If the `BufferDiagnosticsEditor` is currently
+                        // focused, move focus to its editor.
+                        if buffer_diagnostics_editor.focus_handle.is_focused(window) {
+                            buffer_diagnostics_editor
+                                .editor
+                                .read(cx)
+                                .focus_handle(cx)
+                                .focus(window);
+                        }
+                    }
+                }
+
+                // Cloning the blocks before moving ownership so these can later
+                // be used to set the block contents for testing purposes.
+                #[cfg(test)]
+                let cloned_blocks = blocks.clone();
+
+                // Build new diagnostic blocks to be added to the editor's
+                // display map for the new diagnostics. Update the `blocks`
+                // property before finishing, to ensure the blocks are removed
+                // on the next execution.
+                let editor_blocks =
+                    anchor_ranges
+                        .into_iter()
+                        .zip(blocks.into_iter())
+                        .map(|(anchor, block)| {
+                            let editor = buffer_diagnostics_editor.editor.downgrade();
+
+                            BlockProperties {
+                                placement: BlockPlacement::Near(anchor.start),
+                                height: Some(1),
+                                style: BlockStyle::Flex,
+                                render: Arc::new(move |block_context| {
+                                    block.render_block(editor.clone(), block_context)
+                                }),
+                                priority: 1,
+                            }
+                        });
+
+                let block_ids = buffer_diagnostics_editor.editor.update(cx, |editor, cx| {
+                    editor.display_map.update(cx, |display_map, cx| {
+                        display_map.insert_blocks(editor_blocks, cx)
+                    })
+                });
+
+                // In order to be able to verify which diagnostic blocks are
+                // rendered in the editor, the `set_block_content_for_tests`
+                // function must be used, so that the
+                // `editor::test::editor_content_with_blocks` function can then
+                // be called to fetch these blocks.
+                #[cfg(test)]
+                {
+                    for (block_id, block) in block_ids.iter().zip(cloned_blocks.iter()) {
+                        let markdown = block.markdown.clone();
+                        editor::test::set_block_content_for_tests(
+                            &buffer_diagnostics_editor.editor,
+                            *block_id,
+                            cx,
+                            move |cx| {
+                                markdown::MarkdownElement::rendered_text(
+                                    markdown.clone(),
+                                    cx,
+                                    editor::hover_popover::diagnostics_markdown_style,
+                                )
+                            },
+                        );
+                    }
+                }
+
+                buffer_diagnostics_editor.blocks = block_ids;
+                cx.notify()
+            })
+        })
+    }
+
+    fn set_diagnostics(&mut self, diagnostics: &Vec<DiagnosticEntry<Anchor>>) {
+        self.diagnostics = diagnostics.clone();
+    }
+
+    fn diagnostics_are_unchanged(
+        &self,
+        diagnostics: &Vec<DiagnosticEntry<Anchor>>,
+        snapshot: &BufferSnapshot,
+    ) -> bool {
+        if self.diagnostics.len() != diagnostics.len() {
+            return false;
+        }
+
+        self.diagnostics
+            .iter()
+            .zip(diagnostics.iter())
+            .all(|(existing, new)| {
+                existing.diagnostic.message == new.diagnostic.message
+                    && existing.diagnostic.severity == new.diagnostic.severity
+                    && existing.diagnostic.is_primary == new.diagnostic.is_primary
+                    && existing.range.to_offset(snapshot) == new.range.to_offset(snapshot)
+            })
+    }
+
+    fn focus_in(&mut self, window: &mut Window, cx: &mut Context<Self>) {
+        // If the `BufferDiagnosticsEditor` is focused and the multibuffer is
+        // not empty, focus on the editor instead, which will allow the user to
+        // start interacting and editing the buffer's contents.
+        if self.focus_handle.is_focused(window) && !self.multibuffer.read(cx).is_empty() {
+            self.editor.focus_handle(cx).focus(window)
+        }
+    }
+
+    fn focus_out(&mut self, window: &mut Window, cx: &mut Context<Self>) {
+        if !self.focus_handle.is_focused(window) && !self.editor.focus_handle(cx).is_focused(window)
+        {
+            self.update_all_excerpts(window, cx);
+        }
+    }
+
+    pub fn toggle_warnings(
+        &mut self,
+        _: &ToggleWarnings,
+        window: &mut Window,
+        cx: &mut Context<Self>,
+    ) {
+        let include_warnings = !self.include_warnings;
+        let max_severity = Self::max_diagnostics_severity(include_warnings);
+
+        self.editor.update(cx, |editor, cx| {
+            editor.set_max_diagnostics_severity(max_severity, cx);
+        });
+
+        self.include_warnings = include_warnings;
+        self.diagnostics.clear();
+        self.update_all_diagnostics(window, cx);
+    }
+
+    fn max_diagnostics_severity(include_warnings: bool) -> DiagnosticSeverity {
+        match include_warnings {
+            true => DiagnosticSeverity::Warning,
+            false => DiagnosticSeverity::Error,
+        }
+    }
+
+    #[cfg(test)]
+    pub fn editor(&self) -> &Entity<Editor> {
+        &self.editor
+    }
+
+    #[cfg(test)]
+    pub fn summary(&self) -> &DiagnosticSummary {
+        &self.summary
+    }
+}
+
+impl Focusable for BufferDiagnosticsEditor {
+    fn focus_handle(&self, _: &App) -> FocusHandle {
+        self.focus_handle.clone()
+    }
+}
+
+impl EventEmitter<EditorEvent> for BufferDiagnosticsEditor {}
+
+impl Item for BufferDiagnosticsEditor {
+    type Event = EditorEvent;
+
+    fn act_as_type<'a>(
+        &'a self,
+        type_id: std::any::TypeId,
+        self_handle: &'a Entity<Self>,
+        _: &'a App,
+    ) -> Option<gpui::AnyView> {
+        if type_id == TypeId::of::<Self>() {
+            Some(self_handle.to_any())
+        } else if type_id == TypeId::of::<Editor>() {
+            Some(self.editor.to_any())
+        } else {
+            None
+        }
+    }
+
+    fn added_to_workspace(
+        &mut self,
+        workspace: &mut Workspace,
+        window: &mut Window,
+        cx: &mut Context<Self>,
+    ) {
+        self.editor.update(cx, |editor, cx| {
+            editor.added_to_workspace(workspace, window, cx)
+        });
+    }
+
+    fn breadcrumb_location(&self, _: &App) -> ToolbarItemLocation {
+        ToolbarItemLocation::PrimaryLeft
+    }
+
+    fn breadcrumbs(&self, theme: &theme::Theme, cx: &App) -> Option<Vec<BreadcrumbText>> {
+        self.editor.breadcrumbs(theme, cx)
+    }
+
+    fn can_save(&self, _cx: &App) -> bool {
+        true
+    }
+
+    fn clone_on_split(
+        &self,
+        _workspace_id: Option<workspace::WorkspaceId>,
+        window: &mut Window,
+        cx: &mut Context<Self>,
+    ) -> Option<Entity<Self>>
+    where
+        Self: Sized,
+    {
+        Some(cx.new(|cx| {
+            BufferDiagnosticsEditor::new(
+                self.project_path.clone(),
+                self.project.clone(),
+                self.buffer.clone(),
+                self.include_warnings,
+                window,
+                cx,
+            )
+        }))
+    }
+
+    fn deactivated(&mut self, window: &mut Window, cx: &mut Context<Self>) {
+        self.editor
+            .update(cx, |editor, cx| editor.deactivated(window, cx));
+    }
+
+    fn for_each_project_item(&self, cx: &App, f: &mut dyn FnMut(EntityId, &dyn ProjectItem)) {
+        self.editor.for_each_project_item(cx, f);
+    }
+
+    fn has_conflict(&self, cx: &App) -> bool {
+        self.multibuffer.read(cx).has_conflict(cx)
+    }
+
+    fn has_deleted_file(&self, cx: &App) -> bool {
+        self.multibuffer.read(cx).has_deleted_file(cx)
+    }
+
+    fn is_dirty(&self, cx: &App) -> bool {
+        self.multibuffer.read(cx).is_dirty(cx)
+    }
+
+    fn is_singleton(&self, _cx: &App) -> bool {
+        false
+    }
+
+    fn navigate(
+        &mut self,
+        data: Box<dyn Any>,
+        window: &mut Window,
+        cx: &mut Context<Self>,
+    ) -> bool {
+        self.editor
+            .update(cx, |editor, cx| editor.navigate(data, window, cx))
+    }
+
+    fn reload(
+        &mut self,
+        project: Entity<Project>,
+        window: &mut Window,
+        cx: &mut Context<Self>,
+    ) -> Task<Result<()>> {
+        self.editor.reload(project, window, cx)
+    }
+
+    fn save(
+        &mut self,
+        options: workspace::item::SaveOptions,
+        project: Entity<Project>,
+        window: &mut Window,
+        cx: &mut Context<Self>,
+    ) -> Task<Result<()>> {
+        self.editor.save(options, project, window, cx)
+    }
+
+    fn save_as(
+        &mut self,
+        _project: Entity<Project>,
+        _path: ProjectPath,
+        _window: &mut Window,
+        _cx: &mut Context<Self>,
+    ) -> Task<Result<()>> {
+        unreachable!()
+    }
+
+    fn set_nav_history(
+        &mut self,
+        nav_history: ItemNavHistory,
+        _window: &mut Window,
+        cx: &mut Context<Self>,
+    ) {
+        self.editor.update(cx, |editor, _| {
+            editor.set_nav_history(Some(nav_history));
+        })
+    }
+
+    // Builds the content to be displayed in the tab.
+    fn tab_content(&self, params: TabContentParams, _window: &Window, _cx: &App) -> AnyElement {
+        let error_count = self.summary.error_count;
+        let warning_count = self.summary.warning_count;
+        let label = Label::new(
+            self.project_path
+                .path
+                .file_name()
+                .map(|f| f.to_sanitized_string())
+                .unwrap_or_else(|| self.project_path.path.to_sanitized_string()),
+        );
+
+        h_flex()
+            .gap_1()
+            .child(label)
+            .when(error_count == 0 && warning_count == 0, |parent| {
+                parent.child(
+                    h_flex()
+                        .gap_1()
+                        .child(Icon::new(IconName::Check).color(Color::Success)),
+                )
+            })
+            .when(error_count > 0, |parent| {
+                parent.child(
+                    h_flex()
+                        .gap_1()
+                        .child(Icon::new(IconName::XCircle).color(Color::Error))
+                        .child(Label::new(error_count.to_string()).color(params.text_color())),
+                )
+            })
+            .when(warning_count > 0, |parent| {
+                parent.child(
+                    h_flex()
+                        .gap_1()
+                        .child(Icon::new(IconName::Warning).color(Color::Warning))
+                        .child(Label::new(warning_count.to_string()).color(params.text_color())),
+                )
+            })
+            .into_any_element()
+    }
+
+    fn tab_content_text(&self, _detail: usize, _app: &App) -> SharedString {
+        "Buffer Diagnostics".into()
+    }
+
+    fn tab_tooltip_text(&self, _: &App) -> Option<SharedString> {
+        Some(
+            format!(
+                "Buffer Diagnostics - {}",
+                self.project_path.path.to_sanitized_string()
+            )
+            .into(),
+        )
+    }
+
+    fn telemetry_event_text(&self) -> Option<&'static str> {
+        Some("Buffer Diagnostics Opened")
+    }
+
+    fn to_item_events(event: &EditorEvent, f: impl FnMut(ItemEvent)) {
+        Editor::to_item_events(event, f)
+    }
+}
+
+impl Render for BufferDiagnosticsEditor {
+    fn render(&mut self, _: &mut Window, cx: &mut Context<Self>) -> impl IntoElement {
+        let filename = self.project_path.path.to_sanitized_string();
+        let error_count = self.summary.error_count;
+        let warning_count = match self.include_warnings {
+            true => self.summary.warning_count,
+            false => 0,
+        };
+
+        let child = if error_count + warning_count == 0 {
+            let label = match warning_count {
+                0 => "No problems in",
+                _ => "No errors in",
+            };
+
+            v_flex()
+                .key_context("EmptyPane")
+                .size_full()
+                .gap_1()
+                .justify_center()
+                .items_center()
+                .text_center()
+                .bg(cx.theme().colors().editor_background)
+                .child(
+                    div()
+                        .h_flex()
+                        .child(Label::new(label).color(Color::Muted))
+                        .child(
+                            Button::new("open-file", filename)
+                                .style(ButtonStyle::Transparent)
+                                .tooltip(Tooltip::text("Open File"))
+                                .on_click(cx.listener(|buffer_diagnostics, _, window, cx| {
+                                    if let Some(workspace) = window.root::<Workspace>().flatten() {
+                                        workspace.update(cx, |workspace, cx| {
+                                            workspace
+                                                .open_path(
+                                                    buffer_diagnostics.project_path.clone(),
+                                                    None,
+                                                    true,
+                                                    window,
+                                                    cx,
+                                                )
+                                                .detach_and_log_err(cx);
+                                        })
+                                    }
+                                })),
+                        ),
+                )
+                .when(self.summary.warning_count > 0, |div| {
+                    let label = match self.summary.warning_count {
+                        1 => "Show 1 warning".into(),
+                        warning_count => format!("Show {} warnings", warning_count),
+                    };
+
+                    div.child(
+                        Button::new("diagnostics-show-warning-label", label).on_click(cx.listener(
+                            |buffer_diagnostics_editor, _, window, cx| {
+                                buffer_diagnostics_editor.toggle_warnings(
+                                    &Default::default(),
+                                    window,
+                                    cx,
+                                );
+                                cx.notify();
+                            },
+                        )),
+                    )
+                })
+        } else {
+            div().size_full().child(self.editor.clone())
+        };
+
+        div()
+            .key_context("Diagnostics")
+            .track_focus(&self.focus_handle(cx))
+            .size_full()
+            .child(child)
+    }
+}
+
+impl DiagnosticsToolbarEditor for WeakEntity<BufferDiagnosticsEditor> {
+    fn include_warnings(&self, cx: &App) -> bool {
+        self.read_with(cx, |buffer_diagnostics_editor, _cx| {
+            buffer_diagnostics_editor.include_warnings
+        })
+        .unwrap_or(false)
+    }
+
+    fn has_stale_excerpts(&self, _cx: &App) -> bool {
+        false
+    }
+
+    fn is_updating(&self, cx: &App) -> bool {
+        self.read_with(cx, |buffer_diagnostics_editor, cx| {
+            buffer_diagnostics_editor.update_excerpts_task.is_some()
+                || buffer_diagnostics_editor
+                    .project
+                    .read(cx)
+                    .language_servers_running_disk_based_diagnostics(cx)
+                    .next()
+                    .is_some()
+        })
+        .unwrap_or(false)
+    }
+
+    fn stop_updating(&self, cx: &mut App) {
+        let _ = self.update(cx, |buffer_diagnostics_editor, cx| {
+            buffer_diagnostics_editor.update_excerpts_task = None;
+            cx.notify();
+        });
+    }
+
+    fn refresh_diagnostics(&self, window: &mut Window, cx: &mut App) {
+        let _ = self.update(cx, |buffer_diagnostics_editor, cx| {
+            buffer_diagnostics_editor.update_all_excerpts(window, cx);
+        });
+    }
+
+    fn toggle_warnings(&self, window: &mut Window, cx: &mut App) {
+        let _ = self.update(cx, |buffer_diagnostics_editor, cx| {
+            buffer_diagnostics_editor.toggle_warnings(&Default::default(), window, cx);
+        });
+    }
+
+    fn get_diagnostics_for_buffer(
+        &self,
+        _buffer_id: text::BufferId,
+        cx: &App,
+    ) -> Vec<language::DiagnosticEntry<text::Anchor>> {
+        self.read_with(cx, |buffer_diagnostics_editor, _cx| {
+            buffer_diagnostics_editor.diagnostics.clone()
+        })
+        .unwrap_or_default()
+    }
+}
--- a/crates/diagnostics/src/diagnostic_renderer.rs
+++ b/crates/diagnostics/src/diagnostic_renderer.rs
@@ -18,7 +18,7 @@ use ui::{
 };
 use util::maybe;

-use crate::ProjectDiagnosticsEditor;
+use crate::toolbar_controls::DiagnosticsToolbarEditor;

 pub struct DiagnosticRenderer;

@@ -26,7 +26,7 @@ impl DiagnosticRenderer {
    pub fn diagnostic_blocks_for_group(
        diagnostic_group: Vec<DiagnosticEntry<Point>>,
        buffer_id: BufferId,
-        diagnostics_editor: Option<WeakEntity<ProjectDiagnosticsEditor>>,
+        diagnostics_editor: Option<Arc<dyn DiagnosticsToolbarEditor>>,
        cx: &mut App,
    ) -> Vec<DiagnosticBlock> {
        let Some(primary_ix) = diagnostic_group
@@ -130,6 +130,7 @@ impl editor::DiagnosticRenderer for DiagnosticRenderer {
        cx: &mut App,
    ) -> Vec<BlockProperties<Anchor>> {
        let blocks = Self::diagnostic_blocks_for_group(diagnostic_group, buffer_id, None, cx);
+
        blocks
            .into_iter()
            .map(|block| {
@@ -182,7 +183,7 @@ pub(crate) struct DiagnosticBlock {
    pub(crate) initial_range: Range<Point>,
    pub(crate) severity: DiagnosticSeverity,
    pub(crate) markdown: Entity<Markdown>,
-    pub(crate) diagnostics_editor: Option<WeakEntity<ProjectDiagnosticsEditor>>,
+    pub(crate) diagnostics_editor: Option<Arc<dyn DiagnosticsToolbarEditor>>,
 }

 impl DiagnosticBlock {
@@ -233,7 +234,7 @@ impl DiagnosticBlock {

    pub fn open_link(
        editor: &mut Editor,
-        diagnostics_editor: &Option<WeakEntity<ProjectDiagnosticsEditor>>,
+        diagnostics_editor: &Option<Arc<dyn DiagnosticsToolbarEditor>>,
        link: SharedString,
        window: &mut Window,
        cx: &mut Context<Editor>,
@@ -254,18 +255,10 @@ impl DiagnosticBlock {

        if let Some(diagnostics_editor) = diagnostics_editor {
            if let Some(diagnostic) = diagnostics_editor
-                .read_with(cx, |diagnostics, _| {
-                    diagnostics
-                        .diagnostics
-                        .get(&buffer_id)
-                        .cloned()
-                        .unwrap_or_default()
-                        .into_iter()
-                        .filter(|d| d.diagnostic.group_id == group_id)
-                        .nth(ix)
-                })
-                .ok()
-                .flatten()
+                .get_diagnostics_for_buffer(buffer_id, cx)
+                .into_iter()
+                .filter(|d| d.diagnostic.group_id == group_id)
+                .nth(ix)
            {
                let multibuffer = editor.buffer().read(cx);
                let Some(snapshot) = multibuffer
@@ -297,9 +290,9 @@ impl DiagnosticBlock {
        };
    }

-    fn jump_to<T: ToOffset>(
+    fn jump_to<I: ToOffset>(
        editor: &mut Editor,
-        range: Range<T>,
+        range: Range<I>,
        window: &mut Window,
        cx: &mut Context<Editor>,
    ) {
--- a/Show More
+++ b/Show More