Remove util::extend_sorted and its remaining use in fs watching

2024-12-31 15:32:23 -07:00
187 changed files with 3109 additions and 4866 deletions
--- a/.github/workflows/ci.yml
+++ b/.github/workflows/ci.yml
@@ -35,12 +35,7 @@ jobs:
      - name: Check for non-docs changes
        id: check_changes
        run: |
-          if [ "${{ github.event_name }}" == "merge_group" ]; then
-            # When we're running in a merge queue, never assume that the changes
-            # are docs-only, as there could be other PRs in the group that
-            # contain non-docs changes.
-            echo "docs_only=false" >> $GITHUB_OUTPUT
-          elif git diff --name-only ${{ github.event.pull_request.base.sha }} ${{ github.sha }} | grep -qvE '^docs/'; then
+          if git diff --name-only ${{ github.event.pull_request.base.sha }} ${{ github.sha }} | grep -qvE '^docs/'; then
            echo "docs_only=false" >> $GITHUB_OUTPUT
          else
            echo "docs_only=true" >> $GITHUB_OUTPUT
@@ -180,7 +175,7 @@ jobs:

      - name: Cache dependencies
        if: needs.check_docs_only.outputs.docs_only == 'false'
-        uses: swatinem/rust-cache@f0deed1e0edfc6a9be95417288c0e1099b1eeec3 # v2
+        uses: swatinem/rust-cache@82a92a6e8fbeee089604da2575dc567ae9ddeaab # v2
        with:
          save-if: ${{ github.ref == 'refs/heads/main' }}
          cache-provider: "buildjet"
@@ -221,7 +216,7 @@ jobs:

      - name: Cache dependencies
        if: needs.check_docs_only.outputs.docs_only == 'false'
-        uses: swatinem/rust-cache@f0deed1e0edfc6a9be95417288c0e1099b1eeec3 # v2
+        uses: swatinem/rust-cache@82a92a6e8fbeee089604da2575dc567ae9ddeaab # v2
        with:
          save-if: ${{ github.ref == 'refs/heads/main' }}
          cache-provider: "buildjet"
@@ -252,7 +247,7 @@ jobs:

      - name: Cache dependencies
        if: needs.check_docs_only.outputs.docs_only == 'false'
-        uses: swatinem/rust-cache@f0deed1e0edfc6a9be95417288c0e1099b1eeec3 # v2
+        uses: swatinem/rust-cache@82a92a6e8fbeee089604da2575dc567ae9ddeaab # v2
        with:
          save-if: ${{ github.ref == 'refs/heads/main' }}
          cache-provider: "github"
--- a/.github/workflows/publish_extension_cli.yml
+++ b/.github/workflows/publish_extension_cli.yml
@@ -21,7 +21,7 @@ jobs:
          clean: false

      - name: Cache dependencies
-        uses: swatinem/rust-cache@f0deed1e0edfc6a9be95417288c0e1099b1eeec3 # v2
+        uses: swatinem/rust-cache@82a92a6e8fbeee089604da2575dc567ae9ddeaab # v2
        with:
          save-if: ${{ github.ref == 'refs/heads/main' }}
          cache-provider: "github"
--- a/Cargo.lock
+++ b/Cargo.lock
@@ -245,7 +245,7 @@ dependencies = [
 "schemars",
 "serde",
 "serde_json",
- "strum",
+ "strum 0.25.0",
 "thiserror 1.0.69",
 "util",
 ]
@@ -435,7 +435,7 @@ dependencies = [
 "similar",
 "smallvec",
 "smol",
- "strum",
+ "strum 0.25.0",
 "telemetry_events",
 "terminal",
 "terminal_view",
@@ -494,6 +494,7 @@ dependencies = [
 "project",
 "proto",
 "rand 0.8.5",
+ "release_channel",
 "rope",
 "schemars",
 "serde",
@@ -2151,7 +2152,7 @@ dependencies = [
 "cap-primitives",
 "cap-std",
 "io-lifetimes 2.0.4",
- "windows-sys 0.59.0",
+ "windows-sys 0.52.0",
 ]

 [[package]]
@@ -2179,7 +2180,7 @@ dependencies = [
 "ipnet",
 "maybe-owned",
 "rustix 0.38.42",
- "windows-sys 0.59.0",
+ "windows-sys 0.52.0",
 "winx",
 ]

@@ -2274,7 +2275,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index"
 checksum = "3fce8dd7fcfcbf3a0a87d8f515194b49d6135acab73e18bd380d1d93bb1a15eb"
 dependencies = [
 "heck 0.4.1",
- "indexmap",
+ "indexmap 2.7.0",
 "log",
 "proc-macro2",
 "quote",
@@ -2715,7 +2716,7 @@ dependencies = [
 "settings",
 "sha2",
 "sqlx",
- "strum",
+ "strum 0.25.0",
 "subtle",
 "supermaven_api",
 "telemetry_events",
@@ -2784,8 +2785,7 @@ dependencies = [
 name = "collections"
 version = "0.1.0"
 dependencies = [
- "indexmap",
- "rustc-hash 2.1.0",
+ "rustc-hash 1.1.0",
 ]

 [[package]]
@@ -2994,7 +2994,7 @@ dependencies = [
 "serde_json",
 "settings",
 "smol",
- "strum",
+ "strum 0.25.0",
 "task",
 "theme",
 "ui",
@@ -4145,7 +4145,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index"
 checksum = "33d852cb9b869c2a9b3df2f71a3074817f01e1844f839a144f5fcef059a4eb5d"
 dependencies = [
 "libc",
- "windows-sys 0.59.0",
+ "windows-sys 0.52.0",
 ]

 [[package]]
@@ -4812,7 +4812,7 @@ checksum = "5e2e6123af26f0f2c51cc66869137080199406754903cc926a7690401ce09cb4"
 dependencies = [
 "io-lifetimes 2.0.4",
 "rustix 0.38.42",
- "windows-sys 0.59.0",
+ "windows-sys 0.52.0",
 ]

 [[package]]
@@ -5102,7 +5102,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index"
 checksum = "40ecd4077b5ae9fd2e9e169b102c6c330d0605168eb0e8bf79952b256dbefffd"
 dependencies = [
 "fallible-iterator",
- "indexmap",
+ "indexmap 2.7.0",
 "stable_deref_trait",
 ]

@@ -5194,7 +5194,6 @@ dependencies = [
 "util",
 "windows 0.58.0",
 "workspace",
- "worktree",
 ]

 [[package]]
@@ -5275,7 +5274,7 @@ dependencies = [
 "schemars",
 "serde",
 "serde_json",
- "strum",
+ "strum 0.25.0",
 ]

 [[package]]
@@ -5375,7 +5374,7 @@ dependencies = [
 "slotmap",
 "smallvec",
 "smol",
- "strum",
+ "strum 0.25.0",
 "sum_tree",
 "taffy",
 "thiserror 1.0.69",
@@ -5435,7 +5434,7 @@ dependencies = [
 "futures-sink",
 "futures-util",
 "http 0.2.12",
- "indexmap",
+ "indexmap 2.7.0",
 "slab",
 "tokio",
 "tokio-util",
@@ -5454,7 +5453,7 @@ dependencies = [
 "futures-core",
 "futures-sink",
 "http 1.2.0",
- "indexmap",
+ "indexmap 2.7.0",
 "slab",
 "tokio",
 "tokio-util",
@@ -6233,16 +6232,27 @@ dependencies = [
 "heed",
 "html_to_markdown",
 "http_client",
- "indexmap",
+ "indexmap 1.9.3",
 "indoc",
 "parking_lot",
 "paths",
 "pretty_assertions",
 "serde",
- "strum",
+ "strum 0.25.0",
 "util",
 ]

+[[package]]
+name = "indexmap"
+version = "1.9.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "bd070e393353796e801d209ad339e89596eb4c8d430d18ede6a1cced8fafbd99"
+dependencies = [
+ "autocfg",
+ "hashbrown 0.12.3",
+ "serde",
+]
+
 [[package]]
 name = "indexmap"
 version = "2.7.0"
@@ -6378,7 +6388,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index"
 checksum = "2285ddfe3054097ef4b2fe909ef8c3bcd1ea52a8f0d274416caebeef39f04a65"
 dependencies = [
 "io-lifetimes 2.0.4",
- "windows-sys 0.59.0",
+ "windows-sys 0.52.0",
 ]

 [[package]]
@@ -6765,7 +6775,7 @@ dependencies = [
 "serde",
 "serde_json",
 "smol",
- "strum",
+ "strum 0.25.0",
 "ui",
 "util",
 ]
@@ -6811,7 +6821,7 @@ dependencies = [
 "serde_json",
 "settings",
 "smol",
- "strum",
+ "strum 0.25.0",
 "telemetry_events",
 "theme",
 "thiserror 1.0.69",
@@ -6989,7 +6999,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index"
 checksum = "fc2f4eb4bc735547cfed7c0a4922cbd04a4655978c09b54f1f7b228750664c34"
 dependencies = [
 "cfg-if",
- "windows-targets 0.52.6",
+ "windows-targets 0.48.5",
 ]

 [[package]]
@@ -7731,7 +7741,7 @@ dependencies = [
 "cfg_aliases 0.1.1",
 "codespan-reporting",
 "hexf-parse",
- "indexmap",
+ "indexmap 2.7.0",
 "log",
 "rustc-hash 1.1.0",
 "spirv",
@@ -8363,7 +8373,7 @@ checksum = "aedf0a2d09c573ed1d8d85b30c119153926a2b36dce0ab28322c09a117a4683e"
 dependencies = [
 "crc32fast",
 "hashbrown 0.15.2",
- "indexmap",
+ "indexmap 2.7.0",
 "memchr",
 ]

@@ -8468,7 +8478,7 @@ dependencies = [
 "schemars",
 "serde",
 "serde_json",
- "strum",
+ "strum 0.25.0",
 ]

 [[package]]
@@ -9318,7 +9328,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index"
 checksum = "b4c5cc86750666a3ed20bdaf5ca2a0344f9c67674cae0515bec2da16fbaa47db"
 dependencies = [
 "fixedbitset",
- "indexmap",
+ "indexmap 2.7.0",
 ]

 [[package]]
@@ -9501,7 +9511,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index"
 checksum = "42cf17e9a1800f5f396bc67d193dc9411b59012a5876445ef450d449881e1016"
 dependencies = [
 "base64 0.22.1",
- "indexmap",
+ "indexmap 2.7.0",
 "quick-xml 0.32.0",
 "serde",
 "time",
@@ -9819,7 +9829,7 @@ dependencies = [
 "file_icons",
 "git",
 "gpui",
- "indexmap",
+ "indexmap 1.9.3",
 "language",
 "menu",
 "pretty_assertions",
@@ -9923,7 +9933,7 @@ checksum = "22505a5c94da8e3b7c2996394d1c933236c4d743e81a410bcca4e6989fc066a4"
 dependencies = [
 "bytes 1.9.0",
 "heck 0.5.0",
- "itertools 0.10.5",
+ "itertools 0.12.1",
 "log",
 "multimap 0.10.0",
 "once_cell",
@@ -9956,7 +9966,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index"
 checksum = "81bddcdb20abf9501610992b6759a4c888aef7d1a7247ef75e2404275ac24af1"
 dependencies = [
 "anyhow",
- "itertools 0.10.5",
+ "itertools 0.12.1",
 "proc-macro2",
 "quote",
 "syn 2.0.90",
@@ -10138,14 +10148,14 @@ dependencies = [
 "once_cell",
 "socket2 0.5.8",
 "tracing",
- "windows-sys 0.59.0",
+ "windows-sys 0.52.0",
 ]

 [[package]]
 name = "quote"
-version = "1.0.38"
+version = "1.0.37"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "0e4dccaaaf89514f546c693ddc140f729f958c247918a13380cccc6078391acc"
+checksum = "b5b9d34b8991d19d98081b46eacdd8eb58c6f2b201139f7c5f643cc155a633af"
 dependencies = [
 "proc-macro2",
 ]
@@ -10882,7 +10892,7 @@ dependencies = [
 "serde",
 "serde_json",
 "sha2",
- "strum",
+ "strum 0.25.0",
 "tracing",
 "util",
 "zstd",
@@ -11038,7 +11048,7 @@ dependencies = [
 "libc",
 "linux-raw-sys 0.4.14",
 "once_cell",
- "windows-sys 0.59.0",
+ "windows-sys 0.52.0",
 ]

 [[package]]
@@ -11213,7 +11223,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index"
 checksum = "09c024468a378b7e36765cd36702b7a90cc3cba11654f6685c8f233408e89e92"
 dependencies = [
 "dyn-clone",
- "indexmap",
+ "indexmap 1.9.3",
 "schemars_derive",
 "serde",
 "serde_json",
@@ -11286,9 +11296,9 @@ dependencies = [

 [[package]]
 name = "sea-orm"
-version = "1.1.3"
+version = "1.1.2"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "0dbcf83248860dc632c46c7e81a221e041b50d0006191756cb001d9e8afc60a9"
+checksum = "3b24d72a69e89762982c29af249542b06c59fa131f87cc9d5b94be1f692b427a"
 dependencies = [
 "async-stream",
 "async-trait",
@@ -11304,7 +11314,7 @@ dependencies = [
 "serde",
 "serde_json",
 "sqlx",
- "strum",
+ "strum 0.26.3",
 "thiserror 1.0.69",
 "time",
 "tracing",
@@ -11314,9 +11324,9 @@ dependencies = [

 [[package]]
 name = "sea-orm-macros"
-version = "1.1.3"
+version = "1.1.2"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "49ce6f08134f3681b1ca92185b96fac898f26d9b4f5538d13f7032ef243d14b2"
+checksum = "0497f4fd82ecb2a222bea5319b9048f8ab58d4e734d095b062987acbcdeecdda"
 dependencies = [
 "heck 0.4.1",
 "proc-macro2",
@@ -11546,11 +11556,11 @@ dependencies = [

 [[package]]
 name = "serde_json"
-version = "1.0.134"
+version = "1.0.133"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "d00f4175c42ee48b15416f6193a959ba3a0d67fc699a0db9ad12df9f83991c7d"
+checksum = "c7fceb2473b9166b2294ef05efcb65a3db80803f0b03ef86a5fc88a2b85ee377"
 dependencies = [
- "indexmap",
+ "indexmap 2.7.0",
 "itoa",
 "memchr",
 "ryu",
@@ -11563,7 +11573,7 @@ version = "0.2.4"
 source = "registry+https://github.com/rust-lang/crates.io-index"
 checksum = "0e033097bf0d2b59a62b42c18ebbb797503839b26afdda2c4e1415cb6c813540"
 dependencies = [
- "indexmap",
+ "indexmap 2.7.0",
 "itoa",
 "memchr",
 "ryu",
@@ -12136,7 +12146,7 @@ dependencies = [
 "hashbrown 0.14.5",
 "hashlink 0.9.1",
 "hex",
- "indexmap",
+ "indexmap 2.7.0",
 "log",
 "memchr",
 "once_cell",
@@ -12360,7 +12370,7 @@ dependencies = [
 "settings",
 "simplelog",
 "story",
- "strum",
+ "strum 0.25.0",
 "theme",
 "title_bar",
 "ui",
@@ -12420,20 +12430,26 @@ checksum = "7da8b5736845d9f2fcb837ea5d9e2628564b3b043a70948a3f0b778838c5fb4f"

 [[package]]
 name = "strum"
-version = "0.26.3"
+version = "0.25.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "8fec0f0aef304996cf250b31b5a10dee7980c85da9d759361292b8bca5a18f06"
+checksum = "290d54ea6f91c969195bdbcd7442c8c2a2ba87da8bf60a7ee86a235d4bc1e125"
 dependencies = [
 "strum_macros",
 ]

 [[package]]
-name = "strum_macros"
-version = "0.26.4"
+name = "strum"
+version = "0.26.3"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "4c6bee85a5a24955dc440386795aa378cd9cf82acd5f764469152d2270e581be"
+checksum = "8fec0f0aef304996cf250b31b5a10dee7980c85da9d759361292b8bca5a18f06"
+
+[[package]]
+name = "strum_macros"
+version = "0.25.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "23dc1fa9ac9c169a78ba62f0b841814b7abae11bdd047b9c58f893439e309ea0"
 dependencies = [
- "heck 0.5.0",
+ "heck 0.4.1",
 "proc-macro2",
 "quote",
 "rustversion",
@@ -12752,7 +12768,7 @@ dependencies = [
 "fd-lock",
 "io-lifetimes 2.0.4",
 "rustix 0.38.42",
- "windows-sys 0.59.0",
+ "windows-sys 0.52.0",
 "winx",
 ]

@@ -12884,7 +12900,7 @@ dependencies = [
 "fastrand 2.3.0",
 "once_cell",
 "rustix 0.38.42",
- "windows-sys 0.59.0",
+ "windows-sys 0.52.0",
 ]

 [[package]]
@@ -13009,7 +13025,7 @@ dependencies = [
 "fs",
 "futures 0.3.31",
 "gpui",
- "indexmap",
+ "indexmap 1.9.3",
 "log",
 "palette",
 "parking_lot",
@@ -13021,7 +13037,7 @@ dependencies = [
 "serde_json_lenient",
 "serde_repr",
 "settings",
- "strum",
+ "strum 0.25.0",
 "util",
 "uuid",
 ]
@@ -13044,7 +13060,7 @@ dependencies = [
 "anyhow",
 "clap",
 "gpui",
- "indexmap",
+ "indexmap 1.9.3",
 "log",
 "palette",
 "rust-embed",
@@ -13053,7 +13069,7 @@ dependencies = [
 "serde_json",
 "serde_json_lenient",
 "simplelog",
- "strum",
+ "strum 0.25.0",
 "theme",
 "vscode_theme",
 ]
@@ -13481,7 +13497,7 @@ version = "0.22.22"
 source = "registry+https://github.com/rust-lang/crates.io-index"
 checksum = "4ae48d6208a266e853d946088ed816055e556cc6028c5e8e2b84d9fa5dd7c7f5"
 dependencies = [
- "indexmap",
+ "indexmap 2.7.0",
 "serde",
 "serde_spanned",
 "toml_datetime",
@@ -13984,7 +14000,7 @@ dependencies = [
 "settings",
 "smallvec",
 "story",
- "strum",
+ "strum 0.25.0",
 "theme",
 "ui_macros",
 "windows 0.58.0",
@@ -14013,9 +14029,9 @@ dependencies = [

 [[package]]
 name = "unicase"
-version = "2.8.1"
+version = "2.8.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "75b844d17643ee918803943289730bec8aac480150456169e647ed0b576ba539"
+checksum = "7e51b68083f157f853b6379db119d1c1be0e6e4dec98101079dec41f6f5cf6df"

 [[package]]
 name = "unicode-bidi"
@@ -14563,7 +14579,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index"
 checksum = "0fd83062c17b9f4985d438603cde0a5e8c5c8198201a6937f778b607924c7da2"
 dependencies = [
 "anyhow",
- "indexmap",
+ "indexmap 2.7.0",
 "serde",
 "serde_derive",
 "serde_json",
@@ -14592,7 +14608,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index"
 checksum = "84e5df6dba6c0d7fafc63a450f1738451ed7a0b52295d83e868218fa286bf708"
 dependencies = [
 "bitflags 2.6.0",
- "indexmap",
+ "indexmap 2.7.0",
 "semver",
 ]

@@ -14605,7 +14621,7 @@ dependencies = [
 "ahash 0.8.11",
 "bitflags 2.6.0",
 "hashbrown 0.14.5",
- "indexmap",
+ "indexmap 2.7.0",
 "semver",
 "serde",
 ]
@@ -14635,7 +14651,7 @@ dependencies = [
 "cfg-if",
 "encoding_rs",
 "hashbrown 0.14.5",
- "indexmap",
+ "indexmap 2.7.0",
 "libc",
 "libm",
 "log",
@@ -14756,7 +14772,7 @@ dependencies = [
 "cranelift-bitset",
 "cranelift-entity",
 "gimli 0.29.0",
- "indexmap",
+ "indexmap 2.7.0",
 "log",
 "object",
 "postcard",
@@ -14886,7 +14902,7 @@ checksum = "c58b085b2d330e5057dddd31f3ca527569b90fcdd35f6d373420c304927a5190"
 dependencies = [
 "anyhow",
 "heck 0.4.1",
- "indexmap",
+ "indexmap 2.7.0",
 "wit-parser 0.215.0",
 ]

@@ -15187,7 +15203,7 @@ version = "0.1.9"
 source = "registry+https://github.com/rust-lang/crates.io-index"
 checksum = "cf221c93e13a30d793f7645a0e7762c55d169dbb0a49671918a2319d289b10bb"
 dependencies = [
- "windows-sys 0.59.0",
+ "windows-sys 0.48.0",
 ]

 [[package]]
@@ -15636,7 +15652,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index"
 checksum = "3f3fd376f71958b862e7afb20cfe5a22830e1963462f3a17f49d82a6c1d1f42d"
 dependencies = [
 "bitflags 2.6.0",
- "windows-sys 0.59.0",
+ "windows-sys 0.52.0",
 ]

 [[package]]
@@ -15683,7 +15699,7 @@ checksum = "d8a39a15d1ae2077688213611209849cad40e9e5cccf6e61951a425850677ff3"
 dependencies = [
 "anyhow",
 "heck 0.4.1",
- "indexmap",
+ "indexmap 2.7.0",
 "wasm-metadata",
 "wit-bindgen-core",
 "wit-component",
@@ -15711,7 +15727,7 @@ checksum = "421c0c848a0660a8c22e2fd217929a0191f14476b68962afd2af89fd22e39825"
 dependencies = [
 "anyhow",
 "bitflags 2.6.0",
- "indexmap",
+ "indexmap 2.7.0",
 "log",
 "serde",
 "serde_derive",
@@ -15730,7 +15746,7 @@ checksum = "196d3ecfc4b759a8573bf86a9b3f8996b304b3732e4c7de81655f875f6efdca6"
 dependencies = [
 "anyhow",
 "id-arena",
- "indexmap",
+ "indexmap 2.7.0",
 "log",
 "semver",
 "serde",
@@ -15748,7 +15764,7 @@ checksum = "935a97eaffd57c3b413aa510f8f0b550a4a9fe7d59e79cd8b89a83dcb860321f"
 dependencies = [
 "anyhow",
 "id-arena",
- "indexmap",
+ "indexmap 2.7.0",
 "log",
 "semver",
 "serde",
@@ -15804,7 +15820,7 @@ dependencies = [
 "settings",
 "smallvec",
 "sqlez",
- "strum",
+ "strum 0.25.0",
 "task",
 "tempfile",
 "theme",
@@ -16188,7 +16204,7 @@ dependencies = [

 [[package]]
 name = "zed"
-version = "0.169.0"
+version = "0.168.0"
 dependencies = [
 "activity_indicator",
 "anyhow",
@@ -16320,9 +16336,24 @@ dependencies = [
 "serde",
 ]

+[[package]]
+name = "zed_astro"
+version = "0.1.2"
+dependencies = [
+ "serde",
+ "zed_extension_api 0.1.0",
+]
+
+[[package]]
+name = "zed_clojure"
+version = "0.0.3"
+dependencies = [
+ "zed_extension_api 0.1.0",
+]
+
 [[package]]
 name = "zed_csharp"
-version = "0.1.0"
+version = "0.0.2"
 dependencies = [
 "zed_extension_api 0.1.0",
 ]
@@ -16341,6 +16372,13 @@ dependencies = [
 "zed_extension_api 0.2.0 (registry+https://github.com/rust-lang/crates.io-index)",
 ]

+[[package]]
+name = "zed_elm"
+version = "0.0.1"
+dependencies = [
+ "zed_extension_api 0.1.0",
+]
+
 [[package]]
 name = "zed_emmet"
 version = "0.0.3"
--- a/Cargo.toml
+++ b/Cargo.toml
@@ -149,9 +149,12 @@ members = [
    # Extensions
    #

+    "extensions/astro",
+    "extensions/clojure",
    "extensions/csharp",
    "extensions/deno",
    "extensions/elixir",
+    "extensions/elm",
    "extensions/emmet",
    "extensions/erlang",
    "extensions/glsl",
@@ -389,7 +392,7 @@ hyper = "0.14"
 http = "1.1"
 ignore = "0.4.22"
 image = "0.25.1"
-indexmap = { version = "2.7.0", features = ["serde"] }
+indexmap = { version = "1.6.2", features = ["serde"] }
 indoc = "2"
 itertools = "0.13.0"
 jsonwebtoken = "9.3"
@@ -440,10 +443,9 @@ runtimelib = { version = "0.24.0", default-features = false, features = [
 ] }
 rustc-demangle = "0.1.23"
 rust-embed = { version = "8.4", features = ["include-exclude"] }
-rustc-hash = "2.1.0"
 rustls = "0.21.12"
 rustls-native-certs = "0.8.0"
-schemars = { version = "0.8", features = ["impl_json_schema", "indexmap2"] }
+schemars = { version = "0.8", features = ["impl_json_schema"] }
 semver = "1.0"
 serde = { version = "1.0", features = ["derive", "rc"] }
 serde_derive = { version = "1.0", features = ["deserialize_in_place"] }
@@ -463,7 +465,7 @@ smallvec = { version = "1.6", features = ["union"] }
 smol = "1.2"
 sqlformat = "0.2"
 strsim = "0.11"
-strum = { version = "0.26.0", features = ["derive"] }
+strum = { version = "0.25.0", features = ["derive"] }
 subtle = "2.5.0"
 sys-locale = "0.3.1"
 sysinfo = "0.31.0"
--- a/assets/icons/file_search.svg
+++ b/assets/icons/file_search.svg
@@ -1,5 +1 @@
-<svg width="24" height="24" viewBox="0 0 24 24" fill="none" xmlns="http://www.w3.org/2000/svg">
-<path d="M5.2345 20.1C5.38772 20.373 5.60794 20.5998 5.87313 20.7577C6.13832 20.9157 6.43919 20.9992 6.74562 21H17.25C17.7141 21 18.1592 20.8104 18.4874 20.4728C18.8156 20.1352 19 19.6774 19 19.2V7.5L14.625 3H6.75C6.28587 3 5.84075 3.18964 5.51256 3.52721C5.18437 3.86477 5 4.32261 5 4.8V6.5" stroke="black" stroke-width="2" stroke-linecap="round" stroke-linejoin="round"/>
-<path d="M10 16.8182L8.5 15.3182" stroke="black" stroke-width="2" stroke-linecap="round" stroke-linejoin="round"/>
-<path d="M6 15.8182C7.65685 15.8182 9 14.475 9 12.8182C9 11.1613 7.65685 9.81818 6 9.81818C4.34315 9.81818 3 11.1613 3 12.8182C3 14.475 4.34315 15.8182 6 15.8182Z" stroke="black" stroke-width="2" stroke-linecap="round" stroke-linejoin="round"/>
-</svg>
+<svg xmlns="http://www.w3.org/2000/svg" width="24" height="24" viewBox="0 0 24 24" fill="none" stroke="currentColor" stroke-width="2" stroke-linecap="round" stroke-linejoin="round" class="lucide lucide-file-search"><path d="M14 2v4a2 2 0 0 0 2 2h4"/><path d="M4.268 21a2 2 0 0 0 1.727 1H18a2 2 0 0 0 2-2V7l-5-5H6a2 2 0 0 0-2 2v3"/><path d="m9 18-1.5-1.5"/><circle cx="5" cy="14" r="3"/></svg>
--- a/assets/keymaps/default-linux.json
+++ b/assets/keymaps/default-linux.json
@@ -172,7 +172,6 @@
    "context": "AssistantPanel",
    "bindings": {
      "ctrl-k c": "assistant::CopyCode",
-      "ctrl-shift-e": "project_panel::ToggleFocus",
      "ctrl-g": "search::SelectNextMatch",
      "ctrl-shift-g": "search::SelectPrevMatch",
      "ctrl-shift-m": "assistant::ToggleModelSelector",
@@ -378,7 +377,6 @@
      // Change the default action on `menu::Confirm` by setting the parameter
      // "alt-ctrl-o": ["projects::OpenRecent", { "create_new_window": true }],
      "alt-ctrl-o": "projects::OpenRecent",
-      "alt-ctrl-shift-o": "projects::OpenRemote",
      "alt-ctrl-shift-b": "branches::OpenRecent",
      "ctrl-~": "workspace::NewTerminal",
      "ctrl-s": "workspace::Save",
@@ -412,7 +410,7 @@
      "ctrl-shift-p": "command_palette::Toggle",
      "f1": "command_palette::Toggle",
      "ctrl-shift-m": "diagnostics::Deploy",
-      "ctrl-shift-e": "project_panel::ToggleFocus",
+      "ctrl-shift-e": "pane::RevealInProjectPanel",
      "ctrl-shift-b": "outline_panel::ToggleFocus",
      "ctrl-?": "assistant::ToggleFocus",
      "ctrl-alt-s": "workspace::SaveAll",
@@ -436,13 +434,6 @@
      // "foo-bar": ["task::Spawn", { "task_name": "MyTask", "reveal_target": "dock" }]
    }
  },
-  {
-    "context": "ApplicationMenu",
-    "bindings": {
-      "left": ["app_menu::NavigateApplicationMenuInDirection", "Left"],
-      "right": ["app_menu::NavigateApplicationMenuInDirection", "Right"]
-    }
-  },
  // Bindings from Sublime Text
  {
    "context": "Editor",
@@ -533,7 +524,6 @@
      "alt-enter": "editor::OpenExcerpts",
      "shift-enter": "editor::ExpandExcerpts",
      "ctrl-k enter": "editor::OpenExcerptsSplit",
-      "ctrl-shift-e": "pane::RevealInProjectPanel",
      "ctrl-f8": "editor::GoToHunk",
      "ctrl-shift-f8": "editor::GoToPrevHunk",
      "ctrl-enter": "assistant::InlineAssist"
@@ -614,6 +604,7 @@
      "ctrl-delete": ["project_panel::Delete", { "skip_prompt": false }],
      "alt-ctrl-r": "project_panel::RevealInFileManager",
      "ctrl-shift-enter": "project_panel::OpenWithSystem",
+      "ctrl-shift-e": "project_panel::ToggleFocus",
      "ctrl-shift-f": "project_panel::NewSearchInDirectory",
      "shift-down": "menu::SelectNext",
      "shift-up": "menu::SelectPrev",
--- a/assets/keymaps/default-macos.json
+++ b/assets/keymaps/default-macos.json
@@ -196,7 +196,6 @@
    "use_key_equivalents": true,
    "bindings": {
      "cmd-k c": "assistant::CopyCode",
-      "cmd-shift-e": "project_panel::ToggleFocus",
      "cmd-g": "search::SelectNextMatch",
      "cmd-shift-g": "search::SelectPrevMatch",
      "cmd-shift-m": "assistant::ToggleModelSelector",
@@ -476,7 +475,7 @@
      "ctrl-shift-tab": ["tab_switcher::Toggle", { "select_last": true }],
      "cmd-shift-p": "command_palette::Toggle",
      "cmd-shift-m": "diagnostics::Deploy",
-      "cmd-shift-e": "project_panel::ToggleFocus",
+      "cmd-shift-e": "pane::RevealInProjectPanel",
      "cmd-shift-b": "outline_panel::ToggleFocus",
      "cmd-?": "assistant::ToggleFocus",
      "cmd-alt-s": "workspace::SaveAll",
@@ -596,7 +595,6 @@
      "alt-enter": "editor::OpenExcerpts",
      "shift-enter": "editor::ExpandExcerpts",
      "cmd-k enter": "editor::OpenExcerptsSplit",
-      "cmd-shift-e": "pane::RevealInProjectPanel",
      "cmd-f8": "editor::GoToHunk",
      "cmd-shift-f8": "editor::GoToPrevHunk",
      "ctrl-enter": "assistant::InlineAssist"
@@ -665,6 +663,7 @@
      "cmd-delete": ["project_panel::Delete", { "skip_prompt": false }],
      "alt-cmd-r": "project_panel::RevealInFileManager",
      "ctrl-shift-enter": "project_panel::OpenWithSystem",
+      "cmd-shift-e": "project_panel::ToggleFocus",
      "cmd-alt-backspace": ["project_panel::Delete", { "skip_prompt": false }],
      "cmd-shift-f": "project_panel::NewSearchInDirectory",
      "shift-down": "menu::SelectNext",
--- a/assets/keymaps/linux/emacs.json
+++ b/assets/keymaps/linux/emacs.json
@@ -3,71 +3,56 @@
 // To see the default key bindings run `zed: open default keymap`
 // from the command palette.
 [
-  {
-    "bindings": {
-      "ctrl-g": "menu::Cancel"
-    }
-  },
  {
    "context": "Editor",
    "bindings": {
      "ctrl-g": "editor::Cancel",
-      "ctrl-x b": "tab_switcher::Toggle", // switch-to-buffer
-      "alt-g g": "go_to_line::Toggle", // goto-line
-      "alt-g alt-g": "go_to_line::Toggle", // goto-line
+      "ctrl-shift-g": "go_to_line::Toggle",
      //"ctrl-space": "editor::SetMark",
-      "ctrl-f": "editor::MoveRight", // forward-char
-      "ctrl-b": "editor::MoveLeft", // backward-char
-      "ctrl-n": "editor::MoveDown", // next-line
-      "ctrl-p": "editor::MoveUp", // previous-line
-      "home": ["editor::MoveToBeginningOfLine", { "stop_at_soft_wraps": false }], // move-beginning-of-line
-      "end": ["editor::MoveToEndOfLine", { "stop_at_soft_wraps": false }], // move-end-of-line
-      "ctrl-a": ["editor::MoveToBeginningOfLine", { "stop_at_soft_wraps": false }], // move-beginning-of-line
-      "ctrl-e": ["editor::MoveToEndOfLine", { "stop_at_soft_wraps": false }], // move-end-of-line
-      "alt-f": "editor::MoveToNextSubwordEnd", // forward-word
-      "alt-b": "editor::MoveToPreviousSubwordStart", // backward-word
-      "alt-u": "editor::ConvertToUpperCase", // upcase-word
-      "alt-l": "editor::ConvertToLowerCase", // downcase-word
-      "alt-c": "editor::ConvertToUpperCamelCase", // capitalize-word
-      "alt-;": ["editor::ToggleComments", { "advance_downwards": false }],
-      "ctrl-x ctrl-;": "editor::ToggleComments",
-      "alt-.": "editor::GoToDefinition", // xref-find-definitions
-      "alt-,": "pane::GoBack", // xref-pop-marker-stack
-      "ctrl-x h": "editor::SelectAll", // mark-whole-buffer
-      "ctrl-d": "editor::Delete", // delete-char
-      "alt-d": "editor::DeleteToNextWordEnd", // kill-word
-      "ctrl-k": "editor::KillRingCut", // kill-line
-      "ctrl-w": "editor::Cut", // kill-region
-      "alt-w": "editor::Copy", // kill-ring-save
-      "ctrl-y": "editor::KillRingYank", // yank
-      "ctrl-_": "editor::Undo", // undo
-      "ctrl-/": "editor::Undo", // undo
-      "ctrl-x u": "editor::Undo", // undo
-      "ctrl-v": "editor::MovePageDown", // scroll-up
-      "alt-v": "editor::MovePageUp", // scroll-down
-      "ctrl-x [": "editor::MoveToBeginning", // beginning-of-buffer
-      "ctrl-x ]": "editor::MoveToEnd", // end-of-buffer
-      "alt-<": "editor::MoveToBeginning", // beginning-of-buffer
-      "alt->": "editor::MoveToEnd", // end-of-buffer
-      "ctrl-l": "editor::ScrollCursorCenterTopBottom", // recenter-top-bottom
-      "ctrl-s": "buffer_search::Deploy", // isearch-forward
-      "alt-^": "editor::JoinLines" // join-line
+      "ctrl-x u": "editor::Undo",
+      "ctrl-x ctrl-u": "editor::Redo",
+      "ctrl-f": "editor::MoveRight",
+      "ctrl-b": "editor::MoveLeft",
+      "ctrl-n": "editor::MoveDown",
+      "ctrl-p": "editor::MoveUp",
+      "home": ["editor::MoveToBeginningOfLine", { "stop_at_soft_wraps": false }],
+      "end": ["editor::MoveToEndOfLine", { "stop_at_soft_wraps": false }],
+      "ctrl-a": ["editor::MoveToBeginningOfLine", { "stop_at_soft_wraps": false }],
+      "ctrl-e": ["editor::MoveToEndOfLine", { "stop_at_soft_wraps": false }],
+      "alt-f": "editor::MoveToNextSubwordEnd",
+      "alt-b": "editor::MoveToPreviousSubwordStart",
+      "ctrl-d": "editor::Delete",
+      "alt-d": "editor::DeleteToNextWordEnd",
+      "ctrl-k": "editor::CutToEndOfLine",
+      "ctrl-w": "editor::Cut",
+      "alt-w": "editor::Copy",
+      "ctrl-y": "editor::Paste",
+      "ctrl-_": "editor::Undo",
+      "ctrl-v": "editor::MovePageDown",
+      "alt-v": "editor::MovePageUp",
+      "ctrl-x ]": "editor::MoveToEnd",
+      "ctrl-x [": "editor::MoveToBeginning",
+      "ctrl-l": "editor::ScrollCursorCenterTopBottom",
+      "ctrl-s": "buffer_search::Deploy",
+      "ctrl-x ctrl-f": "file_finder::Toggle",
+      "ctrl-shift-r": "editor::Rename"
    }
  },
  {
-    "context": "Workspace && !Terminal",
+    "context": "Workspace",
    "bindings": {
-      "ctrl-x ctrl-c": "workspace::CloseWindow", // kill-emacs
-      "ctrl-x o": "workspace::ActivateNextPane", // other-window
-      "ctrl-x k": "pane::CloseActiveItem", // kill-buffer
-      "ctrl-x 0": "pane::CloseActiveItem", // delete-window
-      "ctrl-x 1": "pane::CloseInactiveItems", // delete-other-windows
-      "ctrl-x 2": "pane::SplitDown", // split-window-below
-      "ctrl-x 3": "pane::SplitRight", // split-window-right
-      "ctrl-x ctrl-f": "file_finder::Toggle", // find-file
-      "ctrl-x ctrl-s": "workspace::Save", // save-buffer
-      "ctrl-x ctrl-w": "workspace::SaveAs", // write-file
-      "ctrl-x s": "workspace::SaveAll" // save-some-buffers
+      "ctrl-x k": "pane::CloseActiveItem",
+      "ctrl-x ctrl-c": "workspace::CloseWindow",
+      "ctrl-x o": "workspace::ActivateNextPane",
+      "ctrl-x b": "tab_switcher::Toggle",
+      "ctrl-x 0": "pane::CloseActiveItem",
+      "ctrl-x 1": "pane::CloseInactiveItems",
+      "ctrl-x 2": "pane::SplitVertical",
+      "ctrl-x ctrl-f": "file_finder::Toggle",
+      "ctrl-x ctrl-s": "workspace::Save",
+      "ctrl-x ctrl-w": "workspace::SaveAs",
+      "ctrl-x s": "workspace::SaveAll",
+      "shift shift": "file_finder::Toggle"
    }
  },
  {
--- a/assets/keymaps/macos/emacs.json
+++ b/assets/keymaps/macos/emacs.json
@@ -3,71 +3,56 @@
 // To see the default key bindings run `zed: open default keymap`
 // from the command palette.
 [
-  {
-    "bindings": {
-      "ctrl-g": "menu::Cancel"
-    }
-  },
  {
    "context": "Editor",
    "bindings": {
      "ctrl-g": "editor::Cancel",
-      "ctrl-x b": "tab_switcher::Toggle", // switch-to-buffer
-      "alt-g g": "go_to_line::Toggle", // goto-line
-      "alt-g alt-g": "go_to_line::Toggle", // goto-line
+      "ctrl-shift-g": "go_to_line::Toggle",
      //"ctrl-space": "editor::SetMark",
-      "ctrl-f": "editor::MoveRight", // forward-char
-      "ctrl-b": "editor::MoveLeft", // backward-char
-      "ctrl-n": "editor::MoveDown", // next-line
-      "ctrl-p": "editor::MoveUp", // previous-line
-      "home": ["editor::MoveToBeginningOfLine", { "stop_at_soft_wraps": false }], // move-beginning-of-line
-      "end": ["editor::MoveToEndOfLine", { "stop_at_soft_wraps": false }], // move-end-of-line
-      "ctrl-a": ["editor::MoveToBeginningOfLine", { "stop_at_soft_wraps": false }], // move-beginning-of-line
-      "ctrl-e": ["editor::MoveToEndOfLine", { "stop_at_soft_wraps": false }], // move-end-of-line
-      "alt-f": "editor::MoveToNextSubwordEnd", // forward-word
-      "alt-b": "editor::MoveToPreviousSubwordStart", // backward-word
-      "alt-u": "editor::ConvertToUpperCase", // upcase-word
-      "alt-l": "editor::ConvertToLowerCase", // downcase-word
-      "alt-c": "editor::ConvertToUpperCamelCase", // capitalize-word
-      "alt-;": ["editor::ToggleComments", { "advance_downwards": false }],
-      "ctrl-x ctrl-;": "editor::ToggleComments",
-      "alt-.": "editor::GoToDefinition", // xref-find-definitions
-      "alt-,": "pane::GoBack", // xref-pop-marker-stack
-      "ctrl-x h": "editor::SelectAll", // mark-whole-buffer
-      "ctrl-d": "editor::Delete", // delete-char
-      "alt-d": "editor::DeleteToNextWordEnd", // kill-word
-      "ctrl-k": "editor::KillRingCut", // kill-line
-      "ctrl-w": "editor::Cut", // kill-region
-      "alt-w": "editor::Copy", // kill-ring-save
-      "ctrl-y": "editor::KillRingYank", // yank
-      "ctrl-_": "editor::Undo", // undo
-      "ctrl-/": "editor::Undo", // undo
-      "ctrl-x u": "editor::Undo", // undo
-      "ctrl-v": "editor::MovePageDown", // scroll-up
-      "alt-v": "editor::MovePageUp", // scroll-down
-      "ctrl-x [": "editor::MoveToBeginning", // beginning-of-buffer
-      "ctrl-x ]": "editor::MoveToEnd", // end-of-buffer
-      "alt-<": "editor::MoveToBeginning", // beginning-of-buffer
-      "alt->": "editor::MoveToEnd", // end-of-buffer
-      "ctrl-l": "editor::ScrollCursorCenterTopBottom", // recenter-top-bottom
-      "ctrl-s": "buffer_search::Deploy", // isearch-forward
-      "alt-^": "editor::JoinLines" // join-line
+      "ctrl-x u": "editor::Undo",
+      "ctrl-x ctrl-u": "editor::Redo",
+      "ctrl-f": "editor::MoveRight",
+      "ctrl-b": "editor::MoveLeft",
+      "ctrl-n": "editor::MoveDown",
+      "ctrl-p": "editor::MoveUp",
+      "home": ["editor::MoveToBeginningOfLine", { "stop_at_soft_wraps": false }],
+      "end": ["editor::MoveToEndOfLine", { "stop_at_soft_wraps": false }],
+      "ctrl-a": ["editor::MoveToBeginningOfLine", { "stop_at_soft_wraps": false }],
+      "ctrl-e": ["editor::MoveToEndOfLine", { "stop_at_soft_wraps": false }],
+      "alt-f": "editor::MoveToNextSubwordEnd",
+      "alt-b": "editor::MoveToPreviousSubwordStart",
+      "ctrl-d": "editor::Delete",
+      "alt-d": "editor::DeleteToNextWordEnd",
+      "ctrl-k": "editor::CutToEndOfLine",
+      "ctrl-w": "editor::Cut",
+      "alt-w": "editor::Copy",
+      "ctrl-y": "editor::Paste",
+      "ctrl-_": "editor::Undo",
+      "ctrl-v": "editor::MovePageDown",
+      "alt-v": "editor::MovePageUp",
+      "ctrl-x ]": "editor::MoveToEnd",
+      "ctrl-x [": "editor::MoveToBeginning",
+      "ctrl-l": "editor::ScrollCursorCenterTopBottom",
+      "ctrl-s": "buffer_search::Deploy",
+      "ctrl-x ctrl-f": "file_finder::Toggle",
+      "ctrl-shift-r": "editor::Rename"
    }
  },
  {
-    "context": "Workspace && !Terminal",
+    "context": "Workspace",
    "bindings": {
-      "ctrl-x ctrl-c": "workspace::CloseWindow", // kill-emacs
-      "ctrl-x o": "workspace::ActivateNextPane", // other-window
-      "ctrl-x k": "pane::CloseActiveItem", // kill-buffer
-      "ctrl-x 0": "pane::CloseActiveItem", // delete-window
-      "ctrl-x 1": "pane::CloseInactiveItems", // delete-other-windows
-      "ctrl-x 2": "pane::SplitDown", // split-window-below
-      "ctrl-x 3": "pane::SplitRight", // split-window-right
-      "ctrl-x ctrl-f": "file_finder::Toggle", // find-file
-      "ctrl-x ctrl-s": "workspace::Save", // save-buffer
-      "ctrl-x ctrl-w": "workspace::SaveAs", // write-file
-      "ctrl-x s": "workspace::SaveAll" // save-some-buffers
+      "ctrl-x k": "pane::CloseActiveItem",
+      "ctrl-x ctrl-c": "workspace::CloseWindow",
+      "ctrl-x o": "workspace::ActivateNextPane",
+      "ctrl-x b": "tab_switcher::Toggle",
+      "ctrl-x 0": "pane::CloseActiveItem",
+      "ctrl-x 1": "pane::CloseInactiveItems",
+      "ctrl-x 2": "pane::SplitVertical",
+      "ctrl-x ctrl-f": "file_finder::Toggle",
+      "ctrl-x ctrl-s": "workspace::Save",
+      "ctrl-x ctrl-w": "workspace::SaveAs",
+      "ctrl-x s": "workspace::SaveAll",
+      "shift shift": "file_finder::Toggle"
    }
  },
  {
--- a/assets/settings/default.json
+++ b/assets/settings/default.json
@@ -256,13 +256,8 @@
    "search_results": true,
    // Whether to show selected symbol occurrences in the scrollbar.
    "selected_symbol": true,
-    // Which diagnostic indicators to show in the scrollbar:
-    //  - "none" or false: do not show diagnostics
-    //  - "error": show only errors
-    //  - "warning": show only errors and warnings
-    //  - "information": show only errors, warnings, and information
-    //  - "all" or true: show all diagnostics
-    "diagnostics": "all",
+    // Whether to show diagnostic indicators in the scrollbar.
+    "diagnostics": true,
    /// Forcefully enable or disable the scrollbar for each axis
    "axes": {
      /// When false, forcefully disables the horizontal scrollbar. Otherwise, obey other settings.
@@ -746,7 +741,7 @@
      // Delay is restarted with every cursor movement.
      // "delay_ms": 600
      //
-      // Whether or not to display the git commit summary on the same line.
+      // Whether or not do display the git commit summary on the same line.
      // "show_commit_summary": false
      //
      // The minimum column number to show the inline blame information at
--- a/crates/anthropic/src/anthropic.rs
+++ b/crates/anthropic/src/anthropic.rs
@@ -30,8 +30,6 @@ pub enum Model {
    #[default]
    #[serde(rename = "claude-3-5-sonnet", alias = "claude-3-5-sonnet-latest")]
    Claude3_5Sonnet,
-    #[serde(rename = "claude-3-5-haiku", alias = "claude-3-5-haiku-latest")]
-    Claude3_5Haiku,
    #[serde(rename = "claude-3-opus", alias = "claude-3-opus-latest")]
    Claude3Opus,
    #[serde(rename = "claude-3-sonnet", alias = "claude-3-sonnet-latest")]
@@ -50,8 +48,6 @@ pub enum Model {
        cache_configuration: Option<AnthropicModelCacheConfiguration>,
        max_output_tokens: Option<u32>,
        default_temperature: Option<f32>,
-        #[serde(default)]
-        extra_beta_headers: Vec<String>,
    },
 }

@@ -59,8 +55,6 @@ impl Model {
    pub fn from_id(id: &str) -> Result<Self> {
        if id.starts_with("claude-3-5-sonnet") {
            Ok(Self::Claude3_5Sonnet)
-        } else if id.starts_with("claude-3-5-haiku") {
-            Ok(Self::Claude3_5Haiku)
        } else if id.starts_with("claude-3-opus") {
            Ok(Self::Claude3Opus)
        } else if id.starts_with("claude-3-sonnet") {
@@ -75,7 +69,6 @@ impl Model {
    pub fn id(&self) -> &str {
        match self {
            Model::Claude3_5Sonnet => "claude-3-5-sonnet-latest",
-            Model::Claude3_5Haiku => "claude-3-5-haiku-latest",
            Model::Claude3Opus => "claude-3-opus-latest",
            Model::Claude3Sonnet => "claude-3-sonnet-latest",
            Model::Claude3Haiku => "claude-3-haiku-latest",
@@ -86,7 +79,6 @@ impl Model {
    pub fn display_name(&self) -> &str {
        match self {
            Self::Claude3_5Sonnet => "Claude 3.5 Sonnet",
-            Self::Claude3_5Haiku => "Claude 3.5 Haiku",
            Self::Claude3Opus => "Claude 3 Opus",
            Self::Claude3Sonnet => "Claude 3 Sonnet",
            Self::Claude3Haiku => "Claude 3 Haiku",
@@ -98,13 +90,11 @@ impl Model {

    pub fn cache_configuration(&self) -> Option<AnthropicModelCacheConfiguration> {
        match self {
-            Self::Claude3_5Sonnet | Self::Claude3_5Haiku | Self::Claude3Haiku => {
-                Some(AnthropicModelCacheConfiguration {
-                    min_total_token: 2_048,
-                    should_speculate: true,
-                    max_cache_anchors: 4,
-                })
-            }
+            Self::Claude3_5Sonnet | Self::Claude3Haiku => Some(AnthropicModelCacheConfiguration {
+                min_total_token: 2_048,
+                should_speculate: true,
+                max_cache_anchors: 4,
+            }),
            Self::Custom {
                cache_configuration,
                ..
@@ -116,7 +106,6 @@ impl Model {
    pub fn max_token_count(&self) -> usize {
        match self {
            Self::Claude3_5Sonnet
-            | Self::Claude3_5Haiku
            | Self::Claude3Opus
            | Self::Claude3Sonnet
            | Self::Claude3Haiku => 200_000,
@@ -127,7 +116,7 @@ impl Model {
    pub fn max_output_tokens(&self) -> u32 {
        match self {
            Self::Claude3Opus | Self::Claude3Sonnet | Self::Claude3Haiku => 4_096,
-            Self::Claude3_5Sonnet | Self::Claude3_5Haiku => 8_192,
+            Self::Claude3_5Sonnet => 8_192,
            Self::Custom {
                max_output_tokens, ..
            } => max_output_tokens.unwrap_or(4_096),
@@ -137,7 +126,6 @@ impl Model {
    pub fn default_temperature(&self) -> f32 {
        match self {
            Self::Claude3_5Sonnet
-            | Self::Claude3_5Haiku
            | Self::Claude3Opus
            | Self::Claude3Sonnet
            | Self::Claude3Haiku => 1.0,
@@ -148,24 +136,6 @@ impl Model {
        }
    }

-    pub fn beta_headers(&self) -> String {
-        let mut headers = vec!["prompt-caching-2024-07-31".to_string()];
-
-        if let Self::Custom {
-            extra_beta_headers, ..
-        } = self
-        {
-            headers.extend(
-                extra_beta_headers
-                    .iter()
-                    .filter(|header| !header.trim().is_empty())
-                    .cloned(),
-            );
-        }
-
-        headers.join(",")
-    }
-
    pub fn tool_model_id(&self) -> &str {
        if let Self::Custom {
            tool_override: Some(tool_override),
@@ -186,12 +156,11 @@ pub async fn complete(
    request: Request,
 ) -> Result<Response, AnthropicError> {
    let uri = format!("{api_url}/v1/messages");
-    let model = Model::from_id(&request.model)?;
    let request_builder = HttpRequest::builder()
        .method(Method::POST)
        .uri(uri)
        .header("Anthropic-Version", "2023-06-01")
-        .header("Anthropic-Beta", model.beta_headers())
+        .header("Anthropic-Beta", "prompt-caching-2024-07-31")
        .header("X-Api-Key", api_key)
        .header("Content-Type", "application/json");

@@ -302,12 +271,14 @@ pub async fn stream_completion_with_rate_limit_info(
        stream: true,
    };
    let uri = format!("{api_url}/v1/messages");
-    let model = Model::from_id(&request.base.model)?;
    let request_builder = HttpRequest::builder()
        .method(Method::POST)
        .uri(uri)
        .header("Anthropic-Version", "2023-06-01")
-        .header("Anthropic-Beta", model.beta_headers())
+        .header(
+            "Anthropic-Beta",
+            "tools-2024-04-04,prompt-caching-2024-07-31,max-tokens-3-5-sonnet-2024-07-15",
+        )
        .header("X-Api-Key", api_key)
        .header("Content-Type", "application/json");
    let serialized_request =
--- a/crates/assistant/src/assistant.rs
+++ b/crates/assistant/src/assistant.rs
@@ -37,7 +37,7 @@ pub use prompts::PromptBuilder;
 use prompts::PromptLoadingParams;
 use semantic_index::{CloudEmbeddingProvider, SemanticDb};
 use serde::{Deserialize, Serialize};
-use settings::{Settings, SettingsStore};
+use settings::{update_settings_file, Settings, SettingsStore};
 use slash_command::search_command::SearchSlashCommandFeatureFlag;
 use slash_command::{
    auto_command, cargo_workspace_command, default_command, delta_command, diagnostics_command,
@@ -199,6 +199,16 @@ pub fn init(
    AssistantSettings::register(cx);
    SlashCommandSettings::register(cx);

+    // TODO: remove this when 0.148.0 is released.
+    if AssistantSettings::get_global(cx).using_outdated_settings_version {
+        update_settings_file::<AssistantSettings>(fs.clone(), cx, {
+            let fs = fs.clone();
+            |content, cx| {
+                content.update_file(fs, cx);
+            }
+        });
+    }
+
    cx.spawn(|mut cx| {
        let client = client.clone();
        async move {
--- a/crates/assistant/src/assistant_panel.rs
+++ b/crates/assistant/src/assistant_panel.rs
@@ -122,7 +122,7 @@ pub fn init(cx: &mut AppContext) {
    cx.observe_new_views(
        |terminal_panel: &mut TerminalPanel, cx: &mut ViewContext<TerminalPanel>| {
            let settings = AssistantSettings::get_global(cx);
-            terminal_panel.set_assistant_enabled(settings.enabled, cx);
+            terminal_panel.asssistant_enabled(settings.enabled, cx);
        },
    )
    .detach();
--- a/crates/assistant/src/assistant_settings.rs
+++ b/crates/assistant/src/assistant_settings.rs
@@ -3,12 +3,18 @@ use std::sync::Arc;
 use ::open_ai::Model as OpenAiModel;
 use anthropic::Model as AnthropicModel;
 use feature_flags::FeatureFlagAppExt;
+use fs::Fs;
 use gpui::{AppContext, Pixels};
 use language_model::{CloudModel, LanguageModel};
+use language_models::{
+    provider::open_ai, AllLanguageModelSettings, AnthropicSettingsContent,
+    AnthropicSettingsContentV1, OllamaSettingsContent, OpenAiSettingsContent,
+    OpenAiSettingsContentV1, VersionedAnthropicSettingsContent, VersionedOpenAiSettingsContent,
+};
 use ollama::Model as OllamaModel;
 use schemars::{schema::Schema, JsonSchema};
 use serde::{Deserialize, Serialize};
-use settings::{Settings, SettingsSources};
+use settings::{update_settings_file, Settings, SettingsSources};

 #[derive(Copy, Clone, Default, Debug, Serialize, Deserialize, JsonSchema)]
 #[serde(rename_all = "snake_case")]
@@ -100,6 +106,96 @@ impl AssistantSettingsContent {
        }
    }

+    pub fn update_file(&mut self, fs: Arc<dyn Fs>, cx: &AppContext) {
+        if let AssistantSettingsContent::Versioned(settings) = self {
+            if let VersionedAssistantSettingsContent::V1(settings) = settings {
+                if let Some(provider) = settings.provider.clone() {
+                    match provider {
+                        AssistantProviderContentV1::Anthropic { api_url, .. } => {
+                            update_settings_file::<AllLanguageModelSettings>(
+                                fs,
+                                cx,
+                                move |content, _| {
+                                    if content.anthropic.is_none() {
+                                        content.anthropic =
+                                            Some(AnthropicSettingsContent::Versioned(
+                                                VersionedAnthropicSettingsContent::V1(
+                                                    AnthropicSettingsContentV1 {
+                                                        api_url,
+                                                        available_models: None,
+                                                    },
+                                                ),
+                                            ));
+                                    }
+                                },
+                            )
+                        }
+                        AssistantProviderContentV1::Ollama { api_url, .. } => {
+                            update_settings_file::<AllLanguageModelSettings>(
+                                fs,
+                                cx,
+                                move |content, _| {
+                                    if content.ollama.is_none() {
+                                        content.ollama = Some(OllamaSettingsContent {
+                                            api_url,
+                                            available_models: None,
+                                        });
+                                    }
+                                },
+                            )
+                        }
+                        AssistantProviderContentV1::OpenAi {
+                            api_url,
+                            available_models,
+                            ..
+                        } => update_settings_file::<AllLanguageModelSettings>(
+                            fs,
+                            cx,
+                            move |content, _| {
+                                if content.openai.is_none() {
+                                    let available_models = available_models.map(|models| {
+                                        models
+                                            .into_iter()
+                                            .filter_map(|model| match model {
+                                                OpenAiModel::Custom {
+                                                    name,
+                                                    display_name,
+                                                    max_tokens,
+                                                    max_output_tokens,
+                                                    max_completion_tokens: None,
+                                                } => Some(open_ai::AvailableModel {
+                                                    name,
+                                                    display_name,
+                                                    max_tokens,
+                                                    max_output_tokens,
+                                                    max_completion_tokens: None,
+                                                }),
+                                                _ => None,
+                                            })
+                                            .collect::<Vec<_>>()
+                                    });
+                                    content.openai = Some(OpenAiSettingsContent::Versioned(
+                                        VersionedOpenAiSettingsContent::V1(
+                                            OpenAiSettingsContentV1 {
+                                                api_url,
+                                                available_models,
+                                            },
+                                        ),
+                                    ));
+                                }
+                            },
+                        ),
+                        _ => {}
+                    }
+                }
+            }
+        }
+
+        *self = AssistantSettingsContent::Versioned(VersionedAssistantSettingsContent::V2(
+            self.upgrade(),
+        ));
+    }
+
    fn upgrade(&self) -> AssistantSettingsContentV2 {
        match self {
            AssistantSettingsContent::Versioned(settings) => match settings {
@@ -438,7 +534,6 @@ fn merge<T>(target: &mut T, value: Option<T>) {

 #[cfg(test)]
 mod tests {
-    use fs::Fs;
    use gpui::{ReadGlobal, TestAppContext};

    use super::*;
--- a/crates/assistant/src/inline_assistant.rs
+++ b/crates/assistant/src/inline_assistant.rs
@@ -133,7 +133,7 @@ impl InlineAssistant {
            };
            let enabled = AssistantSettings::get_global(cx).enabled;
            terminal_panel.update(cx, |terminal_panel, cx| {
-                terminal_panel.set_assistant_enabled(enabled, cx)
+                terminal_panel.asssistant_enabled(enabled, cx)
            });
        })
        .detach();
@@ -797,11 +797,10 @@ impl InlineAssistant {
            if let Some(model) = LanguageModelRegistry::read_global(cx).active_model() {
                let language_name = assist.editor.upgrade().and_then(|editor| {
                    let multibuffer = editor.read(cx).buffer().read(cx);
-                    let multibuffer_snapshot = multibuffer.snapshot(cx);
-                    let ranges = multibuffer_snapshot.range_to_buffer_ranges(assist.range.clone());
+                    let ranges = multibuffer.range_to_buffer_ranges(assist.range.clone(), cx);
                    ranges
                        .first()
-                        .and_then(|(excerpt, _)| excerpt.buffer().language())
+                        .and_then(|(buffer, _, _)| buffer.read(cx).language())
                        .map(|language| language.name())
                });
                report_assistant_event(
@@ -2616,29 +2615,26 @@ impl EventEmitter<CodegenEvent> for CodegenAlternative {}

 impl CodegenAlternative {
    pub fn new(
-        multi_buffer: Model<MultiBuffer>,
+        buffer: Model<MultiBuffer>,
        range: Range<Anchor>,
        active: bool,
        telemetry: Option<Arc<Telemetry>>,
        builder: Arc<PromptBuilder>,
        cx: &mut ModelContext<Self>,
    ) -> Self {
-        let snapshot = multi_buffer.read(cx).snapshot(cx);
+        let snapshot = buffer.read(cx).snapshot(cx);

-        let (old_excerpt, _) = snapshot
-            .range_to_buffer_ranges(range.clone())
+        let (old_buffer, _, _) = buffer
+            .read(cx)
+            .range_to_buffer_ranges(range.clone(), cx)
            .pop()
            .unwrap();
        let old_buffer = cx.new_model(|cx| {
-            let text = old_excerpt.buffer().as_rope().clone();
-            let line_ending = old_excerpt.buffer().line_ending();
-            let language = old_excerpt.buffer().language().cloned();
-            let language_registry = multi_buffer
-                .read(cx)
-                .buffer(old_excerpt.buffer_id())
-                .unwrap()
-                .read(cx)
-                .language_registry();
+            let old_buffer = old_buffer.read(cx);
+            let text = old_buffer.as_rope().clone();
+            let line_ending = old_buffer.line_ending();
+            let language = old_buffer.language().cloned();
+            let language_registry = old_buffer.language_registry();

            let mut buffer = Buffer::local_normalized(text, line_ending, cx);
            buffer.set_language(language, cx);
@@ -2649,7 +2645,7 @@ impl CodegenAlternative {
        });

        Self {
-            buffer: multi_buffer.clone(),
+            buffer: buffer.clone(),
            old_buffer,
            edit_position: None,
            message_id: None,
@@ -2660,7 +2656,7 @@ impl CodegenAlternative {
            generation: Task::ready(()),
            diff: Diff::default(),
            telemetry,
-            _subscription: cx.subscribe(&multi_buffer, Self::handle_buffer_event),
+            _subscription: cx.subscribe(&buffer, Self::handle_buffer_event),
            builder,
            active,
            edits: Vec::new(),
@@ -2871,11 +2867,10 @@ impl CodegenAlternative {
        let telemetry = self.telemetry.clone();
        let language_name = {
            let multibuffer = self.buffer.read(cx);
-            let snapshot = multibuffer.snapshot(cx);
-            let ranges = snapshot.range_to_buffer_ranges(self.range.clone());
+            let ranges = multibuffer.range_to_buffer_ranges(self.range.clone(), cx);
            ranges
                .first()
-                .and_then(|(excerpt, _)| excerpt.buffer().language())
+                .and_then(|(buffer, _, _)| buffer.read(cx).language())
                .map(|language| language.name())
        };

--- a/crates/assistant2/Cargo.toml
+++ b/crates/assistant2/Cargo.toml
@@ -50,6 +50,7 @@ parking_lot.workspace = true
 picker.workspace = true
 project.workspace = true
 proto.workspace = true
+release_channel.workspace = true
 rope.workspace = true
 schemars.workspace = true
 serde.workspace = true
--- a/crates/assistant2/src/active_thread.rs
+++ b/crates/assistant2/src/active_thread.rs
@@ -5,7 +5,7 @@ use collections::HashMap;
 use gpui::{
    list, AbsoluteLength, AnyElement, AppContext, DefiniteLength, EdgesRefinement, Empty, Length,
    ListAlignment, ListOffset, ListState, Model, StyleRefinement, Subscription,
-    TextStyleRefinement, UnderlineStyle, View, WeakView,
+    TextStyleRefinement, View, WeakView,
 };
 use language::LanguageRegistry;
 use language_model::Role;
@@ -22,7 +22,7 @@ pub struct ActiveThread {
    workspace: WeakView<Workspace>,
    language_registry: Arc<LanguageRegistry>,
    tools: Arc<ToolWorkingSet>,
-    pub(crate) thread: Model<Thread>,
+    thread: Model<Thread>,
    messages: Vec<MessageId>,
    list_state: ListState,
    rendered_messages_by_id: HashMap<MessageId, View<Markdown>>,
@@ -140,15 +140,6 @@ impl ActiveThread {
                background_color: Some(colors.editor_foreground.opacity(0.01)),
                ..Default::default()
            },
-            link: TextStyleRefinement {
-                background_color: Some(colors.editor_foreground.opacity(0.025)),
-                underline: Some(UnderlineStyle {
-                    color: Some(colors.text_accent.opacity(0.5)),
-                    thickness: px(1.),
-                    ..Default::default()
-                }),
-                ..Default::default()
-            },
            ..Default::default()
        };

@@ -283,11 +274,12 @@ impl ActiveThread {
                    .when_some(context, |parent, context| {
                        if !context.is_empty() {
                            parent.child(
-                                h_flex().flex_wrap().gap_1().px_1p5().pb_1p5().children(
-                                    context
-                                        .iter()
-                                        .map(|context| ContextPill::new(context.clone())),
-                                ),
+                                h_flex()
+                                    .flex_wrap()
+                                    .gap_1()
+                                    .px_1p5()
+                                    .pb_1p5()
+                                    .children(context.iter().map(|c| ContextPill::new(c.clone()))),
                            )
                        } else {
                            parent
--- a/crates/assistant2/src/assistant_panel.rs
+++ b/crates/assistant2/src/assistant_panel.rs
@@ -19,7 +19,7 @@ use workspace::Workspace;
 use crate::active_thread::ActiveThread;
 use crate::assistant_settings::{AssistantDockPosition, AssistantSettings};
 use crate::message_editor::MessageEditor;
-use crate::thread::{Thread, ThreadError, ThreadId};
+use crate::thread::{ThreadError, ThreadId};
 use crate::thread_history::{PastThread, ThreadHistory};
 use crate::thread_store::ThreadStore;
 use crate::{NewThread, OpenHistory, ToggleFocus};
@@ -206,10 +206,6 @@ impl AssistantPanel {
        self.message_editor.focus_handle(cx).focus(cx);
    }

-    pub(crate) fn active_thread(&self, cx: &AppContext) -> Model<Thread> {
-        self.thread.read(cx).thread.clone()
-    }
-
    pub(crate) fn delete_thread(&mut self, thread_id: &ThreadId, cx: &mut ViewContext<Self>) {
        self.thread_store
            .update(cx, |this, cx| this.delete_thread(thread_id, cx));
--- a/crates/assistant2/src/buffer_codegen.rs
+++ b/crates/assistant2/src/buffer_codegen.rs
@@ -257,20 +257,17 @@ impl CodegenAlternative {
    ) -> Self {
        let snapshot = buffer.read(cx).snapshot(cx);

-        let (old_excerpt, _) = snapshot
-            .range_to_buffer_ranges(range.clone())
+        let (old_buffer, _, _) = buffer
+            .read(cx)
+            .range_to_buffer_ranges(range.clone(), cx)
            .pop()
            .unwrap();
        let old_buffer = cx.new_model(|cx| {
-            let text = old_excerpt.buffer().as_rope().clone();
-            let line_ending = old_excerpt.buffer().line_ending();
-            let language = old_excerpt.buffer().language().cloned();
-            let language_registry = buffer
-                .read(cx)
-                .buffer(old_excerpt.buffer_id())
-                .unwrap()
-                .read(cx)
-                .language_registry();
+            let old_buffer = old_buffer.read(cx);
+            let text = old_buffer.as_rope().clone();
+            let line_ending = old_buffer.line_ending();
+            let language = old_buffer.language().cloned();
+            let language_registry = old_buffer.language_registry();

            let mut buffer = Buffer::local_normalized(text, line_ending, cx);
            buffer.set_language(language, cx);
@@ -474,11 +471,10 @@ impl CodegenAlternative {
        let telemetry = self.telemetry.clone();
        let language_name = {
            let multibuffer = self.buffer.read(cx);
-            let snapshot = multibuffer.snapshot(cx);
-            let ranges = snapshot.range_to_buffer_ranges(self.range.clone());
+            let ranges = multibuffer.range_to_buffer_ranges(self.range.clone(), cx);
            ranges
                .first()
-                .and_then(|(excerpt, _)| excerpt.buffer().language())
+                .and_then(|(buffer, _, _)| buffer.read(cx).language())
                .map(|language| language.name())
        };

--- a/crates/assistant2/src/context.rs
+++ b/crates/assistant2/src/context.rs
@@ -1,11 +1,8 @@
 use gpui::SharedString;
 use language_model::{LanguageModelRequestMessage, MessageContent};
-use project::ProjectEntryId;
 use serde::{Deserialize, Serialize};
 use util::post_inc;

-use crate::thread::ThreadId;
-
 #[derive(Debug, PartialEq, Eq, PartialOrd, Ord, Hash, Clone, Copy, Serialize, Deserialize)]
 pub struct ContextId(pub(crate) usize);

@@ -24,12 +21,12 @@ pub struct Context {
    pub text: SharedString,
 }

-#[derive(Debug, Clone, PartialEq, Eq, Hash)]
+#[derive(Debug, Clone, Copy, PartialEq, Eq, Hash)]
 pub enum ContextKind {
-    File(ProjectEntryId),
+    File,
    Directory,
    FetchedUrl,
-    Thread(ThreadId),
+    Thread,
 }

 pub fn attach_context_to_message(
@@ -43,7 +40,7 @@ pub fn attach_context_to_message(

    for context in context.into_iter() {
        match context.kind {
-            ContextKind::File(_) => {
+            ContextKind::File => {
                file_context.push_str(&context.text);
                file_context.push('\n');
            }
@@ -57,7 +54,7 @@ pub fn attach_context_to_message(
                fetch_context.push_str(&context.text);
                fetch_context.push('\n');
            }
-            ContextKind::Thread(_) => {
+            ContextKind::Thread => {
                thread_context.push_str(&context.name);
                thread_context.push('\n');
                thread_context.push_str(&context.text);
--- a/crates/assistant2/src/context_picker.rs
+++ b/crates/assistant2/src/context_picker.rs
@@ -10,10 +10,12 @@ use gpui::{
    WeakModel, WeakView,
 };
 use picker::{Picker, PickerDelegate};
+use release_channel::ReleaseChannel;
 use ui::{prelude::*, ListItem, ListItemSpacing};
 use util::ResultExt;
 use workspace::Workspace;

+use crate::context::ContextKind;
 use crate::context_picker::directory_context_picker::DirectoryContextPicker;
 use crate::context_picker::fetch_context_picker::FetchContextPicker;
 use crate::context_picker::file_context_picker::FileContextPicker;
@@ -52,24 +54,29 @@ impl ContextPicker {
        let mut entries = Vec::new();
        entries.push(ContextPickerEntry {
            name: "File".into(),
-            kind: ContextPickerEntryKind::File,
+            kind: ContextKind::File,
            icon: IconName::File,
        });
-        entries.push(ContextPickerEntry {
-            name: "Folder".into(),
-            kind: ContextPickerEntryKind::Directory,
-            icon: IconName::Folder,
-        });
+        let release_channel = ReleaseChannel::global(cx);
+        // The directory context picker isn't fully implemented yet, so limit it
+        // to development builds.
+        if release_channel == ReleaseChannel::Dev {
+            entries.push(ContextPickerEntry {
+                name: "Folder".into(),
+                kind: ContextKind::Directory,
+                icon: IconName::Folder,
+            });
+        }
        entries.push(ContextPickerEntry {
            name: "Fetch".into(),
-            kind: ContextPickerEntryKind::FetchedUrl,
+            kind: ContextKind::FetchedUrl,
            icon: IconName::Globe,
        });

        if thread_store.is_some() {
            entries.push(ContextPickerEntry {
                name: "Thread".into(),
-                kind: ContextPickerEntryKind::Thread,
+                kind: ContextKind::Thread,
                icon: IconName::MessageCircle,
            });
        }
@@ -133,18 +140,10 @@ impl Render for ContextPicker {
 #[derive(Clone)]
 struct ContextPickerEntry {
    name: SharedString,
-    kind: ContextPickerEntryKind,
+    kind: ContextKind,
    icon: IconName,
 }

-#[derive(Debug, Clone)]
-enum ContextPickerEntryKind {
-    File,
-    Directory,
-    FetchedUrl,
-    Thread,
-}
-
 pub(crate) struct ContextPickerDelegate {
    context_picker: WeakView<ContextPicker>,
    workspace: WeakView<Workspace>,
@@ -184,7 +183,7 @@ impl PickerDelegate for ContextPickerDelegate {
            self.context_picker
                .update(cx, |this, cx| {
                    match entry.kind {
-                        ContextPickerEntryKind::File => {
+                        ContextKind::File => {
                            this.mode = ContextPickerMode::File(cx.new_view(|cx| {
                                FileContextPicker::new(
                                    self.context_picker.clone(),
@@ -195,7 +194,7 @@ impl PickerDelegate for ContextPickerDelegate {
                                )
                            }));
                        }
-                        ContextPickerEntryKind::Directory => {
+                        ContextKind::Directory => {
                            this.mode = ContextPickerMode::Directory(cx.new_view(|cx| {
                                DirectoryContextPicker::new(
                                    self.context_picker.clone(),
@@ -206,7 +205,7 @@ impl PickerDelegate for ContextPickerDelegate {
                                )
                            }));
                        }
-                        ContextPickerEntryKind::FetchedUrl => {
+                        ContextKind::FetchedUrl => {
                            this.mode = ContextPickerMode::Fetch(cx.new_view(|cx| {
                                FetchContextPicker::new(
                                    self.context_picker.clone(),
@@ -217,7 +216,7 @@ impl PickerDelegate for ContextPickerDelegate {
                                )
                            }));
                        }
-                        ContextPickerEntryKind::Thread => {
+                        ContextKind::Thread => {
                            if let Some(thread_store) = self.thread_store.as_ref() {
                                this.mode = ContextPickerMode::Thread(cx.new_view(|cx| {
                                    ThreadContextPicker::new(
--- a/crates/assistant2/src/context_picker/directory_context_picker.rs
+++ b/crates/assistant2/src/context_picker/directory_context_picker.rs
@@ -1,18 +1,19 @@
+// TODO: Remove this when we finish the implementation.
+#![allow(unused)]
+
 use std::path::Path;
 use std::sync::atomic::AtomicBool;
 use std::sync::Arc;

-use anyhow::anyhow;
 use fuzzy::PathMatch;
 use gpui::{AppContext, DismissEvent, FocusHandle, FocusableView, Task, View, WeakModel, WeakView};
 use picker::{Picker, PickerDelegate};
-use project::{PathMatchCandidateSet, ProjectPath, Worktree, WorktreeId};
+use project::{PathMatchCandidateSet, WorktreeId};
 use ui::{prelude::*, ListItem};
 use util::ResultExt as _;
 use workspace::Workspace;

 use crate::context::ContextKind;
-use crate::context_picker::file_context_picker::codeblock_fence_for_path;
 use crate::context_picker::{ConfirmBehavior, ContextPicker};
 use crate::context_store::ContextStore;

@@ -192,61 +193,14 @@ impl PickerDelegate for DirectoryContextPickerDelegate {
        let worktree_id = WorktreeId::from_usize(mat.worktree_id);
        let confirm_behavior = self.confirm_behavior;
        cx.spawn(|this, mut cx| async move {
-            let worktree = project.update(&mut cx, |project, cx| {
-                project
-                    .worktree_for_id(worktree_id, cx)
-                    .ok_or_else(|| anyhow!("no worktree found for {worktree_id:?}"))
-            })??;
-
-            let files = worktree.update(&mut cx, |worktree, _cx| {
-                collect_files_in_path(worktree, &path)
-            })?;
-
-            let open_buffer_tasks = project.update(&mut cx, |project, cx| {
-                files
-                    .into_iter()
-                    .map(|file_path| {
-                        project.open_buffer(
-                            ProjectPath {
-                                worktree_id,
-                                path: file_path.clone(),
-                            },
-                            cx,
-                        )
-                    })
-                    .collect::<Vec<_>>()
-            })?;
-
-            let open_all_buffers_tasks = cx.background_executor().spawn(async move {
-                let mut buffers = Vec::with_capacity(open_buffer_tasks.len());
-
-                for open_buffer_task in open_buffer_tasks {
-                    let buffer = open_buffer_task.await?;
-
-                    buffers.push(buffer);
-                }
-
-                anyhow::Ok(buffers)
-            });
-
-            let buffers = open_all_buffers_tasks.await?;
-
            this.update(&mut cx, |this, cx| {
                let mut text = String::new();

-                for buffer in buffers {
-                    text.push_str(&codeblock_fence_for_path(Some(&path), None));
-                    text.push_str(&buffer.read(cx).text());
-                    if !text.ends_with('\n') {
-                        text.push('\n');
-                    }
-
-                    text.push_str("```\n");
-                }
+                // TODO: Add the files from the selected directory.

                this.delegate
                    .context_store
-                    .update(cx, |context_store, _cx| {
+                    .update(cx, |context_store, cx| {
                        context_store.insert_context(
                            ContextKind::Directory,
                            path.to_string_lossy().to_string(),
@@ -293,17 +247,3 @@ impl PickerDelegate for DirectoryContextPickerDelegate {
        )
    }
 }
-
-fn collect_files_in_path(worktree: &Worktree, path: &Path) -> Vec<Arc<Path>> {
-    let mut files = Vec::new();
-
-    for entry in worktree.child_entries(path) {
-        if entry.is_dir() {
-            files.extend(collect_files_in_path(worktree, &entry.path));
-        } else if entry.is_file() {
-            files.push(entry.path.clone());
-        }
-    }
-
-    files
-}
--- a/crates/assistant2/src/context_picker/file_context_picker.rs
+++ b/crates/assistant2/src/context_picker/file_context_picker.rs
@@ -7,7 +7,7 @@ use std::sync::Arc;
 use fuzzy::PathMatch;
 use gpui::{AppContext, DismissEvent, FocusHandle, FocusableView, Task, View, WeakModel, WeakView};
 use picker::{Picker, PickerDelegate};
-use project::{PathMatchCandidateSet, ProjectPath, WorktreeId};
+use project::{PathMatchCandidateSet, WorktreeId};
 use ui::{prelude::*, ListItem};
 use util::ResultExt as _;
 use workspace::Workspace;
@@ -207,20 +207,11 @@ impl PickerDelegate for FileContextPickerDelegate {
        let worktree_id = WorktreeId::from_usize(mat.worktree_id);
        let confirm_behavior = self.confirm_behavior;
        cx.spawn(|this, mut cx| async move {
-            let Some((entry_id, open_buffer_task)) = project
+            let Some(open_buffer_task) = project
                .update(&mut cx, |project, cx| {
-                    let project_path = ProjectPath {
-                        worktree_id,
-                        path: path.clone(),
-                    };
-
-                    let entry_id = project.entry_for_path(&project_path, cx)?.id;
-                    let task = project.open_buffer(project_path, cx);
-
-                    Some((entry_id, task))
+                    project.open_buffer((worktree_id, path.clone()), cx)
                })
                .ok()
-                .flatten()
            else {
                return anyhow::Ok(());
            };
@@ -241,7 +232,7 @@ impl PickerDelegate for FileContextPickerDelegate {
                        text.push_str("```\n");

                        context_store.insert_context(
-                            ContextKind::File(entry_id),
+                            ContextKind::File,
                            path.to_string_lossy().to_string(),
                            text,
                        );
@@ -316,10 +307,7 @@ impl PickerDelegate for FileContextPickerDelegate {
    }
 }

-pub(crate) fn codeblock_fence_for_path(
-    path: Option<&Path>,
-    row_range: Option<RangeInclusive<u32>>,
-) -> String {
+fn codeblock_fence_for_path(path: Option<&Path>, row_range: Option<RangeInclusive<u32>>) -> String {
    let mut text = String::new();
    write!(text, "```").unwrap();

--- a/crates/assistant2/src/context_picker/thread_context_picker.rs
+++ b/crates/assistant2/src/context_picker/thread_context_picker.rs
@@ -169,11 +169,25 @@ impl PickerDelegate for ThreadContextPickerDelegate {

        self.context_store
            .update(cx, |context_store, cx| {
-                context_store.insert_context(
-                    ContextKind::Thread(thread.read(cx).id().clone()),
-                    entry.summary.clone(),
-                    thread.read(cx).text(),
-                );
+                let text = thread.update(cx, |thread, _cx| {
+                    let mut text = String::new();
+
+                    for message in thread.messages() {
+                        text.push_str(match message.role {
+                            language_model::Role::User => "User:",
+                            language_model::Role::Assistant => "Assistant:",
+                            language_model::Role::System => "System:",
+                        });
+                        text.push('\n');
+
+                        text.push_str(&message.text);
+                        text.push('\n');
+                    }
+
+                    text
+                });
+
+                context_store.insert_context(ContextKind::Thread, entry.summary.clone(), text);
            })
            .ok();

--- a/crates/assistant2/src/context_store.rs
+++ b/crates/assistant2/src/context_store.rs
@@ -1,10 +1,6 @@
 use gpui::SharedString;
-use project::ProjectEntryId;

-use crate::{
-    context::{Context, ContextId, ContextKind},
-    thread::ThreadId,
-};
+use crate::context::{Context, ContextId, ContextKind};

 pub struct ContextStore {
    context: Vec<Context>,
@@ -48,18 +44,4 @@ impl ContextStore {
    pub fn remove_context(&mut self, id: &ContextId) {
        self.context.retain(|context| context.id != *id);
    }
-
-    pub fn contains_project_entry(&self, entry_id: ProjectEntryId) -> bool {
-        self.context.iter().any(|probe| match probe.kind {
-            ContextKind::File(probe_entry_id) => probe_entry_id == entry_id,
-            ContextKind::Directory | ContextKind::FetchedUrl | ContextKind::Thread(_) => false,
-        })
-    }
-
-    pub fn contains_thread(&self, thread_id: &ThreadId) -> bool {
-        self.context.iter().any(|probe| match probe.kind {
-            ContextKind::Thread(ref probe_thread_id) => probe_thread_id == thread_id,
-            ContextKind::File(_) | ContextKind::Directory | ContextKind::FetchedUrl => false,
-        })
-    }
 }
--- a/crates/assistant2/src/context_strip.rs
+++ b/crates/assistant2/src/context_strip.rs
@@ -1,27 +1,21 @@
 use std::rc::Rc;

-use editor::Editor;
-use gpui::{AppContext, FocusHandle, Model, View, WeakModel, WeakView};
-use language::Buffer;
-use project::ProjectEntryId;
-use ui::{prelude::*, KeyBinding, PopoverMenu, PopoverMenuHandle, Tooltip};
+use gpui::{FocusHandle, Model, View, WeakModel, WeakView};
+use ui::{prelude::*, PopoverMenu, PopoverMenuHandle, Tooltip};
 use workspace::Workspace;

-use crate::context::ContextKind;
 use crate::context_picker::{ConfirmBehavior, ContextPicker};
 use crate::context_store::ContextStore;
-use crate::thread::{Thread, ThreadId};
 use crate::thread_store::ThreadStore;
 use crate::ui::ContextPill;
-use crate::{AssistantPanel, ToggleContextPicker};
+use crate::ToggleContextPicker;
+use settings::Settings;

 pub struct ContextStrip {
    context_store: Model<ContextStore>,
    context_picker: View<ContextPicker>,
    context_picker_menu_handle: PopoverMenuHandle<ContextPicker>,
    focus_handle: FocusHandle,
-    suggest_context_kind: SuggestContextKind,
-    workspace: WeakView<Workspace>,
 }

 impl ContextStrip {
@@ -31,7 +25,6 @@ impl ContextStrip {
        thread_store: Option<WeakModel<ThreadStore>>,
        focus_handle: FocusHandle,
        context_picker_menu_handle: PopoverMenuHandle<ContextPicker>,
-        suggest_context_kind: SuggestContextKind,
        cx: &mut ViewContext<Self>,
    ) -> Self {
        Self {
@@ -47,76 +40,16 @@ impl ContextStrip {
            }),
            context_picker_menu_handle,
            focus_handle,
-            suggest_context_kind,
-            workspace,
        }
    }
-
-    fn suggested_context(&self, cx: &ViewContext<Self>) -> Option<SuggestedContext> {
-        match self.suggest_context_kind {
-            SuggestContextKind::File => self.suggested_file(cx),
-            SuggestContextKind::Thread => self.suggested_thread(cx),
-        }
-    }
-
-    fn suggested_file(&self, cx: &ViewContext<Self>) -> Option<SuggestedContext> {
-        let workspace = self.workspace.upgrade()?;
-        let active_item = workspace.read(cx).active_item(cx)?;
-        let entry_id = *active_item.project_entry_ids(cx).first()?;
-
-        if self.context_store.read(cx).contains_project_entry(entry_id) {
-            return None;
-        }
-
-        let editor = active_item.to_any().downcast::<Editor>().ok()?.read(cx);
-        let active_buffer = editor.buffer().read(cx).as_singleton()?;
-
-        let file = active_buffer.read(cx).file()?;
-        let title = file.path().to_string_lossy().into_owned().into();
-
-        Some(SuggestedContext::File {
-            entry_id,
-            title,
-            buffer: active_buffer.downgrade(),
-        })
-    }
-
-    fn suggested_thread(&self, cx: &ViewContext<Self>) -> Option<SuggestedContext> {
-        let workspace = self.workspace.upgrade()?;
-        let active_thread = workspace
-            .read(cx)
-            .panel::<AssistantPanel>(cx)?
-            .read(cx)
-            .active_thread(cx);
-        let weak_active_thread = active_thread.downgrade();
-
-        let active_thread = active_thread.read(cx);
-
-        if self
-            .context_store
-            .read(cx)
-            .contains_thread(active_thread.id())
-        {
-            return None;
-        }
-
-        Some(SuggestedContext::Thread {
-            id: active_thread.id().clone(),
-            title: active_thread.summary().unwrap_or("Active Thread".into()),
-            thread: weak_active_thread,
-        })
-    }
 }

 impl Render for ContextStrip {
    fn render(&mut self, cx: &mut ViewContext<Self>) -> impl IntoElement {
-        let context_store = self.context_store.read(cx);
-        let context = context_store.context().clone();
+        let context = self.context_store.read(cx).context().clone();
        let context_picker = self.context_picker.clone();
        let focus_handle = self.focus_handle.clone();

-        let suggested_context = self.suggested_context(cx);
-
        h_flex()
            .flex_wrap()
            .gap_1()
@@ -127,17 +60,13 @@ impl Render for ContextStrip {
                        IconButton::new("add-context", IconName::Plus)
                            .icon_size(IconSize::Small)
                            .style(ui::ButtonStyle::Filled)
-                            .tooltip({
-                                let focus_handle = focus_handle.clone();
-
-                                move |cx| {
-                                    Tooltip::for_action_in(
-                                        "Add Context",
-                                        &ToggleContextPicker,
-                                        &focus_handle,
-                                        cx,
-                                    )
-                                }
+                            .tooltip(move |cx| {
+                                Tooltip::for_action_in(
+                                    "Add Context",
+                                    &ToggleContextPicker,
+                                    &focus_handle,
+                                    cx,
+                                )
                            }),
                    )
                    .attach(gpui::Corner::TopLeft)
@@ -148,22 +77,26 @@ impl Render for ContextStrip {
                    })
                    .with_handle(self.context_picker_menu_handle.clone()),
            )
-            .when(context.is_empty() && suggested_context.is_none(), {
+            .when(context.is_empty(), {
                |parent| {
                    parent.child(
                        h_flex()
+                            .id("no-content-info")
                            .ml_1p5()
                            .gap_2()
-                            .child(
-                                Label::new("Add Context")
-                                    .size(LabelSize::Small)
-                                    .color(Color::Muted),
-                            )
-                            .opacity(0.5)
+                            .font(theme::ThemeSettings::get_global(cx).buffer_font.clone())
+                            .text_size(TextSize::Small.rems(cx))
+                            .text_color(cx.theme().colors().text_muted)
+                            .child("Add Context")
                            .children(
-                                KeyBinding::for_action_in(&ToggleContextPicker, &focus_handle, cx)
-                                    .map(|binding| binding.into_any_element()),
-                            ),
+                                ui::KeyBinding::for_action_in(
+                                    &ToggleContextPicker,
+                                    &self.focus_handle,
+                                    cx,
+                                )
+                                .map(|binding| binding.into_any_element()),
+                            )
+                            .opacity(0.5),
                    )
                }
            })
@@ -179,30 +112,6 @@ impl Render for ContextStrip {
                    }))
                })
            }))
-            .when_some(suggested_context, |el, suggested| {
-                el.child(
-                    Button::new("add-suggested-context", suggested.title().clone())
-                        .on_click({
-                            let context_store = self.context_store.clone();
-
-                            cx.listener(move |_this, _event, cx| {
-                                context_store.update(cx, |context_store, cx| {
-                                    suggested.accept(context_store, cx);
-                                });
-                                cx.notify();
-                            })
-                        })
-                        .icon(IconName::Plus)
-                        .icon_position(IconPosition::Start)
-                        .icon_size(IconSize::XSmall)
-                        .icon_color(Color::Muted)
-                        .label_size(LabelSize::Small)
-                        .style(ButtonStyle::Filled)
-                        .tooltip(|cx| {
-                            Tooltip::with_meta("Suggested Context", None, "Click to add it", cx)
-                        }),
-                )
-            })
            .when(!context.is_empty(), {
                move |parent| {
                    parent.child(
@@ -221,63 +130,3 @@ impl Render for ContextStrip {
            })
    }
 }
-
-pub enum SuggestContextKind {
-    File,
-    Thread,
-}
-
-#[derive(Clone)]
-pub enum SuggestedContext {
-    File {
-        entry_id: ProjectEntryId,
-        title: SharedString,
-        buffer: WeakModel<Buffer>,
-    },
-    Thread {
-        id: ThreadId,
-        title: SharedString,
-        thread: WeakModel<Thread>,
-    },
-}
-
-impl SuggestedContext {
-    pub fn title(&self) -> &SharedString {
-        match self {
-            Self::File { title, .. } => title,
-            Self::Thread { title, .. } => title,
-        }
-    }
-
-    pub fn accept(&self, context_store: &mut ContextStore, cx: &mut AppContext) {
-        match self {
-            Self::File {
-                entry_id,
-                title,
-                buffer,
-            } => {
-                let Some(buffer) = buffer.upgrade() else {
-                    return;
-                };
-                let text = buffer.read(cx).text();
-
-                context_store.insert_context(
-                    ContextKind::File(*entry_id),
-                    title.clone(),
-                    text.clone(),
-                );
-            }
-            Self::Thread { id, title, thread } => {
-                let Some(thread) = thread.upgrade() else {
-                    return;
-                };
-
-                context_store.insert_context(
-                    ContextKind::Thread(id.clone()),
-                    title.clone(),
-                    thread.read(cx).text(),
-                );
-            }
-        }
-    }
-}
--- a/crates/assistant2/src/inline_assistant.rs
+++ b/crates/assistant2/src/inline_assistant.rs
@@ -118,7 +118,7 @@ impl InlineAssistant {
            };
            let enabled = AssistantSettings::get_global(cx).enabled;
            terminal_panel.update(cx, |terminal_panel, cx| {
-                terminal_panel.set_assistant_enabled(enabled, cx)
+                terminal_panel.asssistant_enabled(enabled, cx)
            });
        })
        .detach();
@@ -871,11 +871,10 @@ impl InlineAssistant {
            if let Some(model) = LanguageModelRegistry::read_global(cx).active_model() {
                let language_name = assist.editor.upgrade().and_then(|editor| {
                    let multibuffer = editor.read(cx).buffer().read(cx);
-                    let snapshot = multibuffer.snapshot(cx);
-                    let ranges = snapshot.range_to_buffer_ranges(assist.range.clone());
+                    let ranges = multibuffer.range_to_buffer_ranges(assist.range.clone(), cx);
                    ranges
                        .first()
-                        .and_then(|(excerpt, _)| excerpt.buffer().language())
+                        .and_then(|(buffer, _, _)| buffer.read(cx).language())
                        .map(|language| language.name())
                });
                report_assistant_event(
--- a/crates/assistant2/src/inline_prompt_editor.rs
+++ b/crates/assistant2/src/inline_prompt_editor.rs
@@ -2,7 +2,7 @@ use crate::assistant_model_selector::AssistantModelSelector;
 use crate::buffer_codegen::BufferCodegen;
 use crate::context_picker::ContextPicker;
 use crate::context_store::ContextStore;
-use crate::context_strip::{ContextStrip, SuggestContextKind};
+use crate::context_strip::ContextStrip;
 use crate::terminal_codegen::TerminalCodegen;
 use crate::thread_store::ThreadStore;
 use crate::{CycleNextInlineAssist, CyclePreviousInlineAssist};
@@ -793,7 +793,6 @@ impl PromptEditor<BufferCodegen> {
                    thread_store.clone(),
                    prompt_editor.focus_handle(cx),
                    context_picker_menu_handle.clone(),
-                    SuggestContextKind::Thread,
                    cx,
                )
            }),
@@ -933,7 +932,6 @@ impl PromptEditor<TerminalCodegen> {
                    thread_store.clone(),
                    prompt_editor.focus_handle(cx),
                    context_picker_menu_handle.clone(),
-                    SuggestContextKind::Thread,
                    cx,
                )
            }),
--- a/crates/assistant2/src/message_editor.rs
+++ b/crates/assistant2/src/message_editor.rs
@@ -20,7 +20,7 @@ use workspace::Workspace;
 use crate::assistant_model_selector::AssistantModelSelector;
 use crate::context_picker::{ConfirmBehavior, ContextPicker};
 use crate::context_store::ContextStore;
-use crate::context_strip::{ContextStrip, SuggestContextKind};
+use crate::context_strip::ContextStrip;
 use crate::thread::{RequestKind, Thread};
 use crate::thread_store::ThreadStore;
 use crate::{Chat, ToggleContextPicker, ToggleModelSelector};
@@ -87,7 +87,6 @@ impl MessageEditor {
                    Some(thread_store.clone()),
                    editor.focus_handle(cx),
                    context_picker_menu_handle.clone(),
-                    SuggestContextKind::File,
                    cx,
                )
            }),
--- a/crates/assistant2/src/thread.rs
+++ b/crates/assistant2/src/thread.rs
@@ -164,27 +164,6 @@ impl Thread {
        id
    }

-    /// Returns the representation of this [`Thread`] in a textual form.
-    ///
-    /// This is the representation we use when attaching a thread as context to another thread.
-    pub fn text(&self) -> String {
-        let mut text = String::new();
-
-        for message in &self.messages {
-            text.push_str(match message.role {
-                language_model::Role::User => "User:",
-                language_model::Role::Assistant => "Assistant:",
-                language_model::Role::System => "System:",
-            });
-            text.push('\n');
-
-            text.push_str(&message.text);
-            text.push('\n');
-        }
-
-        text
-    }
-
    pub fn to_completion_request(
        &self,
        _request_kind: RequestKind,
--- a/crates/assistant2/src/thread_store.rs
+++ b/crates/assistant2/src/thread_store.rs
@@ -238,46 +238,5 @@ impl ThreadStore {
        Async programming in Rust provides a powerful way to write concurrent code that's both safe and efficient. It's particularly useful for servers, network programming, and any application that deals with many concurrent operations.".unindent(), cx);
            thread
        }));
-
-        self.threads.push(cx.new_model(|cx| {
-            let mut thread = Thread::new(self.tools.clone(), cx);
-            thread.set_summary("Rust code with long lines", cx);
-            thread.insert_user_message("Could you write me some Rust code with long lines?", Vec::new(), cx);
-            thread.insert_message(Role::Assistant, r#"Here's some Rust code with some intentionally long lines:
-            ```rust
-            use std::collections::{HashMap, HashSet};
-            use std::sync::{Arc, Mutex};
-            use std::thread;
-
-            fn main() {
-                let very_long_vector = vec![1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25];
-
-                let complicated_hashmap: HashMap<String, Vec<(i32, f64, String)>> = [("key1".to_string(), vec![(1, 1.1, "value1".to_string()), (2, 2.2, "value2".to_string())]), ("key2".to_string(), vec![(3, 3.3, "value3".to_string()), (4, 4.4, "value4".to_string())])].iter().cloned().collect();
-
-                let nested_structure = Arc::new(Mutex::new(HashMap::new()));
-
-                let long_closure = |x: i32, y: i32, z: i32| -> i32 { let result = x * y + z; println!("The result of the long closure calculation is: {}", result); result };
-
-                let thread_handles: Vec<_> = (0..10).map(|i| {
-                    let nested_structure_clone = Arc::clone(&nested_structure);
-                    thread::spawn(move || {
-                        let mut lock = nested_structure_clone.lock().unwrap();
-                        lock.entry(format!("thread_{}", i)).or_insert_with(|| HashSet::new()).insert(i * i);
-                    })
-                }).collect();
-
-                for handle in thread_handles {
-                    handle.join().unwrap();
-                }
-
-                println!("The final state of the nested structure is: {:?}", nested_structure.lock().unwrap());
-
-                let complex_expression = very_long_vector.iter().filter(|&&x| x % 2 == 0).map(|&x| x * x).fold(0, |acc, x| acc + x) + long_closure(5, 10, 15);
-
-                println!("The result of the complex expression is: {}", complex_expression);
-            }
-            ```"#.unindent(), cx);
-            thread
-        }));
    }
 }
--- a/crates/assistant2/src/ui/context_pill.rs
+++ b/crates/assistant2/src/ui/context_pill.rs
@@ -33,10 +33,10 @@ impl RenderOnce for ContextPill {
            px(4.)
        };
        let icon = match self.context.kind {
-            ContextKind::File(_) => IconName::File,
+            ContextKind::File => IconName::File,
            ContextKind::Directory => IconName::Folder,
            ContextKind::FetchedUrl => IconName::Globe,
-            ContextKind::Thread(_) => IconName::MessageCircle,
+            ContextKind::Thread => IconName::MessageCircle,
        };

        h_flex()
--- a/crates/cli/build.rs
+++ b/crates/cli/build.rs
@@ -2,10 +2,4 @@ fn main() {
    if std::env::var("ZED_UPDATE_EXPLANATION").is_ok() {
        println!(r#"cargo:rustc-cfg=feature="no-bundled-uninstall""#);
    }
-
-    if cfg!(target_os = "macos") {
-        println!("cargo:rustc-env=MACOSX_DEPLOYMENT_TARGET=10.15.7");
-        // Weakly link ScreenCaptureKit to ensure can be used on macOS 10.15+.
-        println!("cargo:rustc-link-arg=-Wl,-weak_framework,ScreenCaptureKit");
-    }
 }
--- a/crates/cli/src/main.rs
+++ b/crates/cli/src/main.rs
@@ -79,7 +79,7 @@ fn parse_path_with_position(argument_str: &str) -> anyhow::Result<String> {
        Ok(existing_path) => PathWithPosition::from_path(existing_path),
        Err(_) => {
            let path = PathWithPosition::parse_str(argument_str);
-            let curdir = env::current_dir().context("retrieving current directory")?;
+            let curdir = env::current_dir().context("reteiving current directory")?;
            path.map_path(|path| match fs::canonicalize(&path) {
                Ok(path) => Ok(path),
                Err(e) => {
@@ -257,6 +257,7 @@ fn main() -> Result<()> {
    if args.foreground {
        app.run_foreground(url)?;
    } else {
+        eprintln!("Logs are written to {:?}", paths::log_file());
        app.launch(url)?;
        sender.join().unwrap()?;
        pipe_handle.join().unwrap()?;
--- a/crates/collab/migrations.sqlite/20221109000000_test_schema.sql
+++ b/crates/collab/migrations.sqlite/20221109000000_test_schema.sql
@@ -106,22 +106,6 @@ CREATE TABLE "worktree_repositories" (
 CREATE INDEX "index_worktree_repositories_on_project_id" ON "worktree_repositories" ("project_id");
 CREATE INDEX "index_worktree_repositories_on_project_id_and_worktree_id" ON "worktree_repositories" ("project_id", "worktree_id");

-CREATE TABLE "worktree_repository_statuses" (
-    "project_id" INTEGER NOT NULL,
-    "worktree_id" INT8 NOT NULL,
-    "work_directory_id" INT8 NOT NULL,
-    "repo_path" VARCHAR NOT NULL,
-    "status" INT8 NOT NULL,
-    "scan_id" INT8 NOT NULL,
-    "is_deleted" BOOL NOT NULL,
-    PRIMARY KEY(project_id, worktree_id, work_directory_id, repo_path),
-    FOREIGN KEY(project_id, worktree_id) REFERENCES worktrees (project_id, id) ON DELETE CASCADE,
-    FOREIGN KEY(project_id, worktree_id, work_directory_id) REFERENCES worktree_entries (project_id, worktree_id, id) ON DELETE CASCADE
-);
-CREATE INDEX "index_wt_repos_statuses_on_project_id" ON "worktree_repository_statuses" ("project_id");
-CREATE INDEX "index_wt_repos_statuses_on_project_id_and_wt_id" ON "worktree_repository_statuses" ("project_id", "worktree_id");
-CREATE INDEX "index_wt_repos_statuses_on_project_id_and_wt_id_and_wd_id" ON "worktree_repository_statuses" ("project_id", "worktree_id", "work_directory_id");
-
 CREATE TABLE "worktree_settings_files" (
    "project_id" INTEGER NOT NULL,
    "worktree_id" INTEGER NOT NULL,
--- a/crates/collab/src/db/queries/projects.rs
+++ b/crates/collab/src/db/queries/projects.rs
@@ -1,5 +1,4 @@
 use anyhow::Context as _;
-
 use util::ResultExt;

 use super::*;
@@ -275,8 +274,8 @@ impl Database {
                        mtime_nanos: ActiveValue::set(mtime.nanos as i32),
                        canonical_path: ActiveValue::set(entry.canonical_path.clone()),
                        is_ignored: ActiveValue::set(entry.is_ignored),
-                        git_status: ActiveValue::set(None),
                        is_external: ActiveValue::set(entry.is_external),
+                        git_status: ActiveValue::set(entry.git_status.map(|status| status as i64)),
                        is_deleted: ActiveValue::set(false),
                        scan_id: ActiveValue::set(update.scan_id as i64),
                        is_fifo: ActiveValue::set(entry.is_fifo),
@@ -296,6 +295,7 @@ impl Database {
                        worktree_entry::Column::MtimeNanos,
                        worktree_entry::Column::CanonicalPath,
                        worktree_entry::Column::IsIgnored,
+                        worktree_entry::Column::GitStatus,
                        worktree_entry::Column::ScanId,
                    ])
                    .to_owned(),
@@ -349,79 +349,6 @@ impl Database {
                )
                .exec(&*tx)
                .await?;
-
-                let has_any_statuses = update
-                    .updated_repositories
-                    .iter()
-                    .any(|repository| !repository.updated_statuses.is_empty());
-
-                if has_any_statuses {
-                    worktree_repository_statuses::Entity::insert_many(
-                        update.updated_repositories.iter().flat_map(
-                            |repository: &proto::RepositoryEntry| {
-                                repository.updated_statuses.iter().map(|status_entry| {
-                                    worktree_repository_statuses::ActiveModel {
-                                        project_id: ActiveValue::set(project_id),
-                                        worktree_id: ActiveValue::set(worktree_id),
-                                        work_directory_id: ActiveValue::set(
-                                            repository.work_directory_id as i64,
-                                        ),
-                                        scan_id: ActiveValue::set(update.scan_id as i64),
-                                        is_deleted: ActiveValue::set(false),
-                                        repo_path: ActiveValue::set(status_entry.repo_path.clone()),
-                                        status: ActiveValue::set(status_entry.status as i64),
-                                    }
-                                })
-                            },
-                        ),
-                    )
-                    .on_conflict(
-                        OnConflict::columns([
-                            worktree_repository_statuses::Column::ProjectId,
-                            worktree_repository_statuses::Column::WorktreeId,
-                            worktree_repository_statuses::Column::WorkDirectoryId,
-                            worktree_repository_statuses::Column::RepoPath,
-                        ])
-                        .update_columns([
-                            worktree_repository_statuses::Column::ScanId,
-                            worktree_repository_statuses::Column::Status,
-                        ])
-                        .to_owned(),
-                    )
-                    .exec(&*tx)
-                    .await?;
-                }
-
-                let has_any_removed_statuses = update
-                    .updated_repositories
-                    .iter()
-                    .any(|repository| !repository.removed_statuses.is_empty());
-
-                if has_any_removed_statuses {
-                    worktree_repository_statuses::Entity::update_many()
-                        .filter(
-                            worktree_repository_statuses::Column::ProjectId
-                                .eq(project_id)
-                                .and(
-                                    worktree_repository_statuses::Column::WorktreeId
-                                        .eq(worktree_id),
-                                )
-                                .and(
-                                    worktree_repository_statuses::Column::RepoPath.is_in(
-                                        update.updated_repositories.iter().flat_map(|repository| {
-                                            repository.removed_statuses.iter()
-                                        }),
-                                    ),
-                                ),
-                        )
-                        .set(worktree_repository_statuses::ActiveModel {
-                            is_deleted: ActiveValue::Set(true),
-                            scan_id: ActiveValue::Set(update.scan_id as i64),
-                            ..Default::default()
-                        })
-                        .exec(&*tx)
-                        .await?;
-                }
            }

            if !update.removed_repositories.is_empty() {
@@ -716,6 +643,7 @@ impl Database {
                        canonical_path: db_entry.canonical_path,
                        is_ignored: db_entry.is_ignored,
                        is_external: db_entry.is_external,
+                        git_status: db_entry.git_status.map(|status| status as i32),
                        // This is only used in the summarization backlog, so if it's None,
                        // that just means we won't be able to detect when to resummarize
                        // based on total number of backlogged bytes - instead, we'd go
@@ -729,49 +657,23 @@ impl Database {

        // Populate repository entries.
        {
-            let db_repository_entries = worktree_repository::Entity::find()
+            let mut db_repository_entries = worktree_repository::Entity::find()
                .filter(
                    Condition::all()
                        .add(worktree_repository::Column::ProjectId.eq(project.id))
                        .add(worktree_repository::Column::IsDeleted.eq(false)),
                )
-                .all(tx)
+                .stream(tx)
                .await?;
-            for db_repository_entry in db_repository_entries {
+            while let Some(db_repository_entry) = db_repository_entries.next().await {
+                let db_repository_entry = db_repository_entry?;
                if let Some(worktree) = worktrees.get_mut(&(db_repository_entry.worktree_id as u64))
                {
-                    let mut repository_statuses = worktree_repository_statuses::Entity::find()
-                        .filter(
-                            Condition::all()
-                                .add(worktree_repository_statuses::Column::ProjectId.eq(project.id))
-                                .add(
-                                    worktree_repository_statuses::Column::WorktreeId
-                                        .eq(worktree.id),
-                                )
-                                .add(
-                                    worktree_repository_statuses::Column::WorkDirectoryId
-                                        .eq(db_repository_entry.work_directory_id),
-                                )
-                                .add(worktree_repository_statuses::Column::IsDeleted.eq(false)),
-                        )
-                        .stream(tx)
-                        .await?;
-                    let mut updated_statuses = Vec::new();
-                    while let Some(status_entry) = repository_statuses.next().await {
-                        let status_entry: worktree_repository_statuses::Model = status_entry?;
-                        updated_statuses.push(proto::StatusEntry {
-                            repo_path: status_entry.repo_path,
-                            status: status_entry.status as i32,
-                        });
-                    }
-
                    worktree.repository_entries.insert(
                        db_repository_entry.work_directory_id as u64,
                        proto::RepositoryEntry {
                            work_directory_id: db_repository_entry.work_directory_id as u64,
                            branch: db_repository_entry.branch,
-                            updated_statuses,
-                            removed_statuses: Vec::new(),
                        },
                    );
                }
--- a/crates/collab/src/db/queries/rooms.rs
+++ b/crates/collab/src/db/queries/rooms.rs
@@ -662,6 +662,7 @@ impl Database {
                            canonical_path: db_entry.canonical_path,
                            is_ignored: db_entry.is_ignored,
                            is_external: db_entry.is_external,
+                            git_status: db_entry.git_status.map(|status| status as i32),
                            // This is only used in the summarization backlog, so if it's None,
                            // that just means we won't be able to detect when to resummarize
                            // based on total number of backlogged bytes - instead, we'd go
@@ -681,69 +682,26 @@ impl Database {
                    worktree_repository::Column::IsDeleted.eq(false)
                };

-                let db_repositories = worktree_repository::Entity::find()
+                let mut db_repositories = worktree_repository::Entity::find()
                    .filter(
                        Condition::all()
                            .add(worktree_repository::Column::ProjectId.eq(project.id))
                            .add(worktree_repository::Column::WorktreeId.eq(worktree.id))
                            .add(repository_entry_filter),
                    )
-                    .all(tx)
+                    .stream(tx)
                    .await?;

-                for db_repository in db_repositories.into_iter() {
+                while let Some(db_repository) = db_repositories.next().await {
+                    let db_repository = db_repository?;
                    if db_repository.is_deleted {
                        worktree
                            .removed_repositories
                            .push(db_repository.work_directory_id as u64);
                    } else {
-                        let status_entry_filter = if let Some(rejoined_worktree) = rejoined_worktree
-                        {
-                            worktree_repository_statuses::Column::ScanId
-                                .gt(rejoined_worktree.scan_id)
-                        } else {
-                            worktree_repository_statuses::Column::IsDeleted.eq(false)
-                        };
-
-                        let mut db_statuses = worktree_repository_statuses::Entity::find()
-                            .filter(
-                                Condition::all()
-                                    .add(
-                                        worktree_repository_statuses::Column::ProjectId
-                                            .eq(project.id),
-                                    )
-                                    .add(
-                                        worktree_repository_statuses::Column::WorktreeId
-                                            .eq(worktree.id),
-                                    )
-                                    .add(
-                                        worktree_repository_statuses::Column::WorkDirectoryId
-                                            .eq(db_repository.work_directory_id),
-                                    )
-                                    .add(status_entry_filter),
-                            )
-                            .stream(tx)
-                            .await?;
-                        let mut removed_statuses = Vec::new();
-                        let mut updated_statuses = Vec::new();
-
-                        while let Some(db_status) = db_statuses.next().await {
-                            let db_status: worktree_repository_statuses::Model = db_status?;
-                            if db_status.is_deleted {
-                                removed_statuses.push(db_status.repo_path);
-                            } else {
-                                updated_statuses.push(proto::StatusEntry {
-                                    repo_path: db_status.repo_path,
-                                    status: db_status.status as i32,
-                                });
-                            }
-                        }
-
                        worktree.updated_repositories.push(proto::RepositoryEntry {
                            work_directory_id: db_repository.work_directory_id as u64,
                            branch: db_repository.branch,
-                            updated_statuses,
-                            removed_statuses,
                        });
                    }
                }
--- a/crates/collab/src/tests/integration_tests.rs
+++ b/crates/collab/src/tests/integration_tests.rs
@@ -2925,6 +2925,8 @@ async fn test_git_status_sync(
        assert_eq!(snapshot.status_for_file(file), status);
    }

+    // Smoke test status reading
+
    project_local.read_with(cx_a, |project, cx| {
        assert_status(&Path::new(A_TXT), Some(GitFileStatus::Added), project, cx);
        assert_status(&Path::new(B_TXT), Some(GitFileStatus::Added), project, cx);
@@ -6667,10 +6669,6 @@ async fn test_remote_git_branches(
    client_a
        .fs()
        .insert_branches(Path::new("/project/.git"), &branches);
-    let branches_set = branches
-        .into_iter()
-        .map(ToString::to_string)
-        .collect::<HashSet<_>>();

    let (project_a, worktree_id) = client_a.build_local_project("/project", cx_a).await;
    let project_id = active_call_a
@@ -6692,10 +6690,10 @@ async fn test_remote_git_branches(

    let branches_b = branches_b
        .into_iter()
-        .map(|branch| branch.name.to_string())
-        .collect::<HashSet<_>>();
+        .map(|branch| branch.name)
+        .collect::<Vec<_>>();

-    assert_eq!(branches_b, branches_set);
+    assert_eq!(&branches_b, &branches);

    cx_b.update(|cx| {
        project_b.update(cx, |project, cx| {
--- a/crates/collab/src/tests/remote_editing_collaboration_tests.rs
+++ b/crates/collab/src/tests/remote_editing_collaboration_tests.rs
@@ -229,10 +229,6 @@ async fn test_ssh_collaboration_git_branches(
        .await;

    let branches = ["main", "dev", "feature-1"];
-    let branches_set = branches
-        .iter()
-        .map(ToString::to_string)
-        .collect::<HashSet<_>>();
    remote_fs.insert_branches(Path::new("/project/.git"), &branches);

    // User A connects to the remote project via SSH.
@@ -285,10 +281,10 @@ async fn test_ssh_collaboration_git_branches(

    let branches_b = branches_b
        .into_iter()
-        .map(|branch| branch.name.to_string())
-        .collect::<HashSet<_>>();
+        .map(|branch| branch.name)
+        .collect::<Vec<_>>();

-    assert_eq!(&branches_b, &branches_set);
+    assert_eq!(&branches_b, &branches);

    cx_b.update(|cx| {
        project_b.update(cx, |project, cx| {
--- a/crates/collab_ui/src/chat_panel.rs
+++ b/crates/collab_ui/src/chat_panel.rs
@@ -1135,20 +1135,15 @@ impl Panel for ChatPanel {
    }

    fn icon(&self, cx: &WindowContext) -> Option<ui::IconName> {
-        let show_icon = match ChatPanelSettings::get_global(cx).button {
-            ChatPanelButton::Never => false,
-            ChatPanelButton::Always => true,
-            ChatPanelButton::WhenInCall => {
-                let is_in_call = ActiveCall::global(cx)
-                    .read(cx)
-                    .room()
-                    .map_or(false, |room| room.read(cx).contains_guests());
-
-                self.active || is_in_call
-            }
-        };
-
-        show_icon.then(|| ui::IconName::MessageBubbles)
+        match ChatPanelSettings::get_global(cx).button {
+            ChatPanelButton::Never => None,
+            ChatPanelButton::Always => Some(ui::IconName::MessageBubbles),
+            ChatPanelButton::WhenInCall => ActiveCall::global(cx)
+                .read(cx)
+                .room()
+                .filter(|room| room.read(cx).contains_guests())
+                .map(|_| ui::IconName::MessageBubbles),
+        }
    }

    fn icon_tooltip(&self, _cx: &WindowContext) -> Option<&'static str> {
--- a/crates/collections/Cargo.toml
+++ b/crates/collections/Cargo.toml
@@ -16,5 +16,4 @@ doctest = false
 test-support = []

 [dependencies]
-indexmap.workspace = true
-rustc-hash.workspace = true
+rustc-hash = "1.1"
--- a/crates/collections/src/collections.rs
+++ b/crates/collections/src/collections.rs
@@ -4,24 +4,12 @@ pub type HashMap<K, V> = FxHashMap<K, V>;
 #[cfg(feature = "test-support")]
 pub type HashSet<T> = FxHashSet<T>;

-#[cfg(feature = "test-support")]
-pub type IndexMap<K, V> = indexmap::IndexMap<K, V, rustc_hash::FxBuildHasher>;
-
-#[cfg(feature = "test-support")]
-pub type IndexSet<T> = indexmap::IndexSet<T, rustc_hash::FxBuildHasher>;
-
 #[cfg(not(feature = "test-support"))]
 pub type HashMap<K, V> = std::collections::HashMap<K, V>;

 #[cfg(not(feature = "test-support"))]
 pub type HashSet<T> = std::collections::HashSet<T>;

-#[cfg(not(feature = "test-support"))]
-pub type IndexMap<K, V> = indexmap::IndexMap<K, V>;
-
-#[cfg(not(feature = "test-support"))]
-pub type IndexSet<T> = indexmap::IndexSet<T>;
-
 pub use rustc_hash::FxHasher;
 pub use rustc_hash::{FxHashMap, FxHashSet};
 pub use std::collections::*;
--- a/crates/diagnostics/src/diagnostics.rs
+++ b/crates/diagnostics/src/diagnostics.rs
@@ -841,61 +841,72 @@ fn diagnostic_header_renderer(diagnostic: Diagnostic) -> RenderBlock {

        h_flex()
            .id(DIAGNOSTIC_HEADER)
-            .block_mouse_down()
-            .h(2. * cx.line_height())
            .w_full()
-            .px_9()
-            .justify_between()
-            .gap_2()
+            .relative()
+            .child(
+                div()
+                    .top(px(0.))
+                    .absolute()
+                    .w_full()
+                    .h_px()
+                    .bg(color.border_variant),
+            )
            .child(
                h_flex()
+                    .block_mouse_down()
+                    .h(2. * cx.line_height())
+                    .pl_10()
+                    .pr_5()
+                    .w_full()
+                    .justify_between()
                    .gap_2()
-                    .px_1()
-                    .rounded_md()
-                    .bg(color.surface_background.opacity(0.5))
-                    .map(|stack| {
-                        stack.child(
-                            svg()
-                                .size(cx.text_style().font_size)
-                                .flex_none()
-                                .map(|icon| {
-                                    if diagnostic.severity == DiagnosticSeverity::ERROR {
-                                        icon.path(IconName::XCircle.path())
-                                            .text_color(Color::Error.color(cx))
-                                    } else {
-                                        icon.path(IconName::Warning.path())
-                                            .text_color(Color::Warning.color(cx))
-                                    }
-                                }),
-                        )
-                    })
                    .child(
                        h_flex()
-                            .gap_1()
+                            .gap_3()
+                            .map(|stack| {
+                                stack.child(svg().size(cx.text_style().font_size).flex_none().map(
+                                    |icon| {
+                                        if diagnostic.severity == DiagnosticSeverity::ERROR {
+                                            icon.path(IconName::XCircle.path())
+                                                .text_color(Color::Error.color(cx))
+                                        } else {
+                                            icon.path(IconName::Warning.path())
+                                                .text_color(Color::Warning.color(cx))
+                                        }
+                                    },
+                                ))
+                            })
                            .child(
-                                StyledText::new(message.clone()).with_highlights(
-                                    &cx.text_style(),
-                                    code_ranges
-                                        .iter()
-                                        .map(|range| (range.clone(), highlight_style)),
-                                ),
+                                h_flex()
+                                    .gap_1()
+                                    .child(
+                                        StyledText::new(message.clone()).with_highlights(
+                                            &cx.text_style(),
+                                            code_ranges
+                                                .iter()
+                                                .map(|range| (range.clone(), highlight_style)),
+                                        ),
+                                    )
+                                    .when_some(diagnostic.code.as_ref(), |stack, code| {
+                                        stack.child(
+                                            div()
+                                                .child(SharedString::from(format!("({code})")))
+                                                .text_color(cx.theme().colors().text_muted),
+                                        )
+                                    }),
+                            ),
+                    )
+                    .child(h_flex().gap_1().when_some(
+                        diagnostic.source.as_ref(),
+                        |stack, source| {
+                            stack.child(
+                                div()
+                                    .child(SharedString::from(source.clone()))
+                                    .text_color(cx.theme().colors().text_muted),
                            )
-                            .when_some(diagnostic.code.as_ref(), |stack, code| {
-                                stack.child(
-                                    div()
-                                        .child(SharedString::from(format!("({code})")))
-                                        .text_color(color.text_muted),
-                                )
-                            }),
-                    ),
+                        },
+                    )),
            )
-            .when_some(diagnostic.source.as_ref(), |stack, source| {
-                stack.child(
-                    div()
-                        .child(SharedString::from(source.clone()))
-                        .text_color(color.text_muted),
-                )
-            })
            .into_any_element()
    })
 }
--- a/crates/diagnostics/src/items.rs
+++ b/crates/diagnostics/src/items.rs
@@ -1,11 +1,11 @@
 use std::time::Duration;

-use editor::{AnchorRangeExt, Editor};
+use editor::Editor;
 use gpui::{
    EventEmitter, IntoElement, ParentElement, Render, Styled, Subscription, Task, View,
    ViewContext, WeakView,
 };
-use language::{Diagnostic, DiagnosticEntry};
+use language::Diagnostic;
 use ui::{h_flex, prelude::*, Button, ButtonLike, Color, Icon, IconName, Label, Tooltip};
 use workspace::{item::ItemHandle, StatusItemView, ToolbarItemEvent, Workspace};

@@ -148,11 +148,7 @@ impl DiagnosticIndicator {
            (buffer, cursor_position)
        });
        let new_diagnostic = buffer
-            .diagnostics_in_range(cursor_position..cursor_position, false)
-            .map(|DiagnosticEntry { diagnostic, range }| DiagnosticEntry {
-                diagnostic,
-                range: range.to_offset(&buffer),
-            })
+            .diagnostics_in_range::<_, usize>(cursor_position..cursor_position, false)
            .filter(|entry| !entry.range.is_empty())
            .min_by_key(|entry| (entry.diagnostic.severity, entry.range.len()))
            .map(|entry| entry.diagnostic);
--- a/crates/editor/src/display_map/block_map.rs
+++ b/crates/editor/src/display_map/block_map.rs
@@ -2748,7 +2748,7 @@ mod tests {
                .iter()
                .filter(|(_, block)| matches!(block, Block::FoldedBuffer { .. }))
                .count(),
-            "Should have one folded block, producing a header of the second buffer"
+            "Should have one folded block, prodicing a header of the second buffer"
        );
        assert_eq!(
            blocks_snapshot.text(),
@@ -2994,7 +2994,7 @@ mod tests {
                    }
                })
                .count(),
-            "Should have one folded block, producing a header of the second buffer"
+            "Should have one folded block, prodicing a header of the second buffer"
        );
        assert_eq!(blocks_snapshot.text(), "\n");
        assert_eq!(
--- a/crates/editor/src/editor.rs
+++ b/crates/editor/src/editor.rs
@@ -99,8 +99,8 @@ use itertools::Itertools;
 use language::{
    language_settings::{self, all_language_settings, language_settings, InlayHintSettings},
    markdown, point_from_lsp, AutoindentMode, BracketPair, Buffer, Capability, CharKind, CodeLabel,
-    CursorShape, Diagnostic, DiagnosticEntry, Documentation, IndentKind, IndentSize, Language,
-    OffsetRangeExt, Point, Selection, SelectionGoal, TransactionId,
+    CursorShape, Diagnostic, Documentation, IndentKind, IndentSize, Language, OffsetRangeExt,
+    Point, Selection, SelectionGoal, TransactionId,
 };
 use language::{point_to_lsp, BufferRow, CharClassifier, Runnable, RunnableRange};
 use linked_editing_ranges::refresh_linked_ranges;
@@ -993,10 +993,7 @@ pub(crate) struct FocusedBlock {

 #[derive(Clone)]
 enum JumpData {
-    MultiBufferRow {
-        row: MultiBufferRow,
-        line_offset_from_top: u32,
-    },
+    MultiBufferRow(MultiBufferRow),
    MultiBufferPoint {
        excerpt_id: ExcerptId,
        position: Point,
@@ -3549,12 +3546,13 @@ impl Editor {
            Bias::Left,
        );
        let multi_buffer_visible_range = multi_buffer_visible_start..multi_buffer_visible_end;
-        multi_buffer_snapshot
-            .range_to_buffer_ranges(multi_buffer_visible_range)
+        multi_buffer
+            .range_to_buffer_ranges(multi_buffer_visible_range, cx)
            .into_iter()
-            .filter(|(_, excerpt_visible_range)| !excerpt_visible_range.is_empty())
-            .filter_map(|(excerpt, excerpt_visible_range)| {
-                let buffer_file = project::File::from_dyn(excerpt.buffer().file())?;
+            .filter(|(_, excerpt_visible_range, _)| !excerpt_visible_range.is_empty())
+            .filter_map(|(buffer_handle, excerpt_visible_range, excerpt_id)| {
+                let buffer = buffer_handle.read(cx);
+                let buffer_file = project::File::from_dyn(buffer.file())?;
                let buffer_worktree = project.worktree_for_id(buffer_file.worktree_id(cx), cx)?;
                let worktree_entry = buffer_worktree
                    .read(cx)
@@ -3563,17 +3561,17 @@ impl Editor {
                    return None;
                }

-                let language = excerpt.buffer().language()?;
+                let language = buffer.language()?;
                if let Some(restrict_to_languages) = restrict_to_languages {
                    if !restrict_to_languages.contains(language) {
                        return None;
                    }
                }
                Some((
-                    excerpt.id(),
+                    excerpt_id,
                    (
-                        multi_buffer.buffer(excerpt.buffer_id()).unwrap(),
-                        excerpt.buffer().version().clone(),
+                        buffer_handle,
+                        buffer.version().clone(),
                        excerpt_visible_range,
                    ),
                ))
@@ -9148,12 +9146,11 @@ impl Editor {
        // If there is an active Diagnostic Popover jump to its diagnostic instead.
        if direction == Direction::Next {
            if let Some(popover) = self.hover_state.diagnostic_popover.as_ref() {
-                self.activate_diagnostics(popover.group_id(), cx);
-                if let Some(active_diagnostics) = self.active_diagnostics.as_ref() {
-                    let primary_range_start = active_diagnostics.primary_range.start;
+                let (group_id, jump_to) = popover.activation_info();
+                if self.activate_diagnostics(group_id, cx) {
                    self.change_selections(Some(Autoscroll::fit()), cx, |s| {
                        let mut new_selection = s.newest_anchor().clone();
-                        new_selection.collapse_to(primary_range_start, SelectionGoal::None);
+                        new_selection.collapse_to(jump_to, SelectionGoal::None);
                        s.select_anchors(vec![new_selection.clone()]);
                    });
                }
@@ -9179,23 +9176,10 @@ impl Editor {
        let snapshot = self.snapshot(cx);
        loop {
            let diagnostics = if direction == Direction::Prev {
-                buffer
-                    .diagnostics_in_range(0..search_start, true)
-                    .map(|DiagnosticEntry { diagnostic, range }| DiagnosticEntry {
-                        diagnostic,
-                        range: range.to_offset(&buffer),
-                    })
-                    .collect::<Vec<_>>()
+                buffer.diagnostics_in_range::<_, usize>(0..search_start, true)
            } else {
-                buffer
-                    .diagnostics_in_range(search_start..buffer.len(), false)
-                    .map(|DiagnosticEntry { diagnostic, range }| DiagnosticEntry {
-                        diagnostic,
-                        range: range.to_offset(&buffer),
-                    })
-                    .collect::<Vec<_>>()
+                buffer.diagnostics_in_range::<_, usize>(search_start..buffer.len(), false)
            }
-            .into_iter()
            .filter(|diagnostic| !snapshot.intersects_fold(diagnostic.range.start));
            let group = diagnostics
                // relies on diagnostics_in_range to return diagnostics with the same starting range to
@@ -9225,8 +9209,7 @@ impl Editor {
                });

            if let Some((primary_range, group_id)) = group {
-                self.activate_diagnostics(group_id, cx);
-                if self.active_diagnostics.is_some() {
+                if self.activate_diagnostics(group_id, cx) {
                    self.change_selections(Some(Autoscroll::fit()), cx, |s| {
                        s.select(vec![Selection {
                            id: selection.id,
@@ -10303,12 +10286,11 @@ impl Editor {
            let buffer = self.buffer.read(cx).snapshot(cx);
            let primary_range_start = active_diagnostics.primary_range.start.to_offset(&buffer);
            let is_valid = buffer
-                .diagnostics_in_range(active_diagnostics.primary_range.clone(), false)
+                .diagnostics_in_range::<_, usize>(active_diagnostics.primary_range.clone(), false)
                .any(|entry| {
-                    let range = entry.range.to_offset(&buffer);
                    entry.diagnostic.is_primary
-                        && !range.is_empty()
-                        && range.start == primary_range_start
+                        && !entry.range.is_empty()
+                        && entry.range.start == primary_range_start
                        && entry.diagnostic.message == active_diagnostics.primary_message
                });

@@ -10328,7 +10310,7 @@ impl Editor {
        }
    }

-    fn activate_diagnostics(&mut self, group_id: usize, cx: &mut ViewContext<Self>) {
+    fn activate_diagnostics(&mut self, group_id: usize, cx: &mut ViewContext<Self>) -> bool {
        self.dismiss_diagnostics(cx);
        let snapshot = self.snapshot(cx);
        self.active_diagnostics = self.display_map.update(cx, |display_map, cx| {
@@ -10338,18 +10320,16 @@ impl Editor {
            let mut primary_message = None;
            let mut group_end = Point::zero();
            let diagnostic_group = buffer
-                .diagnostic_group(group_id)
+                .diagnostic_group::<MultiBufferPoint>(group_id)
                .filter_map(|entry| {
-                    let start = entry.range.start.to_point(&buffer);
-                    let end = entry.range.end.to_point(&buffer);
-                    if snapshot.is_line_folded(MultiBufferRow(start.row))
-                        && (start.row == end.row
-                            || snapshot.is_line_folded(MultiBufferRow(end.row)))
+                    if snapshot.is_line_folded(MultiBufferRow(entry.range.start.row))
+                        && (entry.range.start.row == entry.range.end.row
+                            || snapshot.is_line_folded(MultiBufferRow(entry.range.end.row)))
                    {
                        return None;
                    }
-                    if end > group_end {
-                        group_end = end;
+                    if entry.range.end > group_end {
+                        group_end = entry.range.end;
                    }
                    if entry.diagnostic.is_primary {
                        primary_range = Some(entry.range.clone());
@@ -10360,6 +10340,8 @@ impl Editor {
                .collect::<Vec<_>>();
            let primary_range = primary_range?;
            let primary_message = primary_message?;
+            let primary_range =
+                buffer.anchor_after(primary_range.start)..buffer.anchor_before(primary_range.end);

            let blocks = display_map
                .insert_blocks(
@@ -10390,6 +10372,7 @@ impl Editor {
                is_valid: true,
            })
        });
+        self.active_diagnostics.is_some()
    }

    fn dismiss_diagnostics(&mut self, cx: &mut ViewContext<Self>) {
@@ -11507,23 +11490,21 @@ impl Editor {
            let (buffer, selection) = if let Some(buffer) = self.buffer().read(cx).as_singleton() {
                (buffer, selection_range.start.row..selection_range.end.row)
            } else {
-                let multi_buffer = self.buffer().read(cx);
-                let multi_buffer_snapshot = multi_buffer.snapshot(cx);
-                let buffer_ranges = multi_buffer_snapshot.range_to_buffer_ranges(selection_range);
+                let buffer_ranges = self
+                    .buffer()
+                    .read(cx)
+                    .range_to_buffer_ranges(selection_range, cx);

-                let (excerpt, range) = if selection.reversed {
+                let (buffer, range, _) = if selection.reversed {
                    buffer_ranges.first()
                } else {
                    buffer_ranges.last()
                }?;

-                let snapshot = excerpt.buffer();
+                let snapshot = buffer.read(cx).snapshot();
                let selection = text::ToPoint::to_point(&range.start, &snapshot).row
                    ..text::ToPoint::to_point(&range.end, &snapshot).row;
-                (
-                    multi_buffer.buffer(excerpt.buffer_id()).unwrap().clone(),
-                    selection,
-                )
+                (buffer.clone(), selection)
            };

            Some((buffer, selection))
@@ -11781,7 +11762,7 @@ impl Editor {
    }

    /// Merges all anchor ranges for all context types ever set, picking the last highlight added in case of a row conflict.
-    /// Returns a map of display rows that are highlighted and their corresponding highlight color.
+    /// Rerturns a map of display rows that are highlighted and their corresponding highlight color.
    /// Allows to ignore certain kinds of highlights.
    pub fn highlighted_display_rows(
        &mut self,
@@ -12415,18 +12396,17 @@ impl Editor {
        };

        let selections = self.selections.all::<usize>(cx);
-        let multi_buffer = self.buffer.read(cx);
-        let multi_buffer_snapshot = multi_buffer.snapshot(cx);
+        let buffer = self.buffer.read(cx);
        let mut new_selections_by_buffer = HashMap::default();
        for selection in selections {
-            for (excerpt, range) in
-                multi_buffer_snapshot.range_to_buffer_ranges(selection.start..selection.end)
+            for (buffer, range, _) in
+                buffer.range_to_buffer_ranges(selection.start..selection.end, cx)
            {
-                let mut range = range.to_point(excerpt.buffer());
+                let mut range = range.to_point(buffer.read(cx));
                range.start.column = 0;
-                range.end.column = excerpt.buffer().line_len(range.end.row);
+                range.end.column = buffer.read(cx).line_len(range.end.row);
                new_selections_by_buffer
-                    .entry(multi_buffer.buffer(excerpt.buffer_id()).unwrap())
+                    .entry(buffer)
                    .or_insert(Vec::new())
                    .push(range)
            }
@@ -12507,10 +12487,7 @@ impl Editor {
                    );
                }
            }
-            Some(JumpData::MultiBufferRow {
-                row,
-                line_offset_from_top,
-            }) => {
+            Some(JumpData::MultiBufferRow(row)) => {
                let point = MultiBufferPoint::new(row.0, 0);
                if let Some((buffer, buffer_point, _)) =
                    self.buffer.read(cx).point_to_buffer_point(point, cx)
@@ -12518,22 +12495,20 @@ impl Editor {
                    let buffer_offset = buffer.read(cx).point_to_offset(buffer_point);
                    new_selections_by_buffer
                        .entry(buffer)
-                        .or_insert((Vec::new(), Some(*line_offset_from_top)))
+                        .or_insert((Vec::new(), None))
                        .0
                        .push(buffer_offset..buffer_offset)
                }
            }
            None => {
                let selections = self.selections.all::<usize>(cx);
-                let multi_buffer = self.buffer.read(cx);
+                let buffer = self.buffer.read(cx);
                for selection in selections {
-                    for (excerpt, mut range) in multi_buffer
-                        .snapshot(cx)
-                        .range_to_buffer_ranges(selection.range())
+                    for (mut buffer_handle, mut range, _) in
+                        buffer.range_to_buffer_ranges(selection.range(), cx)
                    {
                        // When editing branch buffers, jump to the corresponding location
                        // in their base buffer.
-                        let mut buffer_handle = multi_buffer.buffer(excerpt.buffer_id()).unwrap();
                        let buffer = buffer_handle.read(cx);
                        if let Some(base_buffer) = buffer.base_buffer() {
                            range = buffer.range_to_version(range, &base_buffer.read(cx).version());
@@ -12574,7 +12549,7 @@ impl Editor {
                        .file()
                        .is_none()
                        .then(|| {
-                            // Handle file-less buffers separately: those are not really the project items, so won't have a project path or entity id,
+                            // Handle file-less buffers separately: those are not really the project items, so won't have a paroject path or entity id,
                            // so `workspace.open_project_item` will never find them, always opening a new editor.
                            // Instead, we try to activate the existing editor in the pane first.
                            let (editor, pane_item_index) =
--- a/crates/editor/src/editor_settings.rs
+++ b/crates/editor/src/editor_settings.rs
@@ -105,7 +105,7 @@ pub struct Scrollbar {
    pub git_diff: bool,
    pub selected_symbol: bool,
    pub search_results: bool,
-    pub diagnostics: ScrollbarDiagnostics,
+    pub diagnostics: bool,
    pub cursors: bool,
    pub axes: ScrollbarAxes,
 }
@@ -150,73 +150,6 @@ pub struct ScrollbarAxes {
    pub vertical: bool,
 }

-/// Which diagnostic indicators to show in the scrollbar.
-///
-/// Default: all
-#[derive(Copy, Clone, Debug, Serialize, JsonSchema, PartialEq, Eq)]
-#[serde(rename_all = "lowercase")]
-pub enum ScrollbarDiagnostics {
-    /// Show all diagnostic levels: hint, information, warnings, error.
-    All,
-    /// Show only the following diagnostic levels: information, warning, error.
-    Information,
-    /// Show only the following diagnostic levels: warning, error.
-    Warning,
-    /// Show only the following diagnostic level: error.
-    Error,
-    /// Do not show diagnostics.
-    None,
-}
-
-impl<'de> Deserialize<'de> for ScrollbarDiagnostics {
-    fn deserialize<D>(deserializer: D) -> Result<Self, D::Error>
-    where
-        D: serde::Deserializer<'de>,
-    {
-        struct Visitor;
-
-        impl<'de> serde::de::Visitor<'de> for Visitor {
-            type Value = ScrollbarDiagnostics;
-
-            fn expecting(&self, f: &mut std::fmt::Formatter) -> std::fmt::Result {
-                write!(
-                    f,
-                    r#"a boolean or one of "all", "information", "warning", "error", "none""#
-                )
-            }
-
-            fn visit_bool<E>(self, b: bool) -> Result<Self::Value, E>
-            where
-                E: serde::de::Error,
-            {
-                match b {
-                    false => Ok(ScrollbarDiagnostics::None),
-                    true => Ok(ScrollbarDiagnostics::All),
-                }
-            }
-
-            fn visit_str<E>(self, s: &str) -> Result<Self::Value, E>
-            where
-                E: serde::de::Error,
-            {
-                match s {
-                    "all" => Ok(ScrollbarDiagnostics::All),
-                    "information" => Ok(ScrollbarDiagnostics::Information),
-                    "warning" => Ok(ScrollbarDiagnostics::Warning),
-                    "error" => Ok(ScrollbarDiagnostics::Error),
-                    "none" => Ok(ScrollbarDiagnostics::None),
-                    _ => Err(E::unknown_variant(
-                        s,
-                        &["all", "information", "warning", "error", "none"],
-                    )),
-                }
-            }
-        }
-
-        deserializer.deserialize_any(Visitor)
-    }
-}
-
 /// The key to use for adding multiple cursors
 ///
 /// Default: alt
@@ -415,10 +348,10 @@ pub struct ScrollbarContent {
    ///
    /// Default: true
    pub selected_symbol: Option<bool>,
-    /// Which diagnostic indicators to show in the scrollbar:
+    /// Whether to show diagnostic indicators in the scrollbar.
    ///
-    /// Default: all
-    pub diagnostics: Option<ScrollbarDiagnostics>,
+    /// Default: true
+    pub diagnostics: Option<bool>,
    /// Whether to show cursor positions in the scrollbar.
    ///
    /// Default: true
--- a/crates/editor/src/element.rs
+++ b/crates/editor/src/element.rs
@@ -6,7 +6,7 @@ use crate::{
    },
    editor_settings::{
        CurrentLineHighlight, DoubleClickInMultibuffer, MultiCursorModifier, ScrollBeyondLastLine,
-        ScrollbarDiagnostics, ShowScrollbar,
+        ShowScrollbar,
    },
    git::blame::{CommitDetails, GitBlame},
    hover_popover::{
@@ -45,7 +45,7 @@ use language::{
        IndentGuideBackgroundColoring, IndentGuideColoring, IndentGuideSettings,
        ShowWhitespaceSetting,
    },
-    ChunkRendererContext, DiagnosticEntry,
+    ChunkRendererContext,
 };
 use lsp::DiagnosticSeverity;
 use multi_buffer::{
@@ -599,15 +599,8 @@ impl EditorElement {
                .row;
            if let Some((_, Some(hitbox))) = line_numbers.get(&MultiBufferRow(multi_buffer_row)) {
                if hitbox.contains(&event.position) {
-                    let scroll_position_row =
-                        position_map.scroll_pixel_position.y / position_map.line_height;
-                    let line_offset_from_top = display_row - scroll_position_row as u32;
-
                    editor.open_excerpts_common(
-                        Some(JumpData::MultiBufferRow {
-                            row: MultiBufferRow(multi_buffer_row),
-                            line_offset_from_top,
-                        }),
+                        Some(JumpData::MultiBufferRow(MultiBufferRow(multi_buffer_row))),
                        modifiers.alt,
                        cx,
                    );
@@ -1235,7 +1228,7 @@ impl EditorElement {
                    (is_singleton && scrollbar_settings.selected_symbol && (editor.has_background_highlights::<DocumentHighlightRead>() || editor.has_background_highlights::<DocumentHighlightWrite>()))
                    ||
                    // Diagnostics
-                    (is_singleton && scrollbar_settings.diagnostics != ScrollbarDiagnostics::None && snapshot.buffer_snapshot.has_diagnostics())
+                    (is_singleton && scrollbar_settings.diagnostics && snapshot.buffer_snapshot.has_diagnostics())
                    ||
                    // Cursors out of sight
                    non_visible_cursors
@@ -2966,12 +2959,7 @@ impl EditorElement {
        selected_buffer_ids: &Vec<BufferId>,
        cx: &mut WindowContext,
    ) -> AnyElement {
-        let jump_data = header_jump_data(
-            snapshot,
-            DisplayRow(scroll_position as u32),
-            FILE_HEADER_HEIGHT + MULTI_BUFFER_EXCERPT_HEADER_HEIGHT,
-            excerpt,
-        );
+        let jump_data = header_jump_data(snapshot, DisplayRow(0), FILE_HEADER_HEIGHT, excerpt);

        let editor_bg_color = cx.theme().colors().editor_background;

@@ -4738,39 +4726,13 @@ impl EditorElement {
                                }
                            }

-                            if scrollbar_settings.diagnostics != ScrollbarDiagnostics::None {
+                            if scrollbar_settings.diagnostics {
                                let diagnostics = snapshot
                                    .buffer_snapshot
-                                    .diagnostics_in_range(Point::zero()..max_point, false)
-                                    .map(|DiagnosticEntry { diagnostic, range }| DiagnosticEntry {
-                                        diagnostic,
-                                        range: range.to_point(&snapshot.buffer_snapshot),
-                                    })
-                                    // Don't show diagnostics the user doesn't care about
-                                    .filter(|diagnostic| {
-                                        match (
-                                            scrollbar_settings.diagnostics,
-                                            diagnostic.diagnostic.severity,
-                                        ) {
-                                            (ScrollbarDiagnostics::All, _) => true,
-                                            (
-                                                ScrollbarDiagnostics::Error,
-                                                DiagnosticSeverity::ERROR,
-                                            ) => true,
-                                            (
-                                                ScrollbarDiagnostics::Warning,
-                                                DiagnosticSeverity::ERROR
-                                                | DiagnosticSeverity::WARNING,
-                                            ) => true,
-                                            (
-                                                ScrollbarDiagnostics::Information,
-                                                DiagnosticSeverity::ERROR
-                                                | DiagnosticSeverity::WARNING
-                                                | DiagnosticSeverity::INFORMATION,
-                                            ) => true,
-                                            (_, _) => false,
-                                        }
-                                    })
+                                    .diagnostics_in_range::<_, Point>(
+                                        Point::zero()..max_point,
+                                        false,
+                                    )
                                    // We want to sort by severity, in order to paint the most severe diagnostics last.
                                    .sorted_by_key(|diagnostic| {
                                        std::cmp::Reverse(diagnostic.diagnostic.severity)
@@ -5134,12 +5096,13 @@ fn header_jump_data(
    let offset_from_excerpt_start = if jump_anchor == excerpt_start {
        0
    } else {
-        let excerpt_start_row = language::ToPoint::to_point(&excerpt_start, buffer).row;
+        let excerpt_start_row = language::ToPoint::to_point(&jump_anchor, buffer).row;
        jump_position.row - excerpt_start_row
    };

-    let line_offset_from_top = (block_row_start.0 + height + offset_from_excerpt_start)
-        .saturating_sub(
+    let line_offset_from_top = block_row_start.0
+        + height
+        + offset_from_excerpt_start.saturating_sub(
            snapshot
                .scroll_anchor
                .scroll_position(&snapshot.display_snapshot)
--- a/crates/editor/src/git/project_diff.rs
+++ b/crates/editor/src/git/project_diff.rs
@@ -194,24 +194,14 @@ impl ProjectDiffEditor {
                let open_tasks = project
                    .update(&mut cx, |project, cx| {
                        let worktree = project.worktree_for_id(id, cx)?;
-                        let snapshot = worktree.read(cx).snapshot();
-                        let applicable_entries = snapshot
-                            .repositories()
-                            .flat_map(|entry| {
-                                entry.status().map(|git_entry| {
-                                    (git_entry.status, entry.join(git_entry.repo_path))
-                                })
-                            })
-                            .filter_map(|(status, path)| {
-                                let id = snapshot.entry_for_path(&path)?.id;
-                                Some((
-                                    status,
-                                    id,
-                                    ProjectPath {
-                                        worktree_id: snapshot.id(),
-                                        path: path.into(),
-                                    },
-                                ))
+                        let applicable_entries = worktree
+                            .read(cx)
+                            .entries(false, 0)
+                            .filter(|entry| !entry.is_external)
+                            .filter(|entry| entry.is_file())
+                            .filter_map(|entry| Some((entry.git_status?, entry)))
+                            .filter_map(|(git_status, entry)| {
+                                Some((git_status, entry.id, project.path_for_entry(entry.id, cx)?))
                            })
                            .collect::<Vec<_>>();
                        Some(
--- a/crates/editor/src/hover_popover.rs
+++ b/crates/editor/src/hover_popover.rs
@@ -3,7 +3,7 @@ use crate::{
    hover_links::{InlayHighlight, RangeInEditor},
    scroll::ScrollAmount,
    Anchor, AnchorRangeExt, DisplayPoint, DisplayRow, Editor, EditorSettings, EditorSnapshot,
-    Hover,
+    Hover, RangeToAnchorExt,
 };
 use gpui::{
    div, px, AnyElement, AsyncWindowContext, FontWeight, Hsla, InteractiveElement, IntoElement,
@@ -263,7 +263,29 @@ fn show_hover(
                delay.await;
            }

-            let local_diagnostic = if let Some(invisible) = snapshot
+            // If there's a diagnostic, assign it on the hover state and notify
+            let mut local_diagnostic = snapshot
+                .buffer_snapshot
+                .diagnostics_in_range::<_, usize>(anchor..anchor, false)
+                // Find the entry with the most specific range
+                .min_by_key(|entry| entry.range.end - entry.range.start)
+                .map(|entry| DiagnosticEntry {
+                    diagnostic: entry.diagnostic,
+                    range: entry.range.to_anchors(&snapshot.buffer_snapshot),
+                });
+
+            // Pull the primary diagnostic out so we can jump to it if the popover is clicked
+            let primary_diagnostic = local_diagnostic.as_ref().and_then(|local_diagnostic| {
+                snapshot
+                    .buffer_snapshot
+                    .diagnostic_group::<usize>(local_diagnostic.diagnostic.group_id)
+                    .find(|diagnostic| diagnostic.diagnostic.is_primary)
+                    .map(|entry| DiagnosticEntry {
+                        diagnostic: entry.diagnostic,
+                        range: entry.range.to_anchors(&snapshot.buffer_snapshot),
+                    })
+            });
+            if let Some(invisible) = snapshot
                .buffer_snapshot
                .chars_at(anchor)
                .next()
@@ -272,7 +294,7 @@ fn show_hover(
                let after = snapshot.buffer_snapshot.anchor_after(
                    anchor.to_offset(&snapshot.buffer_snapshot) + invisible.len_utf8(),
                );
-                Some(DiagnosticEntry {
+                local_diagnostic = Some(DiagnosticEntry {
                    diagnostic: Diagnostic {
                        severity: DiagnosticSeverity::HINT,
                        message: format!("Unicode character U+{:02X}", invisible as u32),
@@ -289,7 +311,7 @@ fn show_hover(
                let before = snapshot.buffer_snapshot.anchor_before(
                    anchor.to_offset(&snapshot.buffer_snapshot) - invisible.len_utf8(),
                );
-                Some(DiagnosticEntry {
+                local_diagnostic = Some(DiagnosticEntry {
                    diagnostic: Diagnostic {
                        severity: DiagnosticSeverity::HINT,
                        message: format!("Unicode character U+{:02X}", invisible as u32),
@@ -297,16 +319,7 @@ fn show_hover(
                    },
                    range: before..anchor,
                })
-            } else {
-                snapshot
-                    .buffer_snapshot
-                    .diagnostics_in_range(anchor..anchor, false)
-                    // Find the entry with the most specific range
-                    .min_by_key(|entry| {
-                        let range = entry.range.to_offset(&snapshot.buffer_snapshot);
-                        range.end - range.start
-                    })
-            };
+            }

            let diagnostic_popover = if let Some(local_diagnostic) = local_diagnostic {
                let text = match local_diagnostic.diagnostic.source {
@@ -375,6 +388,7 @@ fn show_hover(

                Some(DiagnosticPopover {
                    local_diagnostic,
+                    primary_diagnostic,
                    parsed_content,
                    border_color,
                    background_color,
@@ -769,6 +783,7 @@ impl InfoPopover {
 #[derive(Debug, Clone)]
 pub struct DiagnosticPopover {
    local_diagnostic: DiagnosticEntry<Anchor>,
+    primary_diagnostic: Option<DiagnosticEntry<Anchor>>,
    parsed_content: Option<View<Markdown>>,
    border_color: Option<Hsla>,
    background_color: Option<Hsla>,
@@ -822,8 +837,13 @@ impl DiagnosticPopover {
        diagnostic_div.into_any_element()
    }

-    pub fn group_id(&self) -> usize {
-        self.local_diagnostic.diagnostic.group_id
+    pub fn activation_info(&self) -> (usize, Anchor) {
+        let entry = self
+            .primary_diagnostic
+            .as_ref()
+            .unwrap_or(&self.local_diagnostic);
+
+        (entry.diagnostic.group_id, entry.range.start)
    }
 }

--- a/crates/editor/src/hunk_diff.rs
+++ b/crates/editor/src/hunk_diff.rs
@@ -456,19 +456,16 @@ impl Editor {
        range: Range<Anchor>,
        cx: &mut ViewContext<Editor>,
    ) -> Option<()> {
-        let multi_buffer = self.buffer.read(cx);
-        let multi_buffer_snapshot = multi_buffer.snapshot(cx);
-        let (excerpt, range) = multi_buffer_snapshot
-            .range_to_buffer_ranges(range)
+        let (buffer, range, _) = self
+            .buffer
+            .read(cx)
+            .range_to_buffer_ranges(range, cx)
            .into_iter()
            .next()?;

-        multi_buffer
-            .buffer(excerpt.buffer_id())
-            .unwrap()
-            .update(cx, |branch_buffer, cx| {
-                branch_buffer.merge_into_base(vec![range], cx);
-            });
+        buffer.update(cx, |branch_buffer, cx| {
+            branch_buffer.merge_into_base(vec![range], cx);
+        });

        if let Some(project) = self.project.clone() {
            self.save(true, project, cx).detach_and_log_err(cx);
--- a/crates/editor/src/inlay_hint_cache.rs
+++ b/crates/editor/src/inlay_hint_cache.rs
@@ -36,7 +36,6 @@ pub struct InlayHintCache {
    allowed_hint_kinds: HashSet<Option<InlayHintKind>>,
    version: usize,
    pub(super) enabled: bool,
-    enabled_in_settings: bool,
    update_tasks: HashMap<ExcerptId, TasksForRanges>,
    refresh_task: Option<Task<()>>,
    invalidate_debounce: Option<Duration>,
@@ -269,7 +268,6 @@ impl InlayHintCache {
        Self {
            allowed_hint_kinds: inlay_hint_settings.enabled_inlay_hint_kinds(),
            enabled: inlay_hint_settings.enabled,
-            enabled_in_settings: inlay_hint_settings.enabled,
            hints: HashMap::default(),
            update_tasks: HashMap::default(),
            refresh_task: None,
@@ -290,21 +288,10 @@ impl InlayHintCache {
        visible_hints: Vec<Inlay>,
        cx: &mut ViewContext<Editor>,
    ) -> ControlFlow<Option<InlaySplice>> {
-        let old_enabled = self.enabled;
-        // If the setting for inlay hints has changed, update `enabled`. This condition avoids inlay
-        // hint visibility changes when other settings change (such as theme).
-        //
-        // Another option might be to store whether the user has manually toggled inlay hint
-        // visibility, and prefer this. This could lead to confusion as it means inlay hint
-        // visibility would not change when updating the setting if they were ever toggled.
-        if new_hint_settings.enabled != self.enabled_in_settings {
-            self.enabled = new_hint_settings.enabled;
-        };
-        self.enabled_in_settings = new_hint_settings.enabled;
        self.invalidate_debounce = debounce_value(new_hint_settings.edit_debounce_ms);
        self.append_debounce = debounce_value(new_hint_settings.scroll_debounce_ms);
        let new_allowed_hint_kinds = new_hint_settings.enabled_inlay_hint_kinds();
-        match (old_enabled, self.enabled) {
+        match (self.enabled, new_hint_settings.enabled) {
            (false, false) => {
                self.allowed_hint_kinds = new_allowed_hint_kinds;
                ControlFlow::Break(None)
@@ -327,6 +314,7 @@ impl InlayHintCache {
                }
            }
            (true, false) => {
+                self.enabled = new_hint_settings.enabled;
                self.allowed_hint_kinds = new_allowed_hint_kinds;
                if self.hints.is_empty() {
                    ControlFlow::Break(None)
@@ -339,6 +327,7 @@ impl InlayHintCache {
                }
            }
            (false, true) => {
+                self.enabled = new_hint_settings.enabled;
                self.allowed_hint_kinds = new_allowed_hint_kinds;
                ControlFlow::Continue(())
            }
--- a/crates/editor/src/items.rs
+++ b/crates/editor/src/items.rs
@@ -615,20 +615,9 @@ impl Item for Editor {
                .read(cx)
                .as_singleton()
                .and_then(|buffer| buffer.read(cx).project_path(cx))
-                .and_then(|path| {
-                    let project = self.project.as_ref()?.read(cx);
-                    let entry = project.entry_for_path(&path, cx)?;
-                    let git_status = project
-                        .worktree_for_id(path.worktree_id, cx)?
-                        .read(cx)
-                        .snapshot()
-                        .status_for_file(path.path);
-
-                    Some(entry_git_aware_label_color(
-                        git_status,
-                        entry.is_ignored,
-                        params.selected,
-                    ))
+                .and_then(|path| self.project.as_ref()?.read(cx).entry_for_path(&path, cx))
+                .map(|entry| {
+                    entry_git_aware_label_color(entry.git_status, entry.is_ignored, params.selected)
                })
                .unwrap_or_else(|| entry_label_color(params.selected))
        } else {
@@ -1570,10 +1559,10 @@ pub fn entry_git_aware_label_color(
        Color::Ignored
    } else {
        match git_status {
-            Some(GitFileStatus::Added) | Some(GitFileStatus::Untracked) => Color::Created,
+            Some(GitFileStatus::Added) => Color::Created,
            Some(GitFileStatus::Modified) => Color::Modified,
            Some(GitFileStatus::Conflict) => Color::Conflict,
-            Some(GitFileStatus::Deleted) | None => entry_label_color(selected),
+            None => entry_label_color(selected),
        }
    }
 }
--- a/crates/editor/src/test/editor_lsp_test_context.rs
+++ b/crates/editor/src/test/editor_lsp_test_context.rs
@@ -257,8 +257,7 @@ impl EditorLspTestContext {
        Self::new(language, Default::default(), cx).await
    }

-    /// Constructs lsp range using a marked string with '[', ']' range delimiters
-    #[track_caller]
+    // Constructs lsp range using a marked string with '[', ']' range delimiters
    pub fn lsp_range(&mut self, marked_text: &str) -> lsp::Range {
        let ranges = self.ranges(marked_text);
        self.to_lsp_range(ranges[0].clone())
--- a/crates/editor/src/test/editor_test_context.rs
+++ b/crates/editor/src/test/editor_test_context.rs
@@ -230,7 +230,6 @@ impl EditorTestContext {
        self.cx.background_executor.run_until_parked();
    }

-    #[track_caller]
    pub fn ranges(&mut self, marked_text: &str) -> Vec<Range<usize>> {
        let (unmarked_text, ranges) = marked_text_ranges(marked_text, false);
        assert_eq!(self.buffer_text(), unmarked_text);
--- a/crates/fs/src/fs.rs
+++ b/crates/fs/src/fs.rs
@@ -10,6 +10,8 @@ use git::GitHostingProviderRegistry;
 #[cfg(any(target_os = "linux", target_os = "freebsd"))]
 use ashpd::desktop::trash;
 #[cfg(any(target_os = "linux", target_os = "freebsd"))]
+use collections::BTreeSet;
+#[cfg(any(target_os = "linux", target_os = "freebsd"))]
 use smol::process::Command;
 #[cfg(any(target_os = "linux", target_os = "freebsd"))]
 use std::fs::File;
@@ -120,6 +122,17 @@ pub trait Fs: Send + Sync {
        path: &Path,
    ) -> Result<Pin<Box<dyn Send + Stream<Item = Result<PathBuf>>>>>;

+    #[cfg(any(target_os = "linux", target_os = "freebsd"))]
+    async fn watch(
+        &self,
+        path: &Path,
+        latency: Duration,
+    ) -> (
+        Pin<Box<dyn Send + Stream<Item = BTreeSet<PathEvent>>>>,
+        Arc<dyn Watcher>,
+    );
+
+    #[cfg(not(any(target_os = "linux", target_os = "freebsd")))]
    async fn watch(
        &self,
        path: &Path,
@@ -701,13 +714,14 @@ impl Fs for RealFs {
        path: &Path,
        latency: Duration,
    ) -> (
-        Pin<Box<dyn Send + Stream<Item = Vec<PathEvent>>>>,
+        Pin<Box<dyn Send + Stream<Item = BTreeSet<PathEvent>>>>,
        Arc<dyn Watcher>,
    ) {
+        use collections::BTreeSet;
        use parking_lot::Mutex;

        let (tx, rx) = smol::channel::unbounded();
-        let pending_paths: Arc<Mutex<Vec<PathEvent>>> = Default::default();
+        let pending_paths: Arc<Mutex<BTreeSet<PathEvent>>> = Default::default();
        let watcher = Arc::new(linux_watcher::LinuxWatcher::new(tx, pending_paths.clone()));

        if watcher.add(path).is_err() {
@@ -720,16 +734,7 @@ impl Fs for RealFs {
        }

        // Check if path is a symlink and follow the target parent
-        if let Some(mut target) = self.read_link(&path).await.ok() {
-            // Check if symlink target is relative path, if so make it absolute
-            if target.is_relative() {
-                if let Some(parent) = path.parent() {
-                    target = parent.join(target);
-                    if let Ok(canonical) = self.canonicalize(&target).await {
-                        target = canonical;
-                    }
-                }
-            }
+        if let Some(target) = self.read_link(&path).await.ok() {
            watcher.add(&target).ok();
            if let Some(parent) = target.parent() {
                watcher.add(parent).log_err();
@@ -1947,6 +1952,7 @@ impl Fs for FakeFs {
        Ok(Box::pin(futures::stream::iter(paths)))
    }

+    #[cfg(not(any(target_os = "linux", target_os = "freebsd")))]
    async fn watch(
        &self,
        path: &Path,
@@ -1975,6 +1981,38 @@ impl Fs for FakeFs {
        )
    }

+    #[cfg(any(target_os = "linux", target_os = "freebsd"))]
+    async fn watch(
+        &self,
+        path: &Path,
+        _: Duration,
+    ) -> (
+        Pin<Box<dyn Send + Stream<Item = BTreeSet<PathEvent>>>>,
+        Arc<dyn Watcher>,
+    ) {
+        self.simulate_random_delay().await;
+        let (tx, rx) = smol::channel::unbounded();
+        self.state.lock().event_txs.push(tx);
+        let path = path.to_path_buf();
+        let executor = self.executor.clone();
+        (
+            Box::pin(
+                futures::StreamExt::filter(rx, move |events| {
+                    let result = events
+                        .iter()
+                        .any(|evt_path| evt_path.path.starts_with(&path));
+                    let executor = executor.clone();
+                    async move {
+                        executor.simulate_random_delay().await;
+                        result
+                    }
+                })
+                .map(|events| BTreeSet::from_iter(events.into_iter())),
+            ),
+            Arc::new(FakeWatcher {}),
+        )
+    }
+
    fn open_repo(&self, abs_dot_git: &Path) -> Option<Arc<dyn GitRepository>> {
        let state = self.state.lock();
        let entry = state.read_path(abs_dot_git).unwrap();
--- a/crates/fs/src/linux_watcher.rs
+++ b/crates/fs/src/linux_watcher.rs
@@ -1,3 +1,4 @@
+use collections::BTreeSet;
 use notify::EventKind;
 use parking_lot::Mutex;
 use std::sync::{Arc, OnceLock};
@@ -7,13 +8,13 @@ use crate::{PathEvent, PathEventKind, Watcher};

 pub struct LinuxWatcher {
    tx: smol::channel::Sender<()>,
-    pending_path_events: Arc<Mutex<Vec<PathEvent>>>,
+    pending_path_events: Arc<Mutex<BTreeSet<PathEvent>>>,
 }

 impl LinuxWatcher {
    pub fn new(
        tx: smol::channel::Sender<()>,
-        pending_path_events: Arc<Mutex<Vec<PathEvent>>>,
+        pending_path_events: Arc<Mutex<BTreeSet<PathEvent>>>,
    ) -> Self {
        Self {
            tx,
@@ -40,7 +41,7 @@ impl Watcher for LinuxWatcher {
                        EventKind::Remove(_) => Some(PathEventKind::Removed),
                        _ => None,
                    };
-                    let mut path_events = event
+                    let path_events = event
                        .paths
                        .iter()
                        .filter_map(|event_path| {
@@ -52,17 +53,12 @@ impl Watcher for LinuxWatcher {
                        .collect::<Vec<_>>();

                    if !path_events.is_empty() {
-                        path_events.sort();
                        let mut pending_paths = pending_paths.lock();
-                        if pending_paths.is_empty() {
+                        let was_empty = pending_paths.is_empty();
+                        pending_paths.extend(path_events);
+                        if was_empty {
                            tx.try_send(()).ok();
                        }
-                        util::extend_sorted(
-                            &mut *pending_paths,
-                            path_events,
-                            usize::MAX,
-                            |a, b| a.path.cmp(&b.path),
-                        );
                    }
                })
            }
--- a/crates/fuzzy/src/paths.rs
+++ b/crates/fuzzy/src/paths.rs
@@ -3,10 +3,7 @@ use std::{
    borrow::Cow,
    cmp::{self, Ordering},
    path::Path,
-    sync::{
-        atomic::{self, AtomicBool},
-        Arc,
-    },
+    sync::{atomic::AtomicBool, Arc},
 };

 use crate::{
@@ -157,10 +154,6 @@ pub async fn match_path_sets<'a, Set: PathMatchCandidateSet<'a>>(

                    let mut tree_start = 0;
                    for candidate_set in candidate_sets {
-                        if cancel_flag.load(atomic::Ordering::Relaxed) {
-                            break;
-                        }
-
                        let tree_end = tree_start + candidate_set.len();

                        if tree_start < segment_end && segment_start < tree_end {
@@ -209,10 +202,6 @@ pub async fn match_path_sets<'a, Set: PathMatchCandidateSet<'a>>(
        })
        .await;

-    if cancel_flag.load(atomic::Ordering::Relaxed) {
-        return Vec::new();
-    }
-
    let mut results = segment_results.concat();
    util::truncate_to_bottom_n_sorted_by(&mut results, max_results, &|a, b| b.cmp(a));
    results
--- a/crates/fuzzy/src/strings.rs
+++ b/crates/fuzzy/src/strings.rs
@@ -8,7 +8,7 @@ use std::{
    cmp::{self, Ordering},
    iter,
    ops::Range,
-    sync::atomic::{self, AtomicBool},
+    sync::atomic::AtomicBool,
 };

 #[derive(Clone, Debug)]
@@ -178,10 +178,6 @@ pub async fn match_strings(
        })
        .await;

-    if cancel_flag.load(atomic::Ordering::Relaxed) {
-        return Vec::new();
-    }
-
    let mut results = segment_results.concat();
    util::truncate_to_bottom_n_sorted_by(&mut results, max_results, &|a, b| b.cmp(a));
    results
--- a/crates/git/src/git.rs
+++ b/crates/git/src/git.rs
@@ -16,7 +16,6 @@ use std::sync::LazyLock;
 pub use crate::hosting_provider::*;
 pub use crate::remote::*;
 pub use git2 as libgit;
-pub use repository::WORK_DIRECTORY_REPO_PATH;

 pub static DOT_GIT: LazyLock<&'static OsStr> = LazyLock::new(|| OsStr::new(".git"));
 pub static COOKIES: LazyLock<&'static OsStr> = LazyLock::new(|| OsStr::new("cookies"));
--- a/crates/git/src/repository.rs
+++ b/crates/git/src/repository.rs
@@ -7,8 +7,6 @@ use gpui::SharedString;
 use parking_lot::Mutex;
 use rope::Rope;
 use serde::{Deserialize, Serialize};
-use std::borrow::Borrow;
-use std::sync::LazyLock;
 use std::{
    cmp::Ordering,
    path::{Component, Path, PathBuf},
@@ -39,8 +37,7 @@ pub trait GitRepository: Send + Sync {
    /// Returns the SHA of the current HEAD.
    fn head_sha(&self) -> Option<String>;

-    /// Returns the list of git statuses, sorted by path
-    fn status(&self, path_prefixes: &[RepoPath]) -> Result<GitStatus>;
+    fn status(&self, path_prefixes: &[PathBuf]) -> Result<GitStatus>;

    fn branches(&self) -> Result<Vec<Branch>>;
    fn change_branch(&self, _: &str) -> Result<()>;
@@ -135,7 +132,7 @@ impl GitRepository for RealGitRepository {
        Some(self.repository.lock().head().ok()?.target()?.to_string())
    }

-    fn status(&self, path_prefixes: &[RepoPath]) -> Result<GitStatus> {
+    fn status(&self, path_prefixes: &[PathBuf]) -> Result<GitStatus> {
        let working_directory = self
            .repository
            .lock()
@@ -292,9 +289,8 @@ impl GitRepository for FakeGitRepository {
        state.dot_git_dir.clone()
    }

-    fn status(&self, path_prefixes: &[RepoPath]) -> Result<GitStatus> {
+    fn status(&self, path_prefixes: &[PathBuf]) -> Result<GitStatus> {
        let state = self.state.lock();
-
        let mut entries = state
            .worktree_statuses
            .iter()
@@ -310,7 +306,6 @@ impl GitRepository for FakeGitRepository {
            })
            .collect::<Vec<_>>();
        entries.sort_unstable_by(|a, b| a.0.cmp(&b.0));
-
        Ok(GitStatus {
            entries: entries.into(),
        })
@@ -399,8 +394,6 @@ pub enum GitFileStatus {
    Added,
    Modified,
    Conflict,
-    Deleted,
-    Untracked,
 }

 impl GitFileStatus {
@@ -428,34 +421,20 @@ impl GitFileStatus {
    }
 }

-pub static WORK_DIRECTORY_REPO_PATH: LazyLock<RepoPath> =
-    LazyLock::new(|| RepoPath(Path::new("").into()));
-
 #[derive(Clone, Debug, Ord, Hash, PartialOrd, Eq, PartialEq)]
-pub struct RepoPath(pub Arc<Path>);
+pub struct RepoPath(pub PathBuf);

 impl RepoPath {
    pub fn new(path: PathBuf) -> Self {
        debug_assert!(path.is_relative(), "Repo paths must be relative");

-        RepoPath(path.into())
-    }
-
-    pub fn from_str(path: &str) -> Self {
-        let path = Path::new(path);
-        debug_assert!(path.is_relative(), "Repo paths must be relative");
-
-        RepoPath(path.into())
-    }
-
-    pub fn to_proto(&self) -> String {
-        self.0.to_string_lossy().to_string()
+        RepoPath(path)
    }
 }

 impl From<&Path> for RepoPath {
    fn from(value: &Path) -> Self {
-        RepoPath::new(value.into())
+        RepoPath::new(value.to_path_buf())
    }
 }

@@ -465,15 +444,9 @@ impl From<PathBuf> for RepoPath {
    }
 }

-impl From<&str> for RepoPath {
-    fn from(value: &str) -> Self {
-        Self::from_str(value)
-    }
-}
-
 impl Default for RepoPath {
    fn default() -> Self {
-        RepoPath(Path::new("").into())
+        RepoPath(PathBuf::new())
    }
 }

@@ -484,19 +457,13 @@ impl AsRef<Path> for RepoPath {
 }

 impl std::ops::Deref for RepoPath {
-    type Target = Path;
+    type Target = PathBuf;

    fn deref(&self) -> &Self::Target {
        &self.0
    }
 }

-impl Borrow<Path> for RepoPath {
-    fn borrow(&self) -> &Path {
-        self.0.as_ref()
-    }
-}
-
 #[derive(Debug)]
 pub struct RepoPathDescendants<'a>(pub &'a Path);

--- a/crates/git/src/status.rs
+++ b/crates/git/src/status.rs
@@ -1,6 +1,10 @@
 use crate::repository::{GitFileStatus, RepoPath};
 use anyhow::{anyhow, Result};
-use std::{path::Path, process::Stdio, sync::Arc};
+use std::{
+    path::{Path, PathBuf},
+    process::Stdio,
+    sync::Arc,
+};

 #[derive(Clone)]
 pub struct GitStatus {
@@ -11,7 +15,7 @@ impl GitStatus {
    pub(crate) fn new(
        git_binary: &Path,
        working_directory: &Path,
-        path_prefixes: &[RepoPath],
+        path_prefixes: &[PathBuf],
    ) -> Result<Self> {
        let child = util::command::new_std_command(git_binary)
            .current_dir(working_directory)
@@ -23,7 +27,7 @@ impl GitStatus {
                "-z",
            ])
            .args(path_prefixes.iter().map(|path_prefix| {
-                if path_prefix.0.as_ref() == Path::new("") {
+                if *path_prefix == Path::new("") {
                    Path::new(".")
                } else {
                    path_prefix
@@ -51,12 +55,10 @@ impl GitStatus {
                    let (status, path) = entry.split_at(3);
                    let status = status.trim();
                    Some((
-                        RepoPath(Path::new(path).into()),
+                        RepoPath(PathBuf::from(path)),
                        match status {
-                            "A" => GitFileStatus::Added,
+                            "A" | "??" => GitFileStatus::Added,
                            "M" => GitFileStatus::Modified,
-                            "D" => GitFileStatus::Deleted,
-                            "??" => GitFileStatus::Untracked,
                            _ => return None,
                        },
                    ))
@@ -73,7 +75,7 @@ impl GitStatus {

    pub fn get(&self, path: &Path) -> Option<GitFileStatus> {
        self.entries
-            .binary_search_by(|(repo_path, _)| repo_path.0.as_ref().cmp(path))
+            .binary_search_by(|(repo_path, _)| repo_path.0.as_path().cmp(path))
            .ok()
            .map(|index| self.entries[index].1)
    }
--- a/crates/git_ui/Cargo.toml
+++ b/crates/git_ui/Cargo.toml
@@ -14,11 +14,9 @@ path = "src/git_ui.rs"

 [dependencies]
 anyhow.workspace = true
-collections.workspace = true
 db.workspace = true
 editor.workspace = true
 futures.workspace = true
-git.workspace = true
 gpui.workspace = true
 language.workspace = true
 menu.workspace = true
@@ -31,7 +29,8 @@ settings.workspace = true
 ui.workspace = true
 util.workspace = true
 workspace.workspace = true
-worktree.workspace = true
+git.workspace = true
+collections.workspace = true

 [target.'cfg(windows)'.dependencies]
 windows.workspace = true
--- a/crates/git_ui/src/git_panel.rs
+++ b/crates/git_ui/src/git_panel.rs
@@ -1,16 +1,11 @@
-use crate::{git_status_icon, settings::GitPanelSettings};
-use crate::{CommitAllChanges, CommitStagedChanges, DiscardAll, StageAll, UnstageAll};
 use anyhow::{Context as _, Result};
+use collections::HashMap;
 use db::kvp::KEY_VALUE_STORE;
 use editor::{
    scroll::{Autoscroll, AutoscrollStrategy},
    Editor, MultiBuffer, DEFAULT_MULTIBUFFER_CONTEXT,
 };
-use git::{
-    diff::DiffHunk,
-    repository::{GitFileStatus, RepoPath},
-};
-use gpui::*;
+use git::{diff::DiffHunk, repository::GitFileStatus};
 use gpui::{
    actions, prelude::*, uniform_list, Action, AppContext, AsyncWindowContext, ClickEvent,
    CursorStyle, EventEmitter, FocusHandle, FocusableView, KeyContext,
@@ -19,7 +14,7 @@ use gpui::{
 };
 use language::{Buffer, BufferRow, OffsetRangeExt};
 use menu::{SelectNext, SelectPrev};
-use project::{EntryKind, Fs, Project, ProjectEntryId, ProjectPath, WorktreeId};
+use project::{Entry, EntryKind, Fs, Project, ProjectEntryId, WorktreeId};
 use serde::{Deserialize, Serialize};
 use settings::Settings as _;
 use std::{
@@ -27,7 +22,7 @@ use std::{
    collections::HashSet,
    ffi::OsStr,
    ops::{Deref, Range},
-    path::PathBuf,
+    path::{Path, PathBuf},
    rc::Rc,
    sync::Arc,
    time::Duration,
@@ -42,7 +37,9 @@ use workspace::{
    dock::{DockPosition, Panel, PanelEvent},
    ItemHandle, Workspace,
 };
-use worktree::StatusEntry;
+
+use crate::{git_status_icon, settings::GitPanelSettings};
+use crate::{CommitAllChanges, CommitStagedChanges, DiscardAll, StageAll, UnstageAll};

 actions!(git_panel, [ToggleFocus]);

@@ -72,7 +69,7 @@ pub struct GitStatusEntry {}
 struct EntryDetails {
    filename: String,
    display_name: String,
-    path: RepoPath,
+    path: Arc<Path>,
    kind: EntryKind,
    depth: usize,
    is_expanded: bool,
@@ -104,8 +101,7 @@ pub struct GitPanel {
    scrollbar_state: ScrollbarState,
    selected_item: Option<usize>,
    show_scrollbar: bool,
-    // TODO Reintroduce expanded directories, once we're deriving directories from paths
-    // expanded_dir_ids: HashMap<WorktreeId, Vec<ProjectEntryId>>,
+    expanded_dir_ids: HashMap<WorktreeId, Vec<ProjectEntryId>>,

    // The entries that are currently shown in the panel, aka
    // not hidden by folding or such
@@ -119,20 +115,18 @@ pub struct GitPanel {
 #[derive(Debug, Clone)]
 struct WorktreeEntries {
    worktree_id: WorktreeId,
-    // TODO support multiple repositories per worktree
-    work_directory: worktree::WorkDirectory,
    visible_entries: Vec<GitPanelEntry>,
-    paths: Rc<OnceCell<HashSet<RepoPath>>>,
+    paths: Rc<OnceCell<HashSet<Arc<Path>>>>,
 }

 #[derive(Debug, Clone)]
 struct GitPanelEntry {
-    entry: worktree::StatusEntry,
+    entry: Entry,
    hunks: Rc<OnceCell<Vec<DiffHunk>>>,
 }

 impl Deref for GitPanelEntry {
-    type Target = worktree::StatusEntry;
+    type Target = Entry;

    fn deref(&self) -> &Self::Target {
        &self.entry
@@ -140,11 +134,11 @@ impl Deref for GitPanelEntry {
 }

 impl WorktreeEntries {
-    fn paths(&self) -> &HashSet<RepoPath> {
+    fn paths(&self) -> &HashSet<Arc<Path>> {
        self.paths.get_or_init(|| {
            self.visible_entries
                .iter()
-                .map(|e| (e.entry.repo_path.clone()))
+                .map(|e| (e.entry.path.clone()))
                .collect()
        })
    }
@@ -171,11 +165,8 @@ impl GitPanel {
            })
            .detach();
            cx.subscribe(&project, |this, _, event, cx| match event {
-                project::Event::GitRepositoryUpdated => {
-                    this.update_visible_entries(None, None, cx);
-                }
-                project::Event::WorktreeRemoved(_id) => {
-                    // this.expanded_dir_ids.remove(id);
+                project::Event::WorktreeRemoved(id) => {
+                    this.expanded_dir_ids.remove(id);
                    this.update_visible_entries(None, None, cx);
                    cx.notify();
                }
@@ -192,7 +183,7 @@ impl GitPanel {
                project::Event::Closed => {
                    this.git_diff_editor_updates = Task::ready(());
                    this.reveal_in_editor = Task::ready(());
-                    // this.expanded_dir_ids.clear();
+                    this.expanded_dir_ids.clear();
                    this.visible_entries.clear();
                    this.git_diff_editor = None;
                }
@@ -209,7 +200,8 @@ impl GitPanel {
                pending_serialization: Task::ready(None),
                visible_entries: Vec::new(),
                current_modifiers: cx.modifiers(),
-                // expanded_dir_ids: Default::default(),
+                expanded_dir_ids: Default::default(),
+
                width: Some(px(360.)),
                scrollbar_state: ScrollbarState::new(scroll_handle.clone()).parent_view(cx.view()),
                scroll_handle,
@@ -296,16 +288,16 @@ impl GitPanel {
    }

    fn calculate_depth_and_difference(
-        entry: &StatusEntry,
-        visible_worktree_entries: &HashSet<RepoPath>,
+        entry: &Entry,
+        visible_worktree_entries: &HashSet<Arc<Path>>,
    ) -> (usize, usize) {
        let (depth, difference) = entry
-            .repo_path
+            .path
            .ancestors()
            .skip(1) // Skip the entry itself
            .find_map(|ancestor| {
                if let Some(parent_entry) = visible_worktree_entries.get(ancestor) {
-                    let entry_path_components_count = entry.repo_path.components().count();
+                    let entry_path_components_count = entry.path.components().count();
                    let parent_path_components_count = parent_entry.components().count();
                    let difference = entry_path_components_count - parent_path_components_count;
                    let depth = parent_entry
@@ -440,7 +432,13 @@ impl GitPanel {
    fn entry_count(&self) -> usize {
        self.visible_entries
            .iter()
-            .map(|worktree_entries| worktree_entries.visible_entries.len())
+            .map(|worktree_entries| {
+                worktree_entries
+                    .visible_entries
+                    .iter()
+                    .filter(|entry| entry.git_status.is_some())
+                    .count()
+            })
            .sum()
    }

@@ -448,7 +446,7 @@ impl GitPanel {
        &self,
        range: Range<usize>,
        cx: &mut ViewContext<Self>,
-        mut callback: impl FnMut(usize, EntryDetails, &mut ViewContext<Self>),
+        mut callback: impl FnMut(ProjectEntryId, EntryDetails, &mut ViewContext<Self>),
    ) {
        let mut ix = 0;
        for worktree_entries in &self.visible_entries {
@@ -470,11 +468,11 @@ impl GitPanel {
            {
                let snapshot = worktree.read(cx).snapshot();
                let root_name = OsStr::new(snapshot.root_name());
-                // let expanded_entry_ids = self
-                //     .expanded_dir_ids
-                //     .get(&snapshot.id())
-                //     .map(Vec::as_slice)
-                //     .unwrap_or(&[]);
+                let expanded_entry_ids = self
+                    .expanded_dir_ids
+                    .get(&snapshot.id())
+                    .map(Vec::as_slice)
+                    .unwrap_or(&[]);

                let entry_range = range.start.saturating_sub(ix)..end_ix - ix;
                let entries = worktree_entries.paths();
@@ -485,22 +483,22 @@ impl GitPanel {
                    .enumerate()
                {
                    let index = index_start + i;
-                    let status = entry.status;
-                    let is_expanded = true; //expanded_entry_ids.binary_search(&entry.id).is_ok();
+                    let status = entry.git_status;
+                    let is_expanded = expanded_entry_ids.binary_search(&entry.id).is_ok();

                    let (depth, difference) = Self::calculate_depth_and_difference(entry, entries);

                    let filename = match difference {
                        diff if diff > 1 => entry
-                            .repo_path
+                            .path
                            .iter()
-                            .skip(entry.repo_path.components().count() - diff)
+                            .skip(entry.path.components().count() - diff)
                            .collect::<PathBuf>()
                            .to_str()
                            .unwrap_or_default()
                            .to_string(),
                        _ => entry
-                            .repo_path
+                            .path
                            .file_name()
                            .map(|name| name.to_string_lossy().into_owned())
                            .unwrap_or_else(|| root_name.to_string_lossy().to_string()),
@@ -508,17 +506,16 @@ impl GitPanel {

                    let details = EntryDetails {
                        filename,
-                        display_name: entry.repo_path.to_string_lossy().into_owned(),
-                        // TODO get it from StatusEntry?
-                        kind: EntryKind::File,
+                        display_name: entry.path.to_string_lossy().into_owned(),
+                        kind: entry.kind,
                        is_expanded,
-                        path: entry.repo_path.clone(),
-                        status: Some(status),
+                        path: entry.path.clone(),
+                        status,
                        hunks: entry.hunks.clone(),
                        depth,
                        index,
                    };
-                    callback(ix, details, cx);
+                    callback(entry.id, details, cx);
                }
            }
            ix = end_ix;
@@ -530,7 +527,7 @@ impl GitPanel {
    fn update_visible_entries(
        &mut self,
        for_worktree: Option<WorktreeId>,
-        _new_selected_entry: Option<(WorktreeId, ProjectEntryId)>,
+        new_selected_entry: Option<(WorktreeId, ProjectEntryId)>,
        cx: &mut ViewContext<Self>,
    ) {
        let project = self.project.read(cx);
@@ -552,36 +549,24 @@ impl GitPanel {
                None => false,
            });
        for worktree in project.visible_worktrees(cx) {
-            let snapshot = worktree.read(cx).snapshot();
-            let worktree_id = snapshot.id();
-
+            let worktree_id = worktree.read(cx).id();
            if for_worktree.is_some() && for_worktree != Some(worktree_id) {
                continue;
            }
+            let snapshot = worktree.read(cx).snapshot();

-            let mut visible_worktree_entries = Vec::new();
-            // Only use the first repository for now
-            let repositories = snapshot.repositories().take(1);
-            let mut work_directory = None;
-            for repository in repositories {
-                visible_worktree_entries.extend(repository.status());
-                work_directory = Some(worktree::WorkDirectory::clone(repository));
-            }
-
-            // TODO use the GitTraversal
-            // let mut visible_worktree_entries = snapshot
-            //     .entries(false, 0)
-            //     .filter(|entry| !entry.is_external)
-            //     .filter(|entry| entry.git_status.is_some())
-            //     .cloned()
-            //     .collect::<Vec<_>>();
-            // snapshot.propagate_git_statuses(&mut visible_worktree_entries);
-            // project::sort_worktree_entries(&mut visible_worktree_entries);
+            let mut visible_worktree_entries = snapshot
+                .entries(false, 0)
+                .filter(|entry| !entry.is_external)
+                .filter(|entry| entry.git_status.is_some())
+                .cloned()
+                .collect::<Vec<_>>();
+            snapshot.propagate_git_statuses(&mut visible_worktree_entries);
+            project::sort_worktree_entries(&mut visible_worktree_entries);

            if !visible_worktree_entries.is_empty() {
                self.visible_entries.push(WorktreeEntries {
                    worktree_id,
-                    work_directory: work_directory.unwrap(),
                    visible_entries: visible_worktree_entries
                        .into_iter()
                        .map(|entry| GitPanelEntry {
@@ -595,25 +580,24 @@ impl GitPanel {
        }
        self.visible_entries.extend(after_update);

-        // TODO re-implement this
-        // if let Some((worktree_id, entry_id)) = new_selected_entry {
-        //     self.selected_item = self.visible_entries.iter().enumerate().find_map(
-        //         |(worktree_index, worktree_entries)| {
-        //             if worktree_entries.worktree_id == worktree_id {
-        //                 worktree_entries
-        //                     .visible_entries
-        //                     .iter()
-        //                     .position(|entry| entry.id == entry_id)
-        //                     .map(|entry_index| {
-        //                         worktree_index * worktree_entries.visible_entries.len()
-        //                             + entry_index
-        //                     })
-        //             } else {
-        //                 None
-        //             }
-        //         },
-        //     );
-        // }
+        if let Some((worktree_id, entry_id)) = new_selected_entry {
+            self.selected_item = self.visible_entries.iter().enumerate().find_map(
+                |(worktree_index, worktree_entries)| {
+                    if worktree_entries.worktree_id == worktree_id {
+                        worktree_entries
+                            .visible_entries
+                            .iter()
+                            .position(|entry| entry.id == entry_id)
+                            .map(|entry_index| {
+                                worktree_index * worktree_entries.visible_entries.len()
+                                    + entry_index
+                            })
+                    } else {
+                        None
+                    }
+                },
+            );
+        }

        let project = self.project.downgrade();
        self.git_diff_editor_updates = cx.spawn(|git_panel, mut cx| async move {
@@ -628,14 +612,12 @@ impl GitPanel {
                                .visible_entries
                                .iter()
                                .filter_map(|entry| {
-                                    let git_status = entry.status;
+                                    let git_status = entry.git_status()?;
                                    let entry_hunks = entry.hunks.clone();
                                    let (entry_path, unstaged_changes_task) =
                                        project.update(cx, |project, cx| {
-                                            let entry_path = ProjectPath {
-                                                worktree_id: worktree_entries.worktree_id,
-                                                path: worktree_entries.work_directory.unrelativize(&entry.repo_path)?,
-                                            };
+                                            let entry_path =
+                                                project.path_for_entry(entry.id, cx)?;
                                            let open_task =
                                                project.open_path(entry_path.clone(), cx);
                                            let unstaged_changes_task =
@@ -700,8 +682,8 @@ impl GitPanel {
                                                                                )
                                                                                .collect()
                                                                    }
-                                                                    // TODO support these
-                                                                    GitFileStatus::Conflict | GitFileStatus::Deleted | GitFileStatus::Untracked => Vec::new(),
+                                                                    // TODO support conflicts display
+                                                                    GitFileStatus::Conflict => Vec::new(),
                                                                }
                                                            }).clone()
                                                    })?;
@@ -1010,17 +992,18 @@ impl GitPanel {

    fn render_entry(
        &self,
-        ix: usize,
+        id: ProjectEntryId,
        selected: bool,
        details: EntryDetails,
        cx: &ViewContext<Self>,
    ) -> impl IntoElement {
-        let checkbox_id = ElementId::Name(format!("checkbox_{}", ix).into());
+        let id = id.to_proto() as usize;
+        let checkbox_id = ElementId::Name(format!("checkbox_{}", id).into());
        let is_staged = ToggleState::Selected;
        let handle = cx.view().downgrade();

        h_flex()
-            .id(("git-panel-entry", ix))
+            .id(id)
            .h(px(28.))
            .w_full()
            .pl(px(12. + 12. * details.depth as f32))
@@ -1036,7 +1019,7 @@ impl GitPanel {
                this.child(git_status_icon(status))
            })
            .child(
-                ListItem::new(details.path.0.clone())
+                ListItem::new(("label", id))
                    .toggle_state(selected)
                    .child(h_flex().gap_1p5().child(details.display_name.clone()))
                    .on_click(move |e, cx| {
--- a/crates/git_ui/src/git_ui.rs
+++ b/crates/git_ui/src/git_ui.rs
@@ -44,13 +44,10 @@ const REMOVED_COLOR: Hsla = Hsla {
 // TODO: Add updated status colors to theme
 pub fn git_status_icon(status: GitFileStatus) -> impl IntoElement {
    match status {
-        GitFileStatus::Added | GitFileStatus::Untracked => {
-            Icon::new(IconName::SquarePlus).color(Color::Custom(ADDED_COLOR))
-        }
+        GitFileStatus::Added => Icon::new(IconName::SquarePlus).color(Color::Custom(ADDED_COLOR)),
        GitFileStatus::Modified => {
            Icon::new(IconName::SquareDot).color(Color::Custom(MODIFIED_COLOR))
        }
        GitFileStatus::Conflict => Icon::new(IconName::Warning).color(Color::Custom(REMOVED_COLOR)),
-        GitFileStatus::Deleted => Icon::new(IconName::Warning).color(Color::Custom(REMOVED_COLOR)),
    }
 }
--- a/crates/gpui/src/action.rs
+++ b/crates/gpui/src/action.rs
@@ -185,7 +185,8 @@ macro_rules! actions {
            #[doc = "The `"]
            #[doc = stringify!($name)]
            #[doc = "` action, see [`gpui::actions!`]"]
-            #[derive(::std::clone::Clone,::std::cmp::PartialEq, ::std::default::Default)]
+            #[derive(::std::cmp::PartialEq, ::std::clone::Clone, ::std::default::Default, ::std::fmt::Debug, gpui::private::serde_derive::Deserialize)]
+            #[serde(crate = "gpui::private::serde")]
            pub struct $name;

            gpui::__impl_action!($namespace, $name, $name,
@@ -210,7 +211,14 @@ macro_rules! action_as {
        #[doc = "The `"]
        #[doc = stringify!($name)]
        #[doc = "` action, see [`gpui::actions!`]"]
-        #[derive(::std::clone::Clone, ::std::cmp::PartialEq, ::std::default::Default)]
+        #[derive(
+            ::std::cmp::PartialEq,
+            ::std::clone::Clone,
+            ::std::default::Default,
+            ::std::fmt::Debug,
+            gpui::private::serde_derive::Deserialize,
+        )]
+        #[serde(crate = "gpui::private::serde")]
        pub struct $name;

        gpui::__impl_action!(
--- a/crates/gpui/src/app.rs
+++ b/crates/gpui/src/app.rs
@@ -33,9 +33,9 @@ use util::ResultExt;

 use crate::{
    current_platform, hash, init_app_menus, Action, ActionRegistry, Any, AnyView, AnyWindowHandle,
-    Asset, AssetSource, BackgroundExecutor, Bounds, ClipboardItem, Context, DispatchPhase,
-    DisplayId, Entity, EventEmitter, FocusHandle, FocusId, ForegroundExecutor, Global, KeyBinding,
-    Keymap, Keystroke, LayoutId, Menu, MenuItem, OwnedMenu, PathPromptOptions, Pixels, Platform,
+    Asset, AssetSource, BackgroundExecutor, ClipboardItem, Context, DispatchPhase, DisplayId,
+    Entity, EventEmitter, FocusHandle, FocusId, ForegroundExecutor, Global, KeyBinding, Keymap,
+    Keystroke, LayoutId, Menu, MenuItem, OwnedMenu, PathPromptOptions, Pixels, Platform,
    PlatformDisplay, Point, PromptBuilder, PromptHandle, PromptLevel, Render,
    RenderablePromptHandle, Reservation, ScreenCaptureSource, SharedString, SubscriberSet,
    Subscription, SvgRenderer, Task, TextSystem, View, ViewContext, Window, WindowAppearance,
@@ -1612,12 +1612,6 @@ pub struct AnyTooltip {

    /// The absolute position of the mouse when the tooltip was deployed.
    pub mouse_position: Point<Pixels>,
-
-    /// Whether the tooltitp can be hovered or not.
-    pub hoverable: bool,
-
-    /// Bounds of the element that triggered the tooltip appearance.
-    pub origin_bounds: Bounds<Pixels>,
 }

 /// A keystroke event, and potentially the associated action
--- a/crates/gpui/src/app/entity_map.rs
+++ b/crates/gpui/src/app/entity_map.rs
@@ -117,9 +117,8 @@ impl EntityMap {

    pub fn read<T: 'static>(&self, model: &Model<T>) -> &T {
        self.assert_valid_context(model);
-        self.entities
-            .get(model.entity_id)
-            .and_then(|entity| entity.downcast_ref())
+        self.entities[model.entity_id]
+            .downcast_ref()
            .unwrap_or_else(|| double_lease_panic::<T>("read"))
    }

--- a/crates/gpui/src/elements/div.rs
+++ b/crates/gpui/src/elements/div.rs
@@ -1417,6 +1417,19 @@ impl Interactivity {
                            None
                        };

+                        let invalidate_tooltip = hitbox
+                            .as_ref()
+                            .map_or(true, |hitbox| !hitbox.bounds.contains(&cx.mouse_position()));
+                        if invalidate_tooltip {
+                            if let Some(active_tooltip) = element_state
+                                .as_ref()
+                                .and_then(|state| state.active_tooltip.as_ref())
+                            {
+                                *active_tooltip.borrow_mut() = None;
+                                self.tooltip_id = None;
+                            }
+                        }
+
                        let scroll_offset = self.clamp_scroll_position(bounds, &style, cx);
                        let result = f(&style, scroll_offset, hitbox, cx);
                        (result, element_state)
@@ -1923,7 +1936,6 @@ impl Interactivity {
                cx.on_mouse_event({
                    let active_tooltip = active_tooltip.clone();
                    let hitbox = hitbox.clone();
-                    let source_bounds = hitbox.bounds;
                    let tooltip_id = self.tooltip_id;
                    move |_: &MouseMoveEvent, phase, cx| {
                        let is_hovered =
@@ -1953,8 +1965,6 @@ impl Interactivity {
                                            tooltip: Some(AnyTooltip {
                                                view: build_tooltip(cx),
                                                mouse_position: cx.mouse_position(),
-                                                hoverable: tooltip_is_hoverable,
-                                                origin_bounds: source_bounds,
                                            }),
                                            _task: None,
                                        });
--- a/crates/gpui/src/elements/text.rs
+++ b/crates/gpui/src/elements/text.rs
@@ -675,7 +675,6 @@ impl Element for InteractiveText {

                if let Some(tooltip_builder) = self.tooltip_builder.clone() {
                    let hitbox = hitbox.clone();
-                    let source_bounds = hitbox.bounds;
                    let active_tooltip = interactive_state.active_tooltip.clone();
                    let pending_mouse_down = interactive_state.mouse_down_index.clone();
                    let text_layout = text_layout.clone();
@@ -709,8 +708,6 @@ impl Element for InteractiveText {
                                                    tooltip: Some(AnyTooltip {
                                                        view: tooltip,
                                                        mouse_position: cx.mouse_position(),
-                                                        hoverable: true,
-                                                        origin_bounds: source_bounds,
                                                    }),
                                                    _task: None,
                                                }
--- a/crates/gpui/src/platform/linux/x11/client.rs
+++ b/crates/gpui/src/platform/linux/x11/client.rs
@@ -1580,7 +1580,7 @@ impl LinuxClient for X11Client {
    }
 }

-// Adapted from:
+// Adatpted from:
 // https://docs.rs/winit/0.29.11/src/winit/platform_impl/linux/x11/monitor.rs.html#103-111
 pub fn mode_refresh_rate(mode: &randr::ModeInfo) -> Duration {
    if mode.dot_clock == 0 || mode.htotal == 0 || mode.vtotal == 0 {
--- a/crates/gpui/src/platform/linux/x11/window.rs
+++ b/crates/gpui/src/platform/linux/x11/window.rs
@@ -55,7 +55,6 @@ x11rb::atom_manager! {
        WM_PROTOCOLS,
        WM_DELETE_WINDOW,
        WM_CHANGE_STATE,
-        _NET_WM_PID,
        _NET_WM_NAME,
        _NET_WM_STATE,
        _NET_WM_STATE_MAXIMIZED_VERT,
@@ -437,18 +436,6 @@ impl X11WindowState {

        // Collect errors during setup, so that window can be destroyed on failure.
        let setup_result = maybe!({
-            let pid = std::process::id();
-            check_reply(
-                || "X11 ChangeProperty for _NET_WM_PID failed.",
-                xcb.change_property32(
-                    xproto::PropMode::REPLACE,
-                    x_window,
-                    atoms._NET_WM_PID,
-                    xproto::AtomEnum::CARDINAL,
-                    &[pid],
-                ),
-            )?;
-
            if let Some(size) = params.window_min_size {
                let mut size_hints = WmSizeHints::new();
                let min_size = (size.width.0 as i32, size.height.0 as i32);
--- a/crates/gpui/src/platform/mac/events.rs
+++ b/crates/gpui/src/platform/mac/events.rs
@@ -322,7 +322,7 @@ unsafe fn parse_keystroke(native_event: id) -> Keystroke {
            let mut chars_with_shift = chars_for_modified_key(native_event.keyCode(), SHIFT_MOD);
            let always_use_cmd_layout = always_use_command_layout();

-            // Handle Dvorak+QWERTY / Russian / Armenian
+            // Handle Dvorak+QWERTY / Russian / Armeniam
            if command || always_use_cmd_layout {
                let chars_with_cmd = chars_for_modified_key(native_event.keyCode(), CMD_MOD);
                let chars_with_both =
--- a/crates/gpui/src/platform/windows/events.rs
+++ b/crates/gpui/src/platform/windows/events.rs
@@ -47,7 +47,6 @@ pub(crate) fn handle_msg(
        WM_MOUSEMOVE => handle_mouse_move_msg(handle, lparam, wparam, state_ptr),
        WM_MOUSELEAVE => handle_mouse_leave_msg(state_ptr),
        WM_NCMOUSEMOVE => handle_nc_mouse_move_msg(handle, lparam, state_ptr),
-        WM_NCMOUSELEAVE => handle_nc_mouse_leave_msg(state_ptr),
        WM_NCLBUTTONDOWN => {
            handle_nc_mouse_down_msg(handle, MouseButton::Left, wparam, lparam, state_ptr)
        }
@@ -315,18 +314,6 @@ fn handle_mouse_move_msg(
    Some(1)
 }

-fn handle_nc_mouse_leave_msg(state_ptr: Rc<WindowsWindowStatePtr>) -> Option<isize> {
-    let mut lock = state_ptr.state.borrow_mut();
-    lock.hovered = false;
-    if let Some(mut callback) = lock.callbacks.hovered_status_change.take() {
-        drop(lock);
-        callback(false);
-        state_ptr.state.borrow_mut().callbacks.hovered_status_change = Some(callback);
-    }
-
-    Some(0)
-}
-
 fn handle_mouse_leave_msg(state_ptr: Rc<WindowsWindowStatePtr>) -> Option<isize> {
    let mut lock = state_ptr.state.borrow_mut();
    lock.hovered = false;
@@ -984,27 +971,6 @@ fn handle_nc_mouse_move_msg(
        return None;
    }

-    let mut lock = state_ptr.state.borrow_mut();
-    if !lock.hovered {
-        lock.hovered = true;
-        unsafe {
-            TrackMouseEvent(&mut TRACKMOUSEEVENT {
-                cbSize: std::mem::size_of::<TRACKMOUSEEVENT>() as u32,
-                dwFlags: TME_LEAVE | TME_NONCLIENT,
-                hwndTrack: handle,
-                dwHoverTime: HOVER_DEFAULT,
-            })
-            .log_err()
-        };
-        if let Some(mut callback) = lock.callbacks.hovered_status_change.take() {
-            drop(lock);
-            callback(true);
-            state_ptr.state.borrow_mut().callbacks.hovered_status_change = Some(callback);
-        }
-    } else {
-        drop(lock);
-    }
-
    let mut lock = state_ptr.state.borrow_mut();
    if let Some(mut callback) = lock.callbacks.input.take() {
        let scale_factor = lock.scale_factor;
--- a/crates/gpui/src/shared_string.rs
+++ b/crates/gpui/src/shared_string.rs
@@ -81,12 +81,6 @@ impl<'a> PartialEq<&'a str> for SharedString {
    }
 }

-impl From<&SharedString> for SharedString {
-    fn from(value: &SharedString) -> Self {
-        value.clone()
-    }
-}
-
 impl From<SharedString> for Arc<str> {
    fn from(val: SharedString) -> Self {
        match val.0 {
--- a/crates/gpui/src/text_system.rs
+++ b/crates/gpui/src/text_system.rs
@@ -356,7 +356,7 @@ impl WindowTextSystem {
            });
        }

-        let layout = self.layout_line(&text, font_size, runs)?;
+        let layout = self.layout_line(text.as_ref(), font_size, runs)?;

        Ok(ShapedLine {
            layout,
@@ -483,16 +483,12 @@ impl WindowTextSystem {
    /// Subsets of the line can be styled independently with the `runs` parameter.
    /// Generally, you should prefer to use `TextLayout::shape_line` instead, which
    /// can be painted directly.
-    pub fn layout_line<Text>(
+    pub fn layout_line(
        &self,
-        text: Text,
+        text: &str,
        font_size: Pixels,
        runs: &[TextRun],
-    ) -> Result<Arc<LineLayout>>
-    where
-        Text: AsRef<str>,
-        SharedString: From<Text>,
-    {
+    ) -> Result<Arc<LineLayout>> {
        let mut font_runs = self.font_runs_pool.lock().pop().unwrap_or_default();
        for run in runs.iter() {
            let font_id = self.resolve_font(&run.font);
--- a/crates/gpui/src/text_system/line_layout.rs
+++ b/crates/gpui/src/text_system/line_layout.rs
@@ -1,4 +1,4 @@
-use crate::{point, px, FontId, GlyphId, Pixels, PlatformTextSystem, Point, SharedString, Size};
+use crate::{point, px, FontId, GlyphId, Pixels, PlatformTextSystem, Point, Size};
 use collections::FxHashMap;
 use parking_lot::{Mutex, RwLock, RwLockUpgradableReadGuard};
 use smallvec::SmallVec;
@@ -420,19 +420,15 @@ impl LineLayoutCache {
        curr_frame.used_wrapped_lines.clear();
    }

-    pub fn layout_wrapped_line<Text>(
+    pub fn layout_wrapped_line(
        &self,
-        text: Text,
+        text: &str,
        font_size: Pixels,
        runs: &[FontRun],
        wrap_width: Option<Pixels>,
-    ) -> Arc<WrappedLineLayout>
-    where
-        Text: AsRef<str>,
-        SharedString: From<Text>,
-    {
+    ) -> Arc<WrappedLineLayout> {
        let key = &CacheKeyRef {
-            text: text.as_ref(),
+            text,
            font_size,
            runs,
            wrap_width,
@@ -453,8 +449,8 @@ impl LineLayoutCache {
            layout
        } else {
            drop(current_frame);
-            let text = SharedString::from(text);
-            let unwrapped_layout = self.layout_line::<&SharedString>(&text, font_size, runs);
+
+            let unwrapped_layout = self.layout_line(text, font_size, runs);
            let wrap_boundaries = if let Some(wrap_width) = wrap_width {
                unwrapped_layout.compute_wrap_boundaries(text.as_ref(), wrap_width)
            } else {
@@ -466,7 +462,7 @@ impl LineLayoutCache {
                wrap_width,
            });
            let key = Arc::new(CacheKey {
-                text,
+                text: text.into(),
                font_size,
                runs: SmallVec::from(runs),
                wrap_width,
@@ -482,18 +478,9 @@ impl LineLayoutCache {
        }
    }

-    pub fn layout_line<Text>(
-        &self,
-        text: Text,
-        font_size: Pixels,
-        runs: &[FontRun],
-    ) -> Arc<LineLayout>
-    where
-        Text: AsRef<str>,
-        SharedString: From<Text>,
-    {
+    pub fn layout_line(&self, text: &str, font_size: Pixels, runs: &[FontRun]) -> Arc<LineLayout> {
        let key = &CacheKeyRef {
-            text: text.as_ref(),
+            text,
            font_size,
            runs,
            wrap_width: None,
@@ -510,13 +497,9 @@ impl LineLayoutCache {
            current_frame.used_lines.push(key);
            layout
        } else {
-            let text = SharedString::from(text);
-            let layout = Arc::new(
-                self.platform_text_system
-                    .layout_line(&text, font_size, runs),
-            );
+            let layout = Arc::new(self.platform_text_system.layout_line(text, font_size, runs));
            let key = Arc::new(CacheKey {
-                text,
+                text: text.into(),
                font_size,
                runs: SmallVec::from(runs),
                wrap_width: None,
@@ -541,7 +524,7 @@ trait AsCacheKeyRef {

 #[derive(Clone, Debug, Eq)]
 struct CacheKey {
-    text: SharedString,
+    text: String,
    font_size: Pixels,
    runs: SmallVec<[FontRun; 1]>,
    wrap_width: Option<Pixels>,
--- a/crates/gpui/src/window.rs
+++ b/crates/gpui/src/window.rs
@@ -1586,19 +1586,6 @@ impl<'a> WindowContext<'a> {
            }
        }

-        // Element's parent can get hidden (e.g. via the `visible_on_hover` method),
-        // and element's `paint` won't be called (ergo, mouse listeners also won't be active) to detect that the tooltip has to be removed.
-        // Ensure it's not stuck around in such cases.
-        let invalidate_tooltip = !tooltip_request
-            .tooltip
-            .origin_bounds
-            .contains(&self.mouse_position())
-            && (!tooltip_request.tooltip.hoverable
-                || !tooltip_bounds.contains(&self.mouse_position()));
-        if invalidate_tooltip {
-            return None;
-        }
-
        self.with_absolute_element_offset(tooltip_bounds.origin, |cx| element.prepaint(cx));

        self.window.tooltip_bounds = Some(TooltipBounds {
@@ -4880,8 +4867,6 @@ pub enum ElementId {
    FocusHandle(FocusId),
    /// A combination of a name and an integer.
    NamedInteger(SharedString, usize),
-    /// A path
-    Path(Arc<std::path::Path>),
 }

 impl Display for ElementId {
@@ -4893,7 +4878,6 @@ impl Display for ElementId {
            ElementId::FocusHandle(_) => write!(f, "FocusHandle")?,
            ElementId::NamedInteger(s, i) => write!(f, "{}-{}", s, i)?,
            ElementId::Uuid(uuid) => write!(f, "{}", uuid)?,
-            ElementId::Path(path) => write!(f, "{}", path.display())?,
        }

        Ok(())
@@ -4930,12 +4914,6 @@ impl From<SharedString> for ElementId {
    }
 }

-impl From<Arc<std::path::Path>> for ElementId {
-    fn from(path: Arc<std::path::Path>) -> Self {
-        ElementId::Path(path)
-    }
-}
-
 impl From<&'static str> for ElementId {
    fn from(name: &'static str) -> Self {
        ElementId::Name(name.into())
--- a/crates/image_viewer/src/image_viewer.rs
+++ b/crates/image_viewer/src/image_viewer.rs
@@ -96,18 +96,12 @@ impl Item for ImageView {

    fn tab_content(&self, params: TabContentParams, cx: &WindowContext) -> AnyElement {
        let project_path = self.image_item.read(cx).project_path(cx);
-
        let label_color = if ItemSettings::get_global(cx).git_status {
-            let git_status = self
-                .project
-                .read(cx)
-                .project_path_git_status(&project_path, cx);
-
            self.project
                .read(cx)
                .entry_for_path(&project_path, cx)
                .map(|entry| {
-                    entry_git_aware_label_color(git_status, entry.is_ignored, params.selected)
+                    entry_git_aware_label_color(entry.git_status, entry.is_ignored, params.selected)
                })
                .unwrap_or_else(|| params.text_color())
        } else {
--- a/crates/language/src/buffer.rs
+++ b/crates/language/src/buffer.rs
@@ -3943,14 +3943,14 @@ impl BufferSnapshot {
    ) -> impl 'a + Iterator<Item = DiagnosticEntry<O>>
    where
        T: 'a + Clone + ToOffset,
-        O: 'a + FromAnchor,
+        O: 'a + FromAnchor + Ord,
    {
        let mut iterators: Vec<_> = self
            .diagnostics
            .iter()
            .map(|(_, collection)| {
                collection
-                    .range::<T, text::Anchor>(search_range.clone(), self, true, reversed)
+                    .range::<T, O>(search_range.clone(), self, true, reversed)
                    .peekable()
            })
            .collect();
@@ -3964,7 +3964,7 @@ impl BufferSnapshot {
                    let cmp = a
                        .range
                        .start
-                        .cmp(&b.range.start, self)
+                        .cmp(&b.range.start)
                        // when range is equal, sort by diagnostic severity
                        .then(a.diagnostic.severity.cmp(&b.diagnostic.severity))
                        // and stabilize order with group_id
@@ -3975,13 +3975,7 @@ impl BufferSnapshot {
                        cmp
                    }
                })?;
-            iterators[next_ix]
-                .next()
-                .map(|DiagnosticEntry { range, diagnostic }| DiagnosticEntry {
-                    diagnostic,
-                    range: FromAnchor::from_anchor(&range.start, self)
-                        ..FromAnchor::from_anchor(&range.end, self),
-                })
+            iterators[next_ix].next()
        })
    }

@@ -4019,12 +4013,12 @@ impl BufferSnapshot {
    }

    /// Returns an iterator over the diagnostics for the given group.
-    pub fn diagnostic_group<O>(
-        &self,
+    pub fn diagnostic_group<'a, O>(
+        &'a self,
        group_id: usize,
-    ) -> impl Iterator<Item = DiagnosticEntry<O>> + '_
+    ) -> impl 'a + Iterator<Item = DiagnosticEntry<O>>
    where
-        O: FromAnchor + 'static,
+        O: 'a + FromAnchor,
    {
        self.diagnostics
            .iter()
--- a/crates/language/src/diagnostic_set.rs
+++ b/crates/language/src/diagnostic_set.rs
@@ -52,7 +52,7 @@ pub struct Summary {
 }

 impl DiagnosticEntry<PointUtf16> {
-    /// Returns a raw LSP diagnostic used to provide diagnostic context to LSP
+    /// Returns a raw LSP diagnostic ssed to provide diagnostic context to LSP
    /// codeAction request
    pub fn to_lsp_diagnostic_stub(&self) -> lsp::Diagnostic {
        let code = self
--- a/crates/language/src/language.rs
+++ b/crates/language/src/language.rs
@@ -1850,20 +1850,16 @@ pub fn point_from_lsp(point: lsp::Position) -> Unclipped<PointUtf16> {
 }

 pub fn range_to_lsp(range: Range<PointUtf16>) -> lsp::Range {
-    let mut start = point_to_lsp(range.start);
-    let mut end = point_to_lsp(range.end);
-    if start > end {
-        log::error!("range_to_lsp called with inverted range {start:?}-{end:?}");
-        mem::swap(&mut start, &mut end);
+    lsp::Range {
+        start: point_to_lsp(range.start),
+        end: point_to_lsp(range.end),
    }
-    lsp::Range { start, end }
 }

 pub fn range_from_lsp(range: lsp::Range) -> Range<Unclipped<PointUtf16>> {
    let mut start = point_from_lsp(range.start);
    let mut end = point_from_lsp(range.end);
    if start > end {
-        log::warn!("range_from_lsp called with inverted range {start:?}-{end:?}");
        mem::swap(&mut start, &mut end);
    }
    start..end
--- a/crates/language_model/src/model/cloud_model.rs
+++ b/crates/language_model/src/model/cloud_model.rs
@@ -68,7 +68,6 @@ impl CloudModel {
                anthropic::Model::Claude3Opus
                | anthropic::Model::Claude3Sonnet
                | anthropic::Model::Claude3Haiku
-                | anthropic::Model::Claude3_5Haiku
                | anthropic::Model::Custom { .. } => {
                    LanguageModelAvailability::RequiresPlan(Plan::ZedPro)
                }
--- a/crates/language_model_selector/src/language_model_selector.rs
+++ b/crates/language_model_selector/src/language_model_selector.rs
@@ -2,8 +2,8 @@ use std::sync::Arc;

 use feature_flags::ZedPro;
 use gpui::{
-    Action, AnyElement, AppContext, DismissEvent, EventEmitter, FocusHandle, FocusableView, Model,
-    Subscription, Task, View, WeakView,
+    Action, AnyElement, AppContext, DismissEvent, EventEmitter, FocusHandle, FocusableView, Task,
+    View, WeakView,
 };
 use language_model::{LanguageModel, LanguageModelAvailability, LanguageModelRegistry};
 use picker::{Picker, PickerDelegate};
@@ -17,10 +17,6 @@ type OnModelChanged = Arc<dyn Fn(Arc<dyn LanguageModel>, &AppContext) + 'static>

 pub struct LanguageModelSelector {
    picker: View<Picker<LanguageModelPickerDelegate>>,
-    /// The task used to update the picker's matches when there is a change to
-    /// the language model registry.
-    update_matches_task: Option<Task<()>>,
-    _subscriptions: Vec<Subscription>,
 }

 impl LanguageModelSelector {
@@ -30,51 +26,7 @@ impl LanguageModelSelector {
    ) -> Self {
        let on_model_changed = Arc::new(on_model_changed);

-        let all_models = Self::all_models(cx);
-        let delegate = LanguageModelPickerDelegate {
-            language_model_selector: cx.view().downgrade(),
-            on_model_changed: on_model_changed.clone(),
-            all_models: all_models.clone(),
-            filtered_models: all_models,
-            selected_index: 0,
-        };
-
-        let picker =
-            cx.new_view(|cx| Picker::uniform_list(delegate, cx).max_height(Some(rems(20.).into())));
-
-        LanguageModelSelector {
-            picker,
-            update_matches_task: None,
-            _subscriptions: vec![cx.subscribe(
-                &LanguageModelRegistry::global(cx),
-                Self::handle_language_model_registry_event,
-            )],
-        }
-    }
-
-    fn handle_language_model_registry_event(
-        &mut self,
-        _registry: Model<LanguageModelRegistry>,
-        event: &language_model::Event,
-        cx: &mut ViewContext<Self>,
-    ) {
-        match event {
-            language_model::Event::ProviderStateChanged
-            | language_model::Event::AddedProvider(_)
-            | language_model::Event::RemovedProvider(_) => {
-                let task = self.picker.update(cx, |this, cx| {
-                    let query = this.query(cx);
-                    this.delegate.all_models = Self::all_models(cx);
-                    this.delegate.update_matches(query, cx)
-                });
-                self.update_matches_task = Some(task);
-            }
-            _ => {}
-        }
-    }
-
-    fn all_models(cx: &AppContext) -> Vec<ModelInfo> {
-        LanguageModelRegistry::global(cx)
+        let all_models = LanguageModelRegistry::global(cx)
            .read(cx)
            .providers()
            .iter()
@@ -92,7 +44,20 @@ impl LanguageModelSelector {
                    }
                })
            })
-            .collect::<Vec<_>>()
+            .collect::<Vec<_>>();
+
+        let delegate = LanguageModelPickerDelegate {
+            language_model_selector: cx.view().downgrade(),
+            on_model_changed: on_model_changed.clone(),
+            all_models: all_models.clone(),
+            filtered_models: all_models,
+            selected_index: 0,
+        };
+
+        let picker =
+            cx.new_view(|cx| Picker::uniform_list(delegate, cx).max_height(Some(rems(20.).into())));
+
+        LanguageModelSelector { picker }
    }
 }

@@ -187,25 +152,25 @@ impl PickerDelegate for LanguageModelPickerDelegate {

        let llm_registry = LanguageModelRegistry::global(cx);

-        let configured_providers = llm_registry
+        let configured_models: Vec<_> = llm_registry
            .read(cx)
            .providers()
            .iter()
            .filter(|provider| provider.is_authenticated(cx))
            .map(|provider| provider.id())
-            .collect::<Vec<_>>();
+            .collect();

        cx.spawn(|this, mut cx| async move {
            let filtered_models = cx
                .background_executor()
                .spawn(async move {
-                    let displayed_models = if configured_providers.is_empty() {
+                    let displayed_models = if configured_models.is_empty() {
                        all_models
                    } else {
                        all_models
                            .into_iter()
                            .filter(|model_info| {
-                                configured_providers.contains(&model_info.model.provider_id())
+                                configured_models.contains(&model_info.model.provider_id())
                            })
                            .collect::<Vec<_>>()
                    };
--- a/crates/language_models/src/provider/anthropic.rs
+++ b/crates/language_models/src/provider/anthropic.rs
@@ -52,8 +52,6 @@ pub struct AvailableModel {
    pub cache_configuration: Option<LanguageModelCacheConfiguration>,
    pub max_output_tokens: Option<u32>,
    pub default_temperature: Option<f32>,
-    #[serde(default)]
-    pub extra_beta_headers: Vec<String>,
 }

 pub struct AnthropicLanguageModelProvider {
@@ -204,7 +202,6 @@ impl LanguageModelProvider for AnthropicLanguageModelProvider {
                    }),
                    max_output_tokens: model.max_output_tokens,
                    default_temperature: model.default_temperature,
-                    extra_beta_headers: model.extra_beta_headers.clone(),
                },
            );
        }
--- a/crates/language_models/src/provider/cloud.rs
+++ b/crates/language_models/src/provider/cloud.rs
@@ -94,9 +94,6 @@ pub struct AvailableModel {
    pub cache_configuration: Option<LanguageModelCacheConfiguration>,
    /// The default temperature to use for this model.
    pub default_temperature: Option<f32>,
-    /// Any extra beta headers to provide when using the model.
-    #[serde(default)]
-    pub extra_beta_headers: Vec<String>,
 }

 struct GlobalRefreshLlmTokenListener(Model<RefreshLlmTokenListener>);
@@ -326,7 +323,6 @@ impl LanguageModelProvider for CloudLanguageModelProvider {
                    }),
                    default_temperature: model.default_temperature,
                    max_output_tokens: model.max_output_tokens,
-                    extra_beta_headers: model.extra_beta_headers.clone(),
                }),
                AvailableProvider::OpenAi => CloudModel::OpenAi(open_ai::Model::Custom {
                    name: model.name.clone(),
--- a/crates/language_models/src/settings.rs
+++ b/crates/language_models/src/settings.rs
@@ -97,7 +97,6 @@ impl AnthropicSettingsContent {
                                    cache_configuration,
                                    max_output_tokens,
                                    default_temperature,
-                                    extra_beta_headers,
                                } => Some(provider::anthropic::AvailableModel {
                                    name,
                                    display_name,
@@ -112,7 +111,6 @@ impl AnthropicSettingsContent {
                                    ),
                                    max_output_tokens,
                                    default_temperature,
-                                    extra_beta_headers,
                                }),
                                _ => None,
                            })
--- a/crates/language_tools/src/syntax_tree_view.rs
+++ b/crates/language_tools/src/syntax_tree_view.rs
@@ -128,18 +128,13 @@ impl SyntaxTreeView {
    fn editor_updated(&mut self, did_reparse: bool, cx: &mut ViewContext<Self>) -> Option<()> {
        // Find which excerpt the cursor is in, and the position within that excerpted buffer.
        let editor_state = self.editor.as_mut()?;
-        let snapshot = editor_state
-            .editor
-            .update(cx, |editor, cx| editor.snapshot(cx));
-        let (excerpt, buffer, range) = editor_state.editor.update(cx, |editor, cx| {
+        let (buffer, range, excerpt_id) = editor_state.editor.update(cx, |editor, cx| {
            let selection_range = editor.selections.last::<usize>(cx).range();
-            let multi_buffer = editor.buffer().read(cx);
-            let (excerpt, range) = snapshot
-                .buffer_snapshot
-                .range_to_buffer_ranges(selection_range)
-                .pop()?;
-            let buffer = multi_buffer.buffer(excerpt.buffer_id()).unwrap().clone();
-            Some((excerpt, buffer, range))
+            editor
+                .buffer()
+                .read(cx)
+                .range_to_buffer_ranges(selection_range, cx)
+                .pop()
        })?;

        // If the cursor has moved into a different excerpt, retrieve a new syntax layer
@@ -148,16 +143,16 @@ impl SyntaxTreeView {
            .active_buffer
            .get_or_insert_with(|| BufferState {
                buffer: buffer.clone(),
-                excerpt_id: excerpt.id(),
+                excerpt_id,
                active_layer: None,
            });
        let mut prev_layer = None;
        if did_reparse {
            prev_layer = buffer_state.active_layer.take();
        }
-        if buffer_state.buffer != buffer || buffer_state.excerpt_id != excerpt.id() {
+        if buffer_state.buffer != buffer || buffer_state.excerpt_id != excerpt_id {
            buffer_state.buffer = buffer.clone();
-            buffer_state.excerpt_id = excerpt.id();
+            buffer_state.excerpt_id = excerpt_id;
            buffer_state.active_layer = None;
        }

--- a/crates/languages/src/markdown/config.toml
+++ b/crates/languages/src/markdown/config.toml
@@ -2,7 +2,6 @@ name = "Markdown"
 grammar = "markdown"
 path_suffixes = ["md", "mdx", "mdwn", "markdown", "MD"]
 word_characters = ["-"]
-block_comment = ["<!-- ", " -->"]
 brackets = [
    { start = "{", end = "}", close = true, newline = true },
    { start = "[", end = "]", close = true, newline = true },
--- a/crates/languages/src/python.rs
+++ b/crates/languages/src/python.rs
@@ -770,12 +770,6 @@ impl PyLspAdapter {
    }
 }

-const BINARY_DIR: &str = if cfg!(target_os = "windows") {
-    "Scripts"
-} else {
-    "bin"
-};
-
 #[async_trait(?Send)]
 impl LspAdapter for PyLspAdapter {
    fn name(&self) -> LanguageServerName {
@@ -817,7 +811,7 @@ impl LspAdapter for PyLspAdapter {
        delegate: &dyn LspAdapterDelegate,
    ) -> Result<LanguageServerBinary> {
        let venv = self.base_venv(delegate).await.map_err(|e| anyhow!(e))?;
-        let pip_path = venv.join(BINARY_DIR).join("pip3");
+        let pip_path = venv.join("bin").join("pip3");
        ensure!(
            util::command::new_smol_command(pip_path.as_path())
                .arg("install")
@@ -848,7 +842,7 @@ impl LspAdapter for PyLspAdapter {
                .success(),
            "pylsp-mypy installation failed"
        );
-        let pylsp = venv.join(BINARY_DIR).join("pylsp");
+        let pylsp = venv.join("bin").join("pylsp");
        Ok(LanguageServerBinary {
            path: pylsp,
            env: None,
@@ -862,7 +856,7 @@ impl LspAdapter for PyLspAdapter {
        delegate: &dyn LspAdapterDelegate,
    ) -> Option<LanguageServerBinary> {
        let venv = self.base_venv(delegate).await.ok()?;
-        let pylsp = venv.join(BINARY_DIR).join("pylsp");
+        let pylsp = venv.join("bin").join("pylsp");
        Some(LanguageServerBinary {
            path: pylsp,
            env: None,
--- a/crates/languages/src/rust.rs
+++ b/crates/languages/src/rust.rs
@@ -253,51 +253,49 @@ impl LspAdapter for RustLspAdapter {
            .as_ref()
            .and_then(|detail| detail.detail.as_ref())
            .or(completion.detail.as_ref())
-            .map(|detail| detail.trim());
+            .map(ToOwned::to_owned);
        let function_signature = completion
            .label_details
            .as_ref()
-            .and_then(|detail| detail.description.as_deref())
-            .or(completion.detail.as_deref());
-        match (detail, completion.kind) {
-            (Some(detail), Some(lsp::CompletionItemKind::FIELD)) => {
+            .and_then(|detail| detail.description.as_ref())
+            .or(completion.detail.as_ref())
+            .map(ToOwned::to_owned);
+        match completion.kind {
+            Some(lsp::CompletionItemKind::FIELD) if detail.is_some() => {
                let name = &completion.label;
-                let text = format!("{name}: {detail}");
-                let prefix = "struct S { ";
-                let source = Rope::from(format!("{prefix}{text} }}"));
-                let runs =
-                    language.highlight_text(&source, prefix.len()..prefix.len() + text.len());
+                let text = format!("{}: {}", name, detail.unwrap());
+                let source = Rope::from(format!("struct S {{ {} }}", text).as_str());
+                let runs = language.highlight_text(&source, 11..11 + text.len());
                return Some(CodeLabel {
                    text,
                    runs,
                    filter_range: 0..name.len(),
                });
            }
-            (
-                Some(detail),
-                Some(lsp::CompletionItemKind::CONSTANT | lsp::CompletionItemKind::VARIABLE),
-            ) if completion.insert_text_format != Some(lsp::InsertTextFormat::SNIPPET) => {
+            Some(lsp::CompletionItemKind::CONSTANT | lsp::CompletionItemKind::VARIABLE)
+                if detail.is_some()
+                    && completion.insert_text_format != Some(lsp::InsertTextFormat::SNIPPET) =>
+            {
                let name = &completion.label;
                let text = format!(
                    "{}: {}",
                    name,
-                    completion.detail.as_deref().unwrap_or(detail)
+                    completion.detail.as_ref().or(detail.as_ref()).unwrap()
                );
-                let prefix = "let ";
-                let source = Rope::from(format!("{prefix}{text} = ();"));
-                let runs =
-                    language.highlight_text(&source, prefix.len()..prefix.len() + text.len());
+                let source = Rope::from(format!("let {} = ();", text).as_str());
+                let runs = language.highlight_text(&source, 4..4 + text.len());
                return Some(CodeLabel {
                    text,
                    runs,
                    filter_range: 0..name.len(),
                });
            }
-            (
-                Some(detail),
-                Some(lsp::CompletionItemKind::FUNCTION | lsp::CompletionItemKind::METHOD),
-            ) => {
+            Some(lsp::CompletionItemKind::FUNCTION | lsp::CompletionItemKind::METHOD)
+                if detail.is_some() =>
+            {
                static REGEX: LazyLock<Regex> = LazyLock::new(|| Regex::new("\\(…?\\)").unwrap());
+
+                let detail = detail.unwrap();
                const FUNCTION_PREFIXES: [&str; 6] = [
                    "async fn",
                    "async unsafe fn",
@@ -317,11 +315,10 @@ impl LspAdapter for RustLspAdapter {
                // fn keyword should be followed by opening parenthesis.
                if let Some((prefix, suffix)) = fn_keyword {
                    let mut text = REGEX.replace(&completion.label, suffix).to_string();
-                    let source = Rope::from(format!("{prefix} {text} {{}}"));
+                    let source = Rope::from(format!("{prefix} {} {{}}", text).as_str());
                    let run_start = prefix.len() + 1;
                    let runs = language.highlight_text(&source, run_start..run_start + text.len());
-                    if detail.starts_with("(") {
-                        text.push(' ');
+                    if detail.starts_with(" (") {
                        text.push_str(&detail);
                    }

@@ -345,7 +342,7 @@ impl LspAdapter for RustLspAdapter {
                    });
                }
            }
-            (_, Some(kind)) => {
+            Some(kind) => {
                let highlight_name = match kind {
                    lsp::CompletionItemKind::STRUCT
                    | lsp::CompletionItemKind::INTERFACE
@@ -359,9 +356,9 @@ impl LspAdapter for RustLspAdapter {
                };

                let mut label = completion.label.clone();
-                if let Some(detail) = detail.filter(|detail| detail.starts_with("(")) {
-                    label.push(' ');
-                    label.push_str(detail);
+                if let Some(detail) = detail.filter(|detail| detail.starts_with(" (")) {
+                    use std::fmt::Write;
+                    write!(label, "{detail}").ok()?;
                }
                let mut label = CodeLabel::plain(label, None);
                if let Some(highlight_name) = highlight_name {
@@ -886,7 +883,7 @@ mod tests {
                        kind: Some(lsp::CompletionItemKind::FUNCTION),
                        label: "hello(…)".to_string(),
                        label_details: Some(CompletionItemLabelDetails {
-                            detail: Some("(use crate::foo)".into()),
+                            detail: Some(" (use crate::foo)".into()),
                            description: Some("fn(&mut Option<T>) -> Vec<T>".to_string())
                        }),
                        ..Default::default()
--- a/crates/markdown/src/markdown.rs
+++ b/crates/markdown/src/markdown.rs
@@ -6,8 +6,8 @@ use gpui::{
    actions, point, quad, AnyElement, AppContext, Bounds, ClipboardItem, CursorStyle,
    DispatchPhase, Edges, FocusHandle, FocusableView, FontStyle, FontWeight, GlobalElementId,
    Hitbox, Hsla, KeyContext, Length, MouseDownEvent, MouseEvent, MouseMoveEvent, MouseUpEvent,
-    Point, Render, Stateful, StrikethroughStyle, StyleRefinement, StyledText, Task, TextLayout,
-    TextRun, TextStyle, TextStyleRefinement, View,
+    Point, Render, StrikethroughStyle, StyleRefinement, StyledText, Task, TextLayout, TextRun,
+    TextStyle, TextStyleRefinement, View,
 };
 use language::{Language, LanguageRegistry, Rope};
 use parser::{parse_links_only, parse_markdown, MarkdownEvent, MarkdownTag, MarkdownTagEnd};
@@ -785,52 +785,8 @@ impl IntoElement for MarkdownElement {
    }
 }

-enum AnyDiv {
-    Div(Div),
-    Stateful(Stateful<Div>),
-}
-
-impl AnyDiv {
-    fn into_any_element(self) -> AnyElement {
-        match self {
-            Self::Div(div) => div.into_any_element(),
-            Self::Stateful(div) => div.into_any_element(),
-        }
-    }
-}
-
-impl From<Div> for AnyDiv {
-    fn from(value: Div) -> Self {
-        Self::Div(value)
-    }
-}
-
-impl From<Stateful<Div>> for AnyDiv {
-    fn from(value: Stateful<Div>) -> Self {
-        Self::Stateful(value)
-    }
-}
-
-impl Styled for AnyDiv {
-    fn style(&mut self) -> &mut StyleRefinement {
-        match self {
-            Self::Div(div) => div.style(),
-            Self::Stateful(div) => div.style(),
-        }
-    }
-}
-
-impl ParentElement for AnyDiv {
-    fn extend(&mut self, elements: impl IntoIterator<Item = AnyElement>) {
-        match self {
-            Self::Div(div) => div.extend(elements),
-            Self::Stateful(div) => div.extend(elements),
-        }
-    }
-}
-
 struct MarkdownElementBuilder {
-    div_stack: Vec<AnyDiv>,
+    div_stack: Vec<Div>,
    rendered_lines: Vec<RenderedLine>,
    pending_line: PendingLine,
    rendered_links: Vec<RenderedLink>,
@@ -856,7 +812,7 @@ struct ListStackEntry {
 impl MarkdownElementBuilder {
    fn new(base_text_style: TextStyle, syntax_theme: Arc<SyntaxTheme>) -> Self {
        Self {
-            div_stack: vec![div().debug_selector(|| "inner".into()).into()],
+            div_stack: vec![div().debug_selector(|| "inner".into())],
            rendered_lines: Vec::new(),
            pending_line: PendingLine::default(),
            rendered_links: Vec::new(),
@@ -885,12 +841,11 @@ impl MarkdownElementBuilder {
        self.text_style_stack.pop();
    }

-    fn push_div(&mut self, div: impl Into<AnyDiv>, range: &Range<usize>, markdown_end: usize) {
-        let mut div = div.into();
+    fn push_div(&mut self, mut div: Div, range: &Range<usize>, markdown_end: usize) {
        self.flush_text();

        if range.start == 0 {
-            // Remove the top margin on the first element.
+            //first element, remove top margin
            div.style().refine(&StyleRefinement {
                margin: gpui::EdgesRefinement {
                    top: Some(Length::Definite(px(0.).into())),
@@ -901,7 +856,6 @@ impl MarkdownElementBuilder {
                ..Default::default()
            });
        }
-
        if range.end == markdown_end {
            div.style().refine(&StyleRefinement {
                margin: gpui::EdgesRefinement {
@@ -913,13 +867,12 @@ impl MarkdownElementBuilder {
                ..Default::default()
            });
        }
-
        self.div_stack.push(div);
    }

    fn pop_div(&mut self) {
        self.flush_text();
-        let div = self.div_stack.pop().unwrap().into_any_element();
+        let div = self.div_stack.pop().unwrap().into_any();
        self.div_stack.last_mut().unwrap().extend(iter::once(div));
    }

@@ -1020,7 +973,7 @@ impl MarkdownElementBuilder {
        debug_assert_eq!(self.div_stack.len(), 1);
        self.flush_text();
        RenderedMarkdown {
-            element: self.div_stack.pop().unwrap().into_any_element(),
+            element: self.div_stack.pop().unwrap().into_any(),
            text: RenderedText {
                lines: self.rendered_lines.into(),
                links: self.rendered_links.into(),
--- a/crates/multi_buffer/src/multi_buffer.rs
+++ b/crates/multi_buffer/src/multi_buffer.rs
@@ -1667,6 +1667,42 @@ impl MultiBuffer {
        })
    }

+    pub fn range_to_buffer_ranges<T: ToOffset>(
+        &self,
+        range: Range<T>,
+        cx: &AppContext,
+    ) -> Vec<(Model<Buffer>, Range<usize>, ExcerptId)> {
+        let snapshot = self.read(cx);
+        let start = range.start.to_offset(&snapshot);
+        let end = range.end.to_offset(&snapshot);
+
+        let mut result = Vec::new();
+        let mut cursor = snapshot.excerpts.cursor::<usize>(&());
+        cursor.seek(&start, Bias::Right, &());
+        if cursor.item().is_none() {
+            cursor.prev(&());
+        }
+
+        while let Some(excerpt) = cursor.item() {
+            if *cursor.start() > end {
+                break;
+            }
+
+            let mut end_before_newline = cursor.end(&());
+            if excerpt.has_trailing_newline {
+                end_before_newline -= 1;
+            }
+            let excerpt_start = excerpt.range.context.start.to_offset(&excerpt.buffer);
+            let start = excerpt_start + (cmp::max(start, *cursor.start()) - *cursor.start());
+            let end = excerpt_start + (cmp::min(end, end_before_newline) - *cursor.start());
+            let buffer = self.buffers.borrow()[&excerpt.buffer_id].buffer.clone();
+            result.push((buffer, start..end, excerpt.id));
+            cursor.next(&());
+        }
+
+        result
+    }
+
    pub fn remove_excerpts(
        &mut self,
        excerpt_ids: impl IntoIterator<Item = ExcerptId>,
@@ -3871,43 +3907,35 @@ impl MultiBufferSnapshot {
            .any(|excerpt| excerpt.buffer.has_diagnostics())
    }

-    pub fn diagnostic_group(
-        &self,
+    pub fn diagnostic_group<'a, O>(
+        &'a self,
        group_id: usize,
-    ) -> impl Iterator<Item = DiagnosticEntry<Anchor>> + '_ {
-        self.all_excerpts().flat_map(move |excerpt| {
-            excerpt.buffer().diagnostic_group(group_id).map(
-                move |DiagnosticEntry { diagnostic, range }| DiagnosticEntry {
-                    diagnostic,
-                    range: self.anchor_in_excerpt(excerpt.id(), range.start).unwrap()
-                        ..self.anchor_in_excerpt(excerpt.id(), range.end).unwrap(),
-                },
-            )
-        })
+    ) -> impl Iterator<Item = DiagnosticEntry<O>> + 'a
+    where
+        O: text::FromAnchor + 'a,
+    {
+        self.as_singleton()
+            .into_iter()
+            .flat_map(move |(_, _, buffer)| buffer.diagnostic_group(group_id))
    }

-    pub fn diagnostics_in_range<'a, T>(
+    pub fn diagnostics_in_range<'a, T, O>(
        &'a self,
        range: Range<T>,
        reversed: bool,
-    ) -> impl Iterator<Item = DiagnosticEntry<Anchor>> + 'a
+    ) -> impl Iterator<Item = DiagnosticEntry<O>> + 'a
    where
        T: 'a + ToOffset,
+        O: 'a + text::FromAnchor + Ord,
    {
-        let mut ranges = self.range_to_buffer_ranges(range);
-        if reversed {
-            ranges.reverse();
-        }
-        ranges.into_iter().flat_map(move |(excerpt, range)| {
-            let excerpt_id = excerpt.id();
-            excerpt.buffer().diagnostics_in_range(range, reversed).map(
-                move |DiagnosticEntry { diagnostic, range }| DiagnosticEntry {
-                    diagnostic,
-                    range: self.anchor_in_excerpt(excerpt_id, range.start).unwrap()
-                        ..self.anchor_in_excerpt(excerpt_id, range.end).unwrap(),
-                },
-            )
-        })
+        self.as_singleton()
+            .into_iter()
+            .flat_map(move |(_, _, buffer)| {
+                buffer.diagnostics_in_range(
+                    range.start.to_offset(self)..range.end.to_offset(self),
+                    reversed,
+                )
+            })
    }

    pub fn syntax_ancestor<T: ToOffset>(
@@ -4157,42 +4185,6 @@ impl MultiBufferSnapshot {
        })
    }

-    pub fn range_to_buffer_ranges<T: ToOffset>(
-        &self,
-        range: Range<T>,
-    ) -> Vec<(MultiBufferExcerpt<'_>, Range<usize>)> {
-        let start = range.start.to_offset(self);
-        let end = range.end.to_offset(self);
-
-        let mut result = Vec::new();
-        let mut cursor = self.excerpts.cursor::<(usize, Point)>(&());
-        cursor.seek(&start, Bias::Right, &());
-        if cursor.item().is_none() {
-            cursor.prev(&());
-        }
-
-        while let Some(excerpt) = cursor.item() {
-            if cursor.start().0 > end {
-                break;
-            }
-
-            let mut end_before_newline = cursor.end(&()).0;
-            if excerpt.has_trailing_newline {
-                end_before_newline -= 1;
-            }
-            let excerpt_start = excerpt.range.context.start.to_offset(&excerpt.buffer);
-            let start = excerpt_start + (cmp::max(start, cursor.start().0) - cursor.start().0);
-            let end = excerpt_start + (cmp::min(end, end_before_newline) - cursor.start().0);
-            result.push((
-                MultiBufferExcerpt::new(&excerpt, *cursor.start()),
-                start..end,
-            ));
-            cursor.next(&());
-        }
-
-        result
-    }
-
    /// Returns excerpts overlapping the given ranges. If range spans multiple excerpts returns one range for each excerpt
    ///
    /// The ranges are specified in the coordinate space of the multibuffer, not the individual excerpted buffers.
@@ -4672,10 +4664,6 @@ impl<'a> MultiBufferExcerpt<'a> {
        self.excerpt.id
    }

-    pub fn buffer_id(&self) -> BufferId {
-        self.excerpt.buffer_id
-    }
-
    pub fn start_anchor(&self) -> Anchor {
        Anchor {
            buffer_id: Some(self.excerpt.buffer_id),
--- a/crates/multi_buffer/src/multi_buffer_tests.rs
+++ b/crates/multi_buffer/src/multi_buffer_tests.rs
@@ -1234,13 +1234,14 @@ fn test_random_multibuffer(cx: &mut AppContext, mut rng: StdRng) {
                start_ix..end_ix
            );

-            let snapshot = multibuffer.read(cx).snapshot(cx);
-            let excerpted_buffer_ranges = snapshot.range_to_buffer_ranges(start_ix..end_ix);
+            let excerpted_buffer_ranges = multibuffer
+                .read(cx)
+                .range_to_buffer_ranges(start_ix..end_ix, cx);
            let excerpted_buffers_text = excerpted_buffer_ranges
                .iter()
-                .map(|(excerpt, buffer_range)| {
-                    excerpt
-                        .buffer()
+                .map(|(buffer, buffer_range, _)| {
+                    buffer
+                        .read(cx)
                        .text_for_range(buffer_range.clone())
                        .collect::<String>()
                })
--- a/crates/outline_panel/Cargo.toml
+++ b/crates/outline_panel/Cargo.toml
@@ -19,8 +19,8 @@ db.workspace = true
 editor.workspace = true
 file_icons.workspace = true
 fuzzy.workspace = true
-gpui.workspace = true
 itertools.workspace = true
+gpui.workspace = true
 language.workspace = true
 log.workspace = true
 menu.workspace = true
@@ -36,8 +36,8 @@ smol.workspace = true
 theme.workspace = true
 ui.workspace = true
 util.workspace = true
-workspace.workspace = true
 worktree.workspace = true
+workspace.workspace = true

 [dev-dependencies]
 search = { workspace = true, features = ["test-support"] }
--- a/crates/outline_panel/src/outline_panel.rs
+++ b/crates/outline_panel/src/outline_panel.rs
--- a/crates/project/src/buffer_store.rs
+++ b/crates/project/src/buffer_store.rs
@@ -569,9 +569,9 @@ impl LocalBufferStore {
                    buffer_change_sets
                        .into_iter()
                        .filter_map(|(change_set, buffer_snapshot, path)| {
-                            let local_repo = snapshot.local_repo_for_path(&path)?;
-                            let relative_path = local_repo.relativize(&path).ok()?;
-                            let base_text = local_repo.repo().load_index_text(&relative_path);
+                            let (repo_entry, local_repo_entry) = snapshot.repo_for_path(&path)?;
+                            let relative_path = repo_entry.relativize(&snapshot, &path).ok()?;
+                            let base_text = local_repo_entry.repo().load_index_text(&relative_path);
                            Some((change_set, buffer_snapshot, base_text))
                        })
                        .collect::<Vec<_>>()
@@ -1161,16 +1161,16 @@ impl BufferStore {
            Worktree::Local(worktree) => {
                let worktree = worktree.snapshot();
                let blame_params = maybe!({
-                    let local_repo = match worktree.local_repo_for_path(&file.path) {
+                    let (repo_entry, local_repo_entry) = match worktree.repo_for_path(&file.path) {
                        Some(repo_for_path) => repo_for_path,
                        None => return Ok(None),
                    };

-                    let relative_path = local_repo
-                        .relativize(&file.path)
+                    let relative_path = repo_entry
+                        .relativize(&worktree, &file.path)
                        .context("failed to relativize buffer path")?;

-                    let repo = local_repo.repo().clone();
+                    let repo = local_repo_entry.repo().clone();

                    let content = match version {
                        Some(version) => buffer.rope_for_version(&version).clone(),
@@ -1247,7 +1247,7 @@ impl BufferStore {
                    });
                };

-                let path = match repo_entry.relativize(file.path()) {
+                let path = match repo_entry.relativize(worktree, file.path()) {
                    Ok(RepoPath(path)) => path,
                    Err(e) => return Task::ready(Err(e)),
                };
--- a/crates/project/src/lsp_store.rs
+++ b/crates/project/src/lsp_store.rs
@@ -87,8 +87,9 @@ pub use language::Location;
 #[cfg(any(test, feature = "test-support"))]
 pub use prettier::FORMAT_SUFFIX as TEST_PRETTIER_FORMAT_SUFFIX;
 pub use worktree::{
-    Entry, EntryKind, File, LocalWorktree, PathChange, ProjectEntryId, UpdatedEntriesSet,
-    UpdatedGitRepositoriesSet, Worktree, WorktreeId, WorktreeSettings, FS_WATCH_LATENCY,
+    Entry, EntryKind, File, LocalWorktree, PathChange, ProjectEntryId, RepositoryEntry,
+    UpdatedEntriesSet, UpdatedGitRepositoriesSet, Worktree, WorktreeId, WorktreeSettings,
+    FS_WATCH_LATENCY,
 };

 const SERVER_LAUNCHING_BEFORE_SHUTDOWN_TIMEOUT: Duration = Duration::from_secs(5);
@@ -3108,7 +3109,6 @@ impl LspStore {
            WorktreeStoreEvent::WorktreeUpdateSent(worktree) => {
                worktree.update(cx, |worktree, _cx| self.send_diagnostic_summaries(worktree));
            }
-            WorktreeStoreEvent::GitRepositoryUpdated => {}
        }
    }

--- a/crates/project/src/project.rs
+++ b/crates/project/src/project.rs
@@ -39,10 +39,7 @@ use futures::{
 pub use image_store::{ImageItem, ImageStore};
 use image_store::{ImageItemEvent, ImageStoreEvent};

-use git::{
-    blame::Blame,
-    repository::{GitFileStatus, GitRepository},
-};
+use git::{blame::Blame, repository::GitRepository};
 use gpui::{
    AnyModel, AppContext, AsyncAppContext, BorrowAppContext, Context as _, EventEmitter, Hsla,
    Model, ModelContext, SharedString, Task, WeakModel, WindowContext,
@@ -98,8 +95,9 @@ pub use task_inventory::{
    BasicContextProvider, ContextProviderWithTasks, Inventory, TaskSourceKind,
 };
 pub use worktree::{
-    Entry, EntryKind, File, LocalWorktree, PathChange, ProjectEntryId, UpdatedEntriesSet,
-    UpdatedGitRepositoriesSet, Worktree, WorktreeId, WorktreeSettings, FS_WATCH_LATENCY,
+    Entry, EntryKind, File, LocalWorktree, PathChange, ProjectEntryId, RepositoryEntry,
+    UpdatedEntriesSet, UpdatedGitRepositoriesSet, Worktree, WorktreeId, WorktreeSettings,
+    FS_WATCH_LATENCY,
 };

 pub use buffer_store::ProjectTransaction;
@@ -244,7 +242,6 @@ pub enum Event {
    ActivateProjectPanel,
    WorktreeAdded(WorktreeId),
    WorktreeOrderChanged,
-    GitRepositoryUpdated,
    WorktreeRemoved(WorktreeId),
    WorktreeUpdatedEntries(WorktreeId, UpdatedEntriesSet),
    WorktreeUpdatedGitRepositories(WorktreeId),
@@ -1436,15 +1433,6 @@ impl Project {
            .unwrap_or(false)
    }

-    pub fn project_path_git_status(
-        &self,
-        project_path: &ProjectPath,
-        cx: &AppContext,
-    ) -> Option<GitFileStatus> {
-        self.worktree_for_id(project_path.worktree_id, cx)
-            .and_then(|worktree| worktree.read(cx).status_for_file(&project_path.path))
-    }
-
    pub fn visibility_for_paths(&self, paths: &[PathBuf], cx: &AppContext) -> Option<bool> {
        paths
            .iter()
@@ -2307,7 +2295,6 @@ impl Project {
            }
            WorktreeStoreEvent::WorktreeOrderChanged => cx.emit(Event::WorktreeOrderChanged),
            WorktreeStoreEvent::WorktreeUpdateSent(_) => {}
-            WorktreeStoreEvent::GitRepositoryUpdated => cx.emit(Event::GitRepositoryUpdated),
        }
    }

@@ -3529,6 +3516,17 @@ impl Project {
        )
    }

+    pub fn get_repo(
+        &self,
+        project_path: &ProjectPath,
+        cx: &AppContext,
+    ) -> Option<Arc<dyn GitRepository>> {
+        self.worktree_for_id(project_path.worktree_id, cx)?
+            .read(cx)
+            .as_local()?
+            .local_git_repo(&project_path.path)
+    }
+
    pub fn get_first_worktree_root_repo(&self, cx: &AppContext) -> Option<Arc<dyn GitRepository>> {
        let worktree = self.visible_worktrees(cx).next()?.read(cx).as_local()?;
        let root_entry = worktree.root_git_entry()?;
@@ -4428,10 +4426,8 @@ impl Completion {
    }
 }

-pub fn sort_worktree_entries(entries: &mut [impl AsRef<Entry>]) {
+pub fn sort_worktree_entries(entries: &mut [Entry]) {
    entries.sort_by(|entry_a, entry_b| {
-        let entry_a = entry_a.as_ref();
-        let entry_b = entry_b.as_ref();
        compare_paths(
            (&entry_a.path, entry_a.is_file()),
            (&entry_b.path, entry_b.is_file()),
--- a/crates/project/src/task_inventory.rs
+++ b/crates/project/src/task_inventory.rs
@@ -109,7 +109,7 @@ impl Inventory {
    /// Pulls its task sources relevant to the worktree and the language given and resolves them with the [`TaskContext`] given.
    /// Joins the new resolutions with the resolved tasks that were used (spawned) before,
    /// orders them so that the most recently used come first, all equally used ones are ordered so that the most specific tasks come first.
-    /// Deduplicates the tasks by their labels and context and splits the ordered list into two: used tasks and the rest, newly resolved tasks.
+    /// Deduplicates the tasks by their labels and contenxt and splits the ordered list into two: used tasks and the rest, newly resolved tasks.
    pub fn used_and_current_resolved_tasks(
        &self,
        worktree: Option<WorktreeId>,
--- a/Show More
+++ b/Show More